NL8000066A - Gemodificeerde polyester bevattende materialen. - Google Patents
Gemodificeerde polyester bevattende materialen. Download PDFInfo
- Publication number
- NL8000066A NL8000066A NL8000066A NL8000066A NL8000066A NL 8000066 A NL8000066 A NL 8000066A NL 8000066 A NL8000066 A NL 8000066A NL 8000066 A NL8000066 A NL 8000066A NL 8000066 A NL8000066 A NL 8000066A
- Authority
- NL
- Netherlands
- Prior art keywords
- material according
- resin
- parts
- poly
- polyester
- Prior art date
Links
- 239000000463 material Substances 0.000 title claims description 49
- 229920000728 polyester Polymers 0.000 title claims description 34
- 239000000203 mixture Substances 0.000 claims description 31
- 229920005989 resin Polymers 0.000 claims description 30
- 239000011347 resin Substances 0.000 claims description 30
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 claims description 25
- 125000003118 aryl group Chemical group 0.000 claims description 24
- 229920000515 polycarbonate Polymers 0.000 claims description 19
- 239000004417 polycarbonate Substances 0.000 claims description 19
- 229920001400 block copolymer Polymers 0.000 claims description 17
- -1 aromatic vinyl compound Chemical class 0.000 claims description 15
- 150000001993 dienes Chemical class 0.000 claims description 14
- 229920002554 vinyl polymer Polymers 0.000 claims description 14
- 229920001577 copolymer Polymers 0.000 claims description 13
- 239000003063 flame retardant Substances 0.000 claims description 13
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 12
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 12
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 11
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 11
- 229920001634 Copolyester Polymers 0.000 claims description 11
- 239000003607 modifier Substances 0.000 claims description 10
- 239000000945 filler Substances 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 239000012744 reinforcing agent Substances 0.000 claims description 8
- 239000003365 glass fiber Substances 0.000 claims description 7
- 229920001519 homopolymer Polymers 0.000 claims description 7
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 6
- 239000004609 Impact Modifier Substances 0.000 claims description 5
- 239000004431 polycarbonate resin Substances 0.000 claims description 5
- 229920005668 polycarbonate resin Polymers 0.000 claims description 5
- 229920000642 polymer Polymers 0.000 claims description 5
- 239000012815 thermoplastic material Substances 0.000 claims description 5
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical group O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 claims description 5
- 239000004927 clay Substances 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 229920003232 aliphatic polyester Polymers 0.000 claims description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical group C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 claims description 2
- 239000012764 mineral filler Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 description 10
- 239000011521 glass Substances 0.000 description 8
- 238000000465 moulding Methods 0.000 description 6
- 239000012763 reinforcing filler Substances 0.000 description 6
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 5
- 229920006026 co-polymeric resin Polymers 0.000 description 5
- 238000001746 injection moulding Methods 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 230000002787 reinforcement Effects 0.000 description 4
- SYJPAKDNFZLSMV-HYXAFXHYSA-N (Z)-2-methylpropanal oxime Chemical compound CC(C)\C=N/O SYJPAKDNFZLSMV-HYXAFXHYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229920004142 LEXAN™ Polymers 0.000 description 3
- 239000004418 Lexan Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229920001225 polyester resin Polymers 0.000 description 3
- 239000004645 polyester resin Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229940106691 bisphenol a Drugs 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000007822 coupling agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000006082 mold release agent Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- VDNSZPNSUQRUMS-UHFFFAOYSA-N 1-cyclohexyl-4-ethenylbenzene Chemical compound C1=CC(C=C)=CC=C1C1CCCCC1 VDNSZPNSUQRUMS-UHFFFAOYSA-N 0.000 description 1
- JZHGRUMIRATHIU-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene Chemical compound CC1=CC=CC(C=C)=C1 JZHGRUMIRATHIU-UHFFFAOYSA-N 0.000 description 1
- VVTGQMLRTKFKAM-UHFFFAOYSA-N 1-ethenyl-4-propylbenzene Chemical compound CCCC1=CC=C(C=C)C=C1 VVTGQMLRTKFKAM-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- KXYAVSFOJVUIHT-UHFFFAOYSA-N 2-vinylnaphthalene Chemical compound C1=CC=CC2=CC(C=C)=CC=C21 KXYAVSFOJVUIHT-UHFFFAOYSA-N 0.000 description 1
- GOXRESIYRAWNOJ-UHFFFAOYSA-N 3-hydroxy-2,2,4-trimethylpent-3-enoic acid Chemical compound CC(C)=C(O)C(C)(C)C(O)=O GOXRESIYRAWNOJ-UHFFFAOYSA-N 0.000 description 1
- VLGDSNWNOFYURG-UHFFFAOYSA-N 4-propyloxetan-2-one Chemical compound CCCC1CC(=O)O1 VLGDSNWNOFYURG-UHFFFAOYSA-N 0.000 description 1
- UGWOAPBVIGCNOV-UHFFFAOYSA-N 5-ethenyldec-5-ene Chemical compound CCCCC=C(C=C)CCCC UGWOAPBVIGCNOV-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920013623 Solprene Polymers 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- ULGYAEQHFNJYML-UHFFFAOYSA-N [AlH3].[Ca] Chemical compound [AlH3].[Ca] ULGYAEQHFNJYML-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 1
- 125000003180 beta-lactone group Chemical group 0.000 description 1
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical compound O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- MMCOUVMKNAHQOY-UHFFFAOYSA-N carbonoperoxoic acid Chemical class OOC(O)=O MMCOUVMKNAHQOY-UHFFFAOYSA-N 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- CJOJIAKIRLKBOO-UHFFFAOYSA-N dimethyl 2-hydroxybenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C(O)=C1 CJOJIAKIRLKBOO-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ZIMKJLALTRLXJO-UHFFFAOYSA-N hioc Chemical compound C12=CC(O)=CC=C2NC=C1CCNC(=O)C1CCCNC1=O ZIMKJLALTRLXJO-UHFFFAOYSA-N 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 150000002641 lithium Chemical group 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000012778 molding material Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000090 poly(aryl ether) Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229960000380 propiolactone Drugs 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000000000 tetracarboxylic acids Chemical class 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 150000003628 tricarboxylic acids Chemical class 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- 238000004260 weight control Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/001,539 US4239677A (en) | 1979-01-08 | 1979-01-08 | Modified polyester compositions |
| US153979 | 1993-11-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8000066A true NL8000066A (nl) | 1980-07-10 |
Family
ID=21696571
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8000066A NL8000066A (nl) | 1979-01-08 | 1980-01-07 | Gemodificeerde polyester bevattende materialen. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4239677A (enExample) |
| JP (1) | JPS55108451A (enExample) |
| AU (1) | AU528556B2 (enExample) |
| BR (1) | BR8000139A (enExample) |
| DE (1) | DE3000290A1 (enExample) |
| FR (1) | FR2445848A1 (enExample) |
| GB (1) | GB2039917B (enExample) |
| NL (1) | NL8000066A (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4568712A (en) * | 1981-07-09 | 1986-02-04 | General Electric Co. | High impact, high modulus fiber reinforced polymers |
| US4539350A (en) * | 1981-07-09 | 1985-09-03 | General Electric Company | High impact, high modulus fiber reinforced linear polyester |
| US4403990A (en) * | 1981-12-02 | 1983-09-13 | Baxter Travenol Laboratories, Inc. | Support assembly for a cannula and the like |
| US4390668A (en) * | 1981-12-02 | 1983-06-28 | Baxter Travenol Laboratories, Inc. | Autoclavable thermoplastic material which is heat bondable to a cannula and the like |
| US4391938A (en) * | 1982-02-16 | 1983-07-05 | Rohm And Haas Company | Polyethylene terephthalate compositions having improved crystallization rate and surface appearance |
| EP0105388A1 (en) * | 1982-09-28 | 1984-04-18 | General Electric Company | Modified thermoplastic polyester molding compositions and articles molded therefrom |
| JPS62195047A (ja) * | 1986-02-21 | 1987-08-27 | Takemoto Oil & Fat Co Ltd | 合成樹脂材料用改質剤 |
| JP2597160B2 (ja) * | 1988-09-02 | 1997-04-02 | 富士写真フイルム株式会社 | 電子写真感光体 |
| US4948823A (en) * | 1988-12-01 | 1990-08-14 | Polysar Financial Services S.A. | Nucleating systems |
| US5187230A (en) * | 1989-12-15 | 1993-02-16 | Monsanto Company | Rubber-modified polymer blends of polycarbonate and PETG |
| NL9101936A (nl) * | 1991-11-20 | 1993-06-16 | Gen Electric | Polymeermengsel en daaruit gevormde voorwerpen. |
| DE102004005652A1 (de) | 2004-02-04 | 2005-08-25 | Basf Ag | Fließfähige Polyesterformmassen |
| DE102004005657A1 (de) * | 2004-02-04 | 2005-08-25 | Basf Ag | Fließfähige Polyesterformmassen |
| MY139705A (en) * | 2004-07-19 | 2009-10-30 | Basf Ag | Mixtures of hyperbranched polyesters with polycarbonates as additive for polyester molding compositions |
| DE102004035357A1 (de) * | 2004-07-21 | 2006-03-16 | Basf Ag | Kontinuierliches Verfahren zur Herstellung von Polyalkylenarylaten mit hyperverzweigten Polyestern und/oder Polycarbonaten |
| DE102004059243A1 (de) * | 2004-08-10 | 2006-02-23 | Basf Ag | Thermoplastische Formmassen mit verbesserten Fließ- und Entformungseigenschaften |
| DE102004038979A1 (de) * | 2004-08-10 | 2006-02-23 | Basf Ag | Schlagzähmodifizierte Polyester mit hyperverzweigten Polyestern |
| DE102004038976A1 (de) * | 2004-08-10 | 2006-02-23 | Basf Ag | Fließfähige Polyesterformmassen mit ASA/ABS und SAN |
| DE102004049342A1 (de) | 2004-10-08 | 2006-04-13 | Basf Ag | Fließfähige Thermoplaste mit halogenfreiem Flammschutz |
| DE102004050025A1 (de) * | 2004-10-13 | 2006-04-20 | Basf Ag | Fließfähige Thermoplaste mit Halogenflammschutz |
| DE102004051241A1 (de) * | 2004-10-20 | 2006-05-04 | Basf Ag | Fließfähige Polyamide mit hyperverzweigten Polyestern/Polycarbonaten |
| DE102005002044A1 (de) * | 2005-01-14 | 2006-07-20 | Basf Ag | Fließfähige Polyester mit Hydrolyseschutz |
| DE102005004856A1 (de) * | 2005-02-01 | 2006-08-03 | Basf Ag | Fliessfähige Polyester mit Carbodilmid-Stabilisatoren |
| DE102005027549A1 (de) | 2005-06-14 | 2006-12-21 | Basf Ag | Mehrkomponentenformkörper mit Polyesterschichten |
| DE102005034999A1 (de) * | 2005-07-22 | 2007-01-25 | Basf Ag | Fließfähige Polyester mit Polyesterelastomeren |
| DE102005034980A1 (de) * | 2005-07-22 | 2007-01-25 | Basf Ag | Fasern und Flüssigkeitsbehälter aus PET |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3953394A (en) * | 1971-11-15 | 1976-04-27 | General Electric Company | Polyester alloys and molding compositions containing the same |
| US3969306A (en) * | 1972-11-20 | 1976-07-13 | General Electric Company | Stabilized polyester compositions |
| DE2417002A1 (de) * | 1974-04-08 | 1975-10-23 | Basf Ag | Thermoplastische polyesterformmassen auf der basis von polybutylenterephthalat |
| JPS5819697B2 (ja) * | 1974-10-14 | 1983-04-19 | 三菱レイヨン株式会社 | 強化樹脂組成物 |
| JPS5813588B2 (ja) * | 1975-02-04 | 1983-03-14 | 帝人株式会社 | 熱可塑性樹脂組成物 |
| US4081424A (en) * | 1976-06-07 | 1978-03-28 | Shell Oil Company | Multicomponent polyolefin - block copolymer - polymer blends |
| GB1569229A (en) * | 1976-12-20 | 1980-06-11 | Gen Electric | Block copolyesters of polybutylene terephthalate |
| CA1102469A (en) * | 1976-12-20 | 1981-06-02 | General Electric Company | Flame retardant compositions comprising block copolyesters of polybutylene terephthalate |
| US4119607A (en) * | 1977-05-05 | 1978-10-10 | Shell Oil Company | Multicomponent polyester- block copolymer- polymer blends |
-
1979
- 1979-01-08 US US06/001,539 patent/US4239677A/en not_active Expired - Lifetime
-
1980
- 1980-01-02 GB GB8000060A patent/GB2039917B/en not_active Expired
- 1980-01-05 DE DE19803000290 patent/DE3000290A1/de not_active Withdrawn
- 1980-01-07 NL NL8000066A patent/NL8000066A/nl not_active Application Discontinuation
- 1980-01-07 FR FR8000205A patent/FR2445848A1/fr active Granted
- 1980-01-08 BR BR8000139A patent/BR8000139A/pt unknown
- 1980-01-08 JP JP34080A patent/JPS55108451A/ja active Pending
- 1980-01-08 AU AU54442/80A patent/AU528556B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| BR8000139A (pt) | 1980-10-21 |
| AU528556B2 (en) | 1983-05-05 |
| US4239677A (en) | 1980-12-16 |
| AU5444280A (en) | 1980-07-17 |
| GB2039917A (en) | 1980-08-20 |
| FR2445848B1 (enExample) | 1982-09-03 |
| JPS55108451A (en) | 1980-08-20 |
| DE3000290A1 (de) | 1980-07-17 |
| FR2445848A1 (fr) | 1980-08-01 |
| GB2039917B (en) | 1983-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8000066A (nl) | Gemodificeerde polyester bevattende materialen. | |
| EP0604074B1 (en) | Stabilization of polybutylene terephthalate/polyester blends | |
| EP0020605B1 (en) | Modified polyester compositions | |
| EP0020737B1 (en) | Modified polyester compositions | |
| US4280949A (en) | Modified polyester compositions containing mineral filler | |
| US4414352A (en) | Thermoplastic molding compositions and process | |
| NL8006082A (nl) | Polycarbonaat, blokcopolymeer en polyesterhars bevattende materialen. | |
| EP1694771B1 (en) | Processes for dispersing an impact modifier in a macrocyclic polyester oligomer | |
| US4271064A (en) | Modified polyester compositions | |
| NL8000542A (nl) | Gemodificeerde, polyester bevattende materialen. | |
| US4373067A (en) | Molded articles of improved impact resistance and compositions therefor | |
| US5424361A (en) | Low temperature impact resistant polycarbonate/poly(cyclohexanedimethylene terephthalate)/core shell acryalte copolymer compositions | |
| US4267286A (en) | Modified polyester compositions | |
| EP0747423B1 (en) | Thermoplastic blend compositions containing a polyester resin and an organosulfate salt | |
| JPH064757B2 (ja) | ポリエステル樹脂組成物の製造方法 | |
| WO1980002430A1 (en) | Thermoplastic molding composition and process | |
| US4369282A (en) | Modified polyester compositions | |
| EP0020739B1 (en) | Thermoplastic molding compositions | |
| NL8001890A (nl) | Gemodificeerde polyestermaterialen. | |
| EP0113096B1 (en) | Modified polyester compositions | |
| NL7903369A (nl) | Gemodificeerde, polyester bevattende samenstelling. | |
| JPH04252261A (ja) | ガラス繊維充填共ポリエーテル−ポリエステル組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |