JPS6337112B2 - - Google Patents
Info
- Publication number
- JPS6337112B2 JPS6337112B2 JP53158173A JP15817378A JPS6337112B2 JP S6337112 B2 JPS6337112 B2 JP S6337112B2 JP 53158173 A JP53158173 A JP 53158173A JP 15817378 A JP15817378 A JP 15817378A JP S6337112 B2 JPS6337112 B2 JP S6337112B2
- Authority
- JP
- Japan
- Prior art keywords
- amino
- syn
- carbon atoms
- acid
- thiazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 cyano, nitro, aminocarbonyl Chemical group 0.000 claims description 99
- 238000000034 method Methods 0.000 claims description 39
- 125000004432 carbon atom Chemical group C* 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical class C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 claims description 14
- 230000008569 process Effects 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 150000001718 carbodiimides Chemical class 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 5
- 125000004185 ester group Chemical group 0.000 claims description 5
- 125000004665 trialkylsilyl group Chemical group 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 125000004472 dialkylaminosulfonyl group Chemical group 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 239000012024 dehydrating agents Substances 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000001425 triazolyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- 230000010933 acylation Effects 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 125000004043 oxo group Chemical group O=* 0.000 claims 1
- 125000001113 thiadiazolyl group Chemical group 0.000 claims 1
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 claims 1
- 125000004306 triazinyl group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 69
- 239000000243 solution Substances 0.000 description 57
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 44
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 42
- 238000006243 chemical reaction Methods 0.000 description 37
- 238000005481 NMR spectroscopy Methods 0.000 description 32
- 239000000203 mixture Substances 0.000 description 32
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 30
- 150000001875 compounds Chemical class 0.000 description 27
- 150000003952 β-lactams Chemical class 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 238000000354 decomposition reaction Methods 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- 239000002253 acid Substances 0.000 description 19
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 19
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 18
- 150000002148 esters Chemical class 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 15
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 14
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 13
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 125000006239 protecting group Chemical group 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- ZCEXLMDGVLJRLC-SDMSXHDGSA-N (5r)-6-amino-4-thia-1-azabicyclo[3.2.0]heptan-7-one Chemical compound S1CCN2C(=O)C(N)[C@H]21 ZCEXLMDGVLJRLC-SDMSXHDGSA-N 0.000 description 11
- QITDACOZCQXYQY-BAFYGKSASA-N (6r)-7-amino-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class S1CC=CN2C(=O)C(N)[C@H]21 QITDACOZCQXYQY-BAFYGKSASA-N 0.000 description 11
- 229930186147 Cephalosporin Natural products 0.000 description 11
- 229940124587 cephalosporin Drugs 0.000 description 11
- 150000001780 cephalosporins Chemical class 0.000 description 11
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- 239000004202 carbamide Substances 0.000 description 10
- 239000012964 benzotriazole Substances 0.000 description 9
- 150000001735 carboxylic acids Chemical class 0.000 description 9
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 9
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 229930182555 Penicillin Natural products 0.000 description 8
- 230000004913 activation Effects 0.000 description 8
- 125000004423 acyloxy group Chemical group 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 238000000926 separation method Methods 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 150000002960 penicillins Chemical class 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 239000012452 mother liquor Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 125000005035 acylthio group Chemical group 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229940049954 penicillin Drugs 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 125000000547 substituted alkyl group Chemical group 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- CSGFFYNMTALICU-ZWNOBZJWSA-N adipyl-7-aminodesacetoxycephalosporanic acid Natural products CC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCCC(O)=O)C2=O)C(O)=O CSGFFYNMTALICU-ZWNOBZJWSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000004675 formic acid derivatives Chemical class 0.000 description 2
- 125000005368 heteroarylthio group Chemical group 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- CZJWRCGMJPIJSJ-UHFFFAOYSA-O pyridin-1-ium-1-yl carbamate Chemical class NC(=O)O[N+]1=CC=CC=C1 CZJWRCGMJPIJSJ-UHFFFAOYSA-O 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- OGVCUHMGJOJMEE-BAFYGKSASA-N (6r)-4-amino-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class C1=CC(N)S[C@@H]2CC(=O)N21 OGVCUHMGJOJMEE-BAFYGKSASA-N 0.000 description 1
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 1
- RUCRATRMJISWLD-LESKNEHBSA-N (6r)-7-amino-8-oxo-3-[(5-thiophen-2-yl-1h-1,2,4-triazol-3-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC(N=1)=NNC=1C1=CC=CS1 RUCRATRMJISWLD-LESKNEHBSA-N 0.000 description 1
- ZNVOUDVNEIRTGV-BBZZFXJRSA-N (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylic acid Chemical class S1C(C(O)=O)C=CN2C(=O)C(N)[C@H]21 ZNVOUDVNEIRTGV-BBZZFXJRSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- GPTZJLZEBUJTOQ-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-nitrobenzotriazole Chemical compound CC1=CC([N+]([O-])=O)=CC2=C1N=NN2O GPTZJLZEBUJTOQ-UHFFFAOYSA-N 0.000 description 1
- FAUXYQYNBHEGDG-UHFFFAOYSA-N 1-hydroxy-4-methylbenzotriazole Chemical compound CC1=CC=CC2=C1N=NN2O FAUXYQYNBHEGDG-UHFFFAOYSA-N 0.000 description 1
- YBNRHMJGYWCQIJ-UHFFFAOYSA-N 1-hydroxy-5,6-dimethylbenzotriazole Chemical compound C1=C(C)C(C)=CC2=C1N(O)N=N2 YBNRHMJGYWCQIJ-UHFFFAOYSA-N 0.000 description 1
- HISVSQKXOPHVJI-UHFFFAOYSA-N 1-hydroxy-5-methoxybenzotriazole Chemical compound COC1=CC=C2N(O)N=NC2=C1 HISVSQKXOPHVJI-UHFFFAOYSA-N 0.000 description 1
- XMUAGMCFZMDQTI-UHFFFAOYSA-N 1-hydroxy-5-methylbenzotriazole Chemical compound CC1=CC=C2N(O)N=NC2=C1 XMUAGMCFZMDQTI-UHFFFAOYSA-N 0.000 description 1
- DGIBHCWBCOAPDN-UHFFFAOYSA-N 1-hydroxy-6-(trifluoromethyl)benzotriazole Chemical compound C1=C(C(F)(F)F)C=C2N(O)N=NC2=C1 DGIBHCWBCOAPDN-UHFFFAOYSA-N 0.000 description 1
- SIQXGSXHNVEPDX-UHFFFAOYSA-N 1-hydroxy-6-methoxybenzotriazole Chemical compound COC1=CC=C2N=NN(O)C2=C1 SIQXGSXHNVEPDX-UHFFFAOYSA-N 0.000 description 1
- PEFBAFXTCWVHCL-UHFFFAOYSA-N 1-hydroxy-6-methylbenzotriazole Chemical compound CC1=CC=C2N=NN(O)C2=C1 PEFBAFXTCWVHCL-UHFFFAOYSA-N 0.000 description 1
- ATXMBRQNETZZQO-UHFFFAOYSA-N 1-hydroxy-6-methylbenzotriazole-5-carbonitrile Chemical compound C1=C(C#N)C(C)=CC2=C1N=NN2O ATXMBRQNETZZQO-UHFFFAOYSA-N 0.000 description 1
- HZPVTKPGROKWRL-UHFFFAOYSA-N 1-hydroxy-6-nitrobenzotriazole Chemical compound C1=C([N+]([O-])=O)C=C2N(O)N=NC2=C1 HZPVTKPGROKWRL-UHFFFAOYSA-N 0.000 description 1
- OEMLXDCOUGFCQD-UHFFFAOYSA-N 1-hydroxybenzotriazole-4-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C1N=NN2O OEMLXDCOUGFCQD-UHFFFAOYSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- DYCLHZPOADTVKK-UHFFFAOYSA-N 2-(2-azaniumyl-1,3-thiazol-4-yl)acetate Chemical class NC1=NC(CC(O)=O)=CS1 DYCLHZPOADTVKK-UHFFFAOYSA-N 0.000 description 1
- YHMZKBZQZGAGOE-UHFFFAOYSA-N 2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical class OC(=O)CC1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 YHMZKBZQZGAGOE-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- AOPRXJXHLWYPQR-UHFFFAOYSA-N 2-phenoxyacetamide Chemical compound NC(=O)COC1=CC=CC=C1 AOPRXJXHLWYPQR-UHFFFAOYSA-N 0.000 description 1
- 125000006325 2-propenyl amino group Chemical group [H]C([H])=C([H])C([H])([H])N([H])* 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- XBWKFIFVFYNOHB-UHFFFAOYSA-N 3-hydroxy-n-methylbenzotriazole-5-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C2N=NN(O)C2=C1 XBWKFIFVFYNOHB-UHFFFAOYSA-N 0.000 description 1
- DROMHRBBANKEQS-UHFFFAOYSA-N 3-hydroxybenzotriazole-5-sulfonamide Chemical compound NS(=O)(=O)C1=CC=C2N=NN(O)C2=C1 DROMHRBBANKEQS-UHFFFAOYSA-N 0.000 description 1
- YCSOKVXQTSKIPQ-UHFFFAOYSA-N 4,5,6,7-tetrachloro-1-hydroxybenzotriazole Chemical compound ClC1=C(Cl)C(Cl)=C2N(O)N=NC2=C1Cl YCSOKVXQTSKIPQ-UHFFFAOYSA-N 0.000 description 1
- WDZCLWRGSRLTLJ-UHFFFAOYSA-N 4-chloro-1-hydroxy-7-methyl-6-nitrobenzotriazole Chemical compound CC1=C([N+]([O-])=O)C=C(Cl)C2=C1N(O)N=N2 WDZCLWRGSRLTLJ-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- POSGTCMXKDSLCH-UHFFFAOYSA-N 5,6-dichloro-1-hydroxybenzotriazole Chemical compound ClC1=C(Cl)C=C2N(O)N=NC2=C1 POSGTCMXKDSLCH-UHFFFAOYSA-N 0.000 description 1
- KCOPVBJLGFRNOG-UHFFFAOYSA-N 5-chloro-1-hydroxybenzotriazole Chemical compound ClC1=CC=C2N(O)N=NC2=C1 KCOPVBJLGFRNOG-UHFFFAOYSA-N 0.000 description 1
- FBOGRWCUOSLQID-UHFFFAOYSA-N 6-bromo-1-hydroxybenzotriazole Chemical compound C1=C(Br)C=C2N(O)N=NC2=C1 FBOGRWCUOSLQID-UHFFFAOYSA-N 0.000 description 1
- LNHHUBMHUQEWIJ-UHFFFAOYSA-N 6-chloro-1-hydroxy-5-methylbenzotriazole Chemical compound C1=C(Cl)C(C)=CC2=C1N(O)N=N2 LNHHUBMHUQEWIJ-UHFFFAOYSA-N 0.000 description 1
- JJSYRPFTUMEUTK-UHFFFAOYSA-N 6-chloro-1-hydroxy-5-propan-2-ylbenzotriazole Chemical compound C1=C(Cl)C(C(C)C)=CC2=C1N(O)N=N2 JJSYRPFTUMEUTK-UHFFFAOYSA-N 0.000 description 1
- 125000001960 7 membered carbocyclic group Chemical group 0.000 description 1
- UCGKVWNBKILEDM-UHFFFAOYSA-N C1=CC=C2[N+]([O-])=NNC2=C1 Chemical compound C1=CC=C2[N+]([O-])=NNC2=C1 UCGKVWNBKILEDM-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical class ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000006323 alkenyl amino group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 1
- 229950004030 cefaloglycin Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000006261 methyl amino sulfonyl group Chemical group [H]N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- NCQKZZDOZJRYFM-UHFFFAOYSA-N n,n-diethyl-3-hydroxybenzotriazole-5-sulfonamide Chemical compound CCN(CC)S(=O)(=O)C1=CC=C2N=NN(O)C2=C1 NCQKZZDOZJRYFM-UHFFFAOYSA-N 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- WSHJJCPTKWSMRR-RXMQYKEDSA-N penam Chemical compound S1CCN2C(=O)C[C@H]21 WSHJJCPTKWSMRR-RXMQYKEDSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000007420 reactivation Effects 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19772758000 DE2758000A1 (de) | 1977-12-24 | 1977-12-24 | Verfahren zur herstellung von penicillinen und cephalosporinen |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS5495593A JPS5495593A (en) | 1979-07-28 |
JPS6337112B2 true JPS6337112B2 (US06534493-20030318-C00166.png) | 1988-07-22 |
Family
ID=6027278
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP15817378A Granted JPS5495593A (en) | 1977-12-24 | 1978-12-23 | Manufacture of penicillin and cephalosporin |
Country Status (9)
Families Citing this family (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE3165922D1 (en) * | 1980-03-28 | 1984-10-18 | Biochemie Gmbh | New process for the production of cephalosporin antibiotics, and novel intermediates used in such process and their production |
DE3037997A1 (de) * | 1980-10-08 | 1982-05-13 | Bayer Ag | (beta) -lactamantibiotika, verfahren zu deren herstellung sowie sie enthaltende mittel |
ES497076A0 (es) * | 1980-11-22 | 1981-10-01 | Gema Sa | Procedimiento para la preparacion de soluciones de acidos 7-aminocefalosporanicos |
DK165118C (da) * | 1980-11-22 | 1993-03-01 | Gema Sa | Fremgangsmaade til fremstilling af oploesninger af 7-aminocephalosporansyrer |
US4681877A (en) * | 1982-12-24 | 1987-07-21 | Kureha Kagaku Kogyo Kabushiki Kaisha | Pivaloyloxymethyl 7-β-[2-(2-amino-4-thiazolyl)-2-methoxyiminoacetamido]-3-(2-amino-1,3-thiadiazolyl-5-thiomethyl)-3-cepheme-4-carboxylate and pharmaceutical composition containing the same |
US4914091A (en) * | 1984-04-02 | 1990-04-03 | American Cyanamid Company | Esters of cephalosporin derivitives |
KR870001332B1 (ko) * | 1984-09-27 | 1987-07-18 | 한미약품공업 주식회사 | 세펨 유도체의 간단한 제조방법 |
GR890100706A (el) * | 1989-10-31 | 1992-03-20 | Han Mi Pharma Ind Co Ltd | Μέ?οδος παρασκευής παραγώγων κεφέμης. |
KR950014571B1 (ko) * | 1991-11-18 | 1995-12-08 | 제일제당주식회사 | 세펨 유도체의 제조방법 |
KR100197788B1 (ko) * | 1995-06-30 | 1999-06-15 | 김충환 | 세펨 유도체의 제조방법 |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS52148094A (en) * | 1976-06-03 | 1977-12-08 | Pfizer | Penicillin compound and process for preparing same |
JPS5328190A (en) * | 1976-08-26 | 1978-03-16 | Lilly Co Eli | 77*22*substituted benzoylamino* acetamide* cephalosporing |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE1668723A1 (de) * | 1966-09-16 | 1971-04-08 | Toyo Jozo Kk | Verfahren zum Herstellen von Verbindungen mit Saeureamid-Bindung |
-
1977
- 1977-12-24 DE DE19772758000 patent/DE2758000A1/de not_active Withdrawn
-
1978
- 1978-12-18 EP EP78101749A patent/EP0002774B1/de not_active Expired
- 1978-12-18 DE DE7878101749T patent/DE2861126D1/de not_active Expired
- 1978-12-19 ES ES476110A patent/ES476110A1/es not_active Expired
- 1978-12-21 AU AU42785/78A patent/AU526890B2/en not_active Expired
- 1978-12-22 AT AT0924078A patent/AT370417B/de not_active IP Right Cessation
- 1978-12-22 CA CA318,498A patent/CA1106358A/en not_active Expired
- 1978-12-22 DK DK579878A patent/DK579878A/da not_active Application Discontinuation
- 1978-12-23 JP JP15817378A patent/JPS5495593A/ja active Granted
- 1978-12-24 IE IE2545/78A patent/IE48101B1/en unknown
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS52148094A (en) * | 1976-06-03 | 1977-12-08 | Pfizer | Penicillin compound and process for preparing same |
JPS5328190A (en) * | 1976-08-26 | 1978-03-16 | Lilly Co Eli | 77*22*substituted benzoylamino* acetamide* cephalosporing |
Also Published As
Publication number | Publication date |
---|---|
IE48101B1 (en) | 1984-10-03 |
ATA924078A (de) | 1982-08-15 |
AT370417B (de) | 1983-03-25 |
AU4278578A (en) | 1979-06-28 |
ES476110A1 (es) | 1979-04-16 |
DE2861126D1 (en) | 1981-12-10 |
EP0002774A1 (de) | 1979-07-11 |
AU526890B2 (en) | 1983-02-03 |
JPS5495593A (en) | 1979-07-28 |
CA1106358A (en) | 1981-08-04 |
DE2758000A1 (de) | 1979-07-05 |
IE782545L (en) | 1979-06-24 |
EP0002774B1 (de) | 1981-09-23 |
DK579878A (da) | 1979-06-25 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
JPS6228153B2 (US06534493-20030318-C00166.png) | ||
US4201779A (en) | 7[(2-Amino-thiazol-4-yl)glyoxylamido]-cephem derivatives and processes for their preparation | |
JPH0346474B2 (US06534493-20030318-C00166.png) | ||
BG60438B2 (bg) | Цефалоспорини | |
JP2004520336A (ja) | 新規チアゾリル酢酸チオエステル誘導体およびそれらのセファロスポリン化合物製造のための使用 | |
JPH02311483A (ja) | セフトリアキソンの製造方法 | |
JPS6337112B2 (US06534493-20030318-C00166.png) | ||
JPS597717B2 (ja) | セフアロスポリン誘導体およびその製造法 | |
EP0175814B1 (en) | Process for preparing cephem derivatives | |
EP0053077B1 (en) | Salts of 7-aminocephalosporanic acids, soluble in organic solvents and their use in the preparation of cephalosporins | |
US5567813A (en) | Process for preparing cephalosporin compounds from reactive organic acid derivatives | |
BE853545A (fr) | Nouveaux derives cephalosporines ayant un nouveau groupe 7-acyle et leur procede de fabrication | |
JP2662176B2 (ja) | 3−ビニルセファロスポリンの製造法 | |
RO109652B1 (ro) | Procedeu pentru prepararea unui antibiotic cefepim dihidroclorura hidrat | |
JP2529093B2 (ja) | セファロスポリン中間体の製造方法 | |
NL8006337A (nl) | N-gesubstitueerde thiazolylderivaten van oxy-imino- gesubstitueerde cefalosporinen, alsmede werkwijzen ter bereiding ervan en farmaceutische en veterinaire preparaten. | |
US6248881B1 (en) | Intermediates and process for the production of 3-vinyl cephalosporins | |
US5484928A (en) | 2-(2-aminothiazol-4-yl)-2-oxoacetic acid derivatives | |
EP0074316B1 (en) | A process for the preparation of 3-substituted 7-aminocephalosporanic acids | |
KR810000860B1 (ko) | 세팔로스포린 유도체의 제조 방법 | |
EP0002586B1 (en) | Method for removing a halogenoacetyl protective group from a halogenoacetyl amino compound | |
KR810000761B1 (ko) | 세팔로스포린 화합물의 제조법 | |
KR810000760B1 (ko) | 세팔로스포린 화합물의 제조법 | |
EP0045717A2 (en) | New cephalosporin derivatives, their production and their use | |
JPS6366188A (ja) | 7−〔2−(2−アミノチアゾ−ル−4−イル)−3−ヒドロキシプロピオンアミド〕セフアロスポリン化合物およびその製造法 |