JPS6310936B2 - - Google Patents
Info
- Publication number
- JPS6310936B2 JPS6310936B2 JP55138233A JP13823380A JPS6310936B2 JP S6310936 B2 JPS6310936 B2 JP S6310936B2 JP 55138233 A JP55138233 A JP 55138233A JP 13823380 A JP13823380 A JP 13823380A JP S6310936 B2 JPS6310936 B2 JP S6310936B2
- Authority
- JP
- Japan
- Prior art keywords
- reaction
- catalyst
- acetic anhydride
- mol
- metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910000510 noble metal Inorganic materials 0.000 claims description 21
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- 150000004820 halides Chemical class 0.000 claims description 8
- 150000008282 halocarbons Chemical class 0.000 claims description 8
- 239000010948 rhodium Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052703 rhodium Inorganic materials 0.000 claims description 7
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 claims description 7
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- CADPTFMOCGIPOI-UHFFFAOYSA-N methyl(diphenyl)arsane Chemical compound C=1C=CC=CC=1[As](C)C1=CC=CC=C1 CADPTFMOCGIPOI-UHFFFAOYSA-N 0.000 claims description 5
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- KZTHCQYZOHMORT-UHFFFAOYSA-N dimethyl(phenyl)arsane Chemical compound C[As](C)C1=CC=CC=C1 KZTHCQYZOHMORT-UHFFFAOYSA-N 0.000 claims description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 87
- 238000006243 chemical reaction Methods 0.000 description 41
- 239000003054 catalyst Substances 0.000 description 35
- 229910052751 metal Inorganic materials 0.000 description 22
- 239000002184 metal Substances 0.000 description 22
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 19
- 229910002091 carbon monoxide Inorganic materials 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 19
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 18
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 18
- -1 acetic anhydride Chemical class 0.000 description 16
- 239000007789 gas Substances 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 238000004587 chromatography analysis Methods 0.000 description 14
- 230000000052 comparative effect Effects 0.000 description 14
- 238000005810 carbonylation reaction Methods 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 11
- 239000000376 reactant Substances 0.000 description 9
- 230000035484 reaction time Effects 0.000 description 9
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 230000006315 carbonylation Effects 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003426 co-catalyst Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 150000002736 metal compounds Chemical class 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 229910000856 hastalloy Inorganic materials 0.000 description 3
- 229910052741 iridium Inorganic materials 0.000 description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- HSSMNYDDDSNUKH-UHFFFAOYSA-K trichlororhodium;hydrate Chemical compound O.Cl[Rh](Cl)Cl HSSMNYDDDSNUKH-UHFFFAOYSA-K 0.000 description 3
- MBVAQOHBPXKYMF-LNTINUHCSA-N (z)-4-hydroxypent-3-en-2-one;rhodium Chemical compound [Rh].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O MBVAQOHBPXKYMF-LNTINUHCSA-N 0.000 description 2
- GOKCJCODOLGYQD-UHFFFAOYSA-N 4,6-dichloro-2-imidazol-1-ylpyrimidine Chemical group ClC1=CC(Cl)=NC(N2C=NC=C2)=N1 GOKCJCODOLGYQD-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 229910000074 antimony hydride Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010574 gas phase reaction Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 229910001502 inorganic halide Inorganic materials 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 229910052762 osmium Inorganic materials 0.000 description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical compound [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 2
- BXJWDOYMROEHEN-UHFFFAOYSA-N tributylstibane Chemical compound CCCC[Sb](CCCC)CCCC BXJWDOYMROEHEN-UHFFFAOYSA-N 0.000 description 2
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 2
- YFJORWSFSOXFQR-UHFFFAOYSA-N tris(4-methylphenyl)arsane Chemical compound C1=CC(C)=CC=C1[As](C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 YFJORWSFSOXFQR-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DWKRZZGSVQMWON-UHFFFAOYSA-N 1-diphenylarsanylethyl(diphenyl)arsane Chemical compound C=1C=CC=CC=1[As](C=1C=CC=CC=1)C(C)[As](C=1C=CC=CC=1)C1=CC=CC=C1 DWKRZZGSVQMWON-UHFFFAOYSA-N 0.000 description 1
- XCYBYOYXJFQTFC-UHFFFAOYSA-N C1(=CC=CC=C1)[As](C1=CC=CC=C1)C(C)(C)[As](C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[As](C1=CC=CC=C1)C(C)(C)[As](C1=CC=CC=C1)C1=CC=CC=C1 XCYBYOYXJFQTFC-UHFFFAOYSA-N 0.000 description 1
- DIARVLVWEUBYGP-UHFFFAOYSA-N CC=1C(=C(C=CC=1)[AsH]Cl)C Chemical compound CC=1C(=C(C=CC=1)[AsH]Cl)C DIARVLVWEUBYGP-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- YFJDOWJXDFOBHW-UHFFFAOYSA-N [Rh].ClC1=C(C(=C(C=C1)[AsH](C(=O)[AsH](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)Cl)Cl Chemical compound [Rh].ClC1=C(C(=C(C=C1)[AsH](C(=O)[AsH](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)Cl)Cl YFJDOWJXDFOBHW-UHFFFAOYSA-N 0.000 description 1
- UZZPICCXQXWOHB-UHFFFAOYSA-N [Rh].ClC=1C(=C(C(=C(C1)[As](C(=O)[As](C1=C(C=CC=C1)C)C1=CC=CC=C1)C1=CC=CC=C1)C)Cl)Cl Chemical compound [Rh].ClC=1C(=C(C(=C(C1)[As](C(=O)[As](C1=C(C=CC=C1)C)C1=CC=CC=C1)C1=CC=CC=C1)C)Cl)Cl UZZPICCXQXWOHB-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 229910001570 bauxite Inorganic materials 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- XWDKRVSSHIJNJP-UHFFFAOYSA-N carbon monoxide;iridium Chemical group [Ir].[Ir].[Ir].[Ir].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] XWDKRVSSHIJNJP-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- PHDRSNNXYBUITB-UHFFFAOYSA-K chromium(3+);triacetate;hydrate Chemical compound O.[Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O PHDRSNNXYBUITB-UHFFFAOYSA-K 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000005534 decanoate group Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- BMSDTRMGXCBBBH-UHFFFAOYSA-L diiodochromium Chemical compound [Cr+2].[I-].[I-] BMSDTRMGXCBBBH-UHFFFAOYSA-L 0.000 description 1
- HASCQPSFPAKVEK-UHFFFAOYSA-N dimethyl(phenyl)phosphine Chemical compound CP(C)C1=CC=CC=C1 HASCQPSFPAKVEK-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical class CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003317 industrial substance Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- UJNZOIKQAUQOCN-UHFFFAOYSA-N methyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C)C1=CC=CC=C1 UJNZOIKQAUQOCN-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- XAZAQTBGMXGTBD-UHFFFAOYSA-N tributylarsane Chemical compound CCCC[As](CCCC)CCCC XAZAQTBGMXGTBD-UHFFFAOYSA-N 0.000 description 1
- WXAZIUYTQHYBFW-UHFFFAOYSA-N tris(4-methylphenyl)phosphane Chemical compound C1=CC(C)=CC=C1P(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 WXAZIUYTQHYBFW-UHFFFAOYSA-N 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
- C07C51/56—Preparation of carboxylic acid anhydrides from organic acids, their salts, their esters or their halides, e.g. by carboxylation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/081,304 US4251458A (en) | 1979-10-02 | 1979-10-02 | Process for preparing carboxylic acid anhydrides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5651432A JPS5651432A (en) | 1981-05-09 |
| JPS6310936B2 true JPS6310936B2 (ref) | 1988-03-10 |
Family
ID=22163333
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13823380A Granted JPS5651432A (en) | 1979-10-02 | 1980-10-02 | Manufacture of carboxylic acid anhydride by carbonylation |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4251458A (ref) |
| JP (1) | JPS5651432A (ref) |
| BE (1) | BE885483A (ref) |
| DE (1) | DE3037280C2 (ref) |
| FR (1) | FR2466449A1 (ref) |
| GB (1) | GB2059794B (ref) |
| IT (1) | IT1128571B (ref) |
| NL (1) | NL8005234A (ref) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02125627U (ref) * | 1989-03-28 | 1990-10-16 |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4284585A (en) * | 1979-12-26 | 1981-08-18 | Halcon Research And Development Corp. | Process for the preparation of acetic anhydride |
| US4284586A (en) * | 1979-12-26 | 1981-08-18 | Halcon Research And Development Corp. | Process for the preparation of acetic anhydride |
| FR2489817A1 (fr) * | 1980-09-11 | 1982-03-12 | Rhone Poulenc Ind | Procede de preparation d'anhydrides d'acides carboxyliques par carbonylation |
| US4340569A (en) * | 1981-03-06 | 1982-07-20 | The Halcon Sd Group, Inc. | Treatment of carbonylation residues |
| US4340570A (en) * | 1981-03-06 | 1982-07-20 | The Halcon Sd Group, Inc. | Recovery of rhodium from carbonylation residues |
| US4341741A (en) * | 1981-03-06 | 1982-07-27 | The Halcon Sd Group, Inc. | Recovery of rhodium from carbonylation residues |
| US4511741A (en) * | 1983-12-02 | 1985-04-16 | Union Carbide Corporation | Production of aldehydes from organic acid esters |
| US4563309A (en) * | 1984-08-16 | 1986-01-07 | Union Carbide Corporation | Production of carboxylic anhydrides from methyl carboxlyates using rhodium complex catalysts |
| US5142072A (en) * | 1989-12-19 | 1992-08-25 | The Procter & Gamble Company | Selective esterification of long chain fatty acid monoglycerides with medium chain fatty acid anhydrides |
| US5387705A (en) * | 1993-08-13 | 1995-02-07 | The Procter & Gamble Company | Fatty acid anhydride process |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2730546A (en) * | 1952-05-07 | 1956-01-10 | Basf Ag | Process for the production of aliphatic acid anhydrides by carbonylation of esters |
| US2729651A (en) * | 1952-06-11 | 1956-01-03 | Basf Ag | Process for the production of aliphatic oxygen compounds by carbonylation of alcohols, ethers, and esters |
| DE921987C (de) * | 1952-06-12 | 1955-01-07 | Basf Ag | Verfahren zur Herstellung sauerstoffhaltiger organischer Verbindungen |
| US2789137A (en) * | 1952-06-28 | 1957-04-16 | Basf Ag | Acetic acid anhydride |
| FR1402383A (fr) * | 1963-07-26 | 1965-06-11 | Shell Int Research | Procédé de préparation d'acides carboxyliques et de leurs dérivés |
| US3641137A (en) * | 1969-02-19 | 1972-02-08 | Union Oil Co | Preparation of methacrylic acid |
| US3927078A (en) * | 1972-08-21 | 1975-12-16 | Chevron Res | Methylene and oxymethylene bis-ester production |
| DE2450965C2 (de) * | 1974-10-26 | 1983-06-09 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von Essigsäureanhydrid |
| US3989751A (en) * | 1974-12-12 | 1976-11-02 | Monsanto Company | Process for the preparation of carboxylic anhydrides from olefinic hydrocarbons |
| US4115444A (en) * | 1975-03-10 | 1978-09-19 | Halcon International, Inc. | Process for preparing carboxylic acid anhydrides |
| CA1058636A (en) * | 1975-03-10 | 1979-07-17 | Nabil Rizkalla | Process for preparing carboxylic acid anhydrides |
| US4002678A (en) * | 1975-12-22 | 1977-01-11 | Halcon International, Inc. | Preparation of carboxylic acid anhydrides |
| US4002677A (en) * | 1975-12-22 | 1977-01-11 | Halcon International, Inc. | Process for preparing carboxylic acid anhydrides |
| US4102921A (en) * | 1977-04-26 | 1978-07-25 | Air Products & Chemicals, Inc. | Production of carboxylic acids and esters |
-
1979
- 1979-10-02 US US06/081,304 patent/US4251458A/en not_active Expired - Lifetime
-
1980
- 1980-09-19 NL NL8005234A patent/NL8005234A/nl not_active Application Discontinuation
- 1980-10-01 IT IT49795/80A patent/IT1128571B/it active
- 1980-10-01 BE BE0/202295A patent/BE885483A/fr not_active IP Right Cessation
- 1980-10-01 FR FR8021068A patent/FR2466449A1/fr active Granted
- 1980-10-02 GB GB8031789A patent/GB2059794B/en not_active Expired
- 1980-10-02 DE DE3037280A patent/DE3037280C2/de not_active Expired
- 1980-10-02 JP JP13823380A patent/JPS5651432A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02125627U (ref) * | 1989-03-28 | 1990-10-16 |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2466449B1 (ref) | 1984-05-25 |
| JPS5651432A (en) | 1981-05-09 |
| GB2059794B (en) | 1983-11-30 |
| GB2059794A (en) | 1981-04-29 |
| FR2466449A1 (fr) | 1981-04-10 |
| NL8005234A (nl) | 1981-04-06 |
| US4251458A (en) | 1981-02-17 |
| BE885483A (fr) | 1981-04-01 |
| IT8049795A0 (it) | 1980-10-01 |
| DE3037280A1 (de) | 1981-04-16 |
| IT1128571B (it) | 1986-05-28 |
| DE3037280C2 (de) | 1982-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4559183A (en) | Preparation of carboxylic acid anhydrides | |
| US4659518A (en) | Preparation of carboxylic acids | |
| NO147183B (no) | Fremgangsmaate ved fremstilling av karboksylsyre-anhydrider ved karbonylering av etere eller estere | |
| US4002677A (en) | Process for preparing carboxylic acid anhydrides | |
| JPS6310936B2 (ref) | ||
| US4134912A (en) | Process for preparing carboxylic acids | |
| EP0087869B1 (en) | Process for the coproduction of carboxylic acids and acid anhydrides | |
| JP2002537278A (ja) | 低級脂肪族アルコールのカルボニル化方法 | |
| JPS6364414B2 (ref) | ||
| JPS6237025B2 (ref) | ||
| US4335059A (en) | Preparation of carboxylic acid anhydrides | |
| EP1206433A1 (en) | Vapor phase carbonylation process using promoted iridium catalyst | |
| US6355837B1 (en) | Vapor phase carbonylation process using group 4 metal promoted iridium catalyst | |
| JPH0371418B2 (ref) | ||
| JP4485787B2 (ja) | 低級アルキルアルコールのカルボニル化用錫促進イリジウム触媒 | |
| US4613693A (en) | Process for the co-production of a C2 to C10 monocarboxylic acid and formic acid | |
| JPS6324982B2 (ref) | ||
| NL8006806A (nl) | Werkwijze ter bereiding van azijnzuuranhydride. | |
| US4698187A (en) | Preparation of carboxylic acid anhydrides | |
| EP0077116B1 (en) | Preparation of alkylidene diesters | |
| US4483804A (en) | Preparation of carboxylic acid anhydrides | |
| CA2348472C (en) | Method for preparing acetic acid and/or methyl acetate in the presence of iridium and platinum | |
| NL8105843A (nl) | Werkwijze voor het bereiden van ethylideendiacetaat. | |
| US4329512A (en) | Process for preparing acetaldehyde | |
| JPS6310937B2 (ref) |