JPS64382B2 - - Google Patents
Info
- Publication number
- JPS64382B2 JPS64382B2 JP9748681A JP9748681A JPS64382B2 JP S64382 B2 JPS64382 B2 JP S64382B2 JP 9748681 A JP9748681 A JP 9748681A JP 9748681 A JP9748681 A JP 9748681A JP S64382 B2 JPS64382 B2 JP S64382B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- formula
- lower alkyl
- phenoxy
- propionic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 52
- -1 phenoxypropionate ester Chemical class 0.000 claims description 41
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 125000005843 halogen group Chemical group 0.000 claims description 26
- 230000002363 herbicidal effect Effects 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 23
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 239000004009 herbicide Substances 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- XIKRHZPYZYARLS-UHFFFAOYSA-N 1-phenylmethoxypropan-2-yl 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoate Chemical compound C=1C=C(OC=2C(=CC(Cl)=CN=2)Cl)C=CC=1OC(C)C(=O)OC(C)COCC1=CC=CC=C1 XIKRHZPYZYARLS-UHFFFAOYSA-N 0.000 claims description 2
- KNOUUEYNFHXIEM-UHFFFAOYSA-N 2-phenylmethoxyethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C=1C=CC=CC=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 KNOUUEYNFHXIEM-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- SJSIKMPGHJLKMD-UHFFFAOYSA-N 1-phenylmethoxypropan-2-yl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C=1C=C(OC=2C=CC(=CC=2)C(F)(F)F)C=CC=1OC(C)C(=O)OC(C)COCC1=CC=CC=C1 SJSIKMPGHJLKMD-UHFFFAOYSA-N 0.000 claims 1
- BVPSASAWYIPTIJ-UHFFFAOYSA-N 2-(1-phenylethoxy)ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C=1C=CC=CC=1C(C)OCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 BVPSASAWYIPTIJ-UHFFFAOYSA-N 0.000 claims 1
- HZRSJETYNMBYKJ-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]ethyl 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoate Chemical compound C=1C=CC=C(F)C=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=NC=C(Cl)C=C1Cl HZRSJETYNMBYKJ-UHFFFAOYSA-N 0.000 claims 1
- CTVLBBBHXAAPPO-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C=1C=CC=C(F)C=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 CTVLBBBHXAAPPO-UHFFFAOYSA-N 0.000 claims 1
- TZLANYAEIQMUGT-UHFFFAOYSA-N 2-[(4-chlorophenyl)methoxy]ethyl 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoate Chemical compound C=1C=C(Cl)C=CC=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=NC=C(Cl)C=C1Cl TZLANYAEIQMUGT-UHFFFAOYSA-N 0.000 claims 1
- VMAKMZQHRCAKNJ-UHFFFAOYSA-N 2-phenylmethoxyethyl 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoate Chemical compound C=1C=CC=CC=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=NC=C(Cl)C=C1Cl VMAKMZQHRCAKNJ-UHFFFAOYSA-N 0.000 claims 1
- UKGCEYHGLOIEMF-UHFFFAOYSA-N 3-phenylmethoxypropyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C=1C=CC=CC=1COCCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 UKGCEYHGLOIEMF-UHFFFAOYSA-N 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 38
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 238000012360 testing method Methods 0.000 description 26
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 24
- 125000001246 bromo group Chemical group Br* 0.000 description 24
- 241000196324 Embryophyta Species 0.000 description 21
- 229910052736 halogen Chemical group 0.000 description 19
- 235000019260 propionic acid Nutrition 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 238000004519 manufacturing process Methods 0.000 description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 15
- 239000002689 soil Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 150000002367 halogens Chemical group 0.000 description 12
- 238000000034 method Methods 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 230000008929 regeneration Effects 0.000 description 8
- 238000011069 regeneration method Methods 0.000 description 8
- 238000005507 spraying Methods 0.000 description 8
- 244000025254 Cannabis sativa Species 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 6
- 125000005037 alkyl phenyl group Chemical group 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000003905 agrochemical Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 239000004372 Polyvinyl alcohol Substances 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 125000001188 haloalkyl group Chemical group 0.000 description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 description 4
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 235000016068 Berberis vulgaris Nutrition 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 3
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 244000088415 Raphanus sativus Species 0.000 description 3
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 125000006501 nitrophenyl group Chemical group 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 3
- 238000009333 weeding Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- KJBPYIUAQLPHJG-UHFFFAOYSA-N 1-phenylmethoxypropan-2-ol Chemical compound CC(O)COCC1=CC=CC=C1 KJBPYIUAQLPHJG-UHFFFAOYSA-N 0.000 description 2
- SXERGJJQSKIUIC-UHFFFAOYSA-N 2-Phenoxypropionic acid Chemical class OC(=O)C(C)OC1=CC=CC=C1 SXERGJJQSKIUIC-UHFFFAOYSA-N 0.000 description 2
- MCVIDUDFKDIJMZ-UHFFFAOYSA-N 2-[(2,6-dichlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=C(Cl)C=CC=C1Cl MCVIDUDFKDIJMZ-UHFFFAOYSA-N 0.000 description 2
- VOTIBUBWWVMJIZ-UHFFFAOYSA-N 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 VOTIBUBWWVMJIZ-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- FJFSSESWAFPCSU-UHFFFAOYSA-N 4-[4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 FJFSSESWAFPCSU-UHFFFAOYSA-N 0.000 description 2
- 241000254032 Acrididae Species 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 229910021417 amorphous silicon Inorganic materials 0.000 description 2
- 229940072049 amyl acetate Drugs 0.000 description 2
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 229940111131 antiinflammatory and antirheumatic product propionic acid derivative Drugs 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 2
- 239000002734 clay mineral Substances 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910052901 montmorillonite Inorganic materials 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 150000005599 propionic acid derivatives Chemical class 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- SGIMSNMXCMANKD-UHFFFAOYSA-N 1-(1-phenylethoxy)propan-2-ol Chemical compound CC(O)COC(C)C1=CC=CC=C1 SGIMSNMXCMANKD-UHFFFAOYSA-N 0.000 description 1
- SZHZBCXOGSJKTH-UHFFFAOYSA-N 1-[(2-fluorophenyl)methoxy]propan-2-ol Chemical compound CC(O)COCC1=CC=CC=C1F SZHZBCXOGSJKTH-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- BMHHGQVJEGDNJM-UHFFFAOYSA-N 2-(1-phenylethoxy)ethanol Chemical compound OCCOC(C)C1=CC=CC=C1 BMHHGQVJEGDNJM-UHFFFAOYSA-N 0.000 description 1
- FOIJABNATICWDL-UHFFFAOYSA-N 2-(4-hydroxyphenoxy)-5-(trifluoromethyl)benzonitrile Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1C#N FOIJABNATICWDL-UHFFFAOYSA-N 0.000 description 1
- WCMHEWRMRSJVHY-UHFFFAOYSA-N 2-[(2,4-dichlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Cl)C=C1Cl WCMHEWRMRSJVHY-UHFFFAOYSA-N 0.000 description 1
- RHPLYFZTWLENEV-UHFFFAOYSA-N 2-[(2-bromophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1Br RHPLYFZTWLENEV-UHFFFAOYSA-N 0.000 description 1
- PJWBNHPIMROMAC-UHFFFAOYSA-N 2-[(2-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1Cl PJWBNHPIMROMAC-UHFFFAOYSA-N 0.000 description 1
- WGPCGEJBQSXQRF-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1F WGPCGEJBQSXQRF-UHFFFAOYSA-N 0.000 description 1
- TUACQCVHBZGPSE-UHFFFAOYSA-N 2-[(2-methoxyphenyl)methoxy]ethanol Chemical compound COC1=CC=CC=C1COCCO TUACQCVHBZGPSE-UHFFFAOYSA-N 0.000 description 1
- VUXGDVWWLLCKPD-UHFFFAOYSA-N 2-[(2-methylphenyl)methoxy]ethanol Chemical compound CC1=CC=CC=C1COCCO VUXGDVWWLLCKPD-UHFFFAOYSA-N 0.000 description 1
- VJYYYCCOBZQXGZ-UHFFFAOYSA-N 2-[(2-nitrophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1[N+]([O-])=O VJYYYCCOBZQXGZ-UHFFFAOYSA-N 0.000 description 1
- IFPCMFBCDKXOSS-UHFFFAOYSA-N 2-[(3,4-dichlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Cl)C(Cl)=C1 IFPCMFBCDKXOSS-UHFFFAOYSA-N 0.000 description 1
- NNAYEKVPAWDFCP-UHFFFAOYSA-N 2-[(3-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC(Cl)=C1 NNAYEKVPAWDFCP-UHFFFAOYSA-N 0.000 description 1
- QNTPWFDJZDQATN-UHFFFAOYSA-N 2-[(3-fluorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC(F)=C1 QNTPWFDJZDQATN-UHFFFAOYSA-N 0.000 description 1
- JXWPMFOAMPWOOC-UHFFFAOYSA-N 2-[(3-nitrophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC([N+]([O-])=O)=C1 JXWPMFOAMPWOOC-UHFFFAOYSA-N 0.000 description 1
- LLQTUWZOWFAZCE-UHFFFAOYSA-N 2-[(4-bromophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Br)C=C1 LLQTUWZOWFAZCE-UHFFFAOYSA-N 0.000 description 1
- QWKQPDIBDYVUIZ-UHFFFAOYSA-N 2-[(4-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Cl)C=C1 QWKQPDIBDYVUIZ-UHFFFAOYSA-N 0.000 description 1
- NFVKGIBDPOVUBA-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(F)C=C1 NFVKGIBDPOVUBA-UHFFFAOYSA-N 0.000 description 1
- HBIYGMPJJDCXAO-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]ethyl 2-chloropropanoate Chemical compound CC(Cl)C(=O)OCCOCC1=CC=C(F)C=C1 HBIYGMPJJDCXAO-UHFFFAOYSA-N 0.000 description 1
- PHXZOQVBYCJBHO-UHFFFAOYSA-N 2-[(4-methoxyphenyl)methoxy]ethanol Chemical compound COC1=CC=C(COCCO)C=C1 PHXZOQVBYCJBHO-UHFFFAOYSA-N 0.000 description 1
- GKXYPNNNDBCLFB-UHFFFAOYSA-N 2-[(4-methylphenyl)methoxy]ethanol Chemical compound CC1=CC=C(COCCO)C=C1 GKXYPNNNDBCLFB-UHFFFAOYSA-N 0.000 description 1
- DFVNUJKDFNZLMP-UHFFFAOYSA-N 2-[(4-nitrophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C([N+]([O-])=O)C=C1 DFVNUJKDFNZLMP-UHFFFAOYSA-N 0.000 description 1
- ALRGGAOHSITTLL-UHFFFAOYSA-N 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(Cl)C=C1Cl ALRGGAOHSITTLL-UHFFFAOYSA-N 0.000 description 1
- YOSQIOLFKBRJFP-UHFFFAOYSA-N 2-[4-(2-chloro-4-cyanophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C#N)C=C1Cl YOSQIOLFKBRJFP-UHFFFAOYSA-N 0.000 description 1
- YFPKWYWEXOIAMB-UHFFFAOYSA-N 2-[4-(2-chloro-4-nitrophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1Cl YFPKWYWEXOIAMB-UHFFFAOYSA-N 0.000 description 1
- SVGBNTOHFITEDI-UHFFFAOYSA-N 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(Cl)C=C1Cl SVGBNTOHFITEDI-UHFFFAOYSA-N 0.000 description 1
- NADUNELKTNMTOZ-UHFFFAOYSA-N 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=NC=C(Cl)C=C1Cl NADUNELKTNMTOZ-UHFFFAOYSA-N 0.000 description 1
- WCXVEXZAIRDLDV-UHFFFAOYSA-N 2-[4-(3-chloro-5-nitropyridin-2-yl)oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=NC=C([N+]([O-])=O)C=C1Cl WCXVEXZAIRDLDV-UHFFFAOYSA-N 0.000 description 1
- NCDWVEBJXIGCME-UHFFFAOYSA-N 2-[4-(4-bromo-2-chlorophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(Br)C=C1Cl NCDWVEBJXIGCME-UHFFFAOYSA-N 0.000 description 1
- JFGFWPXGZFVPRC-UHFFFAOYSA-N 2-[4-(4-chloro-2-methylphenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(Cl)C=C1C JFGFWPXGZFVPRC-UHFFFAOYSA-N 0.000 description 1
- VVFWYXPSJGRZSK-UHFFFAOYSA-N 2-[4-(4-fluorophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(F)C=C1 VVFWYXPSJGRZSK-UHFFFAOYSA-N 0.000 description 1
- AGPMQMIGBILOFH-UHFFFAOYSA-N 2-[4-(4-nitrophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 AGPMQMIGBILOFH-UHFFFAOYSA-N 0.000 description 1
- UQMPVJUZDMUSFQ-UHFFFAOYSA-N 2-[4-(5-bromo-3-chloropyridin-2-yl)oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=NC=C(Br)C=C1Cl UQMPVJUZDMUSFQ-UHFFFAOYSA-N 0.000 description 1
- SVSYQGJTTGWBKK-UHFFFAOYSA-N 2-[4-(5-nitropyridin-2-yl)oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C([N+]([O-])=O)C=N1 SVSYQGJTTGWBKK-UHFFFAOYSA-N 0.000 description 1
- UANDLEYUOYVELM-UHFFFAOYSA-N 2-[4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=C(Cl)C=C(C(F)(F)F)C=C1Cl UANDLEYUOYVELM-UHFFFAOYSA-N 0.000 description 1
- FQFHACNYTWJRJN-UHFFFAOYSA-N 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=CC=C1C(F)(F)F FQFHACNYTWJRJN-UHFFFAOYSA-N 0.000 description 1
- OZLJNBZFWYGCCG-UHFFFAOYSA-N 2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl OZLJNBZFWYGCCG-UHFFFAOYSA-N 0.000 description 1
- RMUVDTZHLBLZQZ-UHFFFAOYSA-N 2-[4-[2-cyano-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1C#N RMUVDTZHLBLZQZ-UHFFFAOYSA-N 0.000 description 1
- QLXQTDLUCMZXHZ-UHFFFAOYSA-N 2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O QLXQTDLUCMZXHZ-UHFFFAOYSA-N 0.000 description 1
- HGSXKXIEHULGIE-UHFFFAOYSA-N 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl HGSXKXIEHULGIE-UHFFFAOYSA-N 0.000 description 1
- TYUOEWJHEUYOME-UHFFFAOYSA-N 2-[4-[4-chloro-2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(Cl)C=C1C(F)(F)F TYUOEWJHEUYOME-UHFFFAOYSA-N 0.000 description 1
- MPFAFDFUXJYUOH-UHFFFAOYSA-N 2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 MPFAFDFUXJYUOH-UHFFFAOYSA-N 0.000 description 1
- CUZKCNWZBXLAJX-UHFFFAOYSA-N 2-phenylmethoxyethanol Chemical compound OCCOCC1=CC=CC=C1 CUZKCNWZBXLAJX-UHFFFAOYSA-N 0.000 description 1
- UTALIXJUDXOJIW-UHFFFAOYSA-N 2-phenylmethoxyethyl 2-bromopropanoate Chemical compound CC(Br)C(=O)OCCOCC1=CC=CC=C1 UTALIXJUDXOJIW-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- YEYSOEFOGRDVJM-UHFFFAOYSA-N 3-[(2-fluorophenyl)methoxy]propan-1-ol Chemical compound OCCCOCC1=CC=CC=C1F YEYSOEFOGRDVJM-UHFFFAOYSA-N 0.000 description 1
- WVZIRLAVYREDMM-UHFFFAOYSA-N 3-[(4-fluorophenyl)methoxy]propan-1-ol Chemical compound OCCCOCC1=CC=C(F)C=C1 WVZIRLAVYREDMM-UHFFFAOYSA-N 0.000 description 1
- LFMHAVBLBNHVBH-UHFFFAOYSA-N 3-chloro-4-(4-hydroxyphenoxy)benzonitrile Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C#N)C=C1Cl LFMHAVBLBNHVBH-UHFFFAOYSA-N 0.000 description 1
- FUCYABRIJPUVAT-UHFFFAOYSA-N 3-phenylmethoxypropan-1-ol Chemical compound OCCCOCC1=CC=CC=C1 FUCYABRIJPUVAT-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- DPRSKCAGYLXDCY-UHFFFAOYSA-N 4-(2,4-dichlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Cl)C=C1Cl DPRSKCAGYLXDCY-UHFFFAOYSA-N 0.000 description 1
- VPNNDIAAGGTJQN-UHFFFAOYSA-N 4-(2-chloro-4-nitrophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1Cl VPNNDIAAGGTJQN-UHFFFAOYSA-N 0.000 description 1
- NWFAJOGQUGZVOS-UHFFFAOYSA-N 4-(3,5-dichloropyridin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C(Cl)C=C1Cl NWFAJOGQUGZVOS-UHFFFAOYSA-N 0.000 description 1
- PCNINHBGKGCUNJ-UHFFFAOYSA-N 4-(3,5-dichloropyridin-2-yl)oxyphenol;sodium Chemical compound [Na].C1=CC(O)=CC=C1OC1=NC=C(Cl)C=C1Cl PCNINHBGKGCUNJ-UHFFFAOYSA-N 0.000 description 1
- MOZYIPSLBFVKQU-UHFFFAOYSA-N 4-(3-chloro-5-nitropyridin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C([N+]([O-])=O)C=C1Cl MOZYIPSLBFVKQU-UHFFFAOYSA-N 0.000 description 1
- AJIHBUNFLVGSRK-UHFFFAOYSA-N 4-(4-bromo-2-chlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Br)C=C1Cl AJIHBUNFLVGSRK-UHFFFAOYSA-N 0.000 description 1
- KIVFDFJTCRMULF-UHFFFAOYSA-N 4-(4-fluorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(F)C=C1 KIVFDFJTCRMULF-UHFFFAOYSA-N 0.000 description 1
- DCCDSAOUQRQDEL-UHFFFAOYSA-N 4-(4-nitrophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 DCCDSAOUQRQDEL-UHFFFAOYSA-N 0.000 description 1
- BNMWRIDDXNLQJA-UHFFFAOYSA-N 4-(5-bromo-3-chloropyridin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C(Br)C=C1Cl BNMWRIDDXNLQJA-UHFFFAOYSA-N 0.000 description 1
- IDPORVCPULBGEV-UHFFFAOYSA-N 4-(5-nitropyridin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C([N+]([O-])=O)C=N1 IDPORVCPULBGEV-UHFFFAOYSA-N 0.000 description 1
- LQEVDEYHLYDYKQ-UHFFFAOYSA-N 4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=C(Cl)C=C(C(F)(F)F)C=C1Cl LQEVDEYHLYDYKQ-UHFFFAOYSA-N 0.000 description 1
- PAVKZCYKRPHZIQ-UHFFFAOYSA-N 4-[2-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC=C1C(F)(F)F PAVKZCYKRPHZIQ-UHFFFAOYSA-N 0.000 description 1
- XKBVEHVQDYRJCW-UHFFFAOYSA-N 4-[2-chloro-4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl XKBVEHVQDYRJCW-UHFFFAOYSA-N 0.000 description 1
- IWLRGEKAYJALDI-UHFFFAOYSA-N 4-[2-nitro-4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O IWLRGEKAYJALDI-UHFFFAOYSA-N 0.000 description 1
- NMJNUBBLJFJUKE-UHFFFAOYSA-N 4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl NMJNUBBLJFJUKE-UHFFFAOYSA-N 0.000 description 1
- ODMMFEGUNKFXLV-UHFFFAOYSA-N 4-[4-chloro-2-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Cl)C=C1C(F)(F)F ODMMFEGUNKFXLV-UHFFFAOYSA-N 0.000 description 1
- LXXDBPUREVMTMI-UHFFFAOYSA-N 4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 LXXDBPUREVMTMI-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 240000004731 Acer pseudoplatanus Species 0.000 description 1
- 235000002754 Acer pseudoplatanus Nutrition 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241000189415 Alopecurus aequalis Species 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 241000344765 Aspergillus elegans Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- YTEOZWJXRLOPAG-UHFFFAOYSA-N ClC=[C] Chemical compound ClC=[C] YTEOZWJXRLOPAG-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 240000003176 Digitaria ciliaris Species 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 239000004368 Modified starch Substances 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241001076438 Oxya japonica Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 235000006485 Platanus occidentalis Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241001092459 Rubus Species 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 244000010062 Setaria pumila Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- VBIIFPGSPJYLRR-UHFFFAOYSA-M Stearyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)C VBIIFPGSPJYLRR-UHFFFAOYSA-M 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000005108 alkenylthio group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000005667 attractant Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000006515 benzyloxy alkyl group Chemical group 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- VNSBYDPZHCQWNB-UHFFFAOYSA-N calcium;aluminum;dioxido(oxo)silane;sodium;hydrate Chemical compound O.[Na].[Al].[Ca+2].[O-][Si]([O-])=O VNSBYDPZHCQWNB-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 244000037666 field crops Species 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- QPPQHRDVPBTVEV-UHFFFAOYSA-N isopropyl dihydrogen phosphate Chemical compound CC(C)OP(O)(O)=O QPPQHRDVPBTVEV-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000011890 leaf development Effects 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011419 magnesium lime Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001741 organic sulfur group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (30)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9748681A JPS57212144A (en) | 1981-06-25 | 1981-06-25 | Substituted phenoxypropionic ester, its preparation, and herbicide |
| PH27376A PH18417A (en) | 1981-06-25 | 1982-05-31 | Substituted phenoxypropionates and herbicidal compositions |
| EP82105172A EP0068260B1 (de) | 1981-06-25 | 1982-06-14 | Substituierte Phenoxypropionate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
| AT82105172T ATE18390T1 (de) | 1981-06-25 | 1982-06-14 | Substituierte phenoxypropionate, verfahren zu ihrer herstellung und ihre verwendung als herbizide. |
| DE8282105172T DE3269600D1 (en) | 1981-06-25 | 1982-06-14 | Substituted phenoxypropionates, process for their preparation and their use as herbicides |
| PT75053A PT75053B (en) | 1981-06-25 | 1982-06-15 | Process for the preparation of an herbicidal composition containing substituted phenoxypropionates |
| US06/389,525 US4441913A (en) | 1981-06-25 | 1982-06-17 | Substituted phenoxypropionates and herbicidal compositions |
| NZ201042A NZ201042A (en) | 1981-06-25 | 1982-06-22 | Substituted phenoxypropionates and herbicidal compositions |
| DD82240964A DD202087A5 (de) | 1981-06-25 | 1982-06-22 | Herbizide mittel |
| IL66096A IL66096A (en) | 1981-06-25 | 1982-06-22 | Benzyloxyalkyl esters of substituted 4-phenoxy and 4-pyridinyloxy phenoxypropionic acids,their preparation and their use as herbicides |
| IL7320382A IL73203A (en) | 1981-06-25 | 1982-06-22 | Benzyloxyalkyl-2-halopropionates and their preparation |
| AU85091/82A AU556522B2 (en) | 1981-06-25 | 1982-06-22 | Phenoxypropionate esters, herbicides |
| TR21452A TR21452A (tr) | 1981-06-25 | 1982-06-23 | Yeni suebstitueye fenoksipropionatlar,bunlarin hazirlanisi icin bir usul ve yeni ara ueruenler ve bunlarin herbisidler olarak kullanilmalari |
| GR68546A GR76837B (es) | 1981-06-25 | 1982-06-23 | |
| CA000405784A CA1175839A (en) | 1981-06-25 | 1982-06-23 | Substituted phenoxypropionates and herbicidal compositions |
| ZA824488A ZA824488B (en) | 1981-06-25 | 1982-06-24 | Novel substituted phenoxypropionates, a process and new intermediates for their preparation and their use as herbicides |
| PL23708782A PL134782B1 (en) | 1981-06-25 | 1982-06-24 | Herbicide and method of obtaining new substituted phenoxyproprionates |
| CS471182A CS229683B2 (en) | 1981-06-25 | 1982-06-24 | Herbicide agent and manufacturing process of effective component |
| BR8203706A BR8203706A (pt) | 1981-06-25 | 1982-06-24 | Processo para a preparacao de fenoxipropionatos substituidos composicoes herbicidas e processo para o combate de ervas daninhas |
| DK285782A DK285782A (da) | 1981-06-25 | 1982-06-24 | Substituerede phenoxypropionater fremgangsmaader samt mellemprodukter til fremstilling heraf og deres anvendelse som herbicider |
| HU822065A HU189596B (en) | 1981-06-25 | 1982-06-25 | Herbicide compositions containing new substituted phenoxy-propionates as active agents and process for producing the active agents |
| ES513476A ES8307708A1 (es) | 1981-06-25 | 1982-06-25 | Procedimiento para la obtencion de fenoxipropionatos sustituidos. |
| KR8202834A KR880002413B1 (ko) | 1981-06-25 | 1982-06-25 | 페녹시프로피오네이트 제조방법 |
| CS831993A CS229699B2 (cs) | 1981-06-25 | 1983-03-23 | Způsob výroby nových substituovaných fenoxypropionátů |
| ES83522322A ES8406998A1 (es) | 1981-06-25 | 1983-05-12 | Procedimiento para la obtencion de fenoxipropionatos sustituidos. |
| ES522324A ES522324A0 (es) | 1981-06-25 | 1983-05-12 | Procedimiento para la obtencion de 2-(4-hidroxifenoxi)-propionatos. |
| ES522323A ES522323A0 (es) | 1981-06-25 | 1983-05-12 | Procedimiento para la obtencion de 2-halogenopropionatos sustituidos. |
| US06/546,216 US4584396A (en) | 1981-06-25 | 1983-12-12 | Substituted phenoxypropionates and herbicidal compositions |
| CA000444790A CA1234142A (en) | 1981-06-25 | 1984-01-05 | Substituted 2-halogenopropionates as intermediates for herbicides |
| IL73203A IL73203A0 (en) | 1981-06-25 | 1984-10-09 | Substituted 2-halopropionates and their preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9748681A JPS57212144A (en) | 1981-06-25 | 1981-06-25 | Substituted phenoxypropionic ester, its preparation, and herbicide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57212144A JPS57212144A (en) | 1982-12-27 |
| JPS64382B2 true JPS64382B2 (es) | 1989-01-06 |
Family
ID=14193598
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP9748681A Granted JPS57212144A (en) | 1981-06-25 | 1981-06-25 | Substituted phenoxypropionic ester, its preparation, and herbicide |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS57212144A (es) |
| CS (1) | CS229683B2 (es) |
| PL (1) | PL134782B1 (es) |
| ZA (1) | ZA824488B (es) |
-
1981
- 1981-06-25 JP JP9748681A patent/JPS57212144A/ja active Granted
-
1982
- 1982-06-24 ZA ZA824488A patent/ZA824488B/xx unknown
- 1982-06-24 CS CS471182A patent/CS229683B2/cs unknown
- 1982-06-24 PL PL23708782A patent/PL134782B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL134782B1 (en) | 1985-09-30 |
| PL237087A1 (en) | 1984-05-21 |
| CS229683B2 (en) | 1984-06-18 |
| JPS57212144A (en) | 1982-12-27 |
| ZA824488B (en) | 1983-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4713109A (en) | 2-(4-(5-chloro-3-fluoropyridin-2-yloxy)phenoxy)-propionic acid-propynyl ester with herbicidal activity | |
| WO2001060783A1 (fr) | Derives de phenacylamine, production de ces derives et agents de lutte contre les ravageurs contenant ces derives | |
| EP0353187A2 (de) | Neue Herbizide | |
| JPH0640813A (ja) | 除草性２，６−置換ピリジン | |
| HU181666B (en) | Herbicide compositions and process for preparing the unsaturated esters of alpha-/4-/3',5'-dihalo-pyridyl-2'-oxy/-phenoxy/-propionic acids and -propionic-thiolacids applied as active substances | |
| DK164595B (da) | 3-methoxy-2-pyridyl-methylacrylater, fremgangsmaade til fremstilling deraf, middel indeholdende forbindelserne og disses eller midlets anvendelse til bekaempelse af svampe | |
| KR860000321B1 (ko) | 퀴녹살리닐옥시 에테르의 제조방법 | |
| RU2049775C1 (ru) | N-фенилкарбаматное соединение и фунгицидная композиция | |
| JPH0529221B2 (es) | ||
| US4477276A (en) | Heterocyclic phenyl ethers and their herbicidal use | |
| JP2003508519A (ja) | 農薬としてのテトラヒドロピリジン | |
| US4441913A (en) | Substituted phenoxypropionates and herbicidal compositions | |
| US4500346A (en) | Substituted phenoxypropionates and herbicidal compositions containing same and their herbicidal use | |
| JPH0416468B2 (es) | ||
| JPS64382B2 (es) | ||
| JP4799744B2 (ja) | フェナシルアミン誘導体、それらの製造方法及びそれらを含有する有害生物防除剤 | |
| US4931452A (en) | N-cyanomethyl-2-pyridinone insecticides | |
| CA1196644A (en) | Substituted phenoxypropionic acid esters and intermediates thereof, processes for production thereof and herbicide | |
| JPS58183688A (ja) | オキサジアゾ−ル誘導体、その製法及び除草剤 | |
| GB1579635A (en) | Sulphenamides and their use in pesticidal compositions | |
| KR880002413B1 (ko) | 페녹시프로피오네이트 제조방법 | |
| EP0086747B1 (de) | Neue Phenoxy-phenoxy-alkanoyl-thioamide als Herbizide | |
| EP0201775A2 (en) | Derivative of propionic acid and selective herbicide containing the same | |
| JPH01230555A (ja) | ２−〔４−（３−クロロ−５−トリフルオロメチル−２−ピリジルオキシ）−フェノキシ〕プロピオン酸エステル誘導体 | |
| JPH01139579A (ja) | ピリジルオキシフェノキシプロピオン酸エステル誘導体 |