KR20170117479A - 치환된 모노- 및 폴리아자나프탈렌 유도체 및 이의 용도 - Google Patents
치환된 모노- 및 폴리아자나프탈렌 유도체 및 이의 용도 Download PDFInfo
- Publication number
- KR20170117479A KR20170117479A KR1020177025452A KR20177025452A KR20170117479A KR 20170117479 A KR20170117479 A KR 20170117479A KR 1020177025452 A KR1020177025452 A KR 1020177025452A KR 20177025452 A KR20177025452 A KR 20177025452A KR 20170117479 A KR20170117479 A KR 20170117479A
- Authority
- KR
- South Korea
- Prior art keywords
- group
- substituted
- mmol
- nitrogen
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 claims abstract description 265
- 150000001875 compounds Chemical class 0.000 claims abstract description 196
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 125
- 125000001424 substituent group Chemical group 0.000 claims abstract description 121
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 111
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 99
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 77
- 239000001257 hydrogen Substances 0.000 claims abstract description 75
- 125000003118 aryl group Chemical group 0.000 claims abstract description 65
- 125000002950 monocyclic group Chemical group 0.000 claims abstract description 62
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 58
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 57
- 150000002367 halogens Chemical class 0.000 claims abstract description 57
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 48
- 125000002619 bicyclic group Chemical group 0.000 claims abstract description 41
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 39
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 38
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 38
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 38
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 38
- 229910052717 sulfur Chemical group 0.000 claims abstract description 38
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 33
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 32
- 150000003839 salts Chemical class 0.000 claims abstract description 31
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 29
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 28
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims abstract description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 24
- 201000010099 disease Diseases 0.000 claims abstract description 23
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract description 22
- 238000011282 treatment Methods 0.000 claims abstract description 21
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000011593 sulfur Chemical group 0.000 claims abstract description 20
- 230000002062 proliferating effect Effects 0.000 claims abstract description 19
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 18
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 18
- 239000001301 oxygen Chemical group 0.000 claims abstract description 18
- 201000011510 cancer Diseases 0.000 claims abstract description 15
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 3
- -1 N (R 3) 2 Chemical class 0.000 claims description 247
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 149
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 59
- 229920006395 saturated elastomer Polymers 0.000 claims description 52
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 37
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 25
- 239000000460 chlorine Substances 0.000 claims description 21
- 125000001153 fluoro group Chemical group F* 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 18
- 239000008194 pharmaceutical composition Substances 0.000 claims description 16
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 15
- 125000001188 haloalkyl group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 125000004429 atom Chemical group 0.000 claims description 11
- 125000001624 naphthyl group Chemical group 0.000 claims description 11
- 125000006413 ring segment Chemical group 0.000 claims description 11
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 9
- 241000124008 Mammalia Species 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 125000004076 pyridyl group Chemical group 0.000 claims description 9
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- 125000004434 sulfur atom Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 125000006850 spacer group Chemical group 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- 229910052796 boron Inorganic materials 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 2
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 claims 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 claims 1
- 208000035475 disorder Diseases 0.000 abstract description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 360
- 239000000243 solution Substances 0.000 description 319
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 228
- 239000007787 solid Substances 0.000 description 209
- 238000005481 NMR spectroscopy Methods 0.000 description 191
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 161
- 239000000047 product Substances 0.000 description 142
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 133
- 239000011734 sodium Substances 0.000 description 110
- 239000011541 reaction mixture Substances 0.000 description 108
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 106
- 239000012043 crude product Substances 0.000 description 87
- 238000006243 chemical reaction Methods 0.000 description 86
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 80
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 78
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 78
- 239000004698 Polyethylene Substances 0.000 description 76
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 75
- 238000010898 silica gel chromatography Methods 0.000 description 72
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 69
- 239000012267 brine Substances 0.000 description 68
- 238000002953 preparative HPLC Methods 0.000 description 68
- 239000002904 solvent Substances 0.000 description 52
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 50
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 49
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 49
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 48
- 238000003756 stirring Methods 0.000 description 48
- 230000002829 reductive effect Effects 0.000 description 45
- 239000000706 filtrate Substances 0.000 description 41
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 39
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 37
- 235000019439 ethyl acetate Nutrition 0.000 description 37
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 37
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 37
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- 238000004440 column chromatography Methods 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 32
- PKRRNTJIHGOMRC-UHFFFAOYSA-N 1-benzofuran-2-ylboronic acid Chemical compound C1=CC=C2OC(B(O)O)=CC2=C1 PKRRNTJIHGOMRC-UHFFFAOYSA-N 0.000 description 30
- 239000012300 argon atmosphere Substances 0.000 description 30
- 235000002639 sodium chloride Nutrition 0.000 description 30
- DZXVXQFMSACVAA-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)isoquinoline Chemical compound C1=NC=C(Br)C2=CC(CBr)=CC=C21 DZXVXQFMSACVAA-UHFFFAOYSA-N 0.000 description 29
- 239000003921 oil Substances 0.000 description 29
- 235000019198 oils Nutrition 0.000 description 29
- 239000012074 organic phase Substances 0.000 description 29
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 28
- 238000000746 purification Methods 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 238000010511 deprotection reaction Methods 0.000 description 27
- 238000001914 filtration Methods 0.000 description 27
- 239000012299 nitrogen atmosphere Substances 0.000 description 27
- 239000000741 silica gel Substances 0.000 description 27
- 229910002027 silica gel Inorganic materials 0.000 description 27
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 24
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 21
- 239000012044 organic layer Substances 0.000 description 21
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 20
- 239000000725 suspension Substances 0.000 description 20
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 18
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 18
- 150000001412 amines Chemical class 0.000 description 18
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 18
- 238000001816 cooling Methods 0.000 description 18
- 229910000104 sodium hydride Inorganic materials 0.000 description 18
- VJOWMORERYNYON-UHFFFAOYSA-N 5-ethenyl-2-methylpyridine Chemical compound CC1=CC=C(C=C)C=N1 VJOWMORERYNYON-UHFFFAOYSA-N 0.000 description 17
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 17
- 239000004480 active ingredient Substances 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 239000002253 acid Substances 0.000 description 15
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 13
- CKXZPVPIDOJLLM-UHFFFAOYSA-N tert-butyl n-piperidin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNCC1 CKXZPVPIDOJLLM-UHFFFAOYSA-N 0.000 description 13
- 238000004809 thin layer chromatography Methods 0.000 description 13
- SLAZBTLZPNMAOX-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-fluoroisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)F SLAZBTLZPNMAOX-UHFFFAOYSA-N 0.000 description 12
- 208000035269 cancer or benign tumor Diseases 0.000 description 12
- 239000003039 volatile agent Substances 0.000 description 12
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 12
- 101001082110 Acanthamoeba polyphaga mimivirus Eukaryotic translation initiation factor 4E homolog Proteins 0.000 description 11
- 229910052786 argon Inorganic materials 0.000 description 11
- 239000012230 colorless oil Substances 0.000 description 11
- 239000003480 eluent Substances 0.000 description 11
- 150000003840 hydrochlorides Chemical class 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 101001082109 Danio rerio Eukaryotic translation initiation factor 4E-1B Proteins 0.000 description 9
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 125000005997 bromomethyl group Chemical group 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- 238000003818 flash chromatography Methods 0.000 description 9
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 9
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- 108090000623 proteins and genes Proteins 0.000 description 9
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 9
- COIQUVGFTILYGA-UHFFFAOYSA-N (4-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(O)C=C1 COIQUVGFTILYGA-UHFFFAOYSA-N 0.000 description 8
- 239000004342 Benzoyl peroxide Substances 0.000 description 8
- 206010029260 Neuroblastoma Diseases 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000012298 atmosphere Substances 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 8
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 7
- 102100026299 MAP kinase-interacting serine/threonine-protein kinase 1 Human genes 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- JUHXLNLAKXBYFP-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)isoquinolin-6-yl] trifluoromethanesulfonate Chemical compound FC(S(=O)(=O)OC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2)(F)F JUHXLNLAKXBYFP-UHFFFAOYSA-N 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 235000019400 benzoyl peroxide Nutrition 0.000 description 7
- 239000004202 carbamide Substances 0.000 description 7
- 230000008878 coupling Effects 0.000 description 7
- 238000010168 coupling process Methods 0.000 description 7
- 238000005859 coupling reaction Methods 0.000 description 7
- 239000006260 foam Substances 0.000 description 7
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 7
- RFIOZSIHFNEKFF-UHFFFAOYSA-M piperazine-1-carboxylate Chemical compound [O-]C(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-M 0.000 description 7
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 7
- 125000000464 thioxo group Chemical group S=* 0.000 description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 7
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- 101710139011 MAP kinase-interacting serine/threonine-protein kinase 1 Proteins 0.000 description 6
- 108091000080 Phosphotransferase Proteins 0.000 description 6
- 238000006069 Suzuki reaction reaction Methods 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 238000005119 centrifugation Methods 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 102000020233 phosphotransferase Human genes 0.000 description 6
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- NWZIRCLBEMVXHW-UHFFFAOYSA-N 4-phenyl-6-(piperazin-1-ylmethyl)isoquinolin-1-amine Chemical compound C1(=CC=CC=C1)C1=CN=C(C2=CC=C(C=C12)CN1CCNCC1)N NWZIRCLBEMVXHW-UHFFFAOYSA-N 0.000 description 5
- GFAOKSYHWNNOCO-UHFFFAOYSA-N 6-(3-aminopropoxymethyl)-4-bromoisoquinolin-1-amine Chemical compound NCCCOCC=1C=C2C(=CN=C(C2=CC=1)N)Br GFAOKSYHWNNOCO-UHFFFAOYSA-N 0.000 description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- 239000007821 HATU Substances 0.000 description 5
- 208000034179 Neoplasms, Glandular and Epithelial Diseases 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 5
- 108020004999 messenger RNA Proteins 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 5
- SGKANYYYKALPHW-UHFFFAOYSA-N (4-bromo-8-chloroisoquinolin-6-yl)methanol Chemical compound BrC1=CN=CC2=C(C=C(C=C12)CO)Cl SGKANYYYKALPHW-UHFFFAOYSA-N 0.000 description 4
- QKWWDTYDYOFRJL-UHFFFAOYSA-N 2,2-dimethoxyethanamine Chemical compound COC(CN)OC QKWWDTYDYOFRJL-UHFFFAOYSA-N 0.000 description 4
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 4
- JESRNIJXVIFVOV-UHFFFAOYSA-N 2-methylpyrazol-3-amine Chemical compound CN1N=CC=C1N JESRNIJXVIFVOV-UHFFFAOYSA-N 0.000 description 4
- KKLCYBZPQDOFQK-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CC=C1 KKLCYBZPQDOFQK-UHFFFAOYSA-N 0.000 description 4
- FCFGLZGJSHBDOJ-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-fluoroisoquinolin-1-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=C(C2=CC=C(C=C12)F)N FCFGLZGJSHBDOJ-UHFFFAOYSA-N 0.000 description 4
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 4
- XLWCQTRYIQADHL-UHFFFAOYSA-N 4-bromoisoquinoline-6-carboxylic acid Chemical compound OC(=O)c1ccc2cncc(Br)c2c1 XLWCQTRYIQADHL-UHFFFAOYSA-N 0.000 description 4
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- MHABMANUFPZXEB-UHFFFAOYSA-N O-demethyl-aloesaponarin I Natural products O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(O)C(C(O)=O)=C2C MHABMANUFPZXEB-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 206010039491 Sarcoma Diseases 0.000 description 4
- 238000006161 Suzuki-Miyaura coupling reaction Methods 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 150000002537 isoquinolines Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 230000002018 overexpression Effects 0.000 description 4
- 125000005936 piperidyl group Chemical group 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- LUCGBEPEAUHERV-UHFFFAOYSA-N pyridazin-4-amine Chemical compound NC1=CC=NN=C1 LUCGBEPEAUHERV-UHFFFAOYSA-N 0.000 description 4
- 125000002098 pyridazinyl group Chemical group 0.000 description 4
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical compound NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 4
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- 125000006633 tert-butoxycarbonylamino group Chemical group 0.000 description 4
- LZRDHSFPLUWYAX-UHFFFAOYSA-N tert-butyl 4-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)CC1 LZRDHSFPLUWYAX-UHFFFAOYSA-N 0.000 description 4
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 4
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 3
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 3
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 3
- SRSKXJVMVSSSHB-UHFFFAOYSA-N 1h-pyrrolo[3,2-c]pyridine Chemical compound N1=CC=C2NC=CC2=C1 SRSKXJVMVSSSHB-UHFFFAOYSA-N 0.000 description 3
- DOGVHEHFCWBXLB-UHFFFAOYSA-N 2-azidopyridin-4-amine Chemical compound NC1=CC=NC(N=[N+]=[N-])=C1 DOGVHEHFCWBXLB-UHFFFAOYSA-N 0.000 description 3
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 3
- KMKOKPUXZWBMEI-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C(C=C1)=CC=C1OCC1=CC=CC=C1 KMKOKPUXZWBMEI-UHFFFAOYSA-N 0.000 description 3
- GOIVOCQXLABPPA-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(piperazin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN1CCNCC1 GOIVOCQXLABPPA-UHFFFAOYSA-N 0.000 description 3
- UAAUUEADLTYOPN-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)isoquinolin-6-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)N UAAUUEADLTYOPN-UHFFFAOYSA-N 0.000 description 3
- JXRPUNXNFKHTEA-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)isoquinolin-6-ol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)O JXRPUNXNFKHTEA-UHFFFAOYSA-N 0.000 description 3
- JNOQZCFZQYPCFX-UHFFFAOYSA-N 4-(2,5-dimethylpyrrol-1-yl)cyclohexane-1,1-diol Chemical compound CC=1N(C(=CC=1)C)C1CCC(CC1)(O)O JNOQZCFZQYPCFX-UHFFFAOYSA-N 0.000 description 3
- FYIYXLVIZNHFEB-UHFFFAOYSA-N 4-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]oxycyclohexan-1-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCC(CC1)N FYIYXLVIZNHFEB-UHFFFAOYSA-N 0.000 description 3
- FQYRLEXKXQRZDH-UHFFFAOYSA-N 4-aminoquinoline Chemical compound C1=CC=C2C(N)=CC=NC2=C1 FQYRLEXKXQRZDH-UHFFFAOYSA-N 0.000 description 3
- VQDJUAYRMCZPOY-UHFFFAOYSA-N 4-bromo-6-[(5-nitroindol-1-yl)methyl]isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN1C=CC2=CC(=CC=C12)[N+](=O)[O-] VQDJUAYRMCZPOY-UHFFFAOYSA-N 0.000 description 3
- IXLPAFQCBBGXBG-UHFFFAOYSA-N 4-bromo-6-fluoroisoquinoline Chemical compound C1=NC=C(Br)C2=CC(F)=CC=C21 IXLPAFQCBBGXBG-UHFFFAOYSA-N 0.000 description 3
- GQHSIDJIHBURNW-UHFFFAOYSA-N 4-bromo-8-chloro-6-methylisoquinolin-1-amine Chemical compound BrC1=CN=C(C2=C(C=C(C=C12)C)Cl)N GQHSIDJIHBURNW-UHFFFAOYSA-N 0.000 description 3
- KOMFTCUQPUHQJP-UHFFFAOYSA-N 4-chloro-6-fluoroisoquinolin-1-amine Chemical compound ClC1=CN=C(C2=CC=C(C=C12)F)N KOMFTCUQPUHQJP-UHFFFAOYSA-N 0.000 description 3
- CUOPIAZWZRECAD-UHFFFAOYSA-N 4-phenyl-6-(piperazin-1-ylmethyl)cinnoline Chemical compound C1(=CC=CC=C1)C1=CN=NC2=CC=C(C=C12)CN1CCNCC1 CUOPIAZWZRECAD-UHFFFAOYSA-N 0.000 description 3
- GUDGKPYGXVDTRR-UHFFFAOYSA-N 6-methyl-7-nitroisoquinoline Chemical compound CC=1C=C2C=CN=CC2=CC=1[N+](=O)[O-] GUDGKPYGXVDTRR-UHFFFAOYSA-N 0.000 description 3
- RKLXGOUXSQHFNU-UHFFFAOYSA-N 8-(1-benzofuran-2-yl)-1,6-naphthyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=N1 RKLXGOUXSQHFNU-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229910010082 LiAlH Inorganic materials 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 208000021712 Soft tissue sarcoma Diseases 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical group [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 208000009956 adenocarcinoma Diseases 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 3
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 229960004979 fampridine Drugs 0.000 description 3
- 125000004428 fluoroalkoxy group Chemical group 0.000 description 3
- PZJSZBJLOWMDRG-UHFFFAOYSA-N furan-2-ylboronic acid Chemical compound OB(O)C1=CC=CO1 PZJSZBJLOWMDRG-UHFFFAOYSA-N 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 238000007726 management method Methods 0.000 description 3
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 125000002757 morpholinyl group Chemical group 0.000 description 3
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 229910000160 potassium phosphate Inorganic materials 0.000 description 3
- 235000011009 potassium phosphates Nutrition 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000015424 sodium Nutrition 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- ZTMJHPULXULBFM-UHFFFAOYSA-N tert-butyl 4-(benzylamino)-3,3-difluoropiperidine-1-carboxylate Chemical compound FC1(F)CN(C(=O)OC(C)(C)C)CCC1NCC1=CC=CC=C1 ZTMJHPULXULBFM-UHFFFAOYSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- VSOSXKMEQPYESP-UHFFFAOYSA-N 1,6-naphthyridine Chemical class C1=CN=CC2=CC=CN=C21 VSOSXKMEQPYESP-UHFFFAOYSA-N 0.000 description 2
- CWTGISFTGLOJOL-UHFFFAOYSA-N 1-(4-bromophenyl)-3-phenylurea Chemical compound C1=CC(Br)=CC=C1NC(=O)NC1=CC=CC=C1 CWTGISFTGLOJOL-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 2
- ZTAQYLDHKXVNDT-UHFFFAOYSA-N 1-methyl-4-phenylisoquinolin-3-amine Chemical compound C12=CC=CC=C2C(C)=NC(N)=C1C1=CC=CC=C1 ZTAQYLDHKXVNDT-UHFFFAOYSA-N 0.000 description 2
- ZCBIFHNDZBSCEP-UHFFFAOYSA-N 1H-indol-5-amine Chemical compound NC1=CC=C2NC=CC2=C1 ZCBIFHNDZBSCEP-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- AZZUNKUKVQWKFQ-UHFFFAOYSA-N 2-(3-aminocyclopentyl)isoindole-1,3-dione Chemical compound NC1CCC(C1)N1C(=O)C2=C(C=CC=C2)C1=O AZZUNKUKVQWKFQ-UHFFFAOYSA-N 0.000 description 2
- PIDMPPJXCBLLQN-UHFFFAOYSA-N 2-(3-azidocyclopentyl)isoindole-1,3-dione Chemical compound [N-]=[N+]=NC1CCC(C1)N1C(=O)C2=C(C=CC=C2)C1=O PIDMPPJXCBLLQN-UHFFFAOYSA-N 0.000 description 2
- IJCKQUWNYOBTKL-UHFFFAOYSA-N 2-(3-hydroxycyclopentyl)isoindole-1,3-dione Chemical compound C1C(O)CCC1N1C(=O)C2=CC=CC=C2C1=O IJCKQUWNYOBTKL-UHFFFAOYSA-N 0.000 description 2
- RTIZJQCGWLDNKT-UHFFFAOYSA-N 2-(3-oxocyclopentyl)isoindole-1,3-dione Chemical compound C1C(=O)CCC1N1C(=O)C2=CC=CC=C2C1=O RTIZJQCGWLDNKT-UHFFFAOYSA-N 0.000 description 2
- OQSYHAAVQAWZDK-UHFFFAOYSA-N 2-[3-[(4-bromoisoquinolin-6-yl)methoxy]propyl]isoindole-1,3-dione Chemical compound BrC1=CN=CC2=CC=C(C=C12)COCCCN1C(C2=CC=CC=C2C1=O)=O OQSYHAAVQAWZDK-UHFFFAOYSA-N 0.000 description 2
- ZAAOUOISKXXING-UHFFFAOYSA-N 2-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]oxyethanamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCCN ZAAOUOISKXXING-UHFFFAOYSA-N 0.000 description 2
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 2
- OSPMNRDGMUPWNO-UHFFFAOYSA-N 2-chloro-4-methylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(Cl)=C1 OSPMNRDGMUPWNO-UHFFFAOYSA-N 0.000 description 2
- PWMOQGXCXFHJMF-UHFFFAOYSA-N 2-methyl-3-nitropyridin-4-amine Chemical compound CC1=NC=CC(N)=C1[N+]([O-])=O PWMOQGXCXFHJMF-UHFFFAOYSA-N 0.000 description 2
- GNCLPNMQEGMNTG-UHFFFAOYSA-N 2-methylpyridin-4-amine Chemical compound CC1=CC(N)=CC=N1 GNCLPNMQEGMNTG-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- BJAFSAFEHZLMCB-UHFFFAOYSA-N 4,6-dibromo-2H-isoquinolin-1-one Chemical compound BrC1=CNC(C2=CC=C(C=C12)Br)=O BJAFSAFEHZLMCB-UHFFFAOYSA-N 0.000 description 2
- LGUBWXLHEVGLNQ-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(pyridin-4-ylmethoxy)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCC1=CC=NC=C1 LGUBWXLHEVGLNQ-UHFFFAOYSA-N 0.000 description 2
- ILNJKYJEWVVTIK-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-N-(pyridin-4-ylmethyl)isoquinoline-1,6-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=C(C2=CC=C(C=C12)NCC1=CC=NC=C1)N ILNJKYJEWVVTIK-UHFFFAOYSA-N 0.000 description 2
- KJOYHBRREYBHKO-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[4-(2,5-dimethylpyrrol-1-yl)cyclohexyl]oxyisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCC(CC1)N1C(=CC=C1C)C KJOYHBRREYBHKO-UHFFFAOYSA-N 0.000 description 2
- PNZFYXIIEARCKA-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-piperidin-4-yloxyisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCNCC1 PNZFYXIIEARCKA-UHFFFAOYSA-N 0.000 description 2
- YDVYUMQBAQHFLD-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-7-chloro-6-fluoroisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC(=C(C=C12)F)Cl YDVYUMQBAQHFLD-UHFFFAOYSA-N 0.000 description 2
- GVXZEOAJQXXDDE-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-8-chloro-6-fluoroisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)F)Cl GVXZEOAJQXXDDE-UHFFFAOYSA-N 0.000 description 2
- XWKKEZUPWNZCDT-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-8-nitro-6-(piperidin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CN1CCCCC1)[N+](=O)[O-] XWKKEZUPWNZCDT-UHFFFAOYSA-N 0.000 description 2
- GCWNXJJFYJHYNX-UHFFFAOYSA-N 4-(4-phenylmethoxyphenyl)isoquinoline-6-carbaldehyde Chemical compound C(C1=CC=CC=C1)OC1=CC=C(C=C1)C1=CN=CC2=CC=C(C=C12)C=O GCWNXJJFYJHYNX-UHFFFAOYSA-N 0.000 description 2
- UDIUXGQYPTZDSM-UHFFFAOYSA-N 4-(4-phenylmethoxyphenyl)isoquinoline-6-carboxylic acid Chemical compound C(C1=CC=CC=C1)OC1=CC=C(C=C1)C1=CN=CC2=CC=C(C=C12)C(=O)O UDIUXGQYPTZDSM-UHFFFAOYSA-N 0.000 description 2
- PGHUOJUEAURNQC-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)-7-methoxyisoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound COC1=C(NC2CCC(N)CC2)C=C2C(C=NC=C2C2=CC3=CC=CC=C3O2)=C1 PGHUOJUEAURNQC-UHFFFAOYSA-N 0.000 description 2
- NXBAIKFVLAYEJB-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]benzene-1,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC=C(C=C1)N NXBAIKFVLAYEJB-UHFFFAOYSA-N 0.000 description 2
- VUNMUZIBSWKMJL-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound NC1CCC(CC1)NC1=CC=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=C1 VUNMUZIBSWKMJL-UHFFFAOYSA-N 0.000 description 2
- ZOMPKBNMLJYQIF-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]pyridine-2,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC(=NC=C1)N ZOMPKBNMLJYQIF-UHFFFAOYSA-N 0.000 description 2
- HNMTZMAOBIZRBE-UHFFFAOYSA-N 4-[6-(3-aminopropoxymethyl)isoquinolin-4-yl]phenol Chemical compound NCCCOCC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O HNMTZMAOBIZRBE-UHFFFAOYSA-N 0.000 description 2
- KZPZKNRPPZKJPZ-UHFFFAOYSA-N 4-[6-[(4-aminobutylamino)methyl]isoquinolin-4-yl]phenol Chemical compound NCCCCNCC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O KZPZKNRPPZKJPZ-UHFFFAOYSA-N 0.000 description 2
- RWBNRWZCKKATBH-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)-7-nitroisoquinoline Chemical compound BrC1=CN=CC2=CC(=C(C=C12)CBr)[N+](=O)[O-] RWBNRWZCKKATBH-UHFFFAOYSA-N 0.000 description 2
- ZHKOIUWTFWRGCV-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)-8-chloroisoquinoline Chemical compound BrC1=CN=CC2=C(C=C(C=C12)CBr)Cl ZHKOIUWTFWRGCV-UHFFFAOYSA-N 0.000 description 2
- PIKMURAVQBNNKH-UHFFFAOYSA-N 4-bromo-6-(pyrrolo[3,2-c]pyridin-1-ylmethyl)isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN1C=CC=2C=NC=CC=21 PIKMURAVQBNNKH-UHFFFAOYSA-N 0.000 description 2
- OGJHFFDEYURCPU-UHFFFAOYSA-N 4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine Chemical compound BrC1=C(N=CC2=CC=C(C=C12)CNC1=CC=NC=C1)N OGJHFFDEYURCPU-UHFFFAOYSA-N 0.000 description 2
- YETSBNVBLHJTGW-UHFFFAOYSA-N 4-bromo-6-[(quinolin-4-ylamino)methyl]isoquinolin-1-amine Chemical compound BrC1=CN=C(C2=CC=C(C=C12)CNC1=CC=NC2=CC=CC=C12)N YETSBNVBLHJTGW-UHFFFAOYSA-N 0.000 description 2
- XEQBCCXHOOXUKT-UHFFFAOYSA-N 4-bromo-6-methyl-7-nitroisoquinoline Chemical compound BrC1=CN=CC2=CC(=C(C=C12)C)[N+](=O)[O-] XEQBCCXHOOXUKT-UHFFFAOYSA-N 0.000 description 2
- BBOMKUFXFZKOME-UHFFFAOYSA-N 4-bromo-6-methylisoquinolin-3-amine Chemical compound BrC1=C(N=CC2=CC=C(C=C12)C)N BBOMKUFXFZKOME-UHFFFAOYSA-N 0.000 description 2
- UQKURXKBUHYNAT-UHFFFAOYSA-N 4-bromo-6-methylisoquinoline Chemical compound C1=NC=C(Br)C2=CC(C)=CC=C21 UQKURXKBUHYNAT-UHFFFAOYSA-N 0.000 description 2
- LFSNMZKTWDLKEC-UHFFFAOYSA-N 4-bromo-7-chloro-6-fluoroisoquinoline Chemical compound C1=NC=C2C=C(Cl)C(F)=CC2=C1Br LFSNMZKTWDLKEC-UHFFFAOYSA-N 0.000 description 2
- NZANTASDZLBERP-UHFFFAOYSA-N 4-bromo-8-chloro-6-fluoroisoquinoline Chemical compound BrC1=CN=CC2=C(C=C(C=C12)F)Cl NZANTASDZLBERP-UHFFFAOYSA-N 0.000 description 2
- KAHXMNVVZSUZPS-UHFFFAOYSA-N 4-bromo-8-chloro-6-methylisoquinoline Chemical compound BrC1=CN=CC2=C(C=C(C=C12)C)Cl KAHXMNVVZSUZPS-UHFFFAOYSA-N 0.000 description 2
- SMLSAJLTEYEBGO-UHFFFAOYSA-N 4-bromoisoquinoline-6-carbaldehyde Chemical compound BrC1=CN=CC2=CC=C(C=C12)C=O SMLSAJLTEYEBGO-UHFFFAOYSA-N 0.000 description 2
- UORWTZYYTNAMNF-UHFFFAOYSA-N 4-chloro-6-fluoroisoquinoline Chemical compound C1=NC=C(Cl)C2=CC(F)=CC=C21 UORWTZYYTNAMNF-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- NSHBJRKIKWQDNH-UHFFFAOYSA-N 5-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]pyridine-2,5-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC=1C=CC(=NC=1)N NSHBJRKIKWQDNH-UHFFFAOYSA-N 0.000 description 2
- RWXLGOSZZQXLDZ-UHFFFAOYSA-N 6-(3-aminopropoxymethyl)-4-(1-benzofuran-2-yl)isoquinolin-1-amine Chemical compound NCCCOCC=1C=C2C(=CN=C(C2=CC=1)N)C=1OC2=C(C=1)C=CC=C2 RWXLGOSZZQXLDZ-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- WTVJKKVTJSUHNN-UHFFFAOYSA-N 6-azido-4-(1-benzofuran-2-yl)isoquinoline Chemical compound N(=[N+]=[N-])C=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 WTVJKKVTJSUHNN-UHFFFAOYSA-N 0.000 description 2
- ZDYXSEQHOVSTPA-UHFFFAOYSA-N 6-bromo-2h-isoquinolin-1-one Chemical compound C1=CNC(=O)C=2C1=CC(Br)=CC=2 ZDYXSEQHOVSTPA-UHFFFAOYSA-N 0.000 description 2
- AALOETOHAVZCIE-UHFFFAOYSA-N 6-bromo-4-chloro-2h-isoquinolin-1-one Chemical compound C1=C(Br)C=C2C(Cl)=CNC(=O)C2=C1 AALOETOHAVZCIE-UHFFFAOYSA-N 0.000 description 2
- UKSVTOGMUNNCFO-UHFFFAOYSA-N 6-fluoro-4-phenylisoquinoline Chemical compound FC=1C=C2C(=CN=CC2=CC=1)C1=CC=CC=C1 UKSVTOGMUNNCFO-UHFFFAOYSA-N 0.000 description 2
- HMPDTQYNATWNPO-UHFFFAOYSA-N 6-methyl-4-quinolin-2-ylisoquinoline Chemical compound CC=1C=C2C(=CN=CC2=CC=1)C1=NC2=CC=CC=C2C=C1 HMPDTQYNATWNPO-UHFFFAOYSA-N 0.000 description 2
- DBOBOPSSKJMSSY-UHFFFAOYSA-N 6-methylisoquinolin-3-amine Chemical compound C1=NC(N)=CC2=CC(C)=CC=C21 DBOBOPSSKJMSSY-UHFFFAOYSA-N 0.000 description 2
- BCZPUVXMWIBIRE-UHFFFAOYSA-N 7-chloro-6-fluoroisoquinoline Chemical compound C1=NC=C2C=C(Cl)C(F)=CC2=C1 BCZPUVXMWIBIRE-UHFFFAOYSA-N 0.000 description 2
- OKJGMKGYRXNFHN-UHFFFAOYSA-N 8-chloro-6-fluoroisoquinoline Chemical compound C1=NC=CC2=CC(F)=CC(Cl)=C21 OKJGMKGYRXNFHN-UHFFFAOYSA-N 0.000 description 2
- WGEXKUOPBCSTCB-UHFFFAOYSA-N 8-chloro-6-methylisoquinoline Chemical compound CC1=CC(Cl)=C2C=NC=CC2=C1 WGEXKUOPBCSTCB-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 2
- 208000003200 Adenoma Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 208000005440 Basal Cell Neoplasms Diseases 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- IILHQAYXANRUAA-IYARVYRRSA-N C1(=CC=CC=C1)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N Chemical compound C1(=CC=CC=C1)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N IILHQAYXANRUAA-IYARVYRRSA-N 0.000 description 2
- ISHRKCUYRAQKCM-UHFFFAOYSA-N CC=1C=C2C(=CN=CC2=CC=1)B(O)O Chemical compound CC=1C=C2C(=CN=CC2=CC=1)B(O)O ISHRKCUYRAQKCM-UHFFFAOYSA-N 0.000 description 2
- 102000014914 Carrier Proteins Human genes 0.000 description 2
- CBZBHRQLOZEKPN-MKMNVTDBSA-N ClC=1C=C(C=CC=1F)\C=N\CC(OC)OC Chemical compound ClC=1C=C(C=CC=1F)\C=N\CC(OC)OC CBZBHRQLOZEKPN-MKMNVTDBSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- 229920002307 Dextran Polymers 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- 108010007457 Extracellular Signal-Regulated MAP Kinases Proteins 0.000 description 2
- 102000017013 Heterogeneous Nuclear Ribonucleoprotein A1 Human genes 0.000 description 2
- 108010014594 Heterogeneous Nuclear Ribonucleoprotein A1 Proteins 0.000 description 2
- 102100037611 Lysophospholipase Human genes 0.000 description 2
- 102000043136 MAP kinase family Human genes 0.000 description 2
- 108091054455 MAP kinase family Proteins 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 206010027406 Mesothelioma Diseases 0.000 description 2
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 2
- 102100023482 Mitogen-activated protein kinase 14 Human genes 0.000 description 2
- SOAFWHNQOBFUBW-UHFFFAOYSA-N N'-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]ethane-1,2-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NCCN SOAFWHNQOBFUBW-UHFFFAOYSA-N 0.000 description 2
- MNYJEDVJKQSCDJ-UHFFFAOYSA-N N-(3-aminopropyl)-8-(1-benzofuran-2-yl)-1,6-naphthyridine-2-carboxamide Chemical compound NCCCNC(=O)C1=CC=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=N1 MNYJEDVJKQSCDJ-UHFFFAOYSA-N 0.000 description 2
- CDESIEBVHQBYGN-UHFFFAOYSA-N N1=CC=C(C=C1)NC=1C=C2C=CN=CC2=CC=1 Chemical compound N1=CC=C(C=C1)NC=1C=C2C=CN=CC2=CC=1 CDESIEBVHQBYGN-UHFFFAOYSA-N 0.000 description 2
- VUNMUZIBSWKMJL-IYARVYRRSA-N O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N VUNMUZIBSWKMJL-IYARVYRRSA-N 0.000 description 2
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 2
- 108700020796 Oncogene Proteins 0.000 description 2
- 206010056658 Pseudocyst Diseases 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 206010068771 Soft tissue neoplasm Diseases 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- UTBZBFABWURPNP-UHFFFAOYSA-N [3-(1,3-dioxoisoindol-2-yl)cyclopentyl] methanesulfonate Chemical compound CS(=O)(=O)OC1CC(CC1)N1C(C2=CC=CC=C2C1=O)=O UTBZBFABWURPNP-UHFFFAOYSA-N 0.000 description 2
- ALOHCOOPYLLDTG-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]methanol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CO)OC ALOHCOOPYLLDTG-UHFFFAOYSA-N 0.000 description 2
- NGZYTIFLQWNFFR-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)cinnolin-6-yl]methanol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=NC2=CC=C(C=C12)CO NGZYTIFLQWNFFR-UHFFFAOYSA-N 0.000 description 2
- PRODLXHVZJXWMY-UHFFFAOYSA-N [4-(4-chlorophenyl)cinnolin-6-yl]methanol Chemical compound ClC1=CC=C(C=C1)C1=CN=NC2=CC=C(C=C12)CO PRODLXHVZJXWMY-UHFFFAOYSA-N 0.000 description 2
- DMGMCZRNMYQQQB-UHFFFAOYSA-N [4-(oxan-2-yloxy)phenyl]boronic acid Chemical compound C1=CC(B(O)O)=CC=C1OC1OCCCC1 DMGMCZRNMYQQQB-UHFFFAOYSA-N 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- OYTKINVCDFNREN-UHFFFAOYSA-N amifampridine Chemical compound NC1=CC=NC=C1N OYTKINVCDFNREN-UHFFFAOYSA-N 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 108091008324 binding proteins Proteins 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 231100000504 carcinogenesis Toxicity 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- PNZXMIKHJXIPEK-UHFFFAOYSA-N cyclohexanecarboxamide Chemical compound NC(=O)C1CCCCC1 PNZXMIKHJXIPEK-UHFFFAOYSA-N 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 2
- 208000012106 cystic neoplasm Diseases 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 2
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 2
- REWLCYPYZCHYSS-UHFFFAOYSA-N ditert-butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Chemical compound COC1=CC=C(OC)C(C=2C(=CC(=CC=2C(C)C)C(C)C)C(C)C)=C1P(C(C)(C)C)C(C)(C)C REWLCYPYZCHYSS-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000105 evaporative light scattering detection Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000003838 furazanyl group Chemical group 0.000 description 2
- 239000007902 hard capsule Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 231100000682 maximum tolerated dose Toxicity 0.000 description 2
- 201000001441 melanoma Diseases 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- PYSJPOCXDUSGSU-UHFFFAOYSA-N methyl 4-(4-chlorophenyl)cinnoline-6-carboxylate Chemical compound ClC1=CC=C(C=C1)C1=CN=NC2=CC=C(C=C12)C(=O)OC PYSJPOCXDUSGSU-UHFFFAOYSA-N 0.000 description 2
- APIWQCZMCBJJGR-UHFFFAOYSA-N methyl 4-oxo-1h-cinnoline-6-carboxylate Chemical compound N1N=CC(=O)C2=CC(C(=O)OC)=CC=C21 APIWQCZMCBJJGR-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 208000022669 mucinous neoplasm Diseases 0.000 description 2
- 201000009368 muscle benign neoplasm Diseases 0.000 description 2
- 208000017708 myomatous neoplasm Diseases 0.000 description 2
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 2
- XCJNSBCFLUPJAP-UHFFFAOYSA-N n,n-dimethylpiperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.CN(C)C1CCNCC1 XCJNSBCFLUPJAP-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- PWBBAFHDYQMQRY-UHFFFAOYSA-N n-[(2-chloro-4-fluorophenyl)methyl]-2,2-dimethoxyethanamine Chemical compound COC(OC)CNCC1=CC=C(F)C=C1Cl PWBBAFHDYQMQRY-UHFFFAOYSA-N 0.000 description 2
- BPQHACCSMMFJNV-UHFFFAOYSA-N n-[(2-chloro-4-fluorophenyl)methyl]-n-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide Chemical compound C=1C=C(C)C=CC=1S(=O)(=O)N(CC(OC)OC)CC1=CC=C(F)C=C1Cl BPQHACCSMMFJNV-UHFFFAOYSA-N 0.000 description 2
- CMNWRGRDHIALBO-UHFFFAOYSA-N n-[(3-chloro-4-fluorophenyl)methyl]-2,2-dimethoxyethanamine Chemical compound COC(OC)CNCC1=CC=C(F)C(Cl)=C1 CMNWRGRDHIALBO-UHFFFAOYSA-N 0.000 description 2
- JVVSXUBENIFPMW-UHFFFAOYSA-N n-[(3-chloro-4-fluorophenyl)methyl]-n-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide Chemical compound C=1C=C(C)C=CC=1S(=O)(=O)N(CC(OC)OC)CC1=CC=C(F)C(Cl)=C1 JVVSXUBENIFPMW-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 2
- 230000001613 neoplastic effect Effects 0.000 description 2
- 239000003176 neuroleptic agent Substances 0.000 description 2
- 230000000701 neuroleptic effect Effects 0.000 description 2
- 108010068338 p38 Mitogen-Activated Protein Kinases Proteins 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 208000016596 serous neoplasm Diseases 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 208000017572 squamous cell neoplasm Diseases 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- APZOOTJWPGQYSZ-UHFFFAOYSA-N tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)C(F)(F)C1 APZOOTJWPGQYSZ-UHFFFAOYSA-N 0.000 description 2
- PWQLFIKTGRINFF-UHFFFAOYSA-N tert-butyl 4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)CC1 PWQLFIKTGRINFF-UHFFFAOYSA-N 0.000 description 2
- JSEWHIPZDUDEJR-UHFFFAOYSA-N tert-butyl N-(1,8-naphthyridin-4-yl)carbamate Chemical compound N1=CC=C(C2=CC=CN=C12)NC(OC(C)(C)C)=O JSEWHIPZDUDEJR-UHFFFAOYSA-N 0.000 description 2
- ROTQKOFOMSLZEB-UHFFFAOYSA-N tert-butyl N-[4-bromo-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxymethyl]isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=CN=C(C2=CC=C(C=C12)COCCCNC(=O)OC(C)(C)C)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C ROTQKOFOMSLZEB-UHFFFAOYSA-N 0.000 description 2
- VMBHTAFUPKPVHG-UHFFFAOYSA-N tert-butyl N-[4-bromo-8-chloro-6-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=CN=C(C2=C(C=C(C=C12)CN1CCC(CC1)NC(=O)OC(C)(C)C)Cl)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C VMBHTAFUPKPVHG-UHFFFAOYSA-N 0.000 description 2
- LKJFDGMIPKPELH-UHFFFAOYSA-N tert-butyl N-[6-(aminomethyl)-4-bromoisoquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound NCC=1C=C2C(=C(N=CC2=CC=1)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C)Br LKJFDGMIPKPELH-UHFFFAOYSA-N 0.000 description 2
- TZRQZPMQUXEZMC-UHFFFAOYSA-N tert-butyl n-(2-bromoethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCBr TZRQZPMQUXEZMC-UHFFFAOYSA-N 0.000 description 2
- XDJCYKMWJCYQJM-UHFFFAOYSA-N tert-butyl n-(3-hydroxypropyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCO XDJCYKMWJCYQJM-UHFFFAOYSA-N 0.000 description 2
- FEYLUKDSKVSMSZ-UHFFFAOYSA-N tert-butyl n-(4-aminocyclohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(N)CC1 FEYLUKDSKVSMSZ-UHFFFAOYSA-N 0.000 description 2
- ADOLUQJHKOJULD-UHFFFAOYSA-N tert-butyl n-pyridazin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=NN=C1 ADOLUQJHKOJULD-UHFFFAOYSA-N 0.000 description 2
- WKHGDPZRLXDVMJ-UHFFFAOYSA-N tert-butyl n-pyridin-3-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=CN=C1 WKHGDPZRLXDVMJ-UHFFFAOYSA-N 0.000 description 2
- 125000001302 tertiary amino group Chemical group 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- 206010044412 transitional cell carcinoma Diseases 0.000 description 2
- 208000010556 transitional cell papilloma Diseases 0.000 description 2
- 201000004420 transitional papilloma Diseases 0.000 description 2
- 238000013519 translation Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- WWUQRUIBJJBKLS-UHFFFAOYSA-N (2-methylpropan-2-yl)oxycarbonylcarbamic acid Chemical compound CC(C)(C)OC(=O)NC(O)=O WWUQRUIBJJBKLS-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- DQLROJBYDGSHMG-UHFFFAOYSA-N (4-bromopyridin-2-yl)carbamic acid Chemical compound OC(=O)NC1=CC(Br)=CC=N1 DQLROJBYDGSHMG-UHFFFAOYSA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- 125000006582 (C5-C6) heterocycloalkyl group Chemical group 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- OZZMWXQJCJUCEJ-UHFFFAOYSA-N 1,6-naphthyridine-2-carboxylic acid Chemical compound C1=NC=CC2=NC(C(=O)O)=CC=C21 OZZMWXQJCJUCEJ-UHFFFAOYSA-N 0.000 description 1
- FPMFWNDLLWUVEH-UHFFFAOYSA-N 1,8-naphthyridin-4-amine Chemical compound C1=CC=C2C(N)=CC=NC2=N1 FPMFWNDLLWUVEH-UHFFFAOYSA-N 0.000 description 1
- STCSSLJEGHZOAW-UHFFFAOYSA-N 1-(2-chloro-4-methylphenyl)-N-(2,2-dimethoxyethyl)methanimine Chemical compound COC(CN=CC1=C(Cl)C=C(C)C=C1)OC STCSSLJEGHZOAW-UHFFFAOYSA-N 0.000 description 1
- SQHZTJPUWZFWNQ-UHFFFAOYSA-N 1-[(4-bromoisoquinolin-6-yl)methyl]-N,N-dimethylpiperidin-4-amine Chemical compound CN(C)C1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1 SQHZTJPUWZFWNQ-UHFFFAOYSA-N 0.000 description 1
- BLNQYGZTOZJMRF-UHFFFAOYSA-N 1-[(4-bromoisoquinolin-6-yl)methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1 BLNQYGZTOZJMRF-UHFFFAOYSA-N 0.000 description 1
- PTNYSGYPFSYHPO-UHFFFAOYSA-N 1-[(4-quinolin-2-ylisoquinolin-6-yl)methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=CC=C3C=NC=C(C4=NC5=CC=CC=C5C=C4)C3=C2)CC1 PTNYSGYPFSYHPO-UHFFFAOYSA-N 0.000 description 1
- FGZRKGTZUWISOP-UHFFFAOYSA-N 1-[(7-chloro-4-phenylisoquinolin-6-yl)methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=C(Cl)C=C3C=NC=C(C4=CC=CC=C4)C3=C2)CC1 FGZRKGTZUWISOP-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- UJBKDUWYORYGON-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CN1CCC(CC1)N)Cl UJBKDUWYORYGON-UHFFFAOYSA-N 0.000 description 1
- ZPPPZMCZCDFGOO-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]indol-5-amine Chemical compound NC1=CC=C2N(CC3=CC=C4C=NC=C(C5=CC6=CC=CC=C6O5)C4=C3)C=CC2=C1 ZPPPZMCZCDFGOO-UHFFFAOYSA-N 0.000 description 1
- PVBLJPCMWKGTOH-UHFFFAOYSA-N 1-aminocyclohexan-1-ol Chemical compound NC1(O)CCCCC1 PVBLJPCMWKGTOH-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- YKSVXVKIYYQWBB-UHFFFAOYSA-N 1-butylpiperazine Chemical compound CCCCN1CCNCC1 YKSVXVKIYYQWBB-UHFFFAOYSA-N 0.000 description 1
- QZBWBBHQRLUOTM-UHFFFAOYSA-N 1-chloro-6-fluoroisoquinoline Chemical compound ClC1=NC=CC2=CC(F)=CC=C21 QZBWBBHQRLUOTM-UHFFFAOYSA-N 0.000 description 1
- MRCHHCXNURDQHS-UHFFFAOYSA-N 1-methyl-1-nitrourea Chemical compound NC(=O)N(C)[N+]([O-])=O MRCHHCXNURDQHS-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- XLKDJOPOOHHZAN-UHFFFAOYSA-N 1h-pyrrolo[2,3-c]pyridine Chemical compound C1=NC=C2NC=CC2=C1 XLKDJOPOOHHZAN-UHFFFAOYSA-N 0.000 description 1
- IFFLKGMDBKQMAH-UHFFFAOYSA-N 2,4-diaminopyridine Chemical compound NC1=CC=NC(N)=C1 IFFLKGMDBKQMAH-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- OGHAROSJZRTIOK-KQYNXXCUSA-N 2-amino-9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methylpurin-9-ium-6-olate Chemical compound C12=NC(N)=NC([O-])=C2N(C)C=[N+]1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OGHAROSJZRTIOK-KQYNXXCUSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 1
- YDMNXSKZQGQBIF-UHFFFAOYSA-N 2-bromopyridine;hydrochloride Chemical compound Cl.BrC1=CC=CC=N1 YDMNXSKZQGQBIF-UHFFFAOYSA-N 0.000 description 1
- QKJAZPHKNWSXDF-UHFFFAOYSA-N 2-bromoquinoline Chemical compound C1=CC=CC2=NC(Br)=CC=C21 QKJAZPHKNWSXDF-UHFFFAOYSA-N 0.000 description 1
- KMQWNQKESAHDKD-UHFFFAOYSA-N 2-chloro-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C(Cl)=C1 KMQWNQKESAHDKD-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- JMARSTSWTFXHMC-UHFFFAOYSA-N 2-methyl-1h-pyrazol-3-one Chemical compound CN1NC=CC1=O JMARSTSWTFXHMC-UHFFFAOYSA-N 0.000 description 1
- UADBLNUFIZQDOR-UHFFFAOYSA-N 2-methylpyrazol-3-ol Chemical compound CN1N=C[C]=C1O UADBLNUFIZQDOR-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- GVORVQPNNSASDM-UHFFFAOYSA-N 3-chloro-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1Cl GVORVQPNNSASDM-UHFFFAOYSA-N 0.000 description 1
- FNXYWHTZDAVRTB-UHFFFAOYSA-N 3-methyl-1,2-oxazol-5-amine Chemical compound CC=1C=C(N)ON=1 FNXYWHTZDAVRTB-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004364 3-pyrrolinyl group Chemical group [H]C1=C([H])C([H])([H])N(*)C1([H])[H] 0.000 description 1
- FNPZFZKLYGWKLH-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane Chemical compound O1C(C)=CC=C1B1OC(C)(C)C(C)(C)O1 FNPZFZKLYGWKLH-UHFFFAOYSA-N 0.000 description 1
- XMHLCHDPKCUNNH-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(pyrrolo[2,3-c]pyridin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN1C=CC=2C1=CN=CC=2 XMHLCHDPKCUNNH-UHFFFAOYSA-N 0.000 description 1
- XQPNUBJCXVGWEF-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[(quinolin-4-ylamino)methyl]isoquinolin-1-amine Chemical compound NC1=C2C=CC(CNC3=CC=NC4=C3C=CC=C4)=CC2=C(C=N1)C1=CC2=C(O1)C=CC=C2 XQPNUBJCXVGWEF-UHFFFAOYSA-N 0.000 description 1
- VDNPZAWAUGWRER-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-phenylmethoxyisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCC1=CC=CC=C1 VDNPZAWAUGWRER-UHFFFAOYSA-N 0.000 description 1
- QRVUQZWSKCKMJS-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-N-pyridin-4-ylisoquinolin-6-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC=NC=C1 QRVUQZWSKCKMJS-UHFFFAOYSA-N 0.000 description 1
- BLBDTBCGPHPIJK-UHFFFAOYSA-N 4-Amino-2-chloropyridine Chemical compound NC1=CC=NC(Cl)=C1 BLBDTBCGPHPIJK-UHFFFAOYSA-N 0.000 description 1
- UVTRJSWQWLUZHT-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)-7-chloroisoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound NC1CCC(CC1)NC1=C(Cl)C=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=C1 UVTRJSWQWLUZHT-UHFFFAOYSA-N 0.000 description 1
- CSBAIBZWNJNZSI-UHFFFAOYSA-N 4-N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]pyridine-2,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CNC1=CC(=NC=C1)N CSBAIBZWNJNZSI-UHFFFAOYSA-N 0.000 description 1
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 1
- XQTNIEJEYBNHTP-UHFFFAOYSA-N 4-azido-1,8-naphthyridine Chemical compound [N-]=[N+]=NC1=C2C=CC=NC2=NC=C1 XQTNIEJEYBNHTP-UHFFFAOYSA-N 0.000 description 1
- AABHEVGNUVRPCB-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)-7-chloroisoquinoline Chemical compound BrC1=CN=CC2=CC(=C(C=C12)CBr)Cl AABHEVGNUVRPCB-UHFFFAOYSA-N 0.000 description 1
- CRHVBTMXKXCZNZ-UHFFFAOYSA-N 4-bromo-6-(dibromomethyl)isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)C(Br)Br CRHVBTMXKXCZNZ-UHFFFAOYSA-N 0.000 description 1
- NGVYUUZSISWYQZ-UHFFFAOYSA-N 4-bromo-6-(piperazin-1-ylmethyl)isoquinolin-3-amine Chemical compound BrC1=C(N=CC2=CC=C(C=C12)CN1CCNCC1)N NGVYUUZSISWYQZ-UHFFFAOYSA-N 0.000 description 1
- HESCAPCNEZDOLP-UHFFFAOYSA-N 4-bromo-6-[(2-methylpyrazol-3-yl)oxymethyl]isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)COC=1N(N=CC=1)C HESCAPCNEZDOLP-UHFFFAOYSA-N 0.000 description 1
- CGXSMTXAIMBDDG-UHFFFAOYSA-N 4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine hydrochloride Chemical compound Cl.Nc1ncc2ccc(CNc3ccncc3)cc2c1Br CGXSMTXAIMBDDG-UHFFFAOYSA-N 0.000 description 1
- JSZSYKFPVWUMLL-UHFFFAOYSA-N 4-bromo-6-[(quinolin-4-ylamino)methyl]isoquinolin-3-amine Chemical compound BrC1=C(N=CC2=CC=C(C=C12)CNC1=CC=NC2=CC=CC=C12)N JSZSYKFPVWUMLL-UHFFFAOYSA-N 0.000 description 1
- VAUFZPQKQGCIHM-UHFFFAOYSA-N 4-bromo-6-methylisoquinolin-1-amine Chemical compound NC1=NC=C(Br)C2=CC(C)=CC=C21 VAUFZPQKQGCIHM-UHFFFAOYSA-N 0.000 description 1
- BSDGZUDFPKIYQG-UHFFFAOYSA-N 4-bromopyridine Chemical compound BrC1=CC=NC=C1 BSDGZUDFPKIYQG-UHFFFAOYSA-N 0.000 description 1
- ACUIUZBDBGSIJH-UHFFFAOYSA-N 4-chloro-6-methylisoquinoline Chemical compound C1=NC=C(Cl)C2=CC(C)=CC=C21 ACUIUZBDBGSIJH-UHFFFAOYSA-N 0.000 description 1
- JXZZRVZCPFTYQV-UHFFFAOYSA-N 4-chloro-N-pyridin-4-ylisoquinolin-6-amine Chemical compound ClC1=CN=CC2=CC=C(C=C12)NC1=CC=NC=C1 JXZZRVZCPFTYQV-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- OZFPSOBLQZPIAV-UHFFFAOYSA-N 5-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2NC=CC2=C1 OZFPSOBLQZPIAV-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- QUPXDMURZIIQDS-UHFFFAOYSA-N 6-(bromomethyl)-4-quinolin-2-ylisoquinoline Chemical compound BrCC=1C=C2C(=CN=CC2=CC=1)C1=NC2=CC=CC=C2C=C1 QUPXDMURZIIQDS-UHFFFAOYSA-N 0.000 description 1
- QJOXNPATRLQENU-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)-8-chloroisoquinolin-1-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=C(C2=C(C=1)Cl)N)C=1OC2=C(C=1)C=CC=C2 QJOXNPATRLQENU-UHFFFAOYSA-N 0.000 description 1
- UBAIDAWSBCBCBU-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)isoquinolin-7-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1N)C=1OC2=C(C=1)C=CC=C2 UBAIDAWSBCBCBU-UHFFFAOYSA-N 0.000 description 1
- XOYSNIOSJRDDCK-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-bromoisoquinolin-3-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=C(N=CC2=CC=1)N)Br XOYSNIOSJRDDCK-UHFFFAOYSA-N 0.000 description 1
- CDMLLPMNUHXCDB-UHFFFAOYSA-N 6-bromo-4-chloroisoquinoline Chemical compound C1=C(Br)C=C2C(Cl)=CN=CC2=C1 CDMLLPMNUHXCDB-UHFFFAOYSA-N 0.000 description 1
- ALLJCJZVQMDEHE-UHFFFAOYSA-N 6-fluoroisoquinoline Chemical compound C1=NC=CC2=CC(F)=CC=C21 ALLJCJZVQMDEHE-UHFFFAOYSA-N 0.000 description 1
- LHRDOJQPLLZVFX-UHFFFAOYSA-N 7-chloro-6-methylisoquinoline Chemical compound C1=NC=C2C=C(Cl)C(C)=CC2=C1 LHRDOJQPLLZVFX-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- PQBNZTONCGWKCZ-UHFFFAOYSA-N 8-bromo-1,6-naphthyridine Chemical compound C1=CN=C2C(Br)=CN=CC2=C1 PQBNZTONCGWKCZ-UHFFFAOYSA-N 0.000 description 1
- ISJKXVUODLFGIU-UHFFFAOYSA-N 8-bromo-1,6-naphthyridine-2-carboxylic acid Chemical compound C1=NC=C(Br)C2=NC(C(=O)O)=CC=C21 ISJKXVUODLFGIU-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 101710134784 Agnoprotein Proteins 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 102100021569 Apoptosis regulator Bcl-2 Human genes 0.000 description 1
- 102100021663 Baculoviral IAP repeat-containing protein 5 Human genes 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- GQUMBCUPZBECDF-UHFFFAOYSA-N BrC1=CN(C(C2=CC=C(C=C12)Br)=O)COCC[Si](C)(C)C Chemical compound BrC1=CN(C(C2=CC=C(C=C12)Br)=O)COCC[Si](C)(C)C GQUMBCUPZBECDF-UHFFFAOYSA-N 0.000 description 1
- OVYSLLCFCGOZBI-UHFFFAOYSA-N BrC=1C=C2C(=CN(C(C2=CC=1)=O)COCC[Si](C)(C)C)Cl Chemical compound BrC=1C=C2C(=CN(C(C2=CC=1)=O)COCC[Si](C)(C)C)Cl OVYSLLCFCGOZBI-UHFFFAOYSA-N 0.000 description 1
- JTMFAWYFAFCMDC-UHFFFAOYSA-N C(C)(=O)NC1C(CN(CC1)C(=O)OC(C)(C)C)(F)F Chemical compound C(C)(=O)NC1C(CN(CC1)C(=O)OC(C)(C)C)(F)F JTMFAWYFAFCMDC-UHFFFAOYSA-N 0.000 description 1
- PNFIBEYKHBFEQY-KYZUINATSA-N C(C)(=O)N[C@@H]1CC[C@H](CC1)CN Chemical compound C(C)(=O)N[C@@H]1CC[C@H](CC1)CN PNFIBEYKHBFEQY-KYZUINATSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- GEWLYFZWVLXQME-UHFFFAOYSA-N Cercosporamide Natural products CC12C(=O)C(C(=O)C)=C(O)C=C1OC1=C2C(O)=CC(O)=C1C(N)=O GEWLYFZWVLXQME-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 102000006311 Cyclin D1 Human genes 0.000 description 1
- 108010058546 Cyclin D1 Proteins 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- 101100232687 Drosophila melanogaster eIF4A gene Proteins 0.000 description 1
- 206010058314 Dysplasia Diseases 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101710091919 Eukaryotic translation initiation factor 4G Proteins 0.000 description 1
- 208000001382 Experimental Melanoma Diseases 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 208000005234 Granulosa Cell Tumor Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 101000971171 Homo sapiens Apoptosis regulator Bcl-2 Proteins 0.000 description 1
- 101000573522 Homo sapiens MAP kinase-interacting serine/threonine-protein kinase 1 Proteins 0.000 description 1
- 101001018978 Homo sapiens MAP kinase-interacting serine/threonine-protein kinase 2 Proteins 0.000 description 1
- 101500028620 Homo sapiens Motilin-associated peptide Proteins 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 108091026898 Leader sequence (mRNA) Proteins 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 102100033610 MAP kinase-interacting serine/threonine-protein kinase 2 Human genes 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 102100038895 Myc proto-oncogene protein Human genes 0.000 description 1
- 101710135898 Myc proto-oncogene protein Proteins 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- 208000014767 Myeloproliferative disease Diseases 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- LSZBDMGMUHYCPF-UHFFFAOYSA-N N-(2-azidopyridin-4-yl)-4-(1-benzofuran-2-yl)isoquinolin-6-amine Chemical compound N(=[N+]=[N-])C1=NC=CC(=C1)NC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 LSZBDMGMUHYCPF-UHFFFAOYSA-N 0.000 description 1
- QZVQMHUEQVFBFB-UHFFFAOYSA-N N-(3,3-difluoropiperidin-4-yl)acetamide Chemical compound FC1(CNCCC1NC(C)=O)F QZVQMHUEQVFBFB-UHFFFAOYSA-N 0.000 description 1
- GRMKMTWGCKMRLT-UHFFFAOYSA-N N-[(2-chloro-4-methylphenyl)methyl]-2,2-dimethoxyethanamine Chemical compound ClC1=C(C=CC(=C1)C)CNCC(OC)OC GRMKMTWGCKMRLT-UHFFFAOYSA-N 0.000 description 1
- DBCWEMQACXCGSI-UHFFFAOYSA-N N-[(2-chloro-4-methylphenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide Chemical compound ClC1=C(C=CC(=C1)C)CN(S(=O)(=O)C1=CC=C(C=C1)C)CC(OC)OC DBCWEMQACXCGSI-UHFFFAOYSA-N 0.000 description 1
- ALQFZSYBDZMXKY-UHFFFAOYSA-N N-[(4-bromoisoquinolin-6-yl)methyl]-3-nitropyridin-4-amine Chemical compound BrC1=CN=CC2=CC=C(C=C12)CNC1=C(C=NC=C1)[N+](=O)[O-] ALQFZSYBDZMXKY-UHFFFAOYSA-N 0.000 description 1
- FFUQUBYTCAIQAS-UHFFFAOYSA-N N-[1-[(4-bromoisoquinolin-6-yl)methyl]-3,3-difluoropiperidin-4-yl]acetamide Chemical compound CC(=O)NC1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1(F)F FFUQUBYTCAIQAS-UHFFFAOYSA-N 0.000 description 1
- QHVFWMDPNQMNAC-UHFFFAOYSA-N N-[3-(trifluoromethyl)pyridin-4-yl]acetamide Chemical compound FC(C=1C=NC=CC=1NC(C)=O)(F)F QHVFWMDPNQMNAC-UHFFFAOYSA-N 0.000 description 1
- KCBJXDUPZWYTRQ-UHFFFAOYSA-N N-[5-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]amino]pyridin-2-yl]acetamide Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC=1C=CC(=NC=1)NC(C)=O KCBJXDUPZWYTRQ-UHFFFAOYSA-N 0.000 description 1
- AVQQQUULBHXFML-UHFFFAOYSA-N N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]-3-nitropyridin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CNC1=C(C=NC=C1)[N+](=O)[O-] AVQQQUULBHXFML-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- UQFQONCQIQEYPJ-UHFFFAOYSA-N N-methylpyrazole Chemical compound CN1C=CC=N1 UQFQONCQIQEYPJ-UHFFFAOYSA-N 0.000 description 1
- CEWHVPGBFSICRT-RUCARUNLSA-N N[C@@H]1CC[C@H](CC1)CNC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 Chemical compound N[C@@H]1CC[C@H](CC1)CNC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 CEWHVPGBFSICRT-RUCARUNLSA-N 0.000 description 1
- 208000031675 Neoplasms, Adnexal and Skin Appendage Diseases 0.000 description 1
- 208000034176 Neoplasms, Germ Cell and Embryonal Diseases 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- UKOARFKHYHRGKE-XGAFWQRZSA-N O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC[C@@H]1CC[C@H](CC1)NC(C)=O Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC[C@@H]1CC[C@H](CC1)NC(C)=O UKOARFKHYHRGKE-XGAFWQRZSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- 108010058864 Phospholipases A2 Proteins 0.000 description 1
- 208000007452 Plasmacytoma Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 102000015097 RNA Splicing Factors Human genes 0.000 description 1
- 108010039259 RNA Splicing Factors Proteins 0.000 description 1
- 229940123690 Raf kinase inhibitor Drugs 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- 201000001880 Sexual dysfunction Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 108010002687 Survivin Proteins 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 101710150448 Transcriptional regulator Myc Proteins 0.000 description 1
- 108700019146 Transgenes Proteins 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 1
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- PIKAHTZTFKKRKO-UHFFFAOYSA-N [1-amino-4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]methanol Chemical compound COC1=C2C(N)=NC=C(C3=CC4=CC=CC=C4O3)C2=CC(CO)=C1 PIKAHTZTFKKRKO-UHFFFAOYSA-N 0.000 description 1
- PEOJULVWBASZSJ-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]methanol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CO)Cl PEOJULVWBASZSJ-UHFFFAOYSA-N 0.000 description 1
- WXIONIWNXBAHRU-UHFFFAOYSA-N [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium Chemical compound C1=CN=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 WXIONIWNXBAHRU-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005213 alkyl heteroaryl group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 229960004012 amifampridine Drugs 0.000 description 1
- BQLZTCOPOODXRE-UHFFFAOYSA-N amino 2,2,2-trifluoroacetate Chemical compound NOC(=O)C(F)(F)F BQLZTCOPOODXRE-UHFFFAOYSA-N 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004533 benzofuran-5-yl group Chemical group O1C=CC2=C1C=CC(=C2)* 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004534 benzothien-2-yl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004535 benzothien-5-yl group Chemical group S1C=CC2=C1C=CC(=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 108020001778 catalytic domains Proteins 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000010307 cell transformation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- GEWLYFZWVLXQME-MRXNPFEDSA-N cercosporamide Chemical compound O=C([C@]12C)C(C(=O)C)=C(O)C=C1OC1=C2C(O)=CC(O)=C1C(N)=O GEWLYFZWVLXQME-MRXNPFEDSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000003184 complementary RNA Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- JCWIWBWXCVGEAN-UHFFFAOYSA-L cyclopentyl(diphenyl)phosphane;dichloropalladium;iron Chemical compound [Fe].Cl[Pd]Cl.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1 JCWIWBWXCVGEAN-UHFFFAOYSA-L 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- ZOCHARZZJNPSEU-UHFFFAOYSA-N diboron Chemical compound B#B ZOCHARZZJNPSEU-UHFFFAOYSA-N 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- LCSNDSFWVKMJCT-UHFFFAOYSA-N dicyclohexyl-(2-phenylphenyl)phosphane Chemical group C1CCCCC1P(C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CCCCC1 LCSNDSFWVKMJCT-UHFFFAOYSA-N 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 150000002013 dioxins Chemical class 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 230000009266 disease activity Effects 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 208000010932 epithelial neoplasm Diseases 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 235000013861 fat-free Nutrition 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- 208000018212 fibroblastic neoplasm Diseases 0.000 description 1
- 230000003176 fibrotic effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- DUJKMJZZYGMSQR-UHFFFAOYSA-N fluoromethylsulfonyl fluoromethanesulfonate Chemical compound FCS(=O)(=O)OS(=O)(=O)CF DUJKMJZZYGMSQR-UHFFFAOYSA-N 0.000 description 1
- 230000003325 follicular Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000004615 furo[2,3-b]pyridinyl group Chemical group O1C(=CC=2C1=NC=CC2)* 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 230000002710 gonadal effect Effects 0.000 description 1
- 201000006604 granular cell tumor Diseases 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- 125000005343 heterocyclic alkyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 208000025095 immunoproliferative disease Diseases 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical compound C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 1
- OSILBMSORKFRTB-UHFFFAOYSA-N isoquinolin-1-amine Chemical compound C1=CC=C2C(N)=NC=CC2=C1 OSILBMSORKFRTB-UHFFFAOYSA-N 0.000 description 1
- VYCKDIRCVDCQAE-UHFFFAOYSA-N isoquinolin-3-amine Chemical compound C1=CC=C2C=NC(N)=CC2=C1 VYCKDIRCVDCQAE-UHFFFAOYSA-N 0.000 description 1
- NGFCTYXFMDWFRQ-UHFFFAOYSA-N isoquinolin-6-amine Chemical compound C1=NC=CC2=CC(N)=CC=C21 NGFCTYXFMDWFRQ-UHFFFAOYSA-N 0.000 description 1
- 238000011813 knockout mouse model Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 238000003760 magnetic stirring Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 201000006512 mast cell neoplasm Diseases 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 206010027191 meningioma Diseases 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 238000006198 methoxylation reaction Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 239000002855 microbicide agent Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 1
- YXAMTQAVAJACLQ-UHFFFAOYSA-N n-(3-nitropyridin-4-yl)acetamide Chemical compound CC(=O)NC1=CC=NC=C1[N+]([O-])=O YXAMTQAVAJACLQ-UHFFFAOYSA-N 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- SXGURHSLXPDJBC-UHFFFAOYSA-N n-(5-aminopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=N1 SXGURHSLXPDJBC-UHFFFAOYSA-N 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- PNFIBEYKHBFEQY-UHFFFAOYSA-N n-[4-(aminomethyl)cyclohexyl]acetamide Chemical compound CC(=O)NC1CCC(CN)CC1 PNFIBEYKHBFEQY-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 230000009826 neoplastic cell growth Effects 0.000 description 1
- 230000010309 neoplastic transformation Effects 0.000 description 1
- 238000011580 nude mouse model Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 231100000590 oncogenic Toxicity 0.000 description 1
- 230000002246 oncogenic effect Effects 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000005963 oxadiazolidinyl group Chemical group 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 102000051624 phosphatidylethanolamine binding protein Human genes 0.000 description 1
- 108700021017 phosphatidylethanolamine binding protein Proteins 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000004290 pyrazolidin-3-yl group Chemical group [H]N1N([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 1
- OHZYAOYVLLHTGW-UHFFFAOYSA-N pyrido[3,2-c]pyridazine Chemical class C1=CN=NC2=CC=CN=C21 OHZYAOYVLLHTGW-UHFFFAOYSA-N 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 231100000872 sexual dysfunction Toxicity 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical group COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000009492 tablet coating Methods 0.000 description 1
- 239000002700 tablet coating Substances 0.000 description 1
- GDZBFUOJMJSIAZ-UHFFFAOYSA-N tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)C(F)(F)C1 GDZBFUOJMJSIAZ-UHFFFAOYSA-N 0.000 description 1
- GTHTVZKGPZWUNC-UHFFFAOYSA-N tert-butyl N-[4-bromo-6-(bromomethyl)isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=CN=C(C2=CC=C(C=C12)CBr)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C GTHTVZKGPZWUNC-UHFFFAOYSA-N 0.000 description 1
- PZAWBCKXFKYMJV-UHFFFAOYSA-N tert-butyl N-[4-bromo-6-(bromomethyl)isoquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=C(N=CC2=CC=C(C=C12)CBr)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C PZAWBCKXFKYMJV-UHFFFAOYSA-N 0.000 description 1
- IKJXBKKJYQJCDA-UHFFFAOYSA-N tert-butyl N-[4-bromo-6-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]methyl]isoquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=C(N=CC2=CC=C(C=C12)CN1CCC(CC1)NC(=O)OC(C)(C)C)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C IKJXBKKJYQJCDA-UHFFFAOYSA-N 0.000 description 1
- VCDLRXGWXCSEPG-UHFFFAOYSA-N tert-butyl N-[6-(aminomethyl)-4-bromoisoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound NCC=1C=C2C(=CN=C(C2=CC=1)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C)Br VCDLRXGWXCSEPG-UHFFFAOYSA-N 0.000 description 1
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 1
- KCZFBLNQOSFGSH-UHFFFAOYSA-N tert-butyl n-(2-aminophenyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=CC=C1N KCZFBLNQOSFGSH-UHFFFAOYSA-N 0.000 description 1
- GPTXCAZYUMDUMN-UHFFFAOYSA-N tert-butyl n-(2-hydroxyethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCO GPTXCAZYUMDUMN-UHFFFAOYSA-N 0.000 description 1
- HMMYZMWDTDJTRR-UHFFFAOYSA-N tert-butyl n-[(4-aminocyclohexyl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1CCC(N)CC1 HMMYZMWDTDJTRR-UHFFFAOYSA-N 0.000 description 1
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000026683 transduction Effects 0.000 description 1
- 238000010361 transduction Methods 0.000 description 1
- 230000014621 translational initiation Effects 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 125000005310 triazolidinyl group Chemical group N1(NNCC1)* 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/06—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms having only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
- C07D237/28—Cinnolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
- C07D491/044—Ortho-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring
- C07D491/048—Ortho-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring the oxygen-containing ring being five-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP15154685.0 | 2015-02-11 | ||
| EP15154685 | 2015-02-11 | ||
| EP15197976 | 2015-12-04 | ||
| EP15197976.2 | 2015-12-04 | ||
| PCT/EP2016/052828 WO2016128465A1 (en) | 2015-02-11 | 2016-02-10 | Substituted mono- and polyazanaphthalene derivatives and their use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20170117479A true KR20170117479A (ko) | 2017-10-23 |
Family
ID=55345828
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020177025452A Withdrawn KR20170117479A (ko) | 2015-02-11 | 2016-02-10 | 치환된 모노- 및 폴리아자나프탈렌 유도체 및 이의 용도 |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US10487075B2 (enExample) |
| EP (1) | EP3256217A1 (enExample) |
| JP (1) | JP2018505207A (enExample) |
| KR (1) | KR20170117479A (enExample) |
| CN (1) | CN107428692A (enExample) |
| AU (1) | AU2016217874A1 (enExample) |
| BR (1) | BR112017017032A2 (enExample) |
| CA (1) | CA2974874A1 (enExample) |
| EA (1) | EA201791781A1 (enExample) |
| IL (1) | IL253656A0 (enExample) |
| MX (1) | MX2017010230A (enExample) |
| TW (1) | TW201636327A (enExample) |
| WO (1) | WO2016128465A1 (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2014100719A2 (en) | 2012-12-21 | 2014-06-26 | Epizyme, Inc. | Prmt5 inhibitors and uses thereof |
| CN106674085B (zh) * | 2016-12-20 | 2020-06-23 | 苏州汉德创宏生化科技有限公司 | N-1,3-二氟异丙基-4-氨基哌啶类化合物的合成方法 |
| CN108033909A (zh) * | 2017-12-20 | 2018-05-15 | 北京六合宁远科技有限公司 | 一种6-甲基-4-溴-异喹啉的制备方法 |
| CN108373443A (zh) * | 2018-05-25 | 2018-08-07 | 陈海鹏 | 一种含金刚烷取代基的吡啶类化合物及其在制备抗肿瘤药物中的用途 |
| CN108484489A (zh) * | 2018-05-25 | 2018-09-04 | 陈海鹏 | 一种含金刚烷取代基的吡啶类化合物及其在制备抗肿瘤药物中的用途 |
| CN108774167A (zh) * | 2018-05-25 | 2018-11-09 | 陈海鹏 | 一种含金刚烷取代基的吡啶类化合物及其在制备抗肿瘤药物中的用途 |
| CN110903286B (zh) * | 2019-12-16 | 2021-09-24 | 沈阳药科大学 | 4,6-双取代吡啶[3,2-d]嘧啶类化合物及其制备和应用 |
| US11753413B2 (en) | 2020-06-19 | 2023-09-12 | Incyte Corporation | Substituted pyrrolo[2,1-f][1,2,4]triazine compounds as JAK2 V617F inhibitors |
| US11691971B2 (en) | 2020-06-19 | 2023-07-04 | Incyte Corporation | Naphthyridinone compounds as JAK2 V617F inhibitors |
| SI4175719T1 (sl) | 2020-07-02 | 2025-07-31 | Incyte Corporation | Triciklične sečninske spojine kot zaviralci jak2 v617f |
| US11767323B2 (en) | 2020-07-02 | 2023-09-26 | Incyte Corporation | Tricyclic pyridone compounds as JAK2 V617F inhibitors |
| US20230339936A1 (en) * | 2020-07-23 | 2023-10-26 | Cytosinlab Therapeutics Co. Ltd. | Compound having kinase inhibitory activity |
| WO2022026380A1 (en) * | 2020-07-29 | 2022-02-03 | Board Of Regents, The University Of Texas System | Urea inhibitors of micro-rna |
| US11661422B2 (en) | 2020-08-27 | 2023-05-30 | Incyte Corporation | Tricyclic urea compounds as JAK2 V617F inhibitors |
| WO2022140231A1 (en) | 2020-12-21 | 2022-06-30 | Incyte Corporation | Deazaguaine compounds as jak2 v617f inhibitors |
| CN112876412B (zh) * | 2021-01-21 | 2022-05-24 | 温州大学 | 掺杂发光材料及其制备方法和应用 |
| US11958861B2 (en) | 2021-02-25 | 2024-04-16 | Incyte Corporation | Spirocyclic lactams as JAK2 V617F inhibitors |
| WO2023143344A1 (zh) * | 2022-01-30 | 2023-08-03 | 微境生物医药科技(上海)有限公司 | 新型egfr抑制剂 |
| US12084430B2 (en) | 2022-03-17 | 2024-09-10 | Incyte Corporation | Tricyclic urea compounds as JAK2 V617F inhibitors |
| WO2024079733A1 (en) * | 2022-10-12 | 2024-04-18 | Adama Makhteshim Ltd. | Process for the preparation of aminopyridazine derivatives |
| AR131541A1 (es) | 2023-01-07 | 2025-04-09 | Syngenta Crop Protection Ag | Compuestos de carboxamida novedosos |
| WO2025109114A1 (en) | 2023-11-24 | 2025-05-30 | Syngenta Crop Protection Ag | Novel carboxamide compounds |
| WO2025149637A1 (en) | 2024-01-12 | 2025-07-17 | Syngenta Crop Protection Ag | Novel carboxamide compounds |
| WO2025149629A1 (en) | 2024-01-12 | 2025-07-17 | Syngenta Crop Protection Ag | Novel carboxamide compounds |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK0584222T3 (da) | 1991-05-10 | 1998-02-23 | Rhone Poulenc Rorer Int | Bis-mono- og bicycliske aryl- og heteroarylforbindelser, som inhiberer EGF- og/eller PDGF-receptor-tyrosinkinase |
| US5451596A (en) | 1992-12-29 | 1995-09-19 | Rhone Poulenc Rorer Pharmaceuticals Inc. | Cycloalkyl amine bis-aryl squalene synthase inhibitors |
| MX226123B (es) | 1999-09-17 | 2005-02-07 | Millennium Pharm Inc | Benzamidas e inhibidores del factor xa relacionadas. |
| EP1217000A1 (en) | 2000-12-23 | 2002-06-26 | Aventis Pharma Deutschland GmbH | Inhibitors of factor Xa and factor VIIa |
| WO2004087153A2 (en) | 2003-03-28 | 2004-10-14 | Chiron Corporation | Use of organic compounds for immunopotentiation |
| PE20050952A1 (es) | 2003-09-24 | 2005-12-19 | Novartis Ag | Derivados de isoquinolina como inhibidores de b-raf |
| BRPI0514126A (pt) * | 2004-08-03 | 2008-05-27 | Serenex Inc | derivados de naftiridina 2,8-dissubstituìdos |
| JP2009528365A (ja) * | 2006-02-28 | 2009-08-06 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン及びキナゾリン誘導体 |
| US20090099175A1 (en) * | 2006-03-01 | 2009-04-16 | Arrington Mark P | Phosphodiesterase 10 inhibitors |
| MX2008011257A (es) | 2006-03-08 | 2008-09-25 | Amgen Inc | Derivados de quinolina e isoquinolina como inhibidores de fosfodiesterasa 10. |
| WO2009025823A1 (en) * | 2007-08-21 | 2009-02-26 | Amgen Inc. | Phosphodiesterase 10 inhibitors |
| WO2010101949A1 (en) | 2009-03-02 | 2010-09-10 | Sirtris Pharmaceuticals, Inc. | 8-substituted quinolines and related analogs as sirtuin modulators |
| GB0905441D0 (en) | 2009-03-30 | 2009-05-13 | Syngenta Ltd | Herbicidal compounds |
| BRPI1013988A2 (pt) * | 2009-04-06 | 2016-04-05 | Daiichi Sankyo Co Ltd | composto, composição farmacêutica , e, uso de um composto ou um sal farmacologicamente aceitável do mesmo |
| TW201116281A (en) * | 2009-08-06 | 2011-05-16 | Astellas Pharma Inc | N atom containing ring acylguanidine derivatives |
| TW201311149A (zh) * | 2011-06-24 | 2013-03-16 | Ishihara Sangyo Kaisha | 有害生物防治劑 |
| WO2013142390A1 (en) * | 2012-03-21 | 2013-09-26 | Gtx, Inc. | Aldo-keto reductase subfamily 1c3 (akr1c3) inhibitors |
| AR093519A1 (es) * | 2012-11-20 | 2015-06-10 | Hoffmann La Roche | 1,6-naftiridinas sustituidas |
| TWI647220B (zh) | 2013-03-15 | 2019-01-11 | 美商西建卡爾有限責任公司 | 雜芳基化合物及其用途 |
| RU2673549C2 (ru) | 2013-05-03 | 2018-11-28 | Ф. Хоффманн-Ля Рош Аг | Производные изохинолина, стимулирующие нейрогенез |
| RU2685234C1 (ru) | 2013-12-09 | 2019-04-17 | Юсб Байофарма Спрл | Конденсированные бициклические гетероароматические производные в качестве модуляторов активности tnf |
| EP3169678A1 (en) | 2014-07-17 | 2017-05-24 | Merck Patent GmbH | Novel naphthryidines and isoquinolines and their use as cdk8/19 inhibitors |
| WO2018119263A1 (en) | 2016-12-22 | 2018-06-28 | Incyte Corporation | Heterocyclic compounds derivatives as pd-l1 internalization inducers |
-
2016
- 2016-02-10 EP EP16703791.0A patent/EP3256217A1/en not_active Withdrawn
- 2016-02-10 US US15/545,149 patent/US10487075B2/en not_active Expired - Fee Related
- 2016-02-10 WO PCT/EP2016/052828 patent/WO2016128465A1/en not_active Ceased
- 2016-02-10 BR BR112017017032A patent/BR112017017032A2/pt not_active Application Discontinuation
- 2016-02-10 MX MX2017010230A patent/MX2017010230A/es unknown
- 2016-02-10 CN CN201680009637.4A patent/CN107428692A/zh active Pending
- 2016-02-10 KR KR1020177025452A patent/KR20170117479A/ko not_active Withdrawn
- 2016-02-10 EA EA201791781A patent/EA201791781A1/ru unknown
- 2016-02-10 AU AU2016217874A patent/AU2016217874A1/en not_active Abandoned
- 2016-02-10 CA CA2974874A patent/CA2974874A1/en not_active Abandoned
- 2016-02-10 JP JP2017542888A patent/JP2018505207A/ja not_active Ceased
- 2016-02-15 TW TW105104357A patent/TW201636327A/zh unknown
-
2017
- 2017-07-25 IL IL253656A patent/IL253656A0/en unknown
-
2019
- 2019-10-04 US US16/593,231 patent/US20200031811A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| BR112017017032A2 (pt) | 2018-04-10 |
| TW201636327A (zh) | 2016-10-16 |
| JP2018505207A (ja) | 2018-02-22 |
| CN107428692A (zh) | 2017-12-01 |
| MX2017010230A (es) | 2017-12-04 |
| US10487075B2 (en) | 2019-11-26 |
| IL253656A0 (en) | 2017-09-28 |
| US20200031811A1 (en) | 2020-01-30 |
| AU2016217874A1 (en) | 2017-08-10 |
| EA201791781A1 (ru) | 2018-02-28 |
| EP3256217A1 (en) | 2017-12-20 |
| WO2016128465A1 (en) | 2016-08-18 |
| US20180002321A1 (en) | 2018-01-04 |
| CA2974874A1 (en) | 2016-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20170117479A (ko) | 치환된 모노- 및 폴리아자나프탈렌 유도체 및 이의 용도 | |
| AU2015289643B2 (en) | Therapeutic inhibitory compounds | |
| TWI532483B (zh) | 喹啉衍生物及含此衍生物之melk抑制劑 | |
| KR102476459B1 (ko) | 리신 특이적 데메틸라제-1의 억제제 | |
| KR101538179B1 (ko) | 수용체 티로신 키나제 억제제로서의 이미다조[1,2-a]피리딘 화합물 | |
| TWI481601B (zh) | 含氮化合物及藥學組成物 | |
| JP2012531438A (ja) | 複素環式化合物およびその使用 | |
| CN107074812B (zh) | 取代的嘧啶化合物 | |
| KR20200036004A (ko) | Jak 키나아제 억제제로서 피라졸로 및 트리아졸로 비시클릭 화합물 | |
| WO2021003314A1 (en) | Heterocyclic compounds as kinase inhibitors | |
| CN115515589A (zh) | Ulk1/2抑制剂及其使用方法 | |
| CA2709314A1 (en) | 5-alkyl/alkenyl-3-cyanopyridines as kinase inhibitors | |
| US20220388962A1 (en) | Molecules that bind to tdp-43 for the treatment of amyotrophic lateral sclerosis and related disorders | |
| EP1655297A1 (en) | Nicotinamide pyridinureas as vascular endothelial growth factor (VEGF) receptor kinase inhibitors | |
| WO2017108204A1 (en) | Novel substituted spiro-[indoline heterocycloalkane] compounds as phosphodiesterase inhibitors | |
| CN113121524A (zh) | 杂环亚砜亚胺化合物及其中间体、制备方法和应用 | |
| CN120957978A (zh) | 作为pkmyt1激酶抑制剂的吲唑化合物 | |
| TW202444351A (zh) | 聯芳基衍生物及相關用途 | |
| EA048523B1 (ru) | Пиримидиновые соединения для применения в качестве ингибиторов map4k1 | |
| HK40049426A (en) | Heterocyclic sulfoximine compound and intermediate thereof, preparation method therefor, and application thereof | |
| WO2018234353A1 (en) | Novel substituted indole and indazole compounds as phosphodiesterase inhibitors | |
| HK1241705A1 (zh) | 治疗性抑制化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20170908 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PC1203 | Withdrawal of no request for examination |