JPWO2018069842A5 - - Google Patents
Download PDFInfo
- Publication number
- JPWO2018069842A5 JPWO2018069842A5 JP2019541895A JP2019541895A JPWO2018069842A5 JP WO2018069842 A5 JPWO2018069842 A5 JP WO2018069842A5 JP 2019541895 A JP2019541895 A JP 2019541895A JP 2019541895 A JP2019541895 A JP 2019541895A JP WO2018069842 A5 JPWO2018069842 A5 JP WO2018069842A5
- Authority
- JP
- Japan
- Prior art keywords
- ethyl
- amino
- phenyl
- methylformimideamide
- serial number
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 C1-6 -haloalkylthio Chemical group 0.000 claims description 248
- 241000196324 Embryophyta Species 0.000 claims description 232
- 150000001875 compounds Chemical class 0.000 claims description 211
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 124
- 239000000203 mixture Substances 0.000 claims description 113
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 69
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 62
- 229910052717 sulfur Inorganic materials 0.000 claims description 54
- 239000001257 hydrogen Substances 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 229910052760 oxygen Inorganic materials 0.000 claims description 39
- 150000001408 amides Chemical class 0.000 claims description 38
- 125000004429 atoms Chemical group 0.000 claims description 37
- 235000013399 edible fruits Nutrition 0.000 claims description 37
- 229910052757 nitrogen Inorganic materials 0.000 claims description 37
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 34
- 229910052799 carbon Inorganic materials 0.000 claims description 34
- 244000005700 microbiome Species 0.000 claims description 34
- 241000233866 Fungi Species 0.000 claims description 29
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 26
- 230000003032 phytopathogenic Effects 0.000 claims description 26
- 239000000126 substance Substances 0.000 claims description 25
- 125000005842 heteroatoms Chemical group 0.000 claims description 23
- 125000004122 cyclic group Chemical group 0.000 claims description 22
- 125000004641 (C1-C12) haloalkyl group Chemical group 0.000 claims description 20
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 19
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 18
- 230000001276 controlling effect Effects 0.000 claims description 18
- 125000001424 substituent group Chemical group 0.000 claims description 18
- 240000007594 Oryza sativa Species 0.000 claims description 16
- 235000007164 Oryza sativa Nutrition 0.000 claims description 16
- 235000009566 rice Nutrition 0.000 claims description 16
- 239000011780 sodium chloride Substances 0.000 claims description 16
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- 235000007688 Lycopersicon esculentum Nutrition 0.000 claims description 14
- 235000013339 cereals Nutrition 0.000 claims description 14
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 claims description 12
- 125000006625 (C3-C8) cycloalkyloxy group Chemical group 0.000 claims description 11
- 239000000969 carrier Substances 0.000 claims description 11
- 230000002363 herbicidal Effects 0.000 claims description 11
- 125000004643 (C1-C12) haloalkoxy group Chemical group 0.000 claims description 10
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 10
- 241000238631 Hexapoda Species 0.000 claims description 10
- 241000244206 Nematoda Species 0.000 claims description 10
- 230000000855 fungicidal Effects 0.000 claims description 10
- 239000000417 fungicide Substances 0.000 claims description 10
- 239000004009 herbicide Substances 0.000 claims description 10
- 239000005871 repellent Substances 0.000 claims description 10
- 230000002940 repellent Effects 0.000 claims description 10
- 244000045561 useful plants Species 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 8
- 241000894006 Bacteria Species 0.000 claims description 8
- ZTQBHLJFTXXKAA-UHFFFAOYSA-N O=S(=O)NCC1=CC=CC=C1 Chemical compound O=S(=O)NCC1=CC=CC=C1 ZTQBHLJFTXXKAA-UHFFFAOYSA-N 0.000 claims description 8
- 240000008042 Zea mays Species 0.000 claims description 8
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 8
- 230000000749 insecticidal Effects 0.000 claims description 8
- 229920000742 Cotton Polymers 0.000 claims description 7
- 235000010469 Glycine max Nutrition 0.000 claims description 7
- 240000007842 Glycine max Species 0.000 claims description 7
- 150000001204 N-oxides Chemical class 0.000 claims description 7
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims description 7
- 240000008962 Nicotiana tabacum Species 0.000 claims description 7
- 235000020971 citrus fruits Nutrition 0.000 claims description 7
- 239000002917 insecticide Substances 0.000 claims description 7
- 241000238876 Acari Species 0.000 claims description 6
- GNNMYBXYNZJGKO-UHFFFAOYSA-N ClC=1C=C(C=CC=1)N(C1=C(C=C(C(=C1)C)N=CN1CCOCC1)C)C Chemical compound ClC=1C=C(C=CC=1)N(C1=C(C=C(C(=C1)C)N=CN1CCOCC1)C)C GNNMYBXYNZJGKO-UHFFFAOYSA-N 0.000 claims description 6
- 240000007154 Coffea arabica Species 0.000 claims description 6
- 240000000111 Saccharum officinarum Species 0.000 claims description 6
- 235000007201 Saccharum officinarum Nutrition 0.000 claims description 6
- 240000003768 Solanum lycopersicum Species 0.000 claims description 6
- 235000016213 coffee Nutrition 0.000 claims description 6
- 235000013353 coffee beverage Nutrition 0.000 claims description 6
- 239000003337 fertilizer Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 6
- 125000001624 naphthyl group Chemical group 0.000 claims description 6
- 239000005645 nematicide Substances 0.000 claims description 6
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 6
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 6
- 125000000335 thiazolyl group Chemical group 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 5
- 240000002840 Allium cepa Species 0.000 claims description 5
- 241000207199 Citrus Species 0.000 claims description 5
- XFWZWNDTUPRMTO-UHFFFAOYSA-N ClC=1C(=CC(=C(N(C)C2=C(C=CC=C2)F)C=1)C)N=CN1CCOCC1 Chemical compound ClC=1C(=CC(=C(N(C)C2=C(C=CC=C2)F)C=1)C)N=CN1CCOCC1 XFWZWNDTUPRMTO-UHFFFAOYSA-N 0.000 claims description 5
- ARMAWOZYLJULEI-UHFFFAOYSA-N ClC=1C=C(C=CC=1)N(C1=C(C=C(C(=C1)C)N=CN1CCCCC1)C)C Chemical compound ClC=1C=C(C=CC=1)N(C1=C(C=C(C(=C1)C)N=CN1CCCCC1)C)C ARMAWOZYLJULEI-UHFFFAOYSA-N 0.000 claims description 5
- 235000002595 Solanum tuberosum Nutrition 0.000 claims description 5
- 240000001016 Solanum tuberosum Species 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 235000002732 oignon Nutrition 0.000 claims description 5
- 239000005648 plant growth regulator Substances 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 125000006652 (C3-C12) cycloalkyl group Chemical group 0.000 claims description 4
- 235000002566 Capsicum Nutrition 0.000 claims description 4
- 241000758706 Piperaceae Species 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 239000003242 anti bacterial agent Substances 0.000 claims description 4
- 235000005822 corn Nutrition 0.000 claims description 4
- 235000005824 corn Nutrition 0.000 claims description 4
- 201000009910 diseases by infectious agent Diseases 0.000 claims description 4
- 239000002184 metal Chemical class 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 125000002971 oxazolyl group Chemical group 0.000 claims description 4
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 3
- WJTBKCCSIUYAST-UHFFFAOYSA-N CCN(C)C=NC1=CC(C)=C(C=C1C)N(C(C)=O)C1=CC=CC=C1 Chemical compound CCN(C)C=NC1=CC(C)=C(C=C1C)N(C(C)=O)C1=CC=CC=C1 WJTBKCCSIUYAST-UHFFFAOYSA-N 0.000 claims description 3
- VQYCJTDLYFQHDJ-UHFFFAOYSA-N CCN(C)C=NC1=CC(C)=C(C=C1Cl)N(C(=O)CC)C1=CC=CC=C1 Chemical compound CCN(C)C=NC1=CC(C)=C(C=C1Cl)N(C(=O)CC)C1=CC=CC=C1 VQYCJTDLYFQHDJ-UHFFFAOYSA-N 0.000 claims description 3
- XTGXKSYFWJAIFF-UHFFFAOYSA-N ClC=1C(=CC(=C(C=1)N(C(C)=O)C1=CC=CC=C1)C)N=CN(C)CC Chemical compound ClC=1C(=CC(=C(C=1)N(C(C)=O)C1=CC=CC=C1)C)N=CN(C)CC XTGXKSYFWJAIFF-UHFFFAOYSA-N 0.000 claims description 3
- AXOYPONQSPUQKG-UHFFFAOYSA-N ClC=1C(=CC(=C(N(C)C2=C(C=CC=C2)F)C=1)C)N=CN1CCSCC1 Chemical compound ClC=1C(=CC(=C(N(C)C2=C(C=CC=C2)F)C=1)C)N=CN1CCSCC1 AXOYPONQSPUQKG-UHFFFAOYSA-N 0.000 claims description 3
- NNDHCURZZWRJGJ-UHFFFAOYSA-N O=S(=O)NCCC1=CC=CC=C1 Chemical compound O=S(=O)NCCC1=CC=CC=C1 NNDHCURZZWRJGJ-UHFFFAOYSA-N 0.000 claims description 3
- 240000000280 Theobroma cacao Species 0.000 claims description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000002619 bicyclic group Chemical group 0.000 claims description 3
- 230000003115 biocidal Effects 0.000 claims description 3
- 230000000853 biopesticidal Effects 0.000 claims description 3
- 235000005764 cacao Nutrition 0.000 claims description 3
- 235000005767 cacao Nutrition 0.000 claims description 3
- 235000001046 cacaotero Nutrition 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 3
- 235000021374 legumes Nutrition 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 3
- 235000013616 tea Nutrition 0.000 claims description 3
- 125000004306 triazinyl group Chemical group 0.000 claims description 3
- 125000001425 triazolyl group Chemical group 0.000 claims description 3
- FXQXTHICPBZFHD-UHFFFAOYSA-N CC1=C(C=C(C(=C1)NC1=CC=2CCCC(C=2C=C1)=O)C)N=CN(C)CC Chemical compound CC1=C(C=C(C(=C1)NC1=CC=2CCCC(C=2C=C1)=O)C)N=CN(C)CC FXQXTHICPBZFHD-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000232 haloalkynyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atoms Chemical class [H]* 0.000 claims 12
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 claims 1
- 240000006962 Gossypium hirsutum Species 0.000 claims 1
- 244000269722 Thea sinensis Species 0.000 claims 1
- 125000006574 non-aromatic ring group Chemical group 0.000 claims 1
- 241000894007 species Species 0.000 description 119
- 238000006243 chemical reaction Methods 0.000 description 87
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N DMSO-d6 Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 60
- 238000002360 preparation method Methods 0.000 description 58
- 239000000243 solution Substances 0.000 description 54
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 51
- 201000010099 disease Diseases 0.000 description 44
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 37
- 238000005160 1H NMR spectroscopy Methods 0.000 description 35
- 239000004480 active ingredient Substances 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- 230000012010 growth Effects 0.000 description 29
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical class CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 28
- 239000000463 material Substances 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 27
- 239000011345 viscous material Substances 0.000 description 27
- 230000002401 inhibitory effect Effects 0.000 description 26
- LIWAQLJGPBVORC-UHFFFAOYSA-N Ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 25
- 239000003039 volatile agent Substances 0.000 description 25
- 150000002431 hydrogen Chemical class 0.000 description 24
- 230000003197 catalytic Effects 0.000 description 22
- 238000003818 flash chromatography Methods 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 22
- 239000000843 powder Substances 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 239000003112 inhibitor Substances 0.000 description 21
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 21
- 239000012299 nitrogen atmosphere Substances 0.000 description 21
- 239000007921 spray Substances 0.000 description 21
- JOXIMZWYDAKGHI-UHFFFAOYSA-N P-Toluenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 19
- 239000003630 growth substance Substances 0.000 description 19
- 238000002953 preparative HPLC Methods 0.000 description 18
- 238000003359 percent control normalization Methods 0.000 description 16
- 230000004224 protection Effects 0.000 description 16
- 241000228437 Cochliobolus Species 0.000 description 15
- 241000223221 Fusarium oxysporum Species 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 230000001965 increased Effects 0.000 description 14
- 239000002609 media Substances 0.000 description 14
- 239000000575 pesticide Substances 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 14
- 241000607479 Yersinia pestis Species 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- 230000000576 supplementary Effects 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- PYOKUURKVVELLB-UHFFFAOYSA-N Trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 12
- 230000002633 protecting Effects 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- 125000006269 biphenyl-2-yl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C(*)C([H])=C([H])C([H])=C1[H] 0.000 description 11
- 238000003306 harvesting Methods 0.000 description 11
- 239000008079 hexane Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 10
- 241000227653 Lycopersicon Species 0.000 description 10
- 240000008529 Triticum aestivum Species 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000002270 dispersing agent Substances 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 229910052742 iron Inorganic materials 0.000 description 10
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 10
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 235000011152 sodium sulphate Nutrition 0.000 description 10
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 238000010353 genetic engineering Methods 0.000 description 9
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 9
- 230000002829 reduced Effects 0.000 description 9
- 239000002689 soil Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 235000021307 wheat Nutrition 0.000 description 9
- 239000002023 wood Substances 0.000 description 9
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 8
- 241001533598 Septoria Species 0.000 description 8
- 239000008199 coating composition Substances 0.000 description 8
- 230000018109 developmental process Effects 0.000 description 8
- 150000002170 ethers Chemical class 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 238000005507 spraying Methods 0.000 description 8
- 238000003860 storage Methods 0.000 description 8
- 238000006467 substitution reaction Methods 0.000 description 8
- 230000002588 toxic Effects 0.000 description 8
- 231100000331 toxic Toxicity 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 7
- 241000228212 Aspergillus Species 0.000 description 7
- 240000002791 Brassica napus Species 0.000 description 7
- 230000036579 abiotic stress Effects 0.000 description 7
- 150000001448 anilines Chemical class 0.000 description 7
- 239000004067 bulking agent Substances 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 7
- 230000002068 genetic Effects 0.000 description 7
- 230000035784 germination Effects 0.000 description 7
- 230000001969 hypertrophic Effects 0.000 description 7
- 230000000051 modifying Effects 0.000 description 7
- DFPAKSUCGFBDDF-UHFFFAOYSA-N nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 239000001965 potato dextrose agar Substances 0.000 description 7
- 238000007711 solidification Methods 0.000 description 7
- 230000035882 stress Effects 0.000 description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 7
- 239000011593 sulfur Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 7
- 230000001131 transforming Effects 0.000 description 7
- XTDZGXBTXBEZDN-UHFFFAOYSA-N 3-(difluoromethyl)-N-(9-isopropyl-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl)-1-methylpyrazole-4-carboxamide Chemical compound CC(C)C1C2CCC1C1=C2C=CC=C1NC(=O)C1=CN(C)N=C1C(F)F XTDZGXBTXBEZDN-UHFFFAOYSA-N 0.000 description 6
- 241000193388 Bacillus thuringiensis Species 0.000 description 6
- 241000223218 Fusarium Species 0.000 description 6
- 241000219146 Gossypium Species 0.000 description 6
- 239000005799 Isopyrazam Substances 0.000 description 6
- 102000019315 Nicotinic acetylcholine receptors Human genes 0.000 description 6
- 108050006807 Nicotinic acetylcholine receptors Proteins 0.000 description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 6
- 239000000853 adhesive Substances 0.000 description 6
- 230000001070 adhesive Effects 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 239000003995 emulsifying agent Substances 0.000 description 6
- 230000002538 fungal Effects 0.000 description 6
- 125000001475 halogen functional group Chemical group 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- QDHHCQZDFGDHMP-UHFFFAOYSA-N monochloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 6
- 230000035772 mutation Effects 0.000 description 6
- 235000015097 nutrients Nutrition 0.000 description 6
- 230000000885 phytotoxic Effects 0.000 description 6
- 239000000049 pigment Substances 0.000 description 6
- 230000005070 ripening Effects 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 5
- 241000223600 Alternaria Species 0.000 description 5
- 241000213004 Alternaria solani Species 0.000 description 5
- 229940097012 Bacillus thuringiensis Drugs 0.000 description 5
- 235000016068 Berberis vulgaris Nutrition 0.000 description 5
- 241000335053 Beta vulgaris Species 0.000 description 5
- 241001465180 Botrytis Species 0.000 description 5
- 239000005944 Chlorpyrifos Substances 0.000 description 5
- SBPBAQFWLVIOKP-UHFFFAOYSA-N Chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 5
- 239000005946 Cypermethrin Substances 0.000 description 5
- 231100000674 Phytotoxicity Toxicity 0.000 description 5
- 235000007238 Secale cereale Nutrition 0.000 description 5
- 240000002057 Secale cereale Species 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 125000000129 anionic group Chemical group 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 230000001488 breeding Effects 0.000 description 5
- 230000022534 cell killing Effects 0.000 description 5
- 230000009089 cytolysis Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 230000002438 mitochondrial Effects 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000006011 modification reaction Methods 0.000 description 5
- 230000017074 necrotic cell death Effects 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 5
- 239000000123 paper Substances 0.000 description 5
- 230000003449 preventive Effects 0.000 description 5
- 235000018102 proteins Nutrition 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 210000004215 spores Anatomy 0.000 description 5
- 235000013311 vegetables Nutrition 0.000 description 5
- BTANRVKWQNVYAZ-UHFFFAOYSA-N 2-Butanol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 4
- VZTDIZULWFCMLS-UHFFFAOYSA-N Ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 4
- 241000228197 Aspergillus flavus Species 0.000 description 4
- 241000193830 Bacillus <bacterium> Species 0.000 description 4
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N Chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- KAATUXNTWXVJKI-UHFFFAOYSA-N Cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 241000228143 Penicillium Species 0.000 description 4
- 241001123663 Penicillium expansum Species 0.000 description 4
- 241000233639 Pythium Species 0.000 description 4
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000004414 alkyl thio group Chemical group 0.000 description 4
- 230000004075 alteration Effects 0.000 description 4
- 230000037348 biosynthesis Effects 0.000 description 4
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 4
- 229910052796 boron Inorganic materials 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 125000001188 haloalkyl group Chemical group 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 125000001072 heteroaryl group Chemical group 0.000 description 4
- 239000010985 leather Substances 0.000 description 4
- 235000009973 maize Nutrition 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 4
- 230000000813 microbial Effects 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 230000002335 preservative Effects 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 230000001603 reducing Effects 0.000 description 4
- 230000027756 respiratory electron transport chain Effects 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000002562 thickening agent Substances 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- KAATUXNTWXVJKI-NSHGMRRFSA-N (1R)-cis-(alphaS)-cypermethrin Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-NSHGMRRFSA-N 0.000 description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 3
- 125000004361 3,4,5-trifluorophenyl group Chemical group [H]C1=C(F)C(F)=C(F)C([H])=C1* 0.000 description 3
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 3
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- 235000007558 Avena sp Nutrition 0.000 description 3
- 241000123650 Botrytis cinerea Species 0.000 description 3
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 3
- 240000006906 Brassica oleracea var. capitata Species 0.000 description 3
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 3
- 241001535157 Cynodon <characin> Species 0.000 description 3
- RFHAOTPXVQNOHP-UHFFFAOYSA-N Fluconazole Chemical compound C1=NC=NN1CC(C=1C(=CC(F)=CC=1)F)(O)CN1C=NC=N1 RFHAOTPXVQNOHP-UHFFFAOYSA-N 0.000 description 3
- 235000003222 Helianthus annuus Nutrition 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 241000207783 Ipomoea Species 0.000 description 3
- 241001495426 Macrophomina phaseolina Species 0.000 description 3
- 241001330975 Magnaporthe oryzae Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 231100000678 Mycotoxin Toxicity 0.000 description 3
- 241000745991 Phalaris Species 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 240000005158 Phaseolus vulgaris Species 0.000 description 3
- 241000221300 Puccinia Species 0.000 description 3
- 241000813090 Rhizoctonia solani Species 0.000 description 3
- 241000221662 Sclerotinia Species 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 230000000844 anti-bacterial Effects 0.000 description 3
- 244000052616 bacterial pathogens Species 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 230000000875 corresponding Effects 0.000 description 3
- 229960005424 cypermethrin Drugs 0.000 description 3
- 230000035613 defoliation Effects 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000002708 enhancing Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229960004884 fluconazole Drugs 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 239000002054 inoculum Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000035800 maturation Effects 0.000 description 3
- RLXWGEUQYNIHRM-UHFFFAOYSA-N methanetriolate Chemical compound [O-]C([O-])[O-] RLXWGEUQYNIHRM-UHFFFAOYSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 239000002636 mycotoxin Substances 0.000 description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical Effects 0.000 description 3
- 230000001717 pathogenic Effects 0.000 description 3
- 244000052769 pathogens Species 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- 230000001681 protective Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 239000011435 rock Substances 0.000 description 3
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Chemical compound [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 230000000007 visual effect Effects 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- CXBMCYHAMVGWJQ-CABCVRRESA-N (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCN1C(=O)C(CCCC2)=C2C1=O CXBMCYHAMVGWJQ-CABCVRRESA-N 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N 1-[(1S,2R,3R,4S,5R,6R)-3-carbamimidamido-6-{[(2R,3R,4R,5S)-3-{[(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(methylamino)oxan-2-yl]oxy}-4-formyl-4-hydroxy-5-methyloxolan-2-yl]oxy}-2,4,5-trihydroxycyclohexyl]guanidine Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 125000006426 1-chlorocyclopropyl group Chemical group [H]C1([H])C([H])([H])C1(Cl)* 0.000 description 2
- HILAYQUKKYWPJW-UHFFFAOYSA-N 1-dodecylguanidine Chemical compound CCCCCCCCCCCCN=C(N)N HILAYQUKKYWPJW-UHFFFAOYSA-N 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- VOWZNBNDMFLQGM-UHFFFAOYSA-N 2,5-Xylidine Chemical compound CC1=CC=C(C)C(N)=C1 VOWZNBNDMFLQGM-UHFFFAOYSA-N 0.000 description 2
- JYVLIDXNZAXMDK-UHFFFAOYSA-N 2-Pentanol Chemical compound CCCC(C)O JYVLIDXNZAXMDK-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- PDPWCKVFIFAQIQ-UHFFFAOYSA-N 2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-methoxy-N-methylacetamide Chemical compound CNC(=O)C(OC)C1=CC=CC=C1COC1=CC(C)=CC=C1C PDPWCKVFIFAQIQ-UHFFFAOYSA-N 0.000 description 2
- 239000005660 Abamectin Substances 0.000 description 2
- 102000012440 Acetylcholinesterase Human genes 0.000 description 2
- 229940022698 Acetylcholinesterase Drugs 0.000 description 2
- 108010022752 Acetylcholinesterase Proteins 0.000 description 2
- 241000748223 Alisma Species 0.000 description 2
- 229940064005 Antibiotic throat preparations Drugs 0.000 description 2
- 229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 description 2
- 229940042052 Antibiotics for systemic use Drugs 0.000 description 2
- 229940042786 Antitubercular Antibiotics Drugs 0.000 description 2
- 241000235349 Ascomycota Species 0.000 description 2
- 241000228257 Aspergillus sp. Species 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N BINAP Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- 241000221198 Basidiomycota Species 0.000 description 2
- 239000002028 Biomass Substances 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000011299 Brassica oleracea var botrytis Nutrition 0.000 description 2
- 240000003259 Brassica oleracea var. botrytis Species 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N Bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L Caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 241001468265 Candidatus Phytoplasma Species 0.000 description 2
- DJHJJVWPFGHIPH-OODMECLYSA-N Chitin Chemical compound O[C@@H]1C(NC(=O)C)[C@H](O)OC(CO)[C@H]1COC[C@H]1C(NC(C)=O)[C@@H](O)[C@H](COC[C@H]2C([C@@H](O)[C@H](O)C(CO)O2)NC(C)=O)C(CO)O1 DJHJJVWPFGHIPH-OODMECLYSA-N 0.000 description 2
- 229920002101 Chitin Polymers 0.000 description 2
- 102000011045 Chloride Channels Human genes 0.000 description 2
- 108010062745 Chloride Channels Proteins 0.000 description 2
- NONAQOOLHZLBRA-UHFFFAOYSA-N ClC=1C(=CC(=C(C=1)N(S(=O)(=O)C)C1=CC=CC=C1)C)N=CN(C)CC Chemical compound ClC=1C(=CC(=C(C=1)N(S(=O)(=O)C)C1=CC=CC=C1)C)N=CN(C)CC NONAQOOLHZLBRA-UHFFFAOYSA-N 0.000 description 2
- 241000222290 Cladosporium Species 0.000 description 2
- 241001600093 Coniophora Species 0.000 description 2
- 241001365101 Corica Species 0.000 description 2
- 241000195493 Cryptophyta Species 0.000 description 2
- 229960003887 Dichlorophen Drugs 0.000 description 2
- MDNWOSOZYLHTCG-UHFFFAOYSA-N Dichlorophene Chemical compound OC1=CC=C(Cl)C=C1CC1=CC(Cl)=CC=C1O MDNWOSOZYLHTCG-UHFFFAOYSA-N 0.000 description 2
- OEBRKCOSUFCWJD-UHFFFAOYSA-N Dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 239000005766 Dodine Substances 0.000 description 2
- 102000015782 Electron Transport Complex III Human genes 0.000 description 2
- 108010024882 Electron Transport Complex III Proteins 0.000 description 2
- 241001221090 Eriophyoidea Species 0.000 description 2
- 241000221787 Erysiphe Species 0.000 description 2
- 239000005900 Flonicamid Substances 0.000 description 2
- 241000223194 Fusarium culmorum Species 0.000 description 2
- 241000223195 Fusarium graminearum Species 0.000 description 2
- 241001208371 Fusarium incarnatum Species 0.000 description 2
- 241001451172 Fusarium pseudograminearum Species 0.000 description 2
- 241000145502 Fusarium subglutinans Species 0.000 description 2
- 241000879141 Fusarium tricinctum Species 0.000 description 2
- 241001101998 Galium Species 0.000 description 2
- 241000222336 Ganoderma Species 0.000 description 2
- 229940093922 Gynecological Antibiotics Drugs 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 210000004209 Hair Anatomy 0.000 description 2
- 240000006669 Helianthus annuus Species 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 235000003228 Lactuca sativa Nutrition 0.000 description 2
- 241000222418 Lentinus Species 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N Methyl iodide Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 241000237852 Mollusca Species 0.000 description 2
- 241000131448 Mycosphaerella Species 0.000 description 2
- VBEGHXKAFSLLGE-UHFFFAOYSA-N N-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 2
- KYGZCKSPAKDVKC-UHFFFAOYSA-N Nidantin Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC2=C1OCO2 KYGZCKSPAKDVKC-UHFFFAOYSA-N 0.000 description 2
- 241000144610 Oculimacula acuformis Species 0.000 description 2
- 241000238814 Orthoptera Species 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L Palladium(II) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 241000228153 Penicillium citrinum Species 0.000 description 2
- 241000864266 Penicillium verrucosum Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000233614 Phytophthora Species 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- 240000004713 Pisum sativum Species 0.000 description 2
- 241000233626 Plasmopara Species 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- 241000896242 Podosphaera Species 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N Propanamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 108010009736 Protein Hydrolysates Proteins 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- 241000589615 Pseudomonas syringae Species 0.000 description 2
- 241000232299 Ralstonia Species 0.000 description 2
- 235000005733 Raphanus sativus var niger Nutrition 0.000 description 2
- 240000003799 Raphanus sativus var. niger Species 0.000 description 2
- JUVIOZPCNVVQFO-HBGVWJBISA-N Rotenone Natural products O([C@H](CC1=C2O3)C(C)=C)C1=CC=C2C(=O)[C@@H]1[C@H]3COC2=C1C=C(OC)C(OC)=C2 JUVIOZPCNVVQFO-HBGVWJBISA-N 0.000 description 2
- 241000235070 Saccharomyces Species 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 241000800294 Sarocladium oryzae Species 0.000 description 2
- 206010039509 Scab Diseases 0.000 description 2
- 241000221696 Sclerotinia sclerotiorum Species 0.000 description 2
- 235000002597 Solanum melongena Nutrition 0.000 description 2
- 240000002686 Solanum melongena Species 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- VGGSULWDCMWZPO-ODEMIOGVSA-N Spinosin Natural products O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1C1=C(O)C=2C(=O)C=C(OC=2C=C1OC)C=1C=CC(O)=CC=1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O VGGSULWDCMWZPO-ODEMIOGVSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N Tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- 241001122767 Theaceae Species 0.000 description 2
- 241000722133 Tilletia Species 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L Tin(II) chloride Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- 229940024982 Topical Antifungal Antibiotics Drugs 0.000 description 2
- 241000223259 Trichoderma Species 0.000 description 2
- 241000905623 Venturia oleaginea Species 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- LINOMUASTDIRTM-LZTLOYDTSA-N Vomitoxin Chemical compound C([C@]12[C@@]3(C[C@@H](O)[C@H]1O[C@@H]1C=C(C([C@@H](O)[C@@]13CO)=O)C)C)O2 LINOMUASTDIRTM-LZTLOYDTSA-N 0.000 description 2
- 241000589636 Xanthomonas campestris Species 0.000 description 2
- KAATUXNTWXVJKI-HBFSDRIKSA-N [(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-HBFSDRIKSA-N 0.000 description 2
- 230000000895 acaricidal Effects 0.000 description 2
- 239000000642 acaricide Substances 0.000 description 2
- 239000005409 aflatoxin Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 230000003281 allosteric Effects 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000001195 anabolic Effects 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 230000000843 anti-fungal Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 235000021028 berry Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 150000003857 carboxamides Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 235000019804 chlorophyll Nutrition 0.000 description 2
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 2
- 229930002875 chlorophylls Natural products 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 229910052570 clay Inorganic materials 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 229910052803 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000005068 cooling lubricant Substances 0.000 description 2
- 229940120693 copper naphthenate Drugs 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000004042 decolorization Methods 0.000 description 2
- 230000023753 dehiscence Effects 0.000 description 2
- 230000003111 delayed Effects 0.000 description 2
- 229930002954 deoxynivalenol Natural products 0.000 description 2
- 230000001419 dependent Effects 0.000 description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- FBOUIAKEJMZPQG-BLXFFLACSA-N diniconazole-M Chemical compound C1=NC=NN1/C([C@H](O)C(C)(C)C)=C/C1=CC=C(Cl)C=C1Cl FBOUIAKEJMZPQG-BLXFFLACSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000024346 drought recovery Effects 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 230000004028 fruit dehiscence Effects 0.000 description 2
- 244000053095 fungal pathogens Species 0.000 description 2
- 235000003869 genetically modified organisms (GMOs) Nutrition 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 2
- 125000005980 hexynyl group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 229940079866 intestinal antibiotics Drugs 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 235000019713 millet Nutrition 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N n-butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 239000005445 natural product Substances 0.000 description 2
- 229960003966 nicotinamide Drugs 0.000 description 2
- 235000005152 nicotinamide Nutrition 0.000 description 2
- 239000011570 nicotinamide Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 235000016709 nutrition Nutrition 0.000 description 2
- 229940005935 ophthalmologic Antibiotics Drugs 0.000 description 2
- 210000000056 organs Anatomy 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N oxane Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229960000321 oxolinic acid Drugs 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920001888 polyacrylic acid Polymers 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 229920001184 polypeptide Polymers 0.000 description 2
- 235000013824 polyphenols Nutrition 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- 235000019624 protein content Nutrition 0.000 description 2
- 239000003531 protein hydrolysate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 239000000018 receptor agonist Substances 0.000 description 2
- 230000001850 reproductive Effects 0.000 description 2
- 230000035806 respiratory chain Effects 0.000 description 2
- 230000002786 root growth Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 229960005199 tetramethrin Drugs 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 230000005068 transpiration Effects 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- NFGXHKASABOEEW-UHFFFAOYSA-N (+)-methoprene Chemical compound COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C NFGXHKASABOEEW-UHFFFAOYSA-N 0.000 description 1
- YNWVFADWVLCOPU-MDWZMJQESA-N (1E)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol Chemical compound C1=NC=NN1/C(C(O)C(C)(C)C)=C/C1=CC=C(Cl)C=C1 YNWVFADWVLCOPU-MDWZMJQESA-N 0.000 description 1
- SPXBEYPYQKZKGX-PVAVHDDUSA-N (1S,2R,5R)-2-(chloromethyl)-5-[(4-chlorophenyl)methyl]-2-methyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol Chemical compound C([C@H]1CC[C@]([C@]1(O)CN1N=CN=C1)(CCl)C)C1=CC=C(Cl)C=C1 SPXBEYPYQKZKGX-PVAVHDDUSA-N 0.000 description 1
- CCCGEKHKTPTUHJ-VHSXEESVSA-N (1S,4R)-benzovindiflupyr Chemical compound C1([C@@]2([H])CC[C@@]3(C2=C(Cl)Cl)[H])=C3C=CC=C1NC(=O)C1=CN(C)N=C1C(F)F CCCGEKHKTPTUHJ-VHSXEESVSA-N 0.000 description 1
- NJGIRBISCGPRPF-KXQOOQHDSA-N (2-aminoethoxy)[(2R)-2-(icosanoyloxy)-3-(pentadecanoyloxy)propoxy]phosphinic acid Chemical compound CCCCCCCCCCCCCCCCCCCC(=O)O[C@@H](COP(O)(=O)OCCN)COC(=O)CCCCCCCCCCCCCC NJGIRBISCGPRPF-KXQOOQHDSA-N 0.000 description 1
- SAPGTCDSBGMXCD-UHFFFAOYSA-N (2-chlorophenyl)-(4-fluorophenyl)-pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC=CC=1)Cl)(O)C1=CC=C(F)C=C1 SAPGTCDSBGMXCD-UHFFFAOYSA-N 0.000 description 1
- OMFRMAHOUUJSGP-UNOMPAQXSA-N (2-methyl-3-phenylphenyl)methyl 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate Chemical compound C1=CC=C(C=2C=CC=CC=2)C(C)=C1COC(=O)C1C(\C=C(/Cl)C(F)(F)F)C1(C)C OMFRMAHOUUJSGP-UNOMPAQXSA-N 0.000 description 1
- FYQGBXGJFWXIPP-UHFFFAOYSA-N (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoic acid, ethyl ester Chemical compound CCOC(=O)C=C(C)C=CCC(C)CCCC(C)C FYQGBXGJFWXIPP-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2R,3R,4S,5R,6S)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2R,3R,4S,5R,6R)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- XDEHMKQLKPZERH-BYPYZUCNSA-N (2S)-2-amino-3-methylbutanamide Chemical compound CC(C)[C@H](N)C(N)=O XDEHMKQLKPZERH-BYPYZUCNSA-N 0.000 description 1
- DBTMGCOVALSLOR-DEVYUCJPSA-N (2S,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](CO)O[C@H](O)[C@@H]2O)O)O[C@H](CO)[C@H]1O DBTMGCOVALSLOR-DEVYUCJPSA-N 0.000 description 1
- SBUKOHLFHYSZNG-UHFFFAOYSA-N (2S,6S)-4-dodecyl-2,6-dimethylmorpholine Chemical compound CCCCCCCCCCCCN1CC(C)OC(C)C1 SBUKOHLFHYSZNG-UHFFFAOYSA-N 0.000 description 1
- RLLPVAHGXHCWKJ-HKUYNNGSSA-N (3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-HKUYNNGSSA-N 0.000 description 1
- KAEYISLSIRRSJI-YRNVUSSQSA-N (3E)-3-[1-[(6-chloropyridin-3-yl)methyl]pyridin-2-ylidene]-1,1,1-trifluoropropan-2-one Chemical compound FC(F)(F)C(=O)\C=C1/C=CC=CN1CC1=CC=C(Cl)N=C1 KAEYISLSIRRSJI-YRNVUSSQSA-N 0.000 description 1
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3aR,7aS)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- HERTVNKDSUIUDK-JBASAIQMSA-N (4E)-N-(2-methylphenyl)-3-oxo-4-[(2,4,5-trichlorophenyl)hydrazinylidene]naphthalene-2-carboxamide Chemical compound CC1=CC=CC=C1NC(=O)C(C1=O)=CC2=CC=CC=C2\C1=N/NC1=CC(Cl)=C(Cl)C=C1Cl HERTVNKDSUIUDK-JBASAIQMSA-N 0.000 description 1
- AESOVJYUXGEHCV-UHFFFAOYSA-N (5-bromo-2-methoxy-4-methylpyridin-3-yl)-(2,3,4-trimethoxy-6-methylphenyl)methanone Chemical compound COC1=C(OC)C(OC)=CC(C)=C1C(=O)C1=C(C)C(Br)=CN=C1OC AESOVJYUXGEHCV-UHFFFAOYSA-N 0.000 description 1
- PPDBOQMNKNNODG-NTEUORMPSA-N (5E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentanol Chemical compound C1=NC=NN1CC1(O)C(C)(C)CC\C1=C/C1=CC=C(Cl)C=C1 PPDBOQMNKNNODG-NTEUORMPSA-N 0.000 description 1
- QEUOHPLVFSQWME-XDJHFCHBSA-N (E)-3-(4-tert-butylphenyl)-3-(2-chloropyridin-4-yl)-1-morpholin-4-ylprop-2-en-1-one Chemical compound C1=CC(C(C)(C)C)=CC=C1C(\C=1C=C(Cl)N=CC=1)=C/C(=O)N1CCOCC1 QEUOHPLVFSQWME-XDJHFCHBSA-N 0.000 description 1
- YDHZUCLRCLIJRL-HXUWFJFHSA-N (R)-[3-(4-chloro-2-fluorophenyl)-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol Chemical compound C=1([C@H](O)C=2C=NC=CC=2)C(C=2C(=CC(Cl)=CC=2)F)=NOC=1C1=CC=C(F)C=C1F YDHZUCLRCLIJRL-HXUWFJFHSA-N 0.000 description 1
- RYAUSSKQMZRMAI-ZACQAIPSSA-N (R)-fenpropimorph Chemical compound C([C@H](C)CC=1C=CC(=CC=1)C(C)(C)C)N1C[C@H](C)O[C@H](C)C1 RYAUSSKQMZRMAI-ZACQAIPSSA-N 0.000 description 1
- YDHZUCLRCLIJRL-FQEVSTJZSA-N (S)-[3-(4-chloro-2-fluorophenyl)-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol Chemical compound C=1([C@@H](O)C=2C=NC=CC=2)C(C=2C(=CC(Cl)=CC=2)F)=NOC=1C1=CC=C(F)C=C1F YDHZUCLRCLIJRL-FQEVSTJZSA-N 0.000 description 1
- QEUOHPLVFSQWME-CYVLTUHYSA-N (Z)-3-(4-tert-butylphenyl)-3-(2-chloropyridin-4-yl)-1-morpholin-4-ylprop-2-en-1-one Chemical compound C1=CC(C(C)(C)C)=CC=C1C(\C=1C=C(Cl)N=CC=1)=C\C(=O)N1CCOCC1 QEUOHPLVFSQWME-CYVLTUHYSA-N 0.000 description 1
- PCKNFPQPGUWFHO-SXBRIOAWSA-N (Z)-flucycloxuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1CO\N=C(C=1C=CC(Cl)=CC=1)\C1CC1 PCKNFPQPGUWFHO-SXBRIOAWSA-N 0.000 description 1
- XBCKTJDKWPZLJH-ZUPCBTBPSA-N (Z,2E)-5-[1-(4-chlorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-N,3-dimethylpent-3-enamide Chemical compound N1=C(OC\C=C(\C)/C(=N\OC)/C(=O)NC)C=CN1C1=CC=C(Cl)C=C1 XBCKTJDKWPZLJH-ZUPCBTBPSA-N 0.000 description 1
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 1
- IAKOZHOLGAGEJT-UHFFFAOYSA-N 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-Ethane Chemical compound C1=CC(OC)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(OC)C=C1 IAKOZHOLGAGEJT-UHFFFAOYSA-N 0.000 description 1
- MEUXXHGDZUDAAW-LLVKDONJSA-N 1,3,5-trimethyl-N-[(3R)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C=1C(C)=NN(C)C=1C MEUXXHGDZUDAAW-LLVKDONJSA-N 0.000 description 1
- MEUXXHGDZUDAAW-NSHDSACASA-N 1,3,5-trimethyl-N-[(3S)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C=1C(C)=NN(C)C=1C MEUXXHGDZUDAAW-NSHDSACASA-N 0.000 description 1
- QYPFLRIVEVOAGA-LLVKDONJSA-N 1,3-dimethyl-N-[(3R)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C QYPFLRIVEVOAGA-LLVKDONJSA-N 0.000 description 1
- WRGKWWRFSUGDPX-UHFFFAOYSA-N 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)cycloheptan-1-ol Chemical compound C=1C=C(Cl)C=CC=1C1(O)CCCCCC1N1C=NC=N1 WRGKWWRFSUGDPX-UHFFFAOYSA-N 0.000 description 1
- RMOGWMIKYWRTKW-UHFFFAOYSA-N 1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)CC1=CC=C(Cl)C=C1 RMOGWMIKYWRTKW-UHFFFAOYSA-N 0.000 description 1
- VGPIBGGRCVEHQZ-UHFFFAOYSA-N 1-(biphenyl-4-yloxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)OC(C=C1)=CC=C1C1=CC=CC=C1 VGPIBGGRCVEHQZ-UHFFFAOYSA-N 0.000 description 1
- LQDARGUHUSPFNL-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]1,2,4-triazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(COC(F)(F)C(F)F)CN1C=NC=N1 LQDARGUHUSPFNL-UHFFFAOYSA-N 0.000 description 1
- WKBPZYKAUNRMKP-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)pentyl]1,2,4-triazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(CCC)CN1C=NC=N1 WKBPZYKAUNRMKP-UHFFFAOYSA-N 0.000 description 1
- MGNFYQILYYYUBS-UHFFFAOYSA-N 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine Chemical compound C=1C=C(C(C)(C)C)C=CC=1CC(C)CN1CCCCC1 MGNFYQILYYYUBS-UHFFFAOYSA-N 0.000 description 1
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- JLPULHDHAOZNQI-ZTIMHPMXSA-N 1-hexadecanoyl-2-(9Z,12Z-octadecadienoyl)-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCC\C=C/C\C=C/CCCCC JLPULHDHAOZNQI-ZTIMHPMXSA-N 0.000 description 1
- LRCCWFKSGWHDQR-UHFFFAOYSA-N 1-methyl-3-(trifluoromethyl)-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)pyrazole-4-carboxamide Chemical compound C=12C(C)CC(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C(F)(F)F LRCCWFKSGWHDQR-UHFFFAOYSA-N 0.000 description 1
- LRCCWFKSGWHDQR-SNVBAGLBSA-N 1-methyl-3-(trifluoromethyl)-N-[(3R)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C(F)(F)F LRCCWFKSGWHDQR-SNVBAGLBSA-N 0.000 description 1
- LRCCWFKSGWHDQR-JTQLQIEISA-N 1-methyl-3-(trifluoromethyl)-N-[(3S)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C(F)(F)F LRCCWFKSGWHDQR-JTQLQIEISA-N 0.000 description 1
- WXDAGKGYVTVWAE-UHFFFAOYSA-N 1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound FC(F)(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1OC(F)(F)C(F)F WXDAGKGYVTVWAE-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 1H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000004781 2,2-dichloro-2-fluoroethyl group Chemical group [H]C([H])(*)C(F)(Cl)Cl 0.000 description 1
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 1
- LWEAHXKXKDCSIE-UHFFFAOYSA-M 2,3-di(propan-2-yl)naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S([O-])(=O)=O)=C(C(C)C)C(C(C)C)=CC2=C1 LWEAHXKXKDCSIE-UHFFFAOYSA-M 0.000 description 1
- XODZOJBRMYSETR-UHFFFAOYSA-N 2,3-dibutyl-6-chlorothieno[2,3-d]pyrimidin-4-one Chemical compound O=C1N(CCCC)C(CCCC)=NC2=C1C=C(Cl)S2 XODZOJBRMYSETR-UHFFFAOYSA-N 0.000 description 1
- PBYJSIGTSNIRAH-UHFFFAOYSA-N 2,5-dimethyl-4-N-phenylbenzene-1,4-diamine Chemical compound C1=C(N)C(C)=CC(NC=2C=CC=CC=2)=C1C PBYJSIGTSNIRAH-UHFFFAOYSA-N 0.000 description 1
- UFNOUKDBUJZYDE-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1CC(O)(C=1C=CC(Cl)=CC=1)C(C)C1CC1 UFNOUKDBUJZYDE-UHFFFAOYSA-N 0.000 description 1
- YABFPHSQTSFWQB-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)-3-(trimethylsilyl)propan-2-ol Chemical compound C=1C=C(F)C=CC=1C(O)(C[Si](C)(C)C)CN1C=NC=N1 YABFPHSQTSFWQB-UHFFFAOYSA-N 0.000 description 1
- AGVACZYQCJRDQE-UHFFFAOYSA-N 2-(6-benzylpyridin-2-yl)quinazoline Chemical compound C=1C=CC(C=2N=C3C=CC=CC3=CN=2)=NC=1CC1=CC=CC=C1 AGVACZYQCJRDQE-UHFFFAOYSA-N 0.000 description 1
- SPXBEYPYQKZKGX-UHFFFAOYSA-N 2-(chloromethyl)-5-[(4-chlorophenyl)methyl]-2-methyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol Chemical compound C1=NC=NN1CC1(O)C(C)(CCl)CCC1CC1=CC=C(Cl)C=C1 SPXBEYPYQKZKGX-UHFFFAOYSA-N 0.000 description 1
- LLEMOWNGBBNAJR-UHFFFAOYSA-N 2-Phenylphenol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N 2-Pyrrolidone Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- IYRCSBXNZXXLHZ-XFBWCDHKSA-N 2-[(2R,4S,5S)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione Chemical compound N1([C@H]([C@@H](O)C(C)(C)C)C[C@H](C)CC=2C(=CC(Cl)=CC=2)Cl)NC=NC1=S IYRCSBXNZXXLHZ-XFBWCDHKSA-N 0.000 description 1
- IYRCSBXNZXXLHZ-XZJROXQQSA-N 2-[(2S,4R,5R)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione Chemical compound N1([C@@H]([C@H](O)C(C)(C)C)C[C@@H](C)CC=2C(=CC(Cl)=CC=2)Cl)NC=NC1=S IYRCSBXNZXXLHZ-XZJROXQQSA-N 0.000 description 1
- IYRCSBXNZXXLHZ-UVBJJODRSA-N 2-[(2S,4S,5R)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione Chemical compound N1([C@H]([C@H](O)C(C)(C)C)C[C@@H](C)CC=2C(=CC(Cl)=CC=2)Cl)NC=NC1=S IYRCSBXNZXXLHZ-UVBJJODRSA-N 0.000 description 1
- IYRCSBXNZXXLHZ-KNXALSJPSA-N 2-[(2S,4S,5S)-1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione Chemical compound N1([C@H]([C@@H](O)C(C)(C)C)C[C@@H](C)CC=2C(=CC(Cl)=CC=2)Cl)NC=NC1=S IYRCSBXNZXXLHZ-KNXALSJPSA-N 0.000 description 1
- LCPNCBSCOIMOBC-XNTDXEJSSA-N 2-[(E)-(phenylhydrazinylidene)methyl]aniline Chemical compound NC1=CC=CC=C1\C=N\NC1=CC=CC=C1 LCPNCBSCOIMOBC-XNTDXEJSSA-N 0.000 description 1
- IYRCSBXNZXXLHZ-UHFFFAOYSA-N 2-[1-(2,4-dichlorophenyl)-5-hydroxy-2,6,6-trimethylheptan-4-yl]-1H-1,2,4-triazole-3-thione Chemical compound C=1C=C(Cl)C=C(Cl)C=1CC(C)CC(C(O)C(C)(C)C)N1N=CNC1=S IYRCSBXNZXXLHZ-UHFFFAOYSA-N 0.000 description 1
- GFTWHAGNSGTEGO-UHFFFAOYSA-M 2-[1-(4-methoxyphenoxy)-3,3-dimethylbutan-2-yl]imidazole-1-carboxylate Chemical compound C1=CC(OC)=CC=C1OCC(C(C)(C)C)C1=NC=CN1C([O-])=O GFTWHAGNSGTEGO-UHFFFAOYSA-M 0.000 description 1
- MNHVNIJQQRJYDH-UHFFFAOYSA-N 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2-dihydro-1,2,4-triazole-3-thione Chemical compound N1=CNC(=S)N1CC(C1(Cl)CC1)(O)CC1=CC=CC=C1Cl MNHVNIJQQRJYDH-UHFFFAOYSA-N 0.000 description 1
- GYATVWZBWGYBFH-UHFFFAOYSA-N 2-[2-fluoro-6-(8-fluoro-2-methylquinolin-3-yl)oxyphenyl]propan-2-ol Chemical compound CC1=NC2=C(F)C=CC=C2C=C1OC1=CC=CC(F)=C1C(C)(C)O GYATVWZBWGYBFH-UHFFFAOYSA-N 0.000 description 1
- JERZEQUMJNCPRJ-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1,2,4-triazol-1-yl)propan-2-ol Chemical compound C=1C=C(OC=2C=CC(Cl)=CC=2)C=C(C(F)(F)F)C=1C(O)(C)CN1C=NC=N1 JERZEQUMJNCPRJ-UHFFFAOYSA-N 0.000 description 1
- URDOPMVCASNBEZ-VHRLMMNYSA-N 2-amino-2-[(2R,3S,5S,6R)-5-amino-2-methyl-6-[(2S,3S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyoxan-3-yl]iminoacetic acid;hydrate;hydrochloride Chemical compound O.Cl.N[C@H]1C[C@H](N=C(N)C(O)=O)[C@@H](C)O[C@@H]1OC1[C@H](O)[C@@H](O)C(O)[C@H](O)[C@@H]1O URDOPMVCASNBEZ-VHRLMMNYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- ZQMRDENWZKMOTM-UHFFFAOYSA-N 2-butoxy-6-iodo-3-propylchromen-4-one Chemical compound C1=C(I)C=C2C(=O)C(CCC)=C(OCCCC)OC2=C1 ZQMRDENWZKMOTM-UHFFFAOYSA-N 0.000 description 1
- 125000004780 2-chloro-2,2-difluoroethyl group Chemical group [H]C([H])(*)C(F)(F)Cl 0.000 description 1
- 125000004779 2-chloro-2-fluoroethyl group Chemical group [H]C([H])(*)C([H])(F)Cl 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- GTKIGDZXPDCIKR-UHFFFAOYSA-N 2-phenylbenzamide Chemical class NC(=O)C1=CC=CC=C1C1=CC=CC=C1 GTKIGDZXPDCIKR-UHFFFAOYSA-N 0.000 description 1
- 229940061334 2-phenylphenol Drugs 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N 289-95-2 Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- ZVOWUYIDRJPVTD-UHFFFAOYSA-N 3,4,5-trichloropyridine-2,6-dicarbonitrile Chemical compound ClC1=C(Cl)C(C#N)=NC(C#N)=C1Cl ZVOWUYIDRJPVTD-UHFFFAOYSA-N 0.000 description 1
- CVQODEWAPZVVBU-UHFFFAOYSA-N 3,5-Dimethylphenyl methylcarbamate Chemical compound CNC(=O)OC1=CC(C)=CC(C)=C1 CVQODEWAPZVVBU-UHFFFAOYSA-N 0.000 description 1
- SOUGWDPPRBKJEX-UHFFFAOYSA-N 3,5-dichloro-N-(1-chloro-3-methyl-2-oxopentan-3-yl)-4-methylbenzamide Chemical compound ClCC(=O)C(C)(CC)NC(=O)C1=CC(Cl)=C(C)C(Cl)=C1 SOUGWDPPRBKJEX-UHFFFAOYSA-N 0.000 description 1
- IDMIADZAXUGPDR-UHFFFAOYSA-N 3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1,8-diazaspiro[4.5]dec-3-en-2-one Chemical compound C1CN(OC)CCC21C(O)=C(C=1C(=CC=C(C)C=1)C)C(=O)N2 IDMIADZAXUGPDR-UHFFFAOYSA-N 0.000 description 1
- YTCIYOXHHQLDEI-UHFFFAOYSA-N 3-(difluoromethyl)-1-methyl-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)pyrazole-4-carboxamide Chemical compound C=12C(C)CC(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C(F)F YTCIYOXHHQLDEI-UHFFFAOYSA-N 0.000 description 1
- YTCIYOXHHQLDEI-SNVBAGLBSA-N 3-(difluoromethyl)-1-methyl-N-[(3R)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C(F)F YTCIYOXHHQLDEI-SNVBAGLBSA-N 0.000 description 1
- YTCIYOXHHQLDEI-JTQLQIEISA-N 3-(difluoromethyl)-1-methyl-N-[(3S)-1,1,3-trimethyl-2,3-dihydroinden-4-yl]pyrazole-4-carboxamide Chemical compound C([C@@H](C=12)C)C(C)(C)C2=CC=CC=1NC(=O)C1=CN(C)N=C1C(F)F YTCIYOXHHQLDEI-JTQLQIEISA-N 0.000 description 1
- TUGLVMDNIRDNER-UHFFFAOYSA-N 3-(difluoromethyl)-1-methyl-N-[2-[4-(trifluoromethyl)phenyl]phenyl]pyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC=C(C(F)(F)F)C=C1 TUGLVMDNIRDNER-UHFFFAOYSA-N 0.000 description 1
- XCGBHLLWJZOLEM-UHFFFAOYSA-N 3-(difluoromethyl)-N-(7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-yl)-1-methylpyrazole-4-carboxamide Chemical compound CC1CC(C)(C)C(C(=CC=2)F)=C1C=2NC(=O)C1=CN(C)N=C1C(F)F XCGBHLLWJZOLEM-UHFFFAOYSA-N 0.000 description 1
- XCGBHLLWJZOLEM-VIFPVBQESA-N 3-(difluoromethyl)-N-[(3S)-7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-yl]-1-methylpyrazole-4-carboxamide Chemical compound C([C@@H]1C)C(C)(C)C(C(=CC=2)F)=C1C=2NC(=O)C1=CN(C)N=C1C(F)F XCGBHLLWJZOLEM-VIFPVBQESA-N 0.000 description 1
- JQNKSCBHXQAMHB-UHFFFAOYSA-N 3-(difluoromethyl)-N-[2-(4-ethynylphenyl)phenyl]-1-methylpyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC=C(C#C)C=C1 JQNKSCBHXQAMHB-UHFFFAOYSA-N 0.000 description 1
- JZRXHLPCGMDOOT-UHFFFAOYSA-N 3-(difluoromethyl)-N-[4-fluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1-methylpyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=C(F)C=C1OC(F)(F)C(F)C(F)(F)F JZRXHLPCGMDOOT-UHFFFAOYSA-N 0.000 description 1
- DGOAXBPOVUPPEB-UHFFFAOYSA-N 3-(difluoromethyl)-N-methoxy-1-methyl-N-[1-(2,4,6-trichlorophenyl)propan-2-yl]pyrazole-4-carboxamide Chemical compound C=1N(C)N=C(C(F)F)C=1C(=O)N(OC)C(C)CC1=C(Cl)C=C(Cl)C=C1Cl DGOAXBPOVUPPEB-UHFFFAOYSA-N 0.000 description 1
- ZNBJSAAROMDHOX-UHFFFAOYSA-N 3-chloro-4-(2,6-difluorophenyl)-6-methyl-5-phenylpyridazine Chemical compound C=1C=CC=CC=1C=1C(C)=NN=C(Cl)C=1C1=C(F)C=CC=C1F ZNBJSAAROMDHOX-UHFFFAOYSA-N 0.000 description 1
- DNDLJUVNJLTMIE-UHFFFAOYSA-N 3-chloro-5-(4-chlorophenyl)-4-(2,6-difluorophenyl)-6-methylpyridazine Chemical compound C=1C=C(Cl)C=CC=1C=1C(C)=NN=C(Cl)C=1C1=C(F)C=CC=C1F DNDLJUVNJLTMIE-UHFFFAOYSA-N 0.000 description 1
- INDMHHREARZNOU-UHFFFAOYSA-N 3-chloro-5-(6-chloropyridin-3-yl)-6-methyl-4-(2,4,6-trifluorophenyl)pyridazine Chemical compound C=1C=C(Cl)N=CC=1C=1C(C)=NN=C(Cl)C=1C1=C(F)C=C(F)C=C1F INDMHHREARZNOU-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- RUXHWBMJNBBYNL-UHFFFAOYSA-N 3-hydroxy-1,2-dihydropyrrol-5-one Chemical class OC1=CC(=O)NC1 RUXHWBMJNBBYNL-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- HSRXLAJZZXXCNQ-UHFFFAOYSA-N 4,4,5-trifluoro-3,3-dimethyl-1-quinolin-3-ylisoquinoline Chemical compound C12=CC=CC(F)=C2C(F)(F)C(C)(C)N=C1C1=CN=C(C=CC=C2)C2=C1 HSRXLAJZZXXCNQ-UHFFFAOYSA-N 0.000 description 1
- SWTPIYGGSMJRTB-UHFFFAOYSA-N 4,4-difluoro-3,3-dimethyl-1-quinolin-3-ylisoquinoline Chemical compound C12=CC=CC=C2C(F)(F)C(C)(C)N=C1C1=CN=C(C=CC=C2)C2=C1 SWTPIYGGSMJRTB-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- ODJRGOYSTVDWMP-UHFFFAOYSA-N 4-(2-bromo-4-fluorophenyl)-N-(2,6-difluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Br)C=1C=1C(C)=NN(C)C=1NC1=C(F)C=CC=C1F ODJRGOYSTVDWMP-UHFFFAOYSA-N 0.000 description 1
- CMQKKWSPWPFZCL-UHFFFAOYSA-N 4-(2-bromo-4-fluorophenyl)-N-(2-bromo-6-fluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Br)C=1C=1C(C)=NN(C)C=1NC1=C(F)C=CC=C1Br CMQKKWSPWPFZCL-UHFFFAOYSA-N 0.000 description 1
- IVSBZKYDKRRHIZ-UHFFFAOYSA-N 4-(2-bromo-4-fluorophenyl)-N-(2-bromophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Br)C=1C=1C(C)=NN(C)C=1NC1=CC=CC=C1Br IVSBZKYDKRRHIZ-UHFFFAOYSA-N 0.000 description 1
- FUDOELJPMJSOMR-UHFFFAOYSA-N 4-(2-bromo-4-fluorophenyl)-N-(2-chlorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Br)C=1C=1C(C)=NN(C)C=1NC1=CC=CC=C1Cl FUDOELJPMJSOMR-UHFFFAOYSA-N 0.000 description 1
- LXYMTKGURRCLHQ-UHFFFAOYSA-N 4-(2-bromo-4-fluorophenyl)-N-(2-fluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Br)C=1C=1C(C)=NN(C)C=1NC1=CC=CC=C1F LXYMTKGURRCLHQ-UHFFFAOYSA-N 0.000 description 1
- OJTSHHXIWDLHGO-UHFFFAOYSA-N 4-(2-chloro-4-fluorophenyl)-N-(2,6-difluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Cl)C=1C=1C(C)=NN(C)C=1NC1=C(F)C=CC=C1F OJTSHHXIWDLHGO-UHFFFAOYSA-N 0.000 description 1
- MHPQCMPLCLJPQP-UHFFFAOYSA-N 4-(2-chloro-4-fluorophenyl)-N-(2-chlorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Cl)C=1C=1C(C)=NN(C)C=1NC1=CC=CC=C1Cl MHPQCMPLCLJPQP-UHFFFAOYSA-N 0.000 description 1
- BDYBSRNTPXTEGT-UHFFFAOYSA-N 4-(2-chloro-4-fluorophenyl)-N-(2-fluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Cl)C=1C=1C(C)=NN(C)C=1NC1=CC=CC=C1F BDYBSRNTPXTEGT-UHFFFAOYSA-N 0.000 description 1
- FXSRCEOKVUFSGM-UHFFFAOYSA-N 4-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3,6-dimethylpyridazine Chemical compound C=1C=C(Cl)C=CC=1C=1C(C)=NN=C(C)C=1C1=C(F)C=CC=C1F FXSRCEOKVUFSGM-UHFFFAOYSA-N 0.000 description 1
- WQMVTGCKCKMBSJ-UHFFFAOYSA-N 4-(difluoromethyl)-2-methyl-N-[2-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C)=NC(C(F)F)=C1C(=O)NC1=CC=CC=C1C1=CC=C(C(F)(F)F)C=C1 WQMVTGCKCKMBSJ-UHFFFAOYSA-N 0.000 description 1
- PLVOXKOSGFJQEJ-UHFFFAOYSA-N 4-bromo-2-chloro-5-methylaniline Chemical compound CC1=CC(N)=C(Cl)C=C1Br PLVOXKOSGFJQEJ-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- YLJLLELGHSWIDU-UHFFFAOYSA-N 4-cyclododecyl-2,6-dimethylmorpholin-4-ium;acetate Chemical compound CC([O-])=O.C1C(C)OC(C)C[NH+]1C1CCCCCCCCCCC1 YLJLLELGHSWIDU-UHFFFAOYSA-N 0.000 description 1
- FEPBITJSIHRMRT-UHFFFAOYSA-N 4-hydroxybenzenesulfonic acid Chemical compound OC1=CC=C(S(O)(=O)=O)C=C1 FEPBITJSIHRMRT-UHFFFAOYSA-N 0.000 description 1
- LHZOTJOOBRODLL-UHFFFAOYSA-N 4-oxo-1-(pyrimidin-5-ylmethyl)-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-5-ium-2-olate Chemical compound O=C1[N+]2=CC=CC=C2N(CC=2C=NC=NC=2)C([O-])=C1C1=CC=CC(C(F)(F)F)=C1 LHZOTJOOBRODLL-UHFFFAOYSA-N 0.000 description 1
- ZMYKITJYWFYRFJ-UHFFFAOYSA-N 4-oxo-4-(2-phenylethylamino)butanoic acid Chemical compound OC(=O)CCC(=O)NCCC1=CC=CC=C1 ZMYKITJYWFYRFJ-UHFFFAOYSA-N 0.000 description 1
- FNHWFALBBBUBGY-UHFFFAOYSA-N 4-tert-butyl-1,3-thiazole Chemical compound CC(C)(C)C1=CSC=N1 FNHWFALBBBUBGY-UHFFFAOYSA-N 0.000 description 1
- 125000004487 4-tetrahydropyranyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 1
- GOFJDXZZHFNFLV-UHFFFAOYSA-N 5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=C(F)N(C)N=C1C GOFJDXZZHFNFLV-UHFFFAOYSA-N 0.000 description 1
- ZALZMUXMSIVXKA-UHFFFAOYSA-N 5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-amine Chemical compound C1=C(F)C(N)=NC(OCC=2C=CC(F)=CC=2)=N1 ZALZMUXMSIVXKA-UHFFFAOYSA-N 0.000 description 1
- CGRCPZUQMBYVPZ-UHFFFAOYSA-N 5-fluoro-2-[(4-methylphenyl)methoxy]pyrimidin-4-amine Chemical compound C1=CC(C)=CC=C1COC1=NC=C(F)C(N)=N1 CGRCPZUQMBYVPZ-UHFFFAOYSA-N 0.000 description 1
- GNUDLKJUYSXMNO-UHFFFAOYSA-N 5-fluoro-3,3,4,4-tetramethyl-1-quinolin-3-ylisoquinoline Chemical compound C12=CC=CC(F)=C2C(C)(C)C(C)(C)N=C1C1=CN=C(C=CC=C2)C2=C1 GNUDLKJUYSXMNO-UHFFFAOYSA-N 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1H-pyrazole Chemical compound N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- WHJKCPTVEYZNOG-UHFFFAOYSA-N 6-(hydroxymethyl)-5-methoxy-2-[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane-3,4-diol Chemical compound COCC1OC(OC)C(OC)C(OC)C1OC1C(O)C(O)C(OC)C(CO)O1 WHJKCPTVEYZNOG-UHFFFAOYSA-N 0.000 description 1
- 125000006164 6-membered heteroaryl group Chemical group 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N 8-Hydroxyquinoline Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- JVGXNGXFTFLIGB-UHFFFAOYSA-N 9-fluoro-2,2-dimethyl-5-quinolin-3-yl-3H-1,4-benzoxazepine Chemical compound C12=CC=CC(F)=C2OC(C)(C)CN=C1C1=CN=C(C=CC=C2)C2=C1 JVGXNGXFTFLIGB-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N AI2O3 Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000002407 ATP formation Effects 0.000 description 1
- 229950008167 Abamectin Drugs 0.000 description 1
- 239000005875 Acetamiprid Substances 0.000 description 1
- WCXDHFDTOYPNIE-RIYZIHGNSA-N Acetamiprid Chemical compound N#C/N=C(\C)N(C)CC1=CC=C(Cl)N=C1 WCXDHFDTOYPNIE-RIYZIHGNSA-N 0.000 description 1
- 102000000452 Acetyl-CoA Carboxylase Human genes 0.000 description 1
- 108010016219 Acetyl-CoA Carboxylase Proteins 0.000 description 1
- 239000005964 Acibenzolar-S-methyl Substances 0.000 description 1
- UELITFHSCLAHKR-UHFFFAOYSA-N Acibenzolar-S-methyl Chemical group CSC(=O)C1=CC=CC2=C1SN=N2 UELITFHSCLAHKR-UHFFFAOYSA-N 0.000 description 1
- 239000005652 Acrinathrin Substances 0.000 description 1
- 244000202285 Acrocomia mexicana Species 0.000 description 1
- 235000016413 Actinidia polygama Nutrition 0.000 description 1
- 240000006274 Actinidia polygama Species 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 235000005474 African couch grass Nutrition 0.000 description 1
- 235000016820 Agastache cana Nutrition 0.000 description 1
- 240000006054 Agastache cana Species 0.000 description 1
- 241000919511 Albugo Species 0.000 description 1
- 241000919507 Albugo candida Species 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- 229940045714 Alkyl sulfonate alkylating agents Drugs 0.000 description 1
- 235000008553 Allium fistulosum Nutrition 0.000 description 1
- 240000000889 Allium fistulosum Species 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 239000005877 Alpha-Cypermethrin Substances 0.000 description 1
- 241000223602 Alternaria alternata Species 0.000 description 1
- 241001157812 Alternaria brassicicola Species 0.000 description 1
- PPNXXZIBFHTHDM-UHFFFAOYSA-N Aluminium phosphide Chemical compound P#[Al] PPNXXZIBFHTHDM-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- PZZYQPZGQPZBDN-UHFFFAOYSA-N Aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 1
- QXAITBQSYVNQDR-ZIOPAAQOSA-N Amitraz Chemical compound C=1C=C(C)C=C(C)C=1/N=C/N(C)\C=N\C1=CC=C(C)C=C1C QXAITBQSYVNQDR-ZIOPAAQOSA-N 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 240000002254 Ananas comosus Species 0.000 description 1
- IMHBYKMAHXWHRP-UHFFFAOYSA-N Anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N Anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 1
- 241001444080 Aphanomyces euteiches Species 0.000 description 1
- 240000005781 Arachis hypogaea Species 0.000 description 1
- 235000011330 Armoracia rusticana Nutrition 0.000 description 1
- 240000003291 Armoracia rusticana Species 0.000 description 1
- 241001198951 Ascochyta lentis Species 0.000 description 1
- 241000228193 Aspergillus clavatus Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000131308 Aspergillus nomius Species 0.000 description 1
- 241000122824 Aspergillus ochraceus Species 0.000 description 1
- 241001465318 Aspergillus terreus Species 0.000 description 1
- 241000238017 Astacoidea Species 0.000 description 1
- 241000223651 Aureobasidium Species 0.000 description 1
- 241000223678 Aureobasidium pullulans Species 0.000 description 1
- 229950000294 Azaconazole Drugs 0.000 description 1
- FTNJWQUOZFUQQJ-NDAWSKJSSA-N Azadirachtin Chemical compound C([C@@H]([C@]1(C=CO[C@H]1O1)O)[C@]2(C)O3)[C@H]1[C@]23[C@]1(C)[C@H](O)[C@H](OC[C@@]2([C@@H](C[C@@H]3OC(=O)C(\C)=C\C)OC(C)=O)C(=O)OC)[C@@H]2[C@]32CO[C@@](C(=O)OC)(O)[C@@H]12 FTNJWQUOZFUQQJ-NDAWSKJSSA-N 0.000 description 1
- VNKBTWQZTQIWDV-UHFFFAOYSA-N Azamethiphos Chemical compound C1=C(Cl)C=C2OC(=O)N(CSP(=O)(OC)OC)C2=N1 VNKBTWQZTQIWDV-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N Azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 239000005730 Azoxystrobin Substances 0.000 description 1
- WFDXOXNFNRHQEC-GHRIWEEISA-N Azoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1OC1=CC(OC=2C(=CC=CC=2)C#N)=NC=N1 WFDXOXNFNRHQEC-GHRIWEEISA-N 0.000 description 1
- 241000193738 Bacillus anthracis Species 0.000 description 1
- PNVJTZOFSHSLTO-UHFFFAOYSA-N Baytex Chemical compound COP(=S)(OC)OC1=CC=C(SC)C(C)=C1 PNVJTZOFSHSLTO-UHFFFAOYSA-N 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N Benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N Benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N Benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 1
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N Binapacryl Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 description 1
- 230000036912 Bioavailability Effects 0.000 description 1
- 229950002373 Bioresmethrin Drugs 0.000 description 1
- 241001465178 Bipolaris Species 0.000 description 1
- 241000190150 Bipolaris sorokiniana Species 0.000 description 1
- 241001480060 Blumeria Species 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- 239000005740 Boscalid Substances 0.000 description 1
- 235000017647 Brassica oleracea var italica Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 241000233684 Bremia Species 0.000 description 1
- 241000233685 Bremia lactucae Species 0.000 description 1
- FOANIXZHAMJWOI-UHFFFAOYSA-N Bromopropylate Chemical compound C=1C=C(Br)C=CC=1C(O)(C(=O)OC(C)C)C1=CC=C(Br)C=C1 FOANIXZHAMJWOI-UHFFFAOYSA-N 0.000 description 1
- 239000005742 Bupirimate Substances 0.000 description 1
- DSKJPMWIHSOYEA-UHFFFAOYSA-N Bupirimate Chemical compound CCCCC1=C(C)N=C(NCC)N=C1OS(=O)(=O)N(C)C DSKJPMWIHSOYEA-UHFFFAOYSA-N 0.000 description 1
- 239000005885 Buprofezin Substances 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N Butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- LOCVLSXQGXVADH-UHFFFAOYSA-N C(C)N(C=NC1=C(C=C(C(=C1)F)NC1=CC(=C(C=C1)F)OC(C(F)F)(F)F)C)C Chemical compound C(C)N(C=NC1=C(C=C(C(=C1)F)NC1=CC(=C(C=C1)F)OC(C(F)F)(F)F)C)C LOCVLSXQGXVADH-UHFFFAOYSA-N 0.000 description 1
- JLWSOYKIRUZUJV-UHFFFAOYSA-M C(OC1=C(C(OC11C(CCCC1)CCCC)=O)C1=C(C=C(C=C1)Cl)Cl)([O-])=O Chemical compound C(OC1=C(C(OC11C(CCCC1)CCCC)=O)C1=C(C=C(C=C1)Cl)Cl)([O-])=O JLWSOYKIRUZUJV-UHFFFAOYSA-M 0.000 description 1
- WVKDQESLHACCIT-UHFFFAOYSA-M C(OCCC1=C(C(NC12CCN(CC2)OC)=O)C2=C(C=CC(=C2)C)C)([O-])=O Chemical compound C(OCCC1=C(C(NC12CCN(CC2)OC)=O)C2=C(C=CC(=C2)C)C)([O-])=O WVKDQESLHACCIT-UHFFFAOYSA-M 0.000 description 1
- 229950000775 CYROMAZINE Drugs 0.000 description 1
- SPXBEYPYQKZKGX-USXIJHARSA-N C[C@]1(CCl)CC[C@@H](Cc2ccc(Cl)cc2)[C@]1(O)Cn1cncn1 Chemical compound C[C@]1(CCl)CC[C@@H](Cc2ccc(Cl)cc2)[C@]1(O)Cn1cncn1 SPXBEYPYQKZKGX-USXIJHARSA-N 0.000 description 1
- 241000498608 Cadophora gregata Species 0.000 description 1
- 239000006009 Calcium phosphide Substances 0.000 description 1
- 241001072697 Calonectria ilicicola Species 0.000 description 1
- 241000217446 Calystegia sepium Species 0.000 description 1
- 240000001548 Camellia japonica Species 0.000 description 1
- 229940095731 Candida albicans Drugs 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 240000000218 Cannabis sativa Species 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- 229940117949 Captan Drugs 0.000 description 1
- JNPZQRQPIHJYNM-UHFFFAOYSA-N Carbendazim Chemical compound C1=C[CH]C2=NC(NC(=O)OC)=NC2=C1 JNPZQRQPIHJYNM-UHFFFAOYSA-N 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N Carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- RXDMAYSSBPYBFW-PKFCDNJMSA-N Carpropamide Chemical compound N([C@@H](C)C=1C=CC(Cl)=CC=1)C(=O)[C@@]1(CC)[C@H](C)C1(Cl)Cl RXDMAYSSBPYBFW-PKFCDNJMSA-N 0.000 description 1
- 239000005886 Chlorantraniliprole Substances 0.000 description 1
- CWFOCCVIPCEQCK-UHFFFAOYSA-N Chlorfenapyr Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C#N CWFOCCVIPCEQCK-UHFFFAOYSA-N 0.000 description 1
- WGSLWEXCQQBACX-UHFFFAOYSA-N Chlorin Chemical compound C=1C(C=C2)=NC2=CC(C=C2)=NC2=CC(C=C2)=NC2=CC2=NC=1CC2 WGSLWEXCQQBACX-UHFFFAOYSA-N 0.000 description 1
- LFHISGNCFUNFFM-UHFFFAOYSA-N Chloropicrin Chemical compound [O-][N+](=O)C(Cl)(Cl)Cl LFHISGNCFUNFFM-UHFFFAOYSA-N 0.000 description 1
- 239000005945 Chlorpyrifos-methyl Substances 0.000 description 1
- 241000233652 Chytridiomycota Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 240000002268 Citrus limon Species 0.000 description 1
- 240000000560 Citrus x paradisi Species 0.000 description 1
- GKJLFMAXJGINCV-UHFFFAOYSA-N ClC1=C(C=C(C(=C1)NC1=CC(=C(C=C1)F)OC(C(F)F)(F)F)C)N=CN(C)CC Chemical compound ClC1=C(C=C(C(=C1)NC1=CC(=C(C=C1)F)OC(C(F)F)(F)F)C)N=CN(C)CC GKJLFMAXJGINCV-UHFFFAOYSA-N 0.000 description 1
- GGMYYVOJWIBMKZ-UHFFFAOYSA-N ClC1=CC=C(C=C1)N(C1=C(C=C(C(=C1)C)N)C)C Chemical compound ClC1=CC=C(C=C1)N(C1=C(C=C(C(=C1)C)N)C)C GGMYYVOJWIBMKZ-UHFFFAOYSA-N 0.000 description 1
- HYHIGGADSAZVPS-UHFFFAOYSA-N ClC=1C(=CC(=C(C=1)N(C1=CC(=C(C(=C1)F)F)F)C)C)N Chemical compound ClC=1C(=CC(=C(C=1)N(C1=CC(=C(C(=C1)F)F)F)C)C)N HYHIGGADSAZVPS-UHFFFAOYSA-N 0.000 description 1
- 241001149955 Cladosporium cladosporioides Species 0.000 description 1
- 241001149956 Cladosporium herbarum Species 0.000 description 1
- 241000186650 Clavibacter Species 0.000 description 1
- 241000221760 Claviceps Species 0.000 description 1
- 241000221751 Claviceps purpurea Species 0.000 description 1
- 239000005654 Clofentezine Substances 0.000 description 1
- 239000005888 Clothianidin Substances 0.000 description 1
- PGOOBECODWQEAB-UHFFFAOYSA-N Clothianidin Chemical compound [O-][N+](=O)\N=C(/NC)NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 240000007170 Cocos nucifera Species 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 241000222201 Colletotrichum capsici Species 0.000 description 1
- 239000005750 Copper hydroxide Substances 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 239000005752 Copper oxychloride Substances 0.000 description 1
- JJLJMEJHUUYSSY-UHFFFAOYSA-L Copper(II) hydroxide Chemical compound [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L Copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 244000018951 Cordia abyssinica Species 0.000 description 1
- 241000222356 Coriolus Species 0.000 description 1
- 241001529717 Corticium <basidiomycota> Species 0.000 description 1
- 235000007466 Corylus avellana Nutrition 0.000 description 1
- 240000007582 Corylus avellana Species 0.000 description 1
- 241000609458 Corynespora Species 0.000 description 1
- 241000238424 Crustacea Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000192700 Cyanobacteria Species 0.000 description 1
- SCKHCCSZFPSHGR-UHFFFAOYSA-N Cyanophos Chemical compound COP(=S)(OC)OC1=CC=C(C#N)C=C1 SCKHCCSZFPSHGR-UHFFFAOYSA-N 0.000 description 1
- 239000005889 Cyantraniliprole Substances 0.000 description 1
- DVBUIBGJRQBEDP-UHFFFAOYSA-N Cyantraniliprole Chemical compound CNC(=O)C1=CC(C#N)=CC(C)=C1NC(=O)C1=CC(Br)=NN1C1=NC=CC=C1Cl DVBUIBGJRQBEDP-UHFFFAOYSA-N 0.000 description 1
- 239000005757 Cyproconazole Substances 0.000 description 1
- 239000005891 Cyromazine Substances 0.000 description 1
- LVQDKIWDGQRHTE-UHFFFAOYSA-N Cyromazine Chemical compound NC1=NC(N)=NC(NC2CC2)=N1 LVQDKIWDGQRHTE-UHFFFAOYSA-N 0.000 description 1
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 1
- NMCCNOZOBBWFMN-UHFFFAOYSA-N Davicil Chemical compound CS(=O)(=O)C1=C(Cl)C(Cl)=NC(Cl)=C1Cl NMCCNOZOBBWFMN-UHFFFAOYSA-N 0.000 description 1
- 239000005644 Dazomet Substances 0.000 description 1
- QAYICIQNSGETAS-UHFFFAOYSA-N Dazomet Chemical compound CN1CSC(=S)N(C)C1 QAYICIQNSGETAS-UHFFFAOYSA-N 0.000 description 1
- 239000005892 Deltamethrin Substances 0.000 description 1
- OWZREIFADZCYQD-NSHGMRRFSA-N Deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
- WEBQKRLKWNIYKK-UHFFFAOYSA-N Demeton-S-methyl Chemical compound CCSCCSP(=O)(OC)OC WEBQKRLKWNIYKK-UHFFFAOYSA-N 0.000 description 1
- 206010012504 Dermatophytosis Diseases 0.000 description 1
- 241000489947 Diabrotica virgifera virgifera Species 0.000 description 1
- WURGXGVFSMYFCG-UHFFFAOYSA-N Dichlofluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1 WURGXGVFSMYFCG-UHFFFAOYSA-N 0.000 description 1
- 229950001327 Dichlorvos Drugs 0.000 description 1
- 240000006245 Dichrostachys cinerea Species 0.000 description 1
- URDNHJIVMYZFRT-UHFFFAOYSA-N Diclobutrazol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)CC1=CC=C(Cl)C=C1Cl URDNHJIVMYZFRT-UHFFFAOYSA-N 0.000 description 1
- 239000005893 Diflubenzuron Substances 0.000 description 1
- QQQYTWIFVNKMRW-UHFFFAOYSA-N Diflubenzuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC=C(Cl)C=C1 QQQYTWIFVNKMRW-UHFFFAOYSA-N 0.000 description 1
- YKBZOVFACRVRJN-UHFFFAOYSA-N Dinotefuran Chemical compound [O-][N+](=O)\N=C(/NC)NCC1CCOC1 YKBZOVFACRVRJN-UHFFFAOYSA-N 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N Diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- DOFZAZXDOSGAJZ-UHFFFAOYSA-N Disulfoton Chemical compound CCOP(=S)(OCC)SCCSCC DOFZAZXDOSGAJZ-UHFFFAOYSA-N 0.000 description 1
- KWKXNDCHNDYVRT-UHFFFAOYSA-N Dodecylbenzene Chemical compound CCCCCCCCCCCCC1=CC=CC=C1 KWKXNDCHNDYVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005765 Dodemorph Substances 0.000 description 1
- 108010031396 EC 1.10.3.1 Proteins 0.000 description 1
- 102000031088 EC 1.10.3.1 Human genes 0.000 description 1
- MIZMDSVSLSIMSC-OGLSAIDSSA-N ENNIATIN Chemical compound CC(C)C1OC(=O)[C@H](C(C)C)N(C)C(=O)C(C(C)C)OC(=O)[C@H](C(C)C)N(C)C(=O)C(C(C)C)OC(=O)[C@H](C(C)C)N(C)C1=O MIZMDSVSLSIMSC-OGLSAIDSSA-N 0.000 description 1
- 206010014004 Ear disease Diseases 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 240000002436 Echinochloa crus-galli Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 241000125118 Elsinoe fawcettii Species 0.000 description 1
- CXEGAUYXQAKHKJ-FYOMLGFFSA-N Emamectin Chemical compound C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@H](C)[C@@H](NC)[C@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 CXEGAUYXQAKHKJ-FYOMLGFFSA-N 0.000 description 1
- RDYMFSUJUZBWLH-SVWSLYAFSA-N Endosulfan Chemical compound C([C@@H]12)OS(=O)OC[C@@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl RDYMFSUJUZBWLH-SVWSLYAFSA-N 0.000 description 1
- 229960002125 Enilconazole Drugs 0.000 description 1
- PZBPKYOVPCNPJY-UHFFFAOYSA-N Enilconazole Chemical compound ClC1=CC(Cl)=CC=C1C(OCC=C)CN1C=NC=C1 PZBPKYOVPCNPJY-UHFFFAOYSA-N 0.000 description 1
- 241000588921 Enterobacteriaceae Species 0.000 description 1
- 241001480035 Epidermophyton Species 0.000 description 1
- DNVPQKQSNYMLRS-APGDWVJJSA-N Ergosterol Chemical compound C1[C@@H](O)CC[C@]2(C)[C@@H](CC[C@@]3([C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC[C@H]33)C)C3=CC=C21 DNVPQKQSNYMLRS-APGDWVJJSA-N 0.000 description 1
- DNVPQKQSNYMLRS-LNHMRCHQSA-N Ergosterol Natural products O[C@@H]1CC=2[C@@](C)([C@@H]3C([C@H]4[C@@](C)([C@H]([C@@H](/C=C/[C@H](C(C)C)C)C)CC4)CC3)=CC=2)CC1 DNVPQKQSNYMLRS-LNHMRCHQSA-N 0.000 description 1
- 241000588698 Erwinia Species 0.000 description 1
- 241000588694 Erwinia amylovora Species 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- RIZMRRKBZQXFOY-UHFFFAOYSA-N Ethion Chemical compound CCOP(=S)(OCC)SCSP(=S)(OCC)OCC RIZMRRKBZQXFOY-UHFFFAOYSA-N 0.000 description 1
- 239000005896 Etofenprox Substances 0.000 description 1
- YREQHYQNNWYQCJ-UHFFFAOYSA-N Etofenprox Chemical compound C1=CC(OCC)=CC=C1C(C)(C)COCC1=CC=CC(OC=2C=CC=CC=2)=C1 YREQHYQNNWYQCJ-UHFFFAOYSA-N 0.000 description 1
- 229950005085 Etofenprox Drugs 0.000 description 1
- 239000005897 Etoxazole Substances 0.000 description 1
- 239000005769 Etridiazole Substances 0.000 description 1
- 241000360018 Eupodoidea Species 0.000 description 1
- 241001520106 Eustachys Species 0.000 description 1
- JBLBTTMRJDQAQC-HXUWFJFHSA-M FC(C1=NN(C(=C1)C(F)F)CC(=O)N1CCC(CC1)C=1SC=C(N=1)C1=NO[C@H](C1)C1=C(C=CC=C1Cl)CS(=O)(=O)[O-])F Chemical compound FC(C1=NN(C(=C1)C(F)F)CC(=O)N1CCC(CC1)C=1SC=C(N=1)C1=NO[C@H](C1)C1=C(C=CC=C1Cl)CS(=O)(=O)[O-])F JBLBTTMRJDQAQC-HXUWFJFHSA-M 0.000 description 1
- 241000219428 Fagaceae Species 0.000 description 1
- ZCJPOPBZHLUFHF-UHFFFAOYSA-N Fenamiphos Chemical compound CCOP(=O)(NC(C)C)OC1=CC=C(SC)C(C)=C1 ZCJPOPBZHLUFHF-UHFFFAOYSA-N 0.000 description 1
- 239000005958 Fenamiphos (aka phenamiphos) Substances 0.000 description 1
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N Fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 1
- 239000005778 Fenpropimorph Substances 0.000 description 1
- 239000005779 Fenpyrazamine Substances 0.000 description 1
- WDQNIWFZKXZFAY-UHFFFAOYSA-M Fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 1
- NYPJDWWKZLNGGM-UHFFFAOYSA-N Fenvalerate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 description 1
- 239000005899 Fipronil Substances 0.000 description 1
- ZOCSXAVNDGMNBV-UHFFFAOYSA-N Fipronil Chemical compound NC1=C(S(=O)C(F)(F)F)C(C#N)=NN1C1=C(Cl)C=C(C(F)(F)F)C=C1Cl ZOCSXAVNDGMNBV-UHFFFAOYSA-N 0.000 description 1
- 239000005901 Flubendiamide Substances 0.000 description 1
- XRECTZIEBJDKEO-UHFFFAOYSA-N Flucytosine Chemical compound NC1=NC(=O)NC=C1F XRECTZIEBJDKEO-UHFFFAOYSA-N 0.000 description 1
- 239000005783 Fluopyram Substances 0.000 description 1
- 239000005784 Fluoxastrobin Substances 0.000 description 1
- FQKUGOMFVDPBIZ-UHFFFAOYSA-N Flusilazole Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(C)CN1C=NC=N1 FQKUGOMFVDPBIZ-UHFFFAOYSA-N 0.000 description 1
- 241000223193 Fusarium acuminatum Species 0.000 description 1
- 241000784413 Fusarium asiaticum Species 0.000 description 1
- 241000122692 Fusarium avenaceum Species 0.000 description 1
- 241000879295 Fusarium equiseti Species 0.000 description 1
- 241001489200 Fusarium poae Species 0.000 description 1
- 241000690372 Fusarium proliferatum Species 0.000 description 1
- 241000221779 Fusarium sambucinum Species 0.000 description 1
- 241000427940 Fusarium solani Species 0.000 description 1
- 241000233732 Fusarium verticillioides Species 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N GABA Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 241001149475 Gaeumannomyces graminis Species 0.000 description 1
- 235000001637 Ganoderma lucidum Nutrition 0.000 description 1
- 240000008397 Ganoderma lucidum Species 0.000 description 1
- 241000401653 Ganoderma orbiforme Species 0.000 description 1
- 241000896533 Gliocladium Species 0.000 description 1
- 241001620302 Glomerella <beetle> Species 0.000 description 1
- 241000235503 Glomus Species 0.000 description 1
- 229960002989 Glutamic Acid Drugs 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- 241001481828 Glyptocephalus cynoglossus Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 241000592921 Helminthosporium Species 0.000 description 1
- 241000592938 Helminthosporium solani Species 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N Hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 1
- STMIIPIFODONDC-UHFFFAOYSA-N Hexaconazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(O)(CCCC)CN1C=NC=N1 STMIIPIFODONDC-UHFFFAOYSA-N 0.000 description 1
- IQVNEKKDSLOHHK-FNCQTZNRSA-N Hydramethylnon Chemical compound N1CC(C)(C)CNC1=NN=C(/C=C/C=1C=CC(=CC=1)C(F)(F)F)\C=C\C1=CC=C(C(F)(F)F)C=C1 IQVNEKKDSLOHHK-FNCQTZNRSA-N 0.000 description 1
- 239000005795 Imazalil Substances 0.000 description 1
- 239000005906 Imidacloprid Substances 0.000 description 1
- YWTYJOPNNQFBPC-UHFFFAOYSA-N Imidacloprid Chemical compound [O-][N+](=O)\N=C1/NCCN1CC1=CC=C(Cl)N=C1 YWTYJOPNNQFBPC-UHFFFAOYSA-N 0.000 description 1
- VPRAQYXPZIFIOH-UHFFFAOYSA-N Imiprothrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCN1C(=O)N(CC#C)CC1=O VPRAQYXPZIFIOH-UHFFFAOYSA-N 0.000 description 1
- 240000007171 Imperata cylindrica Species 0.000 description 1
- 239000005907 Indoxacarb Substances 0.000 description 1
- 210000000936 Intestines Anatomy 0.000 description 1
- WYVVKGNFXHOCQV-UHFFFAOYSA-N Iodopropynyl butylcarbamate Chemical compound CCCCNC(=O)OCC#CI WYVVKGNFXHOCQV-UHFFFAOYSA-N 0.000 description 1
- 239000005796 Ipconazole Substances 0.000 description 1
- 241000758791 Juglandaceae Species 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N Kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 108010029541 Laccase Proteins 0.000 description 1
- 239000005717 Laminarin Substances 0.000 description 1
- 229920001543 Laminarin Polymers 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 229920000126 Latex Polymers 0.000 description 1
- 229940067606 Lecithin Drugs 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 240000002178 Lepidium sativum Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000270322 Lepidosauria Species 0.000 description 1
- 241000228457 Leptosphaeria maculans Species 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 239000004117 Lignosulphonate Substances 0.000 description 1
- 241000234435 Lilium Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 239000005912 Lufenuron Substances 0.000 description 1
- PWPJGUXAGUPAHP-UHFFFAOYSA-N Lufenuron Chemical compound C1=C(Cl)C(OC(F)(F)C(C(F)(F)F)F)=CC(Cl)=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F PWPJGUXAGUPAHP-UHFFFAOYSA-N 0.000 description 1
- 241001465167 Lumaria Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N Malathion Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 240000001047 Malus domestica Species 0.000 description 1
- 239000005802 Mancozeb Substances 0.000 description 1
- 239000005803 Mandestrobin Substances 0.000 description 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L Maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 1
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 1
- 239000005805 Mepanipyrim Substances 0.000 description 1
- ZQEIXNIJLIKNTD-UHFFFAOYSA-N Metalaxyl Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 description 1
- 239000005808 Metalaxyl-M Substances 0.000 description 1
- NNKVPIKMPCQWCG-UHFFFAOYSA-N Methamidophos Chemical compound COP(N)(=O)SC NNKVPIKMPCQWCG-UHFFFAOYSA-N 0.000 description 1
- 229950003442 Methoprene Drugs 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- 241000223196 Microdochium nivale Species 0.000 description 1
- 241001460074 Microsporum distortum Species 0.000 description 1
- 239000005918 Milbemectin Substances 0.000 description 1
- 210000004080 Milk Anatomy 0.000 description 1
- 102000013379 Mitochondrial Proton-Translocating ATPases Human genes 0.000 description 1
- 108010026155 Mitochondrial Proton-Translocating ATPases Proteins 0.000 description 1
- 241001668538 Mollisia Species 0.000 description 1
- KGPQKNJSZNXOPV-UHFFFAOYSA-N Moniliformin Chemical compound OC1=CC(=O)C1=O KGPQKNJSZNXOPV-UHFFFAOYSA-N 0.000 description 1
- 241001518729 Monilinia Species 0.000 description 1
- 241000862466 Monilinia laxa Species 0.000 description 1
- 241000218231 Moraceae Species 0.000 description 1
- BQJCRHHNABKAKU-KBQPJGBKSA-N Morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 1
- 241000235395 Mucor Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 240000000569 Musa basjoo Species 0.000 description 1
- 235000000139 Musa basjoo Nutrition 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- ZRWPUFFVAOMMNM-UHFFFAOYSA-N Mycoin C Chemical compound OC1OCC=C2OC(=O)C=C12 ZRWPUFFVAOMMNM-UHFFFAOYSA-N 0.000 description 1
- 241000865904 Mycoleptodiscus terrestris Species 0.000 description 1
- RSJUTKLIFDWDPJ-UHFFFAOYSA-N N(C1=CC=CC=C1)C1=CC(=C(C=C1C)[N+](=O)[O-])C Chemical compound N(C1=CC=CC=C1)C1=CC(=C(C=C1C)[N+](=O)[O-])C RSJUTKLIFDWDPJ-UHFFFAOYSA-N 0.000 description 1
- AXAWJJPNXBSRQV-UHFFFAOYSA-N N(C1=CC=CC=C1)C1=CC(=C(N)C=C1C)Cl Chemical compound N(C1=CC=CC=C1)C1=CC(=C(N)C=C1C)Cl AXAWJJPNXBSRQV-UHFFFAOYSA-N 0.000 description 1
- BLCKKNLGFULNRC-UHFFFAOYSA-L N,N-dimethylcarbamodithioate;nickel(2+) Chemical compound [Ni+2].CN(C)C([S-])=S.CN(C)C([S-])=S BLCKKNLGFULNRC-UHFFFAOYSA-L 0.000 description 1
- BLCHMFQMHCCQCK-UHFFFAOYSA-N N-(2-bromo-6-fluorophenyl)-4-(2-chloro-4-fluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Cl)C=1C=1C(C)=NN(C)C=1NC1=C(F)C=CC=C1Br BLCHMFQMHCCQCK-UHFFFAOYSA-N 0.000 description 1
- FXZGOEUQWCBASE-UHFFFAOYSA-N N-(2-bromophenyl)-4-(2-chloro-4-fluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Cl)C=1C=1C(C)=NN(C)C=1NC1=CC=CC=C1Br FXZGOEUQWCBASE-UHFFFAOYSA-N 0.000 description 1
- QKEKUMRXLOHZQJ-UHFFFAOYSA-N N-(4-chloro-2,6-difluorophenyl)-4-(2-chloro-4-fluorophenyl)-2,5-dimethylpyrazol-3-amine Chemical compound C=1C=C(F)C=C(Cl)C=1C=1C(C)=NN(C)C=1NC1=C(F)C=C(Cl)C=C1F QKEKUMRXLOHZQJ-UHFFFAOYSA-N 0.000 description 1
- ACDCNNFPJPHJCQ-UHFFFAOYSA-N N-[(2-tert-butyl-5-methylphenyl)methyl]-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CC1=CC=C(C(C)(C)C)C(CN(C2CC2)C(=O)C=2C(=NN(C)C=2F)C(F)F)=C1 ACDCNNFPJPHJCQ-UHFFFAOYSA-N 0.000 description 1
- GCIZLUZYQSYVSS-UHFFFAOYSA-N N-[(5-bromo-3-chloropyridin-2-yl)methyl]-2,4-dichloropyridine-3-carboxamide Chemical compound ClC1=CC=NC(Cl)=C1C(=O)NCC1=NC=C(Br)C=C1Cl GCIZLUZYQSYVSS-UHFFFAOYSA-N 0.000 description 1
- ZNPUHPIMSDMYGC-UHFFFAOYSA-N N-[(5-chloro-2-ethylphenyl)methyl]-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CCC1=CC=C(Cl)C=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 ZNPUHPIMSDMYGC-UHFFFAOYSA-N 0.000 description 1
- JEFUQUGZXLEHLD-UHFFFAOYSA-N N-[(5-chloro-2-propan-2-ylphenyl)methyl]-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CC(C)C1=CC=C(Cl)C=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 JEFUQUGZXLEHLD-UHFFFAOYSA-N 0.000 description 1
- HQUIFHINFGFWLJ-UHFFFAOYSA-N N-[(cyclopropylmethoxyamino)-[6-(difluoromethoxy)-2,3-difluorophenyl]methylidene]-2-phenylacetamide Chemical compound FC(F)OC1=CC=C(F)C(F)=C1C(NOCC1CC1)=NC(=O)CC1=CC=CC=C1 HQUIFHINFGFWLJ-UHFFFAOYSA-N 0.000 description 1
- RRRNUBCOWJALGN-UHFFFAOYSA-N N-[1-(5-bromo-3-chloropyridin-2-yl)ethyl]-2,4-dichloropyridine-3-carboxamide Chemical compound N=1C=C(Br)C=C(Cl)C=1C(C)NC(=O)C1=C(Cl)C=CN=C1Cl RRRNUBCOWJALGN-UHFFFAOYSA-N 0.000 description 1
- MQJVOGWREDEYCK-UHFFFAOYSA-N N-[1-(5-bromo-3-chloropyridin-2-yl)ethyl]-2-fluoro-4-iodopyridine-3-carboxamide Chemical compound N=1C=C(Br)C=C(Cl)C=1C(C)NC(=O)C1=C(F)N=CC=C1I MQJVOGWREDEYCK-UHFFFAOYSA-N 0.000 description 1
- ZWWBRKGFSLERLP-UHFFFAOYSA-N N-[2-(2,4-dichlorophenyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC=C(Cl)C=C1Cl ZWWBRKGFSLERLP-UHFFFAOYSA-N 0.000 description 1
- LOALTAUNNJDSSB-UHFFFAOYSA-N N-[2-(2,5-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound FC(F)(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC(F)=CC=C1F LOALTAUNNJDSSB-UHFFFAOYSA-N 0.000 description 1
- UWKQSUQMFIRFMM-UHFFFAOYSA-N N-[2-(tert-butylcarbamoyl)-4-chloro-6-methylphenyl]-2-(3-chloropyridin-2-yl)-5-(fluoromethoxy)pyrazole-3-carboxamide Chemical compound CC1=CC(Cl)=CC(C(=O)NC(C)(C)C)=C1NC(=O)C1=CC(OCF)=NN1C1=NC=CC=C1Cl UWKQSUQMFIRFMM-UHFFFAOYSA-N 0.000 description 1
- DPLHJUQFGXECAS-UHFFFAOYSA-N N-[3-(benzylcarbamoyl)-4-chlorophenyl]-2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-3-carboxamide Chemical compound CN1N=C(C(F)(F)C(F)(F)F)C(C(F)(F)F)=C1C(=O)NC1=CC=C(Cl)C(C(=O)NCC=2C=CC=CC=2)=C1 DPLHJUQFGXECAS-UHFFFAOYSA-N 0.000 description 1
- OAWUUPVZMNKZRY-UHFFFAOYSA-N N-[4-(cyclopropylcarbamoyl)phenyl]sulfonyl-2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(=O)NS(=O)(=O)C1=CC=C(C(=O)NC2CC2)C=C1 OAWUUPVZMNKZRY-UHFFFAOYSA-N 0.000 description 1
- YNKFZRGTXAPYFD-UHFFFAOYSA-N N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1Cl YNKFZRGTXAPYFD-UHFFFAOYSA-N 0.000 description 1
- UTXLNSPIBIMGQJ-UHFFFAOYSA-N N-[[2-chloro-6-(trifluoromethyl)phenyl]methyl]-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CN1N=C(C(F)F)C(C(=O)N(CC=2C(=CC=CC=2Cl)C(F)(F)F)C2CC2)=C1F UTXLNSPIBIMGQJ-UHFFFAOYSA-N 0.000 description 1
- POIXHZKAAMCWOT-UHFFFAOYSA-N N-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CN1N=C(C(F)F)C(C(=O)N(CC=2C(=CC=C(Cl)C=2F)C(F)(F)F)C2CC2)=C1F POIXHZKAAMCWOT-UHFFFAOYSA-N 0.000 description 1
- HEMPTJWLSOMNER-UHFFFAOYSA-N N-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CN1N=C(C(F)F)C(C(=O)N(CC=2C(=CC=C(Cl)C=2)C(F)(F)F)C2CC2)=C1F HEMPTJWLSOMNER-UHFFFAOYSA-N 0.000 description 1
- YSVBFKLFADDJEI-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-N-[(2-propan-2-ylphenyl)methyl]pyrazole-4-carbothioamide Chemical compound CC(C)C1=CC=CC=C1CN(C(=S)C=1C(=NN(C)C=1F)C(F)F)C1CC1 YSVBFKLFADDJEI-UHFFFAOYSA-N 0.000 description 1
- GZSDSDAVLHAHBW-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-N-[[5-methyl-2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxamide Chemical compound CC1=CC=C(C(F)(F)F)C(CN(C2CC2)C(=O)C=2C(=NN(C)C=2F)C(F)F)=C1 GZSDSDAVLHAHBW-UHFFFAOYSA-N 0.000 description 1
- YBQVYCCAGISJDK-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-5-fluoro-N-[(2-fluoro-6-propan-2-ylphenyl)methyl]-1-methylpyrazole-4-carboxamide Chemical compound CC(C)C1=CC=CC(F)=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 YBQVYCCAGISJDK-UHFFFAOYSA-N 0.000 description 1
- KBWODRLEGDCUHW-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-5-fluoro-N-[(5-fluoro-2-propan-2-ylphenyl)methyl]-1-methylpyrazole-4-carboxamide Chemical compound CC(C)C1=CC=C(F)C=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 KBWODRLEGDCUHW-UHFFFAOYSA-N 0.000 description 1
- FLQNESNIAKFCNJ-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-N-[(2-ethyl-4,5-dimethylphenyl)methyl]-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CCC1=CC(C)=C(C)C=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 FLQNESNIAKFCNJ-UHFFFAOYSA-N 0.000 description 1
- QXZWXYMHKYWUJC-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-N-[(2-ethyl-5-fluorophenyl)methyl]-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CCC1=CC=C(F)C=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 QXZWXYMHKYWUJC-UHFFFAOYSA-N 0.000 description 1
- GVRURMVTCDBWMT-UHFFFAOYSA-N N-cyclopropyl-3-(difluoromethyl)-N-[(2-ethyl-5-methylphenyl)methyl]-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CCC1=CC=C(C)C=C1CN(C(=O)C=1C(=NN(C)C=1F)C(F)F)C1CC1 GVRURMVTCDBWMT-UHFFFAOYSA-N 0.000 description 1
- PBBIVBOBRLKLGM-UHFFFAOYSA-N N-cyclopropyl-N-[(2-cyclopropyl-5-fluorophenyl)methyl]-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CN1N=C(C(F)F)C(C(=O)N(CC=2C(=CC=C(F)C=2)C2CC2)C2CC2)=C1F PBBIVBOBRLKLGM-UHFFFAOYSA-N 0.000 description 1
- XTRVHRSUSXRHLB-UHFFFAOYSA-N N-cyclopropyl-N-[(2-cyclopropylphenyl)methyl]-3-(difluoromethyl)-5-fluoro-1-methylpyrazole-4-carboxamide Chemical compound CN1N=C(C(F)F)C(C(=O)N(CC=2C(=CC=CC=2)C2CC2)C2CC2)=C1F XTRVHRSUSXRHLB-UHFFFAOYSA-N 0.000 description 1
- AHJKPWGTBVOQFA-UHFFFAOYSA-N N-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazole-4-carboxamide Chemical compound C1CCC2=CC=CC=C2C1N(C)C(=O)C(N=1)=CSC=1C(CC1)CCN1C(=O)CN1N=C(C(F)(F)F)C=C1C AHJKPWGTBVOQFA-UHFFFAOYSA-N 0.000 description 1
- AHJKPWGTBVOQFA-QFIPXVFZSA-N N-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazole-4-carboxamide Chemical compound CN([C@@H]1C2=CC=CC=C2CCC1)C(=O)C(N=1)=CSC=1C(CC1)CCN1C(=O)CN1N=C(C(F)(F)F)C=C1C AHJKPWGTBVOQFA-QFIPXVFZSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N N-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- XQJQCBDIXRIYRP-UHFFFAOYSA-N N-{2-[1,1'-bi(cyclopropyl)-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1pyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1C(C2CC2)C1 XQJQCBDIXRIYRP-UHFFFAOYSA-N 0.000 description 1
- NCXMLFZGDNKEPB-FFPOYIOWSA-N Natamycin Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C[C@@H](C)OC(=O)/C=C/[C@H]2O[C@@H]2C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 NCXMLFZGDNKEPB-FFPOYIOWSA-N 0.000 description 1
- 229960003255 Natamycin Drugs 0.000 description 1
- 241000498271 Necator Species 0.000 description 1
- 241000124176 Neocosmospora Species 0.000 description 1
- 241000556984 Neonectria galligena Species 0.000 description 1
- 229960002715 Nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-JTQLQIEISA-N Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- CFRPSFYHXJZSBI-DHZHZOJOSA-N Nitenpyram Chemical compound [O-][N+](=O)/C=C(\NC)N(CC)CC1=CC=C(Cl)N=C1 CFRPSFYHXJZSBI-DHZHZOJOSA-N 0.000 description 1
- UKOTXHQERFPCBU-YQPARWETSA-N Nivalenol Chemical compound C([C@]12[C@@]3([C@H](O)[C@@H](O)[C@H]1O[C@@H]1C=C(C([C@@H](O)[C@@]13CO)=O)C)C)O2 UKOTXHQERFPCBU-YQPARWETSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 210000003458 Notochord Anatomy 0.000 description 1
- 101700024583 O162 Proteins 0.000 description 1
- 101700068111 O166 Proteins 0.000 description 1
- 101700070653 O167 Proteins 0.000 description 1
- 101700017789 O168 Proteins 0.000 description 1
- 101700079655 O171 Proteins 0.000 description 1
- HPMOLIHDZUCPIZ-KOLCDFICSA-N O[C@@](CC[C@@H]1CC1(Cl)Cl)(Cn1cncn1)C1(Cl)CC1 Chemical compound O[C@@](CC[C@@H]1CC1(Cl)Cl)(Cn1cncn1)C1(Cl)CC1 HPMOLIHDZUCPIZ-KOLCDFICSA-N 0.000 description 1
- HPMOLIHDZUCPIZ-GXSJLCMTSA-N O[C@](CC[C@H]1CC1(Cl)Cl)(Cn1cncn1)C1(Cl)CC1 Chemical compound O[C@](CC[C@H]1CC1(Cl)Cl)(Cn1cncn1)C1(Cl)CC1 HPMOLIHDZUCPIZ-GXSJLCMTSA-N 0.000 description 1
- 240000008881 Oenanthe javanica Species 0.000 description 1
- 235000000365 Oenanthe javanica Nutrition 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 241001147398 Ostrinia nubilalis Species 0.000 description 1
- YXLXNENXOJSQEI-UHFFFAOYSA-L Oxine-copper Chemical compound [Cu+2].C1=CN=C2C([O-])=CC=CC2=C1.C1=CN=C2C([O-])=CC=CC2=C1 YXLXNENXOJSQEI-UHFFFAOYSA-L 0.000 description 1
- IWVCMVBTMGNXQD-PXOLEDIWSA-N Oxytetracycline Chemical compound C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 description 1
- 229960000625 Oxytetracycline Drugs 0.000 description 1
- 239000004100 Oxytetracycline Substances 0.000 description 1
- LCCNCVORNKJIRZ-UHFFFAOYSA-N Parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
- 239000005813 Penconazole Substances 0.000 description 1
- 239000005815 Penflufen Substances 0.000 description 1
- 240000000064 Penicillium roqueforti Species 0.000 description 1
- 241000864371 Penicillium viridicatum Species 0.000 description 1
- 241001149509 Penicillium vulpinum Species 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N Pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N Pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 1
- 229960000490 Permethrin Drugs 0.000 description 1
- 241000201565 Peronospora viciae f. sp. pisi Species 0.000 description 1
- 102000003992 Peroxidases Human genes 0.000 description 1
- 108090000437 Peroxidases Proteins 0.000 description 1
- 241000143552 Petriella Species 0.000 description 1
- 241000920636 Phaeoacremonium Species 0.000 description 1
- 241000440444 Phakopsora Species 0.000 description 1
- 241000440445 Phakopsora meibomiae Species 0.000 description 1
- SBNFWQZLDJGRLK-UHFFFAOYSA-N Phenothrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 SBNFWQZLDJGRLK-UHFFFAOYSA-N 0.000 description 1
- 229940067631 Phospholipids Drugs 0.000 description 1
- WNZQDUSMALZDQF-UHFFFAOYSA-N Phthalide Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N Phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 241000210649 Phyllosticta ampelicida Species 0.000 description 1
- 241001126998 Phytophthora brassicae Species 0.000 description 1
- 241001149949 Phytophthora cactorum Species 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 241000233624 Phytophthora megasperma Species 0.000 description 1
- 241000233647 Phytophthora nicotianae var. parasitica Species 0.000 description 1
- 239000005818 Picoxystrobin Substances 0.000 description 1
- 206010062080 Pigmentation disease Diseases 0.000 description 1
- 241000490567 Pinctada Species 0.000 description 1
- QHOQHJPRIBSPCY-UHFFFAOYSA-N Pirimiphos-methyl Chemical group CCN(CC)C1=NC(C)=CC(OP(=S)(OC)OC)=N1 QHOQHJPRIBSPCY-UHFFFAOYSA-N 0.000 description 1
- 241001503464 Plasmodiophora Species 0.000 description 1
- 241001503436 Plasmodiophora brassicae Species 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 239000005820 Prochloraz Substances 0.000 description 1
- WTFXJFJYEJZMFO-UHFFFAOYSA-N Propamidine Chemical compound C1=CC(C(=N)N)=CC=C1OCCCOC1=CC=C(C(N)=N)C=C1 WTFXJFJYEJZMFO-UHFFFAOYSA-N 0.000 description 1
- 239000005821 Propamocarb Substances 0.000 description 1
- WZZLDXDUQPOXNW-UHFFFAOYSA-N Propamocarb Chemical compound CCCOC(=O)NCCCN(C)C WZZLDXDUQPOXNW-UHFFFAOYSA-N 0.000 description 1
- MKIMSXGUTQTKJU-UHFFFAOYSA-N Propamocarb hydrochloride Chemical compound [Cl-].CCCOC(=O)NCCC[NH+](C)C MKIMSXGUTQTKJU-UHFFFAOYSA-N 0.000 description 1
- ZYHMJXZULPZUED-UHFFFAOYSA-N Propargite Chemical compound C1=CC(C(C)(C)C)=CC=C1OC1C(OS(=O)OCC#C)CCCC1 ZYHMJXZULPZUED-UHFFFAOYSA-N 0.000 description 1
- 239000005822 Propiconazole Substances 0.000 description 1
- STJLVHWMYQXCPB-UHFFFAOYSA-N Propiconazole Chemical compound O1C(CCC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 STJLVHWMYQXCPB-UHFFFAOYSA-N 0.000 description 1
- 239000005823 Propineb Substances 0.000 description 1
- 241000241446 Propolis farinosa Species 0.000 description 1
- 239000005825 Prothioconazole Substances 0.000 description 1
- 235000009827 Prunus armeniaca Nutrition 0.000 description 1
- 240000005204 Prunus armeniaca Species 0.000 description 1
- 240000002799 Prunus avium Species 0.000 description 1
- 240000005809 Prunus persica Species 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 229960003351 Prussian blue Drugs 0.000 description 1
- 241000947836 Pseudomonadaceae Species 0.000 description 1
- 229940055023 Pseudomonas aeruginosa Drugs 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241001281805 Pseudoperonospora cubensis Species 0.000 description 1
- 241000342307 Pseudoperonospora humuli Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- JOOMJVFZQRQWKR-UHFFFAOYSA-N Pyrazophos Chemical compound N1=C(C)C(C(=O)OCC)=CN2N=C(OP(=S)(OCC)OCC)C=C21 JOOMJVFZQRQWKR-UHFFFAOYSA-N 0.000 description 1
- 241000228454 Pyrenophora graminea Species 0.000 description 1
- 241000520648 Pyrenophora teres Species 0.000 description 1
- 241000190117 Pyrenophora tritici-repentis Species 0.000 description 1
- 229940070846 Pyrethrins Drugs 0.000 description 1
- 239000005663 Pyridaben Substances 0.000 description 1
- 239000005927 Pyriproxyfen Substances 0.000 description 1
- NHDHVHZZCFYRSB-UHFFFAOYSA-N Pyriproxyfen Chemical compound C=1C=CC=NC=1OC(C)COC(C=C1)=CC=C1OC1=CC=CC=C1 NHDHVHZZCFYRSB-UHFFFAOYSA-N 0.000 description 1
- 241000220324 Pyrus Species 0.000 description 1
- 241001505297 Pythium irregulare Species 0.000 description 1
- 241001622896 Pythium myriotylum Species 0.000 description 1
- 241000918584 Pythium ultimum Species 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N Quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 240000007742 Raphanus sativus Species 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 241000244178 Rhabditidae Species 0.000 description 1
- 241001633102 Rhizobiaceae Species 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241000235546 Rhizopus stolonifer Species 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N Rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 229940043267 Rhodamine B Drugs 0.000 description 1
- 241000208422 Rhododendron Species 0.000 description 1
- 241000220222 Rosaceae Species 0.000 description 1
- 241001635171 Rosellinia pepo Species 0.000 description 1
- 229940080817 Rotenone Drugs 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- MSHXTAQSSIEBQS-UHFFFAOYSA-N S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydron;chloride Chemical compound [Cl-].NC(=O)SCC([NH+](C)C)CSC(N)=O MSHXTAQSSIEBQS-UHFFFAOYSA-N 0.000 description 1
- 241000277331 Salmonidae Species 0.000 description 1
- 241000172147 Saprolegnia diclina Species 0.000 description 1
- 241001460075 Saprolegnia parasitica Species 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- 235000010495 Sarothamnus scoparius Nutrition 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241001558929 Sclerotium <basidiomycota> Species 0.000 description 1
- 239000005834 Sedaxane Substances 0.000 description 1
- 241001597359 Septoria apiicola Species 0.000 description 1
- 241001533580 Septoria lycopersici Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000757444 Setosphaeria holmii Species 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N Silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000005835 Silthiofam Substances 0.000 description 1
- 210000003491 Skin Anatomy 0.000 description 1
- 102000018674 Sodium Channels Human genes 0.000 description 1
- 108010052164 Sodium Channels Proteins 0.000 description 1
- CCCGEKHKTPTUHJ-ZJUUUORDSA-N Solatenol Chemical compound C1([C@]2([H])CC[C@]3(C2=C(Cl)Cl)[H])=C3C=CC=C1NC(=O)C1=CN(C)N=C1C(F)F CCCGEKHKTPTUHJ-ZJUUUORDSA-N 0.000 description 1
- 239000005930 Spinosad Substances 0.000 description 1
- 239000005664 Spirodiclofen Substances 0.000 description 1
- 239000005837 Spiroxamine Substances 0.000 description 1
- 241001279361 Stachybotrys Species 0.000 description 1
- 229940076185 Staphylococcus aureus Drugs 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000187747 Streptomyces Species 0.000 description 1
- 229960005322 Streptomycin Drugs 0.000 description 1
- XIUROWKZWPIAIB-UHFFFAOYSA-N Sulfotep Chemical compound CCOP(=S)(OCC)OP(=S)(OCC)OCC XIUROWKZWPIAIB-UHFFFAOYSA-N 0.000 description 1
- 239000005934 Sulfoxaflor Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L Sulphite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 102000003563 TRPV Human genes 0.000 description 1
- 108060008564 TRPV Proteins 0.000 description 1
- 241001540766 Talaromyces purpureogenus Species 0.000 description 1
- 241000228446 Taphrina Species 0.000 description 1
- 241000228448 Taphrina deformans Species 0.000 description 1
- 241000916145 Tarsonemidae Species 0.000 description 1
- XOAAWQZATWQOTB-UHFFFAOYSA-N Taurine Chemical class NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 1
- 239000005839 Tebuconazole Substances 0.000 description 1
- PXMNMQRDXWABCY-UHFFFAOYSA-N Tebuconazole Chemical compound C1=NC=NN1CC(O)(C(C)(C)C)CCC1=CC=C(Cl)C=C1 PXMNMQRDXWABCY-UHFFFAOYSA-N 0.000 description 1
- 239000005937 Tebufenozide Substances 0.000 description 1
- QYPNKSZPJQQLRK-UHFFFAOYSA-N Tebufenozide Chemical compound C1=CC(CC)=CC=C1C(=O)NN(C(C)(C)C)C(=O)C1=CC(C)=CC(C)=C1 QYPNKSZPJQQLRK-UHFFFAOYSA-N 0.000 description 1
- 239000005938 Teflubenzuron Substances 0.000 description 1
- 239000005939 Tefluthrin Substances 0.000 description 1
- ZFHGXWPMULPQSE-SZGBIDFHSA-N Tefluthrin Chemical compound FC1=C(F)C(C)=C(F)C(F)=C1COC(=O)[C@@H]1C(C)(C)[C@@H]1\C=C(/Cl)C(F)(F)F ZFHGXWPMULPQSE-SZGBIDFHSA-N 0.000 description 1
- WWJZWCUNLNYYAU-UHFFFAOYSA-N Temefos Chemical compound C1=CC(OP(=S)(OC)OC)=CC=C1SC1=CC=C(OP(=S)(OC)OC)C=C1 WWJZWCUNLNYYAU-UHFFFAOYSA-N 0.000 description 1
- 239000005840 Tetraconazole Substances 0.000 description 1
- MLGCXEBRWGEOQX-UHFFFAOYSA-N Tetradifon Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl MLGCXEBRWGEOQX-UHFFFAOYSA-N 0.000 description 1
- 239000005940 Thiacloprid Substances 0.000 description 1
- HOKKPVIRMVDYPB-UVTDQMKNSA-N Thiacloprid Chemical compound C1=NC(Cl)=CC=C1CN1C(=N/C#N)/SCC1 HOKKPVIRMVDYPB-UVTDQMKNSA-N 0.000 description 1
- 239000005941 Thiamethoxam Substances 0.000 description 1
- NWWZPOKUUAIXIW-FLIBITNWSA-N Thiamethoxam Chemical compound [O-][N+](=O)\N=C/1N(C)COCN\1CC1=CN=C(Cl)S1 NWWZPOKUUAIXIW-FLIBITNWSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N Thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 239000005842 Thiophanate-methyl Substances 0.000 description 1
- 235000015450 Tilia cordata Nutrition 0.000 description 1
- 240000006909 Tilia x europaea Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000722093 Tilletia caries Species 0.000 description 1
- 241000722096 Tilletia controversa Species 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- YWSCPYYRJXKUDB-KAKFPZCNSA-N Tralomethrin Chemical compound CC1(C)[C@@H](C(Br)C(Br)(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 YWSCPYYRJXKUDB-KAKFPZCNSA-N 0.000 description 1
- DDVNRFNDOPPVQJ-HQJQHLMTSA-N Transfluthrin Chemical compound CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)OCC1=C(F)C(F)=CC(F)=C1F DDVNRFNDOPPVQJ-HQJQHLMTSA-N 0.000 description 1
- AMFGTOFWMRQMEM-UHFFFAOYSA-N Triazofos Chemical compound N1=C(OP(=S)(OCC)OCC)N=CN1C1=CC=CC=C1 AMFGTOFWMRQMEM-UHFFFAOYSA-N 0.000 description 1
- 239000005847 Triazoxide Substances 0.000 description 1
- 229940016279 Trichlorfon Drugs 0.000 description 1
- 241000223261 Trichoderma viride Species 0.000 description 1
- DQJCHOQLCLEDLL-UHFFFAOYSA-O Tricyclazole Chemical compound CC1=CC=CC2=C1N1C=N[NH+]=C1S2 DQJCHOQLCLEDLL-UHFFFAOYSA-O 0.000 description 1
- YTOPFCCWCSOHFV-UHFFFAOYSA-N Tridemorph Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 1
- 239000005857 Trifloxystrobin Substances 0.000 description 1
- JPUKWEQWGBDDQB-QVHTVSSGSA-N Trifolin Natural products O[C@@H]1[C@H](O)[C@@H](O)[C@@H](CO)O[C@H]1OC1=C(C=2C=CC(O)=CC=2)OC2=CC(O)=CC(O)=C2C1=O JPUKWEQWGBDDQB-QVHTVSSGSA-N 0.000 description 1
- NJVOZLGKTAPUTQ-UHFFFAOYSA-M Triphenyltin chloride Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 NJVOZLGKTAPUTQ-UHFFFAOYSA-M 0.000 description 1
- 239000005859 Triticonazole Substances 0.000 description 1
- 241000333201 Typhula incarnata Species 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- 241000221576 Uromyces Species 0.000 description 1
- 241000221566 Ustilago Species 0.000 description 1
- 241000007070 Ustilago nuda Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 1
- 241001123668 Verticillium dahliae Species 0.000 description 1
- 241000726445 Viroids Species 0.000 description 1
- 241000219094 Vitaceae Species 0.000 description 1
- JFLRKDZMHNBDQS-GQHNJWLYSA-N XPA88EAP6V Chemical compound C([C@@H](OC(=O)C[C@H]1[C@@H]2C=C[C@@H]3C[C@H](C[C@H]3[C@@H]2C=C1C(=O)[C@@H]1C)O[C@H]2[C@@H]([C@H](OC)[C@@H](OC)[C@H](C)O2)OC)CC)CCC1O[C@H]1CC[C@H](N(C)C)[C@@H](C)O1.C([C@@H](OC(=O)C[C@H]1[C@@H]2C=C(C)[C@@H]3C[C@H](C[C@H]3[C@@H]2C=C1C(=O)[C@@H]1C)O[C@H]2[C@@H]([C@H](OC)[C@@H](OC)[C@H](C)O2)OC)CC)CCC1O[C@H]1CC[C@H](N(C)C)[C@@H](C)O1 JFLRKDZMHNBDQS-GQHNJWLYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N Xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 241000589634 Xanthomonas Species 0.000 description 1
- MBMQEIFVQACCCH-QBODLPLBSA-N Zearalenone Chemical compound O=C1O[C@@H](C)CCCC(=O)CCC\C=C\C2=CC(O)=CC(O)=C21 MBMQEIFVQACCCH-QBODLPLBSA-N 0.000 description 1
- 235000005042 Zier Kohl Nutrition 0.000 description 1
- 239000006011 Zinc phosphide Substances 0.000 description 1
- 241000758405 Zoopagomycotina Species 0.000 description 1
- 239000005863 Zoxamide Substances 0.000 description 1
- FZSVSABTBYGOQH-XFFZJAGNSA-N [(E)-(3,3-dimethyl-1-methylsulfanylbutan-2-ylidene)amino] N-methylcarbamate Chemical compound CNC(=O)O\N=C(C(C)(C)C)\CSC FZSVSABTBYGOQH-XFFZJAGNSA-N 0.000 description 1
- YLFSVIMMRPNPFK-HIMIUADYSA-N [(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-[(E)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](\C=C\C(=O)OC(C(F)(F)F)C(F)(F)F)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 YLFSVIMMRPNPFK-HIMIUADYSA-N 0.000 description 1
- MWFQAAWRPDRKDG-KOLCDFICSA-N [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound FC1=C(F)C(COC)=C(F)C(F)=C1COC(=O)[C@H]1C(C)(C)[C@@H]1C=C(Cl)Cl MWFQAAWRPDRKDG-KOLCDFICSA-N 0.000 description 1
- APEPLROGLDYWBS-UHFFFAOYSA-N [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate Chemical compound FC1=C(F)C(COC)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1(C)C APEPLROGLDYWBS-UHFFFAOYSA-N 0.000 description 1
- YDHZUCLRCLIJRL-UHFFFAOYSA-N [3-(4-chloro-2-fluorophenyl)-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol Chemical compound C=1C=CN=CC=1C(O)C=1C(C=2C(=CC(Cl)=CC=2)F)=NOC=1C1=CC=C(F)C=C1F YDHZUCLRCLIJRL-UHFFFAOYSA-N 0.000 description 1
- VROYMKJUVCKXBU-HDTXIYAQSA-N [6-[[(2E,8E)-11,17-dihydroxy-2,10,12,20-tetramethyl-13-[4-(3-methyl-3-propanoyloxiran-2-yl)pentan-2-yl]-15-oxo-14,21-dioxabicyclo[15.3.1]henicosa-2,8,19-trien-7-yl]oxy]-3-hydroxy-2-methyloxan-4-yl] carbamate Chemical compound CCC(=O)C1(C)OC1C(C)CC(C)C1C(C)C(O)C(C)/C=C/C(OC2OC(C)C(O)C(OC(N)=O)C2)CCC/C=C(C)/C(O2)C(C)=CCC2(O)CC(=O)O1 VROYMKJUVCKXBU-HDTXIYAQSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- YXWCBRDRVXHABN-JCMHNJIXSA-N [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 3-[(Z)-2-chloro-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carboxylate Chemical compound C=1C=C(F)C(OC=2C=CC=CC=2)=CC=1C(C#N)OC(=O)C1C(C)(C)C1\C=C(/Cl)C1=CC=C(Cl)C=C1 YXWCBRDRVXHABN-JCMHNJIXSA-N 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl-oxo-[1-[6-(trifluoromethyl)pyridin-3-yl]ethyl]-$l^{6}-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 230000000996 additive Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 238000004378 air conditioning Methods 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 125000005108 alkenylthio group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000005227 alkyl sulfonate group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000005109 alkynylthio group Chemical group 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229960003692 aminobutyric acid Drugs 0.000 description 1
- 229960002587 amitraz Drugs 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003042 antagnostic Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000003373 anti-fouling Effects 0.000 description 1
- 230000000111 anti-oxidant Effects 0.000 description 1
- 230000000692 anti-sense Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 235000004458 antinutrient Nutrition 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 238000009360 aquaculture Methods 0.000 description 1
- 244000144974 aquaculture Species 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 210000004883 areola Anatomy 0.000 description 1
- 235000019568 aromas Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic Chemical class [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- RRZXIRBKKLTSOM-XPNPUAGNSA-N avermectin B1a Chemical compound C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 RRZXIRBKKLTSOM-XPNPUAGNSA-N 0.000 description 1
- AKNQMEBLVAMSNZ-UHFFFAOYSA-N azaconazole Chemical compound ClC1=CC(Cl)=CC=C1C1(CN2N=CN=C2)OCCO1 AKNQMEBLVAMSNZ-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- ONHBDDJJTDTLIR-UHFFFAOYSA-N azocyclotin Chemical compound C1CCCCC1[Sn](N1N=CN=C1)(C1CCCCC1)C1CCCCC1 ONHBDDJJTDTLIR-UHFFFAOYSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- FYZBOYWSHKHDMT-UHFFFAOYSA-N benfuracarb Chemical compound CCOC(=O)CCN(C(C)C)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 FYZBOYWSHKHDMT-UHFFFAOYSA-N 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- BZMIHNKNQJJVRO-UHFFFAOYSA-N benzoximate Chemical compound COC=1C=CC(Cl)=C(OC)C=1C(=NOCC)OC(=O)C1=CC=CC=C1 BZMIHNKNQJJVRO-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000035514 bioavailability Effects 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 230000002051 biphasic Effects 0.000 description 1
- OIPMQULDKWSNGX-UHFFFAOYSA-N bis[[ethoxy(oxo)phosphaniumyl]oxy]alumanyloxy-ethoxy-oxophosphanium Chemical compound [Al+3].CCO[P+]([O-])=O.CCO[P+]([O-])=O.CCO[P+]([O-])=O OIPMQULDKWSNGX-UHFFFAOYSA-N 0.000 description 1
- CXNPLSGKWMLZPZ-ZNIXKSQXSA-N blasticidin S Chemical compound O1[C@H](C(O)=O)[C@@H](NC(=O)C[C@@H](N)CCN(C)C(N)=N)C=C[C@@H]1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-ZNIXKSQXSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 229940118790 boscalid Drugs 0.000 description 1
- WYEMLYFITZORAB-UHFFFAOYSA-N boscalid Chemical compound C1=CC(Cl)=CC=C1C1=CC=CC=C1NC(=O)C1=CC=CN=C1Cl WYEMLYFITZORAB-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- PRLVTUNWOQKEAI-UHFFFAOYSA-N buprofezin Chemical compound O=C1N(C(C)C)C(=NC(C)(C)C)SCN1C1=CC=CC=C1 PRLVTUNWOQKEAI-UHFFFAOYSA-N 0.000 description 1
- LUEHNHVFDCZTGL-UHFFFAOYSA-N but-2-ynoic acid Chemical compound CC#CC(O)=O LUEHNHVFDCZTGL-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000003913 calcium metabolism Effects 0.000 description 1
- QSLZFPQJJGGNFN-UHFFFAOYSA-N calcium;sulfane Chemical compound S.[Ca+2] QSLZFPQJJGGNFN-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000006013 carbendazim Substances 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N carbodiimide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000011111 cardboard Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N cdcl3 Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- PSOVNZZNOMJUBI-UHFFFAOYSA-N chlorantraniliprole Chemical compound CNC(=O)C1=CC(Cl)=CC(C)=C1NC(=O)C1=CC(Br)=NN1C1=NC=CC=C1Cl PSOVNZZNOMJUBI-UHFFFAOYSA-N 0.000 description 1
- BIWJNBZANLAXMG-UHFFFAOYSA-N chlordane Chemical compound ClC1=C(Cl)C2(Cl)C3CC(Cl)C(Cl)C3C1(Cl)C2(Cl)Cl BIWJNBZANLAXMG-UHFFFAOYSA-N 0.000 description 1
- UISUNVFOGSJSKD-UHFFFAOYSA-N chlorfluazuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OC1=NC=C(C(F)(F)F)C=C1Cl UISUNVFOGSJSKD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HKMOPYJWSFRURD-UHFFFAOYSA-N chloro hypochlorite;copper Chemical compound [Cu].ClOCl HKMOPYJWSFRURD-UHFFFAOYSA-N 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- PFIADAMVCJPXSF-UHFFFAOYSA-N chloroneb Chemical compound COC1=CC(Cl)=C(OC)C=C1Cl PFIADAMVCJPXSF-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- HRBKVYFZANMGRE-UHFFFAOYSA-N chlorpyrifos-methyl Chemical group COP(=S)(OC)OC1=NC(Cl)=C(Cl)C=C1Cl HRBKVYFZANMGRE-UHFFFAOYSA-N 0.000 description 1
- UXADOQPNKNTIHB-UHFFFAOYSA-N clofentezine Chemical compound ClC1=CC=CC=C1C1=NN=C(C=2C(=CC=CC=2)Cl)N=N1 UXADOQPNKNTIHB-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 235000019571 color Nutrition 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 235000018597 common camellia Nutrition 0.000 description 1
- 230000002860 competitive Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000001010 compromised Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910001956 copper hydroxide Inorganic materials 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- JOXAXMBQVHFGQT-UHFFFAOYSA-J copper;manganese(2+);N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[Cu+2].[S-]C(=S)NCCNC([S-])=S.[S-]C(=S)NCCNC([S-])=S JOXAXMBQVHFGQT-UHFFFAOYSA-J 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000005366 cycloalkylthio group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical class *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- LSFUGNKKPMBOMG-UHFFFAOYSA-N cycloprothrin Chemical compound ClC1(Cl)CC1(C=1C=CC=CC=1)C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 LSFUGNKKPMBOMG-UHFFFAOYSA-N 0.000 description 1
- 229960002483 decamethrin Drugs 0.000 description 1
- 230000003247 decreasing Effects 0.000 description 1
- 230000000593 degrading Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 229940019503 diflubenzuron Drugs 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- 235000019621 digestibility Nutrition 0.000 description 1
- CJHXCRMKMMBYJQ-UHFFFAOYSA-N dimethirimol Chemical compound CCCCC1=C(C)NC(N(C)C)=NC1=O CJHXCRMKMMBYJQ-UHFFFAOYSA-N 0.000 description 1
- SPCNPOWOBZQWJK-UHFFFAOYSA-N dimethoxy-(2-propan-2-ylsulfanylethylsulfanyl)-sulfanylidene-$l^{5}-phosphane Chemical compound COP(=S)(OC)SCCSC(C)C SPCNPOWOBZQWJK-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished Effects 0.000 description 1
- KARVSHNNUWMXFO-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane;hydrate Chemical compound O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Al]O[Al]=O KARVSHNNUWMXFO-UHFFFAOYSA-N 0.000 description 1
- PYZSVQVRHDXQSL-UHFFFAOYSA-N dithianon Chemical compound S1C(C#N)=C(C#N)SC2=C1C(=O)C1=CC=CC=C1C2=O PYZSVQVRHDXQSL-UHFFFAOYSA-N 0.000 description 1
- JMXKCYUTURMERF-UHFFFAOYSA-N dodemorph Chemical compound C1C(C)OC(C)CN1C1CCCCCCCCCCC1 JMXKCYUTURMERF-UHFFFAOYSA-N 0.000 description 1
- 230000005059 dormancy Effects 0.000 description 1
- 230000002222 downregulating Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010981 drying operation Methods 0.000 description 1
- 108010057988 ecdysone receptor Proteins 0.000 description 1
- AWZOLILCOUMRDG-UHFFFAOYSA-N edifenphos Chemical compound C=1C=CC=CC=1SP(=O)(OCC)SC1=CC=CC=C1 AWZOLILCOUMRDG-UHFFFAOYSA-N 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- VMNULHCTRPXWFJ-UJSVPXBISA-N enoxastrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1CO\N=C(/C)\C=C\C1=CC=C(Cl)C=C1 VMNULHCTRPXWFJ-UJSVPXBISA-N 0.000 description 1
- DWRKFAJEBUWTQM-UHFFFAOYSA-N etaconazole Chemical compound O1C(CC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 DWRKFAJEBUWTQM-UHFFFAOYSA-N 0.000 description 1
- HDERJYVLTPVNRI-UHFFFAOYSA-N ethene;ethenyl acetate Chemical group C=C.CC(=O)OC=C HDERJYVLTPVNRI-UHFFFAOYSA-N 0.000 description 1
- AIGRXSNSLVJMEA-UHFFFAOYSA-N ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1P(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-UHFFFAOYSA-N 0.000 description 1
- YKRQBWKLHCEKQH-KHPPLWFESA-N ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate Chemical compound CCOC(=O)C(\C#N)=C(/N)C1=CC=CC=C1 YKRQBWKLHCEKQH-KHPPLWFESA-N 0.000 description 1
- OWTAHMVGGMMDFQ-YWQXDYITSA-N ethyl N-[4-[[(Z)-[7-[(8Z)-8-[[4-(ethoxycarbonylamino)anilino]methylidene]-1,6-dihydroxy-3-methyl-7-oxo-5-propan-2-ylnaphthalen-2-yl]-3,8-dihydroxy-6-methyl-2-oxo-4-propan-2-ylnaphthalen-1-ylidene]methyl]amino]phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC)=CC=C1N\C=C/1C2=C(O)C(C=3C(=C4C(=C/NC=5C=CC(NC(=O)OCC)=CC=5)/C(=O)C(O)=C(C(C)C)C4=CC=3C)O)=C(C)C=C2C(C(C)C)=C(O)C\1=O OWTAHMVGGMMDFQ-YWQXDYITSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- IXSZQYVWNJNRAL-UHFFFAOYSA-N etoxazole Chemical compound CCOC1=CC(C(C)(C)C)=CC=C1C1N=C(C=2C(=CC=CC=2F)F)OC1 IXSZQYVWNJNRAL-UHFFFAOYSA-N 0.000 description 1
- KQTVWCSONPJJPE-UHFFFAOYSA-N etridiazole Chemical compound CCOC1=NC(C(Cl)(Cl)Cl)=NS1 KQTVWCSONPJJPE-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- JISACBWYRJHSMG-UHFFFAOYSA-N famphur Chemical compound COP(=S)(OC)OC1=CC=C(S(=O)(=O)N(C)C)C=C1 JISACBWYRJHSMG-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- HOXINJBQVZWYGZ-UHFFFAOYSA-N fenbutatin oxide Chemical compound C=1C=CC=CC=1C(C)(C)C[Sn](O[Sn](CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C1=CC=CC=C1 HOXINJBQVZWYGZ-UHFFFAOYSA-N 0.000 description 1
- VDLGAVXLJYLFDH-UHFFFAOYSA-N fenhexamid Chemical compound C=1C=C(O)C(Cl)=C(Cl)C=1NC(=O)C1(C)CCCCC1 VDLGAVXLJYLFDH-UHFFFAOYSA-N 0.000 description 1
- UTOHZQYBSYOOGC-UHFFFAOYSA-N fenpyrazamine Chemical compound O=C1N(C(C)C)N(C(=O)SCC=C)C(N)=C1C1=CC=CC=C1C UTOHZQYBSYOOGC-UHFFFAOYSA-N 0.000 description 1
- 229940013764 fipronil Drugs 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- ZGNITFSDLCMLGI-UHFFFAOYSA-N flubendiamide Chemical compound CC1=CC(C(F)(C(F)(F)F)C(F)(F)F)=CC=C1NC(=O)C1=CC=CC(I)=C1C(=O)NC(C)(C)CS(C)(=O)=O ZGNITFSDLCMLGI-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- KVDJTXBXMWJJEF-UHFFFAOYSA-N fluopyram Chemical compound ClC1=CC(C(F)(F)F)=CN=C1CCNC(=O)C1=CC=CC=C1C(F)(F)F KVDJTXBXMWJJEF-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- IPENDKRRWFURRE-UHFFFAOYSA-N fluoroimide Chemical compound C1=CC(F)=CC=C1N1C(=O)C(Cl)=C(Cl)C1=O IPENDKRRWFURRE-UHFFFAOYSA-N 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- UFEODZBUAFNAEU-NLRVBDNBSA-N fluoxastrobin Chemical compound C=1C=CC=C(OC=2C(=C(OC=3C(=CC=CC=3)Cl)N=CN=2)F)C=1C(=N/OC)\C1=NOCCO1 UFEODZBUAFNAEU-NLRVBDNBSA-N 0.000 description 1
- GNVDAZSPJWCIQZ-UHFFFAOYSA-N flusulfamide Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 GNVDAZSPJWCIQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 235000015203 fruit juice Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000003008 fumonisin Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 235000021021 grapes Nutrition 0.000 description 1
- 238000004156 green chemistry Methods 0.000 description 1
- 239000003966 growth inhibitor Substances 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- GBAWQJNHVWMTLU-UHFFFAOYSA-N heptenophos Chemical compound C1=CCC2C(OP(=O)(OC)OC)=C(Cl)C21 GBAWQJNHVWMTLU-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 230000003054 hormonal Effects 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 229930000073 hydroprenes Natural products 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- AGKSTYPVMZODRV-UHFFFAOYSA-N imibenconazole Chemical compound C1=CC(Cl)=CC=C1CSC(CN1N=CN=C1)=NC1=CC=C(Cl)C=C1Cl AGKSTYPVMZODRV-UHFFFAOYSA-N 0.000 description 1
- 229940056881 imidacloprid Drugs 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 1
- VBCVPMMZEGZULK-NRFANRHFSA-N indoxacarb Chemical compound C([C@@]1(OC2)C(=O)OC)C3=CC(Cl)=CC=C3C1=NN2C(=O)N(C(=O)OC)C1=CC=C(OC(F)(F)F)C=C1 VBCVPMMZEGZULK-NRFANRHFSA-N 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000000968 intestinal Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- QTYCMDBMOLSEAM-UHFFFAOYSA-N ipconazole Chemical compound C1=NC=NN1CC1(O)C(C(C)C)CCC1CC1=CC=C(Cl)C=C1 QTYCMDBMOLSEAM-UHFFFAOYSA-N 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 229910000460 iron oxide Inorganic materials 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- CAVJXSIWUWTTQE-UHFFFAOYSA-N iron(2+);oxygen(2-);titanium(2+) Chemical compound [O-2].[O-2].[Ti+2].[Fe+2] CAVJXSIWUWTTQE-UHFFFAOYSA-N 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-M isobutyrate Chemical compound CC(C)C([O-])=O KQNPFQTWMSNSAP-UHFFFAOYSA-M 0.000 description 1
- YFVOXLJXJBQDEF-UHFFFAOYSA-N isocarbophos Chemical compound COP(N)(=S)OC1=CC=CC=C1C(=O)OC(C)C YFVOXLJXJBQDEF-UHFFFAOYSA-N 0.000 description 1
- HOQADATXFBOEGG-UHFFFAOYSA-N isofenphos Chemical compound CCOP(=S)(NC(C)C)OC1=CC=CC=C1C(=O)OC(C)C HOQADATXFBOEGG-UHFFFAOYSA-N 0.000 description 1
- QBSJMKIUCUGGNG-UHFFFAOYSA-N isoprocarb Chemical compound CNC(=O)OC1=CC=CC=C1C(C)C QBSJMKIUCUGGNG-UHFFFAOYSA-N 0.000 description 1
- 230000000366 juvenile Effects 0.000 description 1
- JPUKWEQWGBDDQB-DTGCRPNFSA-N kaempferol 3-O-β-D-galactoside Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1OC1=C(C=2C=CC(O)=CC=2)OC2=CC(O)=CC(O)=C2C1=O JPUKWEQWGBDDQB-DTGCRPNFSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229960000521 lufenuron Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000036244 malformation Effects 0.000 description 1
- 229920000940 maneb Polymers 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- KLGMSAOQDHLCOS-UHFFFAOYSA-N mecarbam Chemical compound CCOC(=O)N(C)C(=O)CSP(=S)(OCC)OCC KLGMSAOQDHLCOS-UHFFFAOYSA-N 0.000 description 1
- 230000001404 mediated Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- CIFWZNRJIBNXRE-UHFFFAOYSA-N mepanipyrim Chemical compound CC#CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 CIFWZNRJIBNXRE-UHFFFAOYSA-N 0.000 description 1
- BCTQJXQXJVLSIG-UHFFFAOYSA-N mepronil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C)=C1 BCTQJXQXJVLSIG-UHFFFAOYSA-N 0.000 description 1
- ZQEIXNIJLIKNTD-GFCCVEGCSA-N metalaxyl-M Chemical compound COCC(=O)N([C@H](C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-GFCCVEGCSA-N 0.000 description 1
- 229930002897 methoprenes Natural products 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- QCAWEPFNJXQPAN-UHFFFAOYSA-N methoxyfenozide Chemical compound COC1=CC=CC(C(=O)NN(C(=O)C=2C=C(C)C=C(C)C=2)C(C)(C)C)=C1C QCAWEPFNJXQPAN-UHFFFAOYSA-N 0.000 description 1
- KZAUOCCYDRDERY-UITAMQMPSA-N methyl (1Z)-2-(dimethylamino)-N-(methylcarbamoyloxy)-2-oxoethanimidothioate Chemical compound CNC(=O)O\N=C(/SC)C(=O)N(C)C KZAUOCCYDRDERY-UITAMQMPSA-N 0.000 description 1
- ONCZDRURRATYFI-QTCHDTBASA-N methyl (2Z)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate Chemical compound CO\N=C(/C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-QTCHDTBASA-N 0.000 description 1
- GEPDYQSQVLXLEU-AATRIKPKSA-N methyl (E)-3-dimethoxyphosphoryloxybut-2-enoate Chemical compound COC(=O)\C=C(/C)OP(=O)(OC)OC GEPDYQSQVLXLEU-AATRIKPKSA-N 0.000 description 1
- LDWLDRDKNBEKMZ-UHFFFAOYSA-N methyl 3-(2,2-dimethyl-1,3-dihydroinden-1-yl)imidazole-4-carboxylate Chemical compound COC(=O)C1=CN=CN1C1C(C)(C)CC2=CC=CC=C21 LDWLDRDKNBEKMZ-UHFFFAOYSA-N 0.000 description 1
- HWGXPHSUTYGITL-GFCCVEGCSA-N methyl 4-[(2R)-6-methyl-4-oxoheptan-2-yl]benzoate Chemical class COC(=O)C1=CC=C([C@H](C)CC(=O)CC(C)C)C=C1 HWGXPHSUTYGITL-GFCCVEGCSA-N 0.000 description 1
- RYICNEMTMSZLOX-UHFFFAOYSA-N methyl N-[[3,5-dibromo-2-[[5-bromo-2-(3-chloropyridin-2-yl)pyrazole-3-carbonyl]amino]benzoyl]-ethylamino]carbamate Chemical compound COC(=O)NN(CC)C(=O)C1=CC(Br)=CC(Br)=C1NC(=O)C1=CC(Br)=NN1C1=NC=CC=C1Cl RYICNEMTMSZLOX-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- LGDSHSYDSCRFAB-UHFFFAOYSA-N methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229960001952 metrifonate Drugs 0.000 description 1
- 239000011785 micronutrient Substances 0.000 description 1
- 235000013369 micronutrients Nutrition 0.000 description 1
- ZLBGSRMUSVULIE-GSMJGMFJSA-N milbemycin A3 Chemical compound O1[C@H](C)[C@@H](C)CC[C@@]11O[C@H](C\C=C(C)\C[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 ZLBGSRMUSVULIE-GSMJGMFJSA-N 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000011490 mineral wool Substances 0.000 description 1
- 230000011278 mitosis Effects 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 229930014694 morphine Natural products 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 229940113083 morpholine Drugs 0.000 description 1
- 238000002703 mutagenesis Methods 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OZGNYLLQHRPOBR-DHZHZOJOSA-N naftifine Chemical compound C=1C=CC2=CC=CC=C2C=1CN(C)C\C=C\C1=CC=CC=C1 OZGNYLLQHRPOBR-DHZHZOJOSA-N 0.000 description 1
- 229960004313 naftifine Drugs 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000004311 natamycin Substances 0.000 description 1
- 235000010298 natamycin Nutrition 0.000 description 1
- 229940042880 natural phospholipids Drugs 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 229930014626 natural products Natural products 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 229930015196 nicotine Natural products 0.000 description 1
- 229940079888 nitenpyram Drugs 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229930002915 nivalenols Natural products 0.000 description 1
- 108010003516 norsynephrine receptor Proteins 0.000 description 1
- 238000001668 nucleic acid synthesis Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 125000005069 octynyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C#C* 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000010292 orthophenyl phenol Nutrition 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 230000010627 oxidative phosphorylation Effects 0.000 description 1
- 125000004430 oxygen atoms Chemical group O* 0.000 description 1
- 235000019366 oxytetracycline Nutrition 0.000 description 1
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical group COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 1
- 230000001776 parthenogenetic Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 235000021017 pears Nutrition 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 230000000361 pesticidal Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- JGCSKOVQDXEQHI-UHFFFAOYSA-N phenazine-1-carboxylic acid Chemical compound C1=CC=C2N=C3C(C(=O)O)=CC=CC3=NC2=C1 JGCSKOVQDXEQHI-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 229960003536 phenothrin Drugs 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- FZTWZIMSKAGPSB-UHFFFAOYSA-N phosphide(3-) Chemical compound [P-3] FZTWZIMSKAGPSB-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 230000029553 photosynthesis Effects 0.000 description 1
- 238000010672 photosynthesis Methods 0.000 description 1
- 230000000243 photosynthetic Effects 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- IBSNKSODLGJUMQ-SDNWHVSQSA-N picoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1COC1=CC=CC(C(F)(F)F)=N1 IBSNKSODLGJUMQ-SDNWHVSQSA-N 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- 230000037039 plant physiology Effects 0.000 description 1
- 230000004260 plant-type cell wall biogenesis Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000011120 plywood Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 150000004291 polyenes Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- WHHIPMZEDGBUCC-UHFFFAOYSA-N probenazole Chemical compound C1=CC=C2C(OCC=C)=NS(=O)(=O)C2=C1 WHHIPMZEDGBUCC-UHFFFAOYSA-N 0.000 description 1
- TVLSRXXIMLFWEO-UHFFFAOYSA-N prochloraz Chemical compound C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl TVLSRXXIMLFWEO-UHFFFAOYSA-N 0.000 description 1
- QXJKBPAVAHBARF-BETUJISGSA-N procymidone Chemical compound O=C([C@]1(C)C[C@@]1(C1=O)C)N1C1=CC(Cl)=CC(Cl)=C1 QXJKBPAVAHBARF-BETUJISGSA-N 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- KKMLIVYBGSAJPM-UHFFFAOYSA-L propineb Chemical compound [Zn+2].[S-]C(=S)NC(C)CNC([S-])=S KKMLIVYBGSAJPM-UHFFFAOYSA-L 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N propyl 3,4,5-trihydroxybenzoate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- 235000010388 propyl gallate Nutrition 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- YRRBXJLFCBCKNW-UHFFFAOYSA-N prothiocarb Chemical compound CCSC(=O)NCCCN(C)C YRRBXJLFCBCKNW-UHFFFAOYSA-N 0.000 description 1
- FITIWKDOCAUBQD-UHFFFAOYSA-N prothiofos Chemical compound CCCSP(=S)(OCC)OC1=CC=C(Cl)C=C1Cl FITIWKDOCAUBQD-UHFFFAOYSA-N 0.000 description 1
- 210000001938 protoplasts Anatomy 0.000 description 1
- DWTVBEZBWMDXIY-UHFFFAOYSA-N pyrametostrobin Chemical compound COC(=O)N(OC)C1=CC=CC=C1COC1=C(C)C(C=2C=CC=CC=2)=NN1C DWTVBEZBWMDXIY-UHFFFAOYSA-N 0.000 description 1
- URXNNPCNKVAQRA-XMHGGMMESA-N pyraoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1COC1=CC(C=2C=CC(Cl)=CC=2)=NN1C URXNNPCNKVAQRA-XMHGGMMESA-N 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- CRFYLQMIDWBKRT-LPYMAVHISA-N pyribencarb Chemical compound C1=C(Cl)C(CNC(=O)OC)=CC(C(\C)=N\OCC=2N=C(C)C=CC=2)=C1 CRFYLQMIDWBKRT-LPYMAVHISA-N 0.000 description 1
- DWFZBUWUXWZWKD-UHFFFAOYSA-N pyridaben Chemical compound C1=CC(C(C)(C)C)=CC=C1CSC1=C(Cl)C(=O)N(C(C)(C)C)N=C1 DWFZBUWUXWZWKD-UHFFFAOYSA-N 0.000 description 1
- CXJSOEPQXUCJSA-UHFFFAOYSA-N pyridaphenthion Chemical compound N1=C(OP(=S)(OCC)OCC)C=CC(=O)N1C1=CC=CC=C1 CXJSOEPQXUCJSA-UHFFFAOYSA-N 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- ITKAIUGKVKDENI-UHFFFAOYSA-N pyrimidifen Chemical compound CC1=C(C)C(CCOCC)=CC=C1OCCNC1=NC=NC(CC)=C1Cl ITKAIUGKVKDENI-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- BAUQXSYUDSNRHL-UHFFFAOYSA-N pyrimorph Chemical compound C1=CC(C(C)(C)C)=CC=C1C(C=1C=NC(Cl)=CC=1)=CC(=O)N1CCOCC1 BAUQXSYUDSNRHL-UHFFFAOYSA-N 0.000 description 1
- 229910052904 quartz Inorganic materials 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- DRYRBWIFRVMRPV-UHFFFAOYSA-N quinazolin-4-amine Chemical compound C1=CC=C2C(N)=NC=NC2=C1 DRYRBWIFRVMRPV-UHFFFAOYSA-N 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- FBQQHUGEACOBDN-UHFFFAOYSA-N quinomethionate Chemical compound N1=C2SC(=O)SC2=NC2=CC(C)=CC=C21 FBQQHUGEACOBDN-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000035812 respiration Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 102000037170 ryanodine receptor (TC 1.A.3.1) family Human genes 0.000 description 1
- 108091006220 ryanodine receptor (TC 1.A.3.1) family Proteins 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 239000003620 semiochemical Substances 0.000 description 1
- 230000001953 sensory Effects 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 239000004460 silage Substances 0.000 description 1
- 230000001743 silencing Effects 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N silicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- MXMXHPPIGKYTAR-UHFFFAOYSA-N silthiofam Chemical compound CC=1SC([Si](C)(C)C)=C(C(=O)NCC=C)C=1C MXMXHPPIGKYTAR-UHFFFAOYSA-N 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000003195 sodium channel blocking agent Substances 0.000 description 1
- IYYIUOWKEMQYNV-UHFFFAOYSA-N sodium;ethoxy-oxido-oxophosphanium Chemical compound [Na+].CCO[P+]([O-])=O IYYIUOWKEMQYNV-UHFFFAOYSA-N 0.000 description 1
- 239000007944 soluble tablet Substances 0.000 description 1
- 229940014213 spinosad Drugs 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- DTDSAWVUFPGDMX-UHFFFAOYSA-N spirodiclofen Chemical compound CCC(C)(C)C(=O)OC1=C(C=2C(=CC(Cl)=CC=2)Cl)C(=O)OC11CCCCC1 DTDSAWVUFPGDMX-UHFFFAOYSA-N 0.000 description 1
- PUYXTUJWRLOUCW-UHFFFAOYSA-N spiroxamine Chemical compound O1C(CN(CC)CCC)COC11CCC(C(C)(C)C)CC1 PUYXTUJWRLOUCW-UHFFFAOYSA-N 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000005936 tau-Fluvalinate Substances 0.000 description 1
- CJDWRQLODFKPEL-UHFFFAOYSA-N teflubenzuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC(Cl)=C(F)C(Cl)=C1F CJDWRQLODFKPEL-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
- 125000006300 thietan-3-yl group Chemical group [H]C1([H])SC([H])([H])C1([H])* 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- DNVLJEWNNDHELH-UHFFFAOYSA-N thiocyclam Chemical compound CN(C)C1CSSSC1 DNVLJEWNNDHELH-UHFFFAOYSA-N 0.000 description 1
- BAKXBZPQTXCKRR-UHFFFAOYSA-N thiodicarb Chemical compound CSC(C)=NOC(=O)NSNC(=O)ON=C(C)SC BAKXBZPQTXCKRR-UHFFFAOYSA-N 0.000 description 1
- OPASCBHCTNRLRM-UHFFFAOYSA-N thiometon Chemical compound CCSCCSP(=S)(OC)OC OPASCBHCTNRLRM-UHFFFAOYSA-N 0.000 description 1
- YFNCATAIYKQPOO-UHFFFAOYSA-N thiophanate Chemical compound CCOC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OCC YFNCATAIYKQPOO-UHFFFAOYSA-N 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- YIBACQHAKISWLZ-UHFFFAOYSA-N thiophene-2-sulfonohydrazide Chemical compound NNS(=O)(=O)C1=CC=CS1 YIBACQHAKISWLZ-UHFFFAOYSA-N 0.000 description 1
- QSOHVSNIQHGFJU-UHFFFAOYSA-L thiosultap disodium Chemical compound [Na+].[Na+].[O-]S(=O)(=O)SCC(N(C)C)CSS([O-])(=O)=O QSOHVSNIQHGFJU-UHFFFAOYSA-L 0.000 description 1
- RSOBJVBYZCMJOS-CYBMUJFWSA-N tolprocarb Chemical compound FC(F)(F)COC(=O)N[C@@H](C(C)C)CNC(=O)C1=CC=C(C)C=C1 RSOBJVBYZCMJOS-CYBMUJFWSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 230000014616 translation Effects 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-M triacetate(1-) Chemical compound CC(=O)CC(=O)CC([O-])=O ILJSQTXMGCGYMG-UHFFFAOYSA-M 0.000 description 1
- NKNFWVNSBIXGLL-UHFFFAOYSA-N triazamate Chemical compound CCOC(=O)CSC1=NC(C(C)(C)C)=NN1C(=O)N(C)C NKNFWVNSBIXGLL-UHFFFAOYSA-N 0.000 description 1
- IQGKIPDJXCAMSM-UHFFFAOYSA-N triazoxide Chemical compound N=1C2=CC=C(Cl)C=C2[N+]([O-])=NC=1N1C=CN=C1 IQGKIPDJXCAMSM-UHFFFAOYSA-N 0.000 description 1
- NFACJZMKEDPNKN-UHFFFAOYSA-N trichlorfon Chemical compound COP(=O)(OC)C(O)C(Cl)(Cl)Cl NFACJZMKEDPNKN-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- UGCNRZFAUBJVPT-UHFFFAOYSA-N tricyclohexyltin;hydrate Chemical compound O.C1CCCCC1[Sn](C1CCCCC1)C1CCCCC1 UGCNRZFAUBJVPT-UHFFFAOYSA-N 0.000 description 1
- NRHFWOJROOQKBK-UHFFFAOYSA-N triphenyltin;hydrate Chemical compound O.C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 NRHFWOJROOQKBK-UHFFFAOYSA-N 0.000 description 1
- YNWVFADWVLCOPU-MAUPQMMJSA-N uniconazole P Chemical compound C1=NC=NN1/C([C@@H](O)C(C)(C)C)=C/C1=CC=C(Cl)C=C1 YNWVFADWVLCOPU-MAUPQMMJSA-N 0.000 description 1
- JARYYMUOCXVXNK-CSLFJTBJSA-N validamycin A Chemical compound N([C@H]1C[C@@H]([C@H]([C@H](O)[C@H]1O)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)CO)[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O JARYYMUOCXVXNK-CSLFJTBJSA-N 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 238000009369 viticulture Methods 0.000 description 1
- 239000000664 voltage gated sodium channel blocking agent Substances 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
- 239000005943 zeta-Cypermethrin Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 229940048462 zinc phosphide Drugs 0.000 description 1
- CHNQZRKUZPNOOH-UHFFFAOYSA-J zinc;manganese(2+);N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[Zn+2].[S-]C(=S)NCCNC([S-])=S.[S-]C(=S)NCCNC([S-])=S CHNQZRKUZPNOOH-UHFFFAOYSA-J 0.000 description 1
- FJBGIXKIXPUXBY-UHFFFAOYSA-N {2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl}(imidazol-1-yl)methanone Chemical compound C1=CN=CN1C(=O)N1C(C)(C)COC1(C)CCCC1=CC=C(Cl)C=C1 FJBGIXKIXPUXBY-UHFFFAOYSA-N 0.000 description 1
- INISTDXBRIBGOC-XMMISQBUSA-N τ-fluvalinate Chemical compound N([C@H](C(C)C)C(=O)OC(C#N)C=1C=C(OC=2C=CC=CC=2)C=CC=1)C1=CC=C(C(F)(F)F)C=C1Cl INISTDXBRIBGOC-XMMISQBUSA-N 0.000 description 1
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
IN201611035246 | 2016-10-14 | ||
IN201611035246 | 2016-10-14 | ||
PCT/IB2017/056277 WO2018069842A1 (en) | 2016-10-14 | 2017-10-11 | 4-amino substituted phenylamidine derivatives and their use to protect crops by fighting undesired phytopathogenic micoorganisms |
Publications (2)
Publication Number | Publication Date |
---|---|
JP2019532107A JP2019532107A (ja) | 2019-11-07 |
JPWO2018069842A5 true JPWO2018069842A5 (ru) | 2022-03-09 |
Family
ID=60320921
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2019541895A Pending JP2019532107A (ja) | 2016-10-14 | 2017-10-11 | 望ましくない植物病原性微生物と戦うことで作物を保護するための4−アミノ置換フェニルアミジン誘導体およびその使用 |
Country Status (13)
Country | Link |
---|---|
US (1) | US20190367445A1 (ru) |
EP (1) | EP3525589B1 (ru) |
JP (1) | JP2019532107A (ru) |
CN (1) | CN109890206A (ru) |
AR (1) | AR109949A1 (ru) |
AU (1) | AU2017342206B2 (ru) |
BR (1) | BR112019007483B1 (ru) |
CA (1) | CA3040408A1 (ru) |
MX (1) | MX2019004293A (ru) |
RU (1) | RU2019114164A (ru) |
TW (1) | TWI770071B (ru) |
UY (1) | UY37443A (ru) |
WO (1) | WO2018069842A1 (ru) |
Families Citing this family (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
TW201838965A (zh) * | 2017-04-20 | 2018-11-01 | 印度商Pi工業公司 | 新穎的苯胺化合物 |
BR112020020959A2 (pt) | 2018-04-16 | 2021-01-19 | Pi Industries Ltd. | Uso de compostos de fenilamidina 4-substituídospara controlar doenças de ferrugem em vegetais |
AR115966A1 (es) | 2018-08-17 | 2021-03-17 | Pi Industries Ltd | Compuestos de fenilamidina y sus usos |
AR117788A1 (es) | 2019-01-14 | 2021-08-25 | Pi Industries Ltd | Compuestos de fenilamidina 3-sustituida, preparación y uso |
Family Cites Families (33)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4173637A (en) | 1976-10-29 | 1979-11-06 | Ishihara Sangyo Kaisha Ltd. | N-Benzoyl-N'-pyridyloxy phenyl urea and insecticidal compositions thereof |
US5026730A (en) * | 1987-08-21 | 1991-06-25 | Ciba-Geigy Corporation | Anilinophenylthioureas, compositions containing them, and the use thereof in pest control |
JPH08291146A (ja) | 1995-02-20 | 1996-11-05 | Sankyo Co Ltd | 除草性n−(置換フェニル)スルホンアミド化合物 |
GB9902592D0 (en) * | 1999-02-06 | 1999-03-24 | Hoechst Schering Agrevo Gmbh | Fungicides |
FR2829362B1 (fr) | 2001-09-10 | 2003-11-07 | Aventis Cropscience Sa | Composition fongicide a base de derives d'arylamidine et de composes fongicides connus |
JP4186484B2 (ja) | 2002-03-12 | 2008-11-26 | 住友化学株式会社 | ピリミジン化合物およびその用途 |
UA78039C2 (en) | 2002-05-03 | 2007-02-15 | Du Pont | Amidinyl phenyl compounds, fungicide compositions and a method for controlling plants diseases |
GB0213715D0 (en) | 2002-06-14 | 2002-07-24 | Syngenta Ltd | Chemical compounds |
DE10229595A1 (de) | 2002-07-02 | 2004-01-15 | Bayer Cropscience Ag | Phenylbenzamide |
TWI312272B (en) | 2003-05-12 | 2009-07-21 | Sumitomo Chemical Co | Pyrimidine compound and pests controlling composition containing the same |
CA2558848C (en) | 2004-03-05 | 2013-11-19 | Nissan Chemical Industries, Ltd. | Isoxazoline-substituted benzamide compound and pesticide |
EP1570736A1 (en) | 2004-03-05 | 2005-09-07 | Bayer CropScience S.A. | Fungicide composition comprising an arylamidine derivative and known fungicide compounds |
MXPA06014019A (es) | 2004-06-03 | 2007-02-08 | Du Pont | Mezclas fungicidas de compuestos de amidinilfenilo. |
GB0414438D0 (en) | 2004-06-28 | 2004-07-28 | Syngenta Participations Ag | Chemical compounds |
AU2005296529B2 (en) | 2004-10-20 | 2011-03-24 | Ihara Chemical Industry Co., Ltd. | 3-triazolylphenyl sulfide derivative and insecticide/acaricide/nematicide containing the same as active ingredient |
DE102007010801A1 (de) * | 2007-03-02 | 2008-09-04 | Bayer Cropscience Ag | Diaminopyrimidine als Fungizide |
EP1969931A1 (de) * | 2007-03-12 | 2008-09-17 | Bayer CropScience Aktiengesellschaft | Fluoalkylphenylamidine und deren Verwendung als Fungizide |
WO2008134969A1 (fr) | 2007-04-30 | 2008-11-13 | Sinochem Corporation | Composés benzamides et leurs applications |
GB0720126D0 (en) | 2007-10-15 | 2007-11-28 | Syngenta Participations Ag | Chemical compounds |
WO2009088549A2 (en) * | 2007-10-19 | 2009-07-16 | The Board Of Regents Of The University Of Texas System | Methods of inhibiting bacterial virulence and compounds relating thereto |
TWI411395B (zh) | 2007-12-24 | 2013-10-11 | Syngenta Participations Ag | 殺蟲化合物 |
TWI401023B (zh) | 2008-02-06 | 2013-07-11 | Du Pont | 中離子農藥 |
CN101337940B (zh) | 2008-08-12 | 2012-05-02 | 国家农药创制工程技术研究中心 | 具杀虫活性的含氮杂环二氯烯丙醚类化合物 |
EP2184273A1 (de) | 2008-11-05 | 2010-05-12 | Bayer CropScience AG | Halogen-substituierte Verbindungen als Pestizide |
EP2223917A1 (de) | 2009-02-02 | 2010-09-01 | Bayer CropScience AG | Isothiazolyloxyphenylamidine und deren Verwendung als Fungizide |
EP2531484B1 (en) | 2010-02-03 | 2016-08-17 | Syngenta Participations AG | Insecticidal compounds |
ES2626601T3 (es) | 2010-06-28 | 2017-07-25 | Bayer Intellectual Property Gmbh | Compuestos heterocíclicos como pesticidas |
NZ703862A (en) | 2010-08-31 | 2016-08-26 | Meiji Seika Pharma Co Ltd | Noxious organism control agent |
CN102060818B (zh) | 2011-01-07 | 2012-02-01 | 青岛科技大学 | 一种新型螺螨酯类化合物及其制法与用途 |
CN102057925B (zh) | 2011-01-21 | 2013-04-10 | 陕西上格之路生物科学有限公司 | 一种含噻虫酰胺和生物源类杀虫剂的杀虫组合物 |
WO2013144213A1 (en) | 2012-03-30 | 2013-10-03 | Basf Se | N-substituted pyridinylidene compounds and derivatives for combating animal pests |
BR112015017414A2 (pt) * | 2013-01-23 | 2017-07-11 | Hoffmann La Roche | derivados de triazol antivirais |
CN103450112B (zh) * | 2013-08-07 | 2019-09-13 | 华东理工大学 | 一种n-桥连接的含氮五元杂环化合物及其制备与用途 |
-
2017
- 2017-10-11 JP JP2019541895A patent/JP2019532107A/ja active Pending
- 2017-10-11 EP EP17797733.7A patent/EP3525589B1/en active Active
- 2017-10-11 CA CA3040408A patent/CA3040408A1/en not_active Abandoned
- 2017-10-11 WO PCT/IB2017/056277 patent/WO2018069842A1/en unknown
- 2017-10-11 BR BR112019007483-0A patent/BR112019007483B1/pt active IP Right Grant
- 2017-10-11 US US16/341,463 patent/US20190367445A1/en not_active Abandoned
- 2017-10-11 MX MX2019004293A patent/MX2019004293A/es unknown
- 2017-10-11 RU RU2019114164A patent/RU2019114164A/ru unknown
- 2017-10-11 CN CN201780063684.1A patent/CN109890206A/zh active Pending
- 2017-10-11 AU AU2017342206A patent/AU2017342206B2/en active Active
- 2017-10-13 TW TW106135027A patent/TWI770071B/zh active
- 2017-10-13 UY UY0001037443A patent/UY37443A/es not_active Application Discontinuation
- 2017-10-13 AR ARP170102867A patent/AR109949A1/es unknown
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CN110087466B (zh) | 活性化合物结合物 | |
TWI825003B (zh) | 4-經取代之苯基胺衍生物及其藉由對抗不要的植物病原性真菌而保護作物之用途 | |
CN111712495A (zh) | 羟基异*唑啉及其衍生物 | |
TWI770071B (zh) | 4-經取代之苯胺衍生物及其在對抗不欲之植物病原微生物以保護作物上之用途 | |
JP2020513413A (ja) | フェニルアミジン類及びそれの殺菌剤としての使用 | |
JPWO2018069841A5 (ru) | ||
US11524934B2 (en) | Phenylamine compounds | |
JPWO2018069842A5 (ru) | ||
EA023170B1 (ru) | Замещенные производные фенил(окси/тио)алканолов | |
RU2796397C2 (ru) | Производные 4-замещенного фениламина и их применение для защиты культур от нежелательных фитопатогенных микроорганизмов | |
RU2796397C9 (ru) | Производные 4-замещенного фениламина и их применение для защиты культур от нежелательных фитопатогенных микроорганизмов | |
CN109890795A (zh) | 新的5-取代的咪唑衍生物 | |
JP2019530689A (ja) | 殺菌剤としての5−置換イミダゾリルメチルオキシラン誘導体 | |
BR112019021835B1 (pt) | Novos compostos de fenilamina |