NO118547B - - Google Patents
Download PDFInfo
- Publication number
- NO118547B NO118547B NO154884A NO15488464A NO118547B NO 118547 B NO118547 B NO 118547B NO 154884 A NO154884 A NO 154884A NO 15488464 A NO15488464 A NO 15488464A NO 118547 B NO118547 B NO 118547B
- Authority
- NO
- Norway
- Prior art keywords
- radical
- atoms
- alkyl
- blood sugar
- cyclohexylethyl
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 239000008280 blood Substances 0.000 claims description 10
- 210000004369 blood Anatomy 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical compound NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 150000004677 hydrates Chemical class 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- -1 4-methylcyclohexyl Chemical group 0.000 description 5
- 239000004202 carbamide Substances 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229940127017 oral antidiabetic Drugs 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Seats For Vehicles (AREA)
- Load-Engaging Elements For Cranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF40828A DE1198354B (de) | 1963-09-25 | 1963-09-25 | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118547B true NO118547B (de) | 1970-01-12 |
Family
ID=7098406
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO154850A NO117362B (de) | 1963-09-25 | 1964-09-22 | |
| NO154882A NO117851B (de) | 1963-09-25 | 1964-09-24 | |
| NO154884A NO118547B (de) | 1963-09-25 | 1964-09-24 | |
| NO154883A NO117744B (de) | 1963-09-25 | 1964-09-24 |
Family Applications Before (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO154850A NO117362B (de) | 1963-09-25 | 1964-09-22 | |
| NO154882A NO117851B (de) | 1963-09-25 | 1964-09-24 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO154883A NO117744B (de) | 1963-09-25 | 1964-09-24 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3336322A (de) |
| AT (4) | AT253523B (de) |
| BE (2) | BE653586A (de) |
| BR (1) | BR6462883D0 (de) |
| CH (5) | CH451911A (de) |
| DE (1) | DE1198354B (de) |
| DK (4) | DK105642C (de) |
| FI (1) | FI41023B (de) |
| FR (2) | FR1431690A (de) |
| GB (1) | GB1054758A (de) |
| IL (1) | IL22148A (de) |
| NO (4) | NO117362B (de) |
| SE (1) | SE310665B (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL141381B (nl) * | 1963-09-25 | 1974-03-15 | Hoechst Ag | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende werkzaamheid. |
| US3424749A (en) * | 1965-06-23 | 1969-01-28 | Heinz A Pfenninger | Certain n-(benzenesulfonyl) pipecolinic acids and lower alkyl esters thereof |
| DE2951135A1 (de) * | 1979-12-19 | 1981-06-25 | Hoechst Ag, 6230 Frankfurt | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung |
| HU226462B1 (en) * | 1995-02-17 | 2008-12-29 | Hoechst Ag | Substituted benzol-sulfonyl-ureas and -thioureas, process for producing them, pharmaceutical compositions containing them, and their use |
| DE19505397A1 (de) * | 1995-02-17 | 1996-08-22 | Hoechst Ag | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament oder Diagnostikum sowie sie enthaltendes Medikament |
| ZA961314B (en) * | 1995-02-21 | 1996-08-27 | Hoechst Ag | Substituted benzenesulfonylureas and -thioreas processes for their preparation their use for the production of pharmaceutical preparations and medicaments containing them |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR919464A (fr) * | 1944-12-28 | 1947-03-10 | Geigy Ag J R | Urées substituées et procédé de préparation de ces produits |
| US2964560A (en) * | 1955-11-28 | 1960-12-13 | Boehringer & Soehne Gmbh | Orally effective compounds for treating diabetes and a process of making same |
| US3198706A (en) * | 1956-07-31 | 1965-08-03 | Hoechst Ag | Methods of reducing blood sugar and compositions therefor |
| GB831044A (en) * | 1959-03-05 | 1960-03-23 | Boehringer & Soehne Gmbh | Benzene sulphonyl ureas |
-
1963
- 1963-09-25 DE DEF40828A patent/DE1198354B/de active Pending
-
1964
- 1964-03-31 GB GB1316564A patent/GB1054758A/en not_active Expired
- 1964-09-21 US US398106A patent/US3336322A/en not_active Expired - Lifetime
- 1964-09-22 NO NO154850A patent/NO117362B/no unknown
- 1964-09-23 CH CH1558367A patent/CH451911A/de unknown
- 1964-09-23 AT AT813164A patent/AT253523B/de active
- 1964-09-23 CH CH1235564A patent/CH448053A/de unknown
- 1964-09-23 CH CH1235464A patent/CH451111A/de unknown
- 1964-09-23 AT AT813064A patent/AT253522B/de active
- 1964-09-23 AT AT812964A patent/AT254892B/de active
- 1964-09-23 CH CH1235664A patent/CH444840A/de unknown
- 1964-09-23 CH CH1235364A patent/CH448052A/de unknown
- 1964-09-23 AT AT813264A patent/AT252934B/de active
- 1964-09-24 DK DK470364AA patent/DK105642C/da active
- 1964-09-24 NO NO154882A patent/NO117851B/no unknown
- 1964-09-24 DK DK470264AA patent/DK119104B/da unknown
- 1964-09-24 NO NO154884A patent/NO118547B/no unknown
- 1964-09-24 DK DK470564AA patent/DK109675C/da active
- 1964-09-24 DK DK470464AA patent/DK106793C/da active
- 1964-09-24 BR BR162883/64A patent/BR6462883D0/pt unknown
- 1964-09-24 IL IL22148A patent/IL22148A/en unknown
- 1964-09-24 FI FI2028/64A patent/FI41023B/fi active
- 1964-09-24 NO NO154883A patent/NO117744B/no unknown
- 1964-09-25 SE SE11511/64A patent/SE310665B/xx unknown
- 1964-09-25 FR FR989291A patent/FR1431690A/fr not_active Expired
- 1964-12-24 FR FR999884A patent/FR3940M/fr not_active Expired
-
1965
- 1965-03-25 BE BE653586A patent/BE653586A/xx unknown
- 1965-11-18 BE BE672496A patent/BE672496R/fr active
Also Published As
| Publication number | Publication date |
|---|---|
| AT253522B (de) | 1967-04-10 |
| US3336322A (en) | 1967-08-15 |
| DK105642C (da) | 1966-10-24 |
| AT252934B (de) | 1967-03-10 |
| FR3940M (de) | 1966-03-28 |
| BE653586A (de) | 1965-03-25 |
| SE310665B (de) | 1969-05-12 |
| DE1198354B (de) | 1965-08-12 |
| FR1431690A (fr) | 1966-03-18 |
| DK119104B (da) | 1970-11-16 |
| NO117362B (de) | 1969-08-04 |
| NO117744B (de) | 1969-09-22 |
| CH451111A (de) | 1968-05-15 |
| GB1054758A (de) | 1967-01-11 |
| NO117851B (de) | 1969-10-06 |
| CH451911A (de) | 1968-05-15 |
| CH448052A (de) | 1967-12-15 |
| CH448053A (de) | 1967-12-15 |
| FI41023B (de) | 1969-04-30 |
| BE672496R (fr) | 1966-03-16 |
| CH444840A (de) | 1967-10-15 |
| AT253523B (de) | 1967-04-10 |
| AT254892B (de) | 1967-06-12 |
| IL22148A (en) | 1968-04-25 |
| DK109675C (da) | 1968-06-04 |
| BR6462883D0 (pt) | 1973-08-07 |
| DK106793C (da) | 1967-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2000095686A (ja) | ２―アルキルピロリジン類 | |
| NO154882B (no) | Fremgangsmaate for fremstilling av 2-(2-(1,4-benzodioksanyl)) -2-imidazolin. | |
| NO160305B (no) | Elektrode som omfatter en elektrokatalysator. | |
| US20100099710A1 (en) | Src family kinase inhibitors | |
| NO163432B (no) | Fremgangsmaate for fremstilling av frisk ost. | |
| NO118547B (de) | ||
| NO154884B (no) | Analogifremgangsmaate ved fremstilling av nye, terapeutiske aktive 4-iazo-androstan-dioner. | |
| US3125488A (en) | Method of inducing analgesia by | |
| US4590205A (en) | Antiinflammatory and/or analgesic 2,3-diaryl-5-halo thiophenes | |
| KR860001578B1 (ko) | 3-티오메틸 파리딘 유도체의 제조방법 | |
| NO163506B (no) | Montering av senkbar tildekning ved lysarmatur. | |
| KR800000944B1 (ko) | 벤젠설포닐-우레아의 제조방법 | |
| NO771728L (no) | Benzensulfonylurinstoffer og fremgangsm}te til deres fremstilling | |
| US3155584A (en) | Compositions and method of inhibiting monoamine oxidase and treating hypertension | |
| US3155672A (en) | N-diphenylisomcotinamide | |
| US3155721A (en) | Novel sulfonylureas | |
| US3435116A (en) | The treatment of diabetes mellitus with benzenesulfonyl ureas | |
| JPS5911584B2 (ja) | ２，６−ジアミノ−ジヒドロピリジン類の製造法 | |
| US3892859A (en) | 1-(M-trifluoromethylphenyl)-5-halopyridazones-(6) as sleep inducers | |
| JPS6324514B2 (de) | ||
| CN108147978B (zh) | 一类具有苯甲酰胺母核结构的Grp94抑制剂及其用途 | |
| NO118555B (de) | ||
| KR840001984B1 (ko) | 설포닐 우레아의 제조방법 | |
| KR102247408B1 (ko) | 피마살탄 프로드러그 | |
| US3957866A (en) | Cyclopentyl carbamide derivative and process for its production |