JPS62948B2 - - Google Patents
Info
- Publication number
- JPS62948B2 JPS62948B2 JP53001598A JP159878A JPS62948B2 JP S62948 B2 JPS62948 B2 JP S62948B2 JP 53001598 A JP53001598 A JP 53001598A JP 159878 A JP159878 A JP 159878A JP S62948 B2 JPS62948 B2 JP S62948B2
- Authority
- JP
- Japan
- Prior art keywords
- polycarbonate
- potassium
- molding composition
- composition according
- tetrachlorophthalimide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004417 polycarbonate Substances 0.000 claims description 64
- 229920000515 polycarbonate Polymers 0.000 claims description 64
- 239000000203 mixture Substances 0.000 claims description 38
- 238000000465 moulding Methods 0.000 claims description 28
- 229910052708 sodium Inorganic materials 0.000 claims description 23
- 239000011734 sodium Substances 0.000 claims description 23
- -1 alkali metal salt Chemical class 0.000 claims description 22
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 20
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 239000011591 potassium Substances 0.000 claims description 10
- 229910052700 potassium Inorganic materials 0.000 claims description 9
- 150000007522 mineralic acids Chemical class 0.000 claims description 8
- 150000007524 organic acids Chemical class 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 7
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 7
- 239000000460 chlorine Chemical group 0.000 claims description 6
- 229920001169 thermoplastic Polymers 0.000 claims description 6
- 239000004416 thermosoftening plastic Substances 0.000 claims description 6
- OHCSZUQRNNNMRG-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-methylisoindole-1,3-dione Chemical group ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(C)C2=O OHCSZUQRNNNMRG-UHFFFAOYSA-N 0.000 claims description 4
- LPTOKNBNQSVVQO-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-phenylisoindole-1,3-dione Chemical group O=C1C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2C(=O)N1C1=CC=CC=C1 LPTOKNBNQSVVQO-UHFFFAOYSA-N 0.000 claims description 4
- LPUUYZVKCMCHLO-UHFFFAOYSA-N 4,5,6,7-tetrachloroisoindole-1,3-dione Chemical group ClC1=C(Cl)C(Cl)=C2C(=O)NC(=O)C2=C1Cl LPUUYZVKCMCHLO-UHFFFAOYSA-N 0.000 claims description 4
- DRXDBDATOLWSNZ-UHFFFAOYSA-L dilithium;dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [Li+].[Li+].[O-]P([O-])(=O)C1=CC=CC=C1 DRXDBDATOLWSNZ-UHFFFAOYSA-L 0.000 claims description 4
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 claims description 4
- QRFTXHFUNIFHST-UHFFFAOYSA-N 4,5,6,7-tetrabromoisoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C2C(=O)NC(=O)C2=C1Br QRFTXHFUNIFHST-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910001610 cryolite Inorganic materials 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- IOXPXHVBWFDRGS-UHFFFAOYSA-N hept-6-enal Chemical compound C=CCCCCC=O IOXPXHVBWFDRGS-UHFFFAOYSA-N 0.000 claims description 3
- DRPLRPSXUUSFOB-UHFFFAOYSA-M potassium;2,4,5-trichlorobenzenesulfonate Chemical compound [K+].[O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl DRPLRPSXUUSFOB-UHFFFAOYSA-M 0.000 claims description 3
- IUTAHLUWHZYCKB-UHFFFAOYSA-M potassium;2,5-dichlorobenzenesulfonate Chemical compound [K+].[O-]S(=O)(=O)C1=CC(Cl)=CC=C1Cl IUTAHLUWHZYCKB-UHFFFAOYSA-M 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- YIOCCOWHPFYHIL-UHFFFAOYSA-L dipotassium;methyl phosphate Chemical compound [K+].[K+].COP([O-])([O-])=O YIOCCOWHPFYHIL-UHFFFAOYSA-L 0.000 claims 2
- 125000001153 fluoro group Chemical group F* 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- WZJYXXMVLGGIHZ-UHFFFAOYSA-N ClC=1C(=C(C(=C2C1C(=O)NC2=O)Cl)Cl)Cl.ClC=2C(=C(C(=C1C2C(=O)NC1=O)Cl)Cl)Cl Chemical compound ClC=1C(=C(C(=C2C1C(=O)NC2=O)Cl)Cl)Cl.ClC=2C(=C(C(=C1C2C(=O)NC1=O)Cl)Cl)Cl WZJYXXMVLGGIHZ-UHFFFAOYSA-N 0.000 claims 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 14
- 239000000654 additive Substances 0.000 description 10
- 230000000996 additive effect Effects 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 6
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000003063 flame retardant Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229920006360 Hostaflon Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000004045 organic chlorine compounds Chemical class 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YIYBRXKMQFDHSM-UHFFFAOYSA-N 2,2'-Dihydroxybenzophenone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1O YIYBRXKMQFDHSM-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- PQDUQLDDKAKBIL-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-ethylisoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=C1C(=O)N(CC)C2=O PQDUQLDDKAKBIL-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- KLKYJMASALXYQR-UHFFFAOYSA-L dipotassium;methyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [K+].[K+].CP([O-])([O-])=O KLKYJMASALXYQR-UHFFFAOYSA-L 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- ZWWGKYHSHZDTKG-UHFFFAOYSA-N 1,1,1,2,2,3,3,4,4,4-decafluorobutane sulfuric acid Chemical compound OS(O)(=O)=O.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F ZWWGKYHSHZDTKG-UHFFFAOYSA-N 0.000 description 1
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical group CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 description 1
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 1
- VPVTXVHUJHGOCM-UHFFFAOYSA-N 2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C(C(C)(C)C=2C=CC(O)=CC=2)=CC=1C(C)(C)C1=CC=C(O)C=C1 VPVTXVHUJHGOCM-UHFFFAOYSA-N 0.000 description 1
- MAQOZOILPAMFSW-UHFFFAOYSA-N 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=C(CC=3C(=CC=C(C)C=3)O)C=C(C)C=2)O)=C1 MAQOZOILPAMFSW-UHFFFAOYSA-N 0.000 description 1
- VXHYVVAUHMGCEX-UHFFFAOYSA-N 2-(2-hydroxyphenoxy)phenol Chemical compound OC1=CC=CC=C1OC1=CC=CC=C1O VXHYVVAUHMGCEX-UHFFFAOYSA-N 0.000 description 1
- BLDLRWQLBOJPEB-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfanylphenol Chemical compound OC1=CC=CC=C1SC1=CC=CC=C1O BLDLRWQLBOJPEB-UHFFFAOYSA-N 0.000 description 1
- XSVZEASGNTZBRQ-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfinylphenol Chemical compound OC1=CC=CC=C1S(=O)C1=CC=CC=C1O XSVZEASGNTZBRQ-UHFFFAOYSA-N 0.000 description 1
- QUWAJPZDCZDTJS-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfonylphenol Chemical compound OC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1O QUWAJPZDCZDTJS-UHFFFAOYSA-N 0.000 description 1
- XKZQKPRCPNGNFR-UHFFFAOYSA-N 2-(3-hydroxyphenyl)phenol Chemical compound OC1=CC=CC(C=2C(=CC=CC=2)O)=C1 XKZQKPRCPNGNFR-UHFFFAOYSA-N 0.000 description 1
- FEUPZKQRLZAQLP-UHFFFAOYSA-N 2-butyl-4,5,6,7-tetrachloroisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(CCCC)C2=O FEUPZKQRLZAQLP-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MXNVXVXUSYZPGQ-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-(2,4,6-trichlorophenyl)isoindole-1,3-dione Chemical compound ClC1=CC(Cl)=CC(Cl)=C1N1C(=O)C(C(Br)=C(Br)C(Br)=C2Br)=C2C1=O MXNVXVXUSYZPGQ-UHFFFAOYSA-N 0.000 description 1
- PTHHCKUKYUFHCR-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-(2-methylpropyl)isoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=C1C(=O)N(CC(C)C)C2=O PTHHCKUKYUFHCR-UHFFFAOYSA-N 0.000 description 1
- VDMNYTPYNQFTGM-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-(3,5-dichlorophenyl)isoindole-1,3-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C3=C(C(=C(Br)C(Br)=C3Br)Br)C2=O)=O)=C1 VDMNYTPYNQFTGM-UHFFFAOYSA-N 0.000 description 1
- VBKUHHKKBKOYJX-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-(4-chlorophenyl)isoindole-1,3-dione Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(C(Br)=C(Br)C(Br)=C2Br)=C2C1=O VBKUHHKKBKOYJX-UHFFFAOYSA-N 0.000 description 1
- LKMHLKASACUQJL-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-butylisoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=C1C(=O)N(CCCC)C2=O LKMHLKASACUQJL-UHFFFAOYSA-N 0.000 description 1
- TVILQPCZOCDNPW-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-naphthalen-1-ylisoindole-1,3-dione Chemical compound C1=CC=C2C(N3C(=O)C4=C(C(=C(Br)C(Br)=C4C3=O)Br)Br)=CC=CC2=C1 TVILQPCZOCDNPW-UHFFFAOYSA-N 0.000 description 1
- WLXSTOFHRPNRGH-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-phenylisoindole-1,3-dione Chemical compound O=C1C2=C(Br)C(Br)=C(Br)C(Br)=C2C(=O)N1C1=CC=CC=C1 WLXSTOFHRPNRGH-UHFFFAOYSA-N 0.000 description 1
- PDFDDSFREWUDSC-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-propan-2-ylisoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=C1C(=O)N(C(C)C)C2=O PDFDDSFREWUDSC-UHFFFAOYSA-N 0.000 description 1
- DLLLZAQDQSKRPO-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-propylisoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=C1C(=O)N(CCC)C2=O DLLLZAQDQSKRPO-UHFFFAOYSA-N 0.000 description 1
- FGIPWXMJBITOHM-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-(2,4,6-trichlorophenyl)isoindole-1,3-dione Chemical compound ClC1=CC(Cl)=CC(Cl)=C1N1C(=O)C(C(Cl)=C(Cl)C(Cl)=C2Cl)=C2C1=O FGIPWXMJBITOHM-UHFFFAOYSA-N 0.000 description 1
- CVLNXBQATVNXEA-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-(2-methylpropyl)isoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(CC(C)C)C2=O CVLNXBQATVNXEA-UHFFFAOYSA-N 0.000 description 1
- KKVLKHHDLQSFSU-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-(3,5-dichlorophenyl)isoindole-1,3-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C3=C(C(=C(Cl)C(Cl)=C3Cl)Cl)C2=O)=O)=C1 KKVLKHHDLQSFSU-UHFFFAOYSA-N 0.000 description 1
- ZLAHKCUEEYMHFP-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-(4-chlorophenyl)isoindole-1,3-dione Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(C(Cl)=C(Cl)C(Cl)=C2Cl)=C2C1=O ZLAHKCUEEYMHFP-UHFFFAOYSA-N 0.000 description 1
- DTSUYDPYXWBPIG-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-ethylisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(CC)C2=O DTSUYDPYXWBPIG-UHFFFAOYSA-N 0.000 description 1
- YHPVYZMRBAXBAW-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-naphthalen-1-ylisoindole-1,3-dione Chemical compound C1=CC=C2C(N3C(=O)C4=C(C(=C(Cl)C(Cl)=C4C3=O)Cl)Cl)=CC=CC2=C1 YHPVYZMRBAXBAW-UHFFFAOYSA-N 0.000 description 1
- HSOZZLSISYXUTJ-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-propan-2-ylisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(C(C)C)C2=O HSOZZLSISYXUTJ-UHFFFAOYSA-N 0.000 description 1
- ULUXWMFXOPDBAS-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-propylisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(CCC)C2=O ULUXWMFXOPDBAS-UHFFFAOYSA-N 0.000 description 1
- SUCTVKDVODFXFX-UHFFFAOYSA-N 4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(S(=O)(=O)C=2C=C(C)C(O)=C(C)C=2)=C1 SUCTVKDVODFXFX-UHFFFAOYSA-N 0.000 description 1
- AZZWZMUXHALBCQ-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1 AZZWZMUXHALBCQ-UHFFFAOYSA-N 0.000 description 1
- BRPSWMCDEYMRPE-UHFFFAOYSA-N 4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C=1C=CC(O)=CC=1)(C)C1=CC=C(O)C=C1 BRPSWMCDEYMRPE-UHFFFAOYSA-N 0.000 description 1
- BWCAVNWKMVHLFW-UHFFFAOYSA-N 4-[1-(4-hydroxy-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(O)=C(C)C=2)=C1 BWCAVNWKMVHLFW-UHFFFAOYSA-N 0.000 description 1
- XJGTVJRTDRARGO-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]benzene-1,3-diol Chemical compound C=1C=C(O)C=C(O)C=1C(C)(C)C1=CC=C(O)C=C1 XJGTVJRTDRARGO-UHFFFAOYSA-N 0.000 description 1
- RQTDWDATSAVLOR-UHFFFAOYSA-N 4-[3,5-bis(4-hydroxyphenyl)phenyl]phenol Chemical compound C1=CC(O)=CC=C1C1=CC(C=2C=CC(O)=CC=2)=CC(C=2C=CC(O)=CC=2)=C1 RQTDWDATSAVLOR-UHFFFAOYSA-N 0.000 description 1
- OBZFGWBLZXIBII-UHFFFAOYSA-N 4-[3-(4-hydroxy-3,5-dimethylphenyl)-3-methylbutyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CCC(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 OBZFGWBLZXIBII-UHFFFAOYSA-N 0.000 description 1
- NIRYBKWMEWFDPM-UHFFFAOYSA-N 4-[3-(4-hydroxyphenyl)-3-methylbutyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CCC1=CC=C(O)C=C1 NIRYBKWMEWFDPM-UHFFFAOYSA-N 0.000 description 1
- MIJYTDQAOVQRRT-UHFFFAOYSA-N 4-[4,6-bis(4-hydroxyphenyl)-4,6-dimethylhept-2-en-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)=CC(C)(C=1C=CC(O)=CC=1)CC(C)(C)C1=CC=C(O)C=C1 MIJYTDQAOVQRRT-UHFFFAOYSA-N 0.000 description 1
- CIEGINNQDIULCT-UHFFFAOYSA-N 4-[4,6-bis(4-hydroxyphenyl)-4,6-dimethylheptan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)CC(C)(C=1C=CC(O)=CC=1)CC(C)(C)C1=CC=C(O)C=C1 CIEGINNQDIULCT-UHFFFAOYSA-N 0.000 description 1
- IQNDEQHJTOJHAK-UHFFFAOYSA-N 4-[4-[2-[4,4-bis(4-hydroxyphenyl)cyclohexyl]propan-2-yl]-1-(4-hydroxyphenyl)cyclohexyl]phenol Chemical compound C1CC(C=2C=CC(O)=CC=2)(C=2C=CC(O)=CC=2)CCC1C(C)(C)C(CC1)CCC1(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 IQNDEQHJTOJHAK-UHFFFAOYSA-N 0.000 description 1
- LIDWAYDGZUAJEG-UHFFFAOYSA-N 4-[bis(4-hydroxyphenyl)-phenylmethyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC(O)=CC=1)C1=CC=CC=C1 LIDWAYDGZUAJEG-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- GIXXQTYGFOHYPT-UHFFFAOYSA-N Bisphenol P Chemical compound C=1C=C(C(C)(C)C=2C=CC(O)=CC=2)C=CC=1C(C)(C)C1=CC=C(O)C=C1 GIXXQTYGFOHYPT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- JAWMENYCRQKKJY-UHFFFAOYSA-N [3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-ylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]methanone Chemical compound N1N=NC=2CN(CCC=21)CC1=NOC2(C1)CCN(CC2)C(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F JAWMENYCRQKKJY-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 235000019395 ammonium persulphate Nutrition 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- BOCUKUHCLICSIY-UHFFFAOYSA-N cyclothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(S(N2)(=O)=O)=C1NC2C1C(C=C2)CC2C1 BOCUKUHCLICSIY-UHFFFAOYSA-N 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical class C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- UCGBHFOOELMUQL-UHFFFAOYSA-L dipotassium;1,2,4-trichlorobenzene;sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O.ClC1=CC=C(Cl)C(Cl)=C1 UCGBHFOOELMUQL-UHFFFAOYSA-L 0.000 description 1
- DTZRCTOSNSNSFM-UHFFFAOYSA-L dipotassium;1,4-dichlorobenzene;sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O.ClC1=CC=C(Cl)C=C1 DTZRCTOSNSNSFM-UHFFFAOYSA-L 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical compound [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- RXCBCUJUGULOGC-UHFFFAOYSA-H dipotassium;tetrafluorotitanium;difluoride Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[K+].[K+].[Ti+4] RXCBCUJUGULOGC-UHFFFAOYSA-H 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910001386 lithium phosphate Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000005526 organic bromine compounds Chemical class 0.000 description 1
- SJDACOMXKWHBOW-UHFFFAOYSA-N oxyphenisatine Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2NC1=O SJDACOMXKWHBOW-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- OQZCJRJRGMMSGK-UHFFFAOYSA-M potassium metaphosphate Chemical compound [K+].[O-]P(=O)=O OQZCJRJRGMMSGK-UHFFFAOYSA-M 0.000 description 1
- 229940099402 potassium metaphosphate Drugs 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 235000019394 potassium persulphate Nutrition 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 229940098424 potassium pyrophosphate Drugs 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- LVTHXRLARFLXNR-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F LVTHXRLARFLXNR-UHFFFAOYSA-M 0.000 description 1
- GBEAPGVTFRUJRU-UHFFFAOYSA-M potassium;2,3,4,5,6-pentachlorobenzoate Chemical compound [K+].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl GBEAPGVTFRUJRU-UHFFFAOYSA-M 0.000 description 1
- WEAGBZRZUQFQAU-UHFFFAOYSA-M potassium;2,4,6-trichlorobenzoate Chemical compound [K+].[O-]C(=O)C1=C(Cl)C=C(Cl)C=C1Cl WEAGBZRZUQFQAU-UHFFFAOYSA-M 0.000 description 1
- IDCFOFYKKXBZRS-UHFFFAOYSA-M potassium;2,4-dichlorobenzoate Chemical compound [K+].[O-]C(=O)C1=CC=C(Cl)C=C1Cl IDCFOFYKKXBZRS-UHFFFAOYSA-M 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- 229960003339 sodium phosphate Drugs 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- TWQULNDIKKJZPH-UHFFFAOYSA-K trilithium;phosphate Chemical compound [Li+].[Li+].[Li+].[O-]P([O-])([O-])=O TWQULNDIKKJZPH-UHFFFAOYSA-K 0.000 description 1
- ZIZQEDPMQXFXTE-UHFFFAOYSA-H tripotassium;hexafluoroaluminum(3-) Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[Al+3].[K+].[K+].[K+] ZIZQEDPMQXFXTE-UHFFFAOYSA-H 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3415—Five-membered rings
- C08K5/3417—Five-membered rings condensed with carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772703710 DE2703710C2 (de) | 1977-01-29 | 1977-01-29 | Polycarbonatformmassen mit verbesserter Flammwidrigkeit |
| DE19772707928 DE2707928A1 (de) | 1977-02-24 | 1977-02-24 | Polycarbonatformmassen mit verbesserter flammwidrigkeit |
| DE19772740850 DE2740850C2 (de) | 1977-09-10 | 1977-09-10 | Polycarbonatformmassen mit verbesserter Flammwidrigkeit |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5396055A JPS5396055A (en) | 1978-08-22 |
| JPS62948B2 true JPS62948B2 (enExample) | 1987-01-10 |
Family
ID=27187106
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP159878A Granted JPS5396055A (en) | 1977-01-29 | 1978-01-12 | Polycarbonate molding composition with improved noncombustibility |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4208489A (enExample) |
| JP (1) | JPS5396055A (enExample) |
| FR (1) | FR2381803A1 (enExample) |
| GB (1) | GB1572537A (enExample) |
| IT (1) | IT1103119B (enExample) |
| NL (1) | NL183829C (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4366283A (en) * | 1979-11-13 | 1982-12-28 | The Dow Chemical Company | Polycarbonate containing a metal salt of a perhalometalate as an ignition depressant |
| US4303575A (en) * | 1980-02-07 | 1981-12-01 | Mobay Chemical Corporation | Flame retardant polycarbonate compositions |
| US4366276A (en) * | 1980-06-25 | 1982-12-28 | Bayer Aktiengesellschaft | Flame-resistant moulding materials based on thermoplastic aromatic polyesters and polyesters carbonates, a process for their production and their use in the production of moulded bodies |
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4335038A (en) * | 1980-09-26 | 1982-06-15 | The Dow Chemical Company | Polycarbonate containing a metal perfluoroborate and an organosilane as ignition depressants |
| US4438231A (en) | 1982-01-29 | 1984-03-20 | General Electric Company | High impact strength, flame retardant polycarbonate composition |
| DE3203905A1 (de) * | 1982-02-05 | 1983-08-11 | Bayer Ag, 5090 Leverkusen | Polycarbonat-formmassen mit verbesserter flammwidrigkeit |
| US4439566A (en) * | 1982-04-16 | 1984-03-27 | The Dow Chemical Company | Carbonate polymers containing a salt of a crown complex as an ignition depressant |
| US4558081A (en) * | 1983-03-03 | 1985-12-10 | The Dow Chemical Company | Carbonate polymer containing an ignition depressant composition |
| US4486560A (en) * | 1983-03-03 | 1984-12-04 | The Dow Chemical Company | Carbonate polymer containing an ignition depressant composition |
| US4532284A (en) * | 1983-06-22 | 1985-07-30 | The Dow Chemical Company | Carbonate polymer composition |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
| DE3337857A1 (de) * | 1983-10-18 | 1985-04-25 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
| US4626563A (en) * | 1983-11-10 | 1986-12-02 | The Dow Chemical Company | Fire retardant carbonate polymer composition |
| DE3342414A1 (de) * | 1983-11-24 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittelkombinationen und ihre verwendung in thermoplastischen formmassen aus polycarbonaten und abs-polymerisaten |
| EP0174493B1 (de) * | 1984-08-17 | 1988-05-25 | Bayer Ag | Thermoplastische Formmassen mit flammwidrigen Eigenschaften |
| US4673699A (en) * | 1984-11-19 | 1987-06-16 | Mobay Corporation | Flame retardant molding compositions |
| US4632949A (en) * | 1984-12-31 | 1986-12-30 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4578409A (en) * | 1985-01-14 | 1986-03-25 | Mobay Chemical Corporation | Flame retarding silanes |
| FR2585026B1 (fr) * | 1985-07-17 | 1987-10-23 | Atochem | Polycarbonates aromatiques ignifuges par un sel alcalin d'un tetraester de l'acide imido diphosphorique |
| DE3577864D1 (de) * | 1985-07-24 | 1990-06-28 | Dow Chemical Co | Karbonat-polymer-zusammensetzung. |
| US4710534A (en) * | 1985-12-09 | 1987-12-01 | General Electric Company | Low gloss, flame reterdant, impact resistant polycarbonate composition |
| US4743637A (en) * | 1986-08-01 | 1988-05-10 | General Electric Company | Flame retardant compounds and thermoplastic compositions containing the same |
| US4959481A (en) * | 1986-08-01 | 1990-09-25 | General Electric Company | Flame retardant compounds and thermoplastic compositions containing the same |
| US4753994A (en) * | 1986-12-02 | 1988-06-28 | Mobay Corporation | Flame retardant polycarbonate compositions |
| US4826900A (en) * | 1988-03-31 | 1989-05-02 | The Dow Chemical Company | Ignition resistant modified carbonate polymer composition |
| US5118739A (en) * | 1990-06-20 | 1992-06-02 | Ethyl Corporation | Flame retardant macromolecular materials containing brominated aromatic sulfonic acid salts |
| DE4024667C2 (de) * | 1990-08-03 | 1997-04-30 | Bayer Ag | Flammschutzmittel für Polycarbonate und Verfahren zur Einarbeitung in Polycarbonate |
| DE4024670A1 (de) * | 1990-08-03 | 1992-02-06 | Bayer Ag | Mischungen und ihre verwendung als flammschutzmittel |
| US5120778A (en) * | 1991-04-30 | 1992-06-09 | Miles Inc. | Flame retardant polycarbonate composition having improved impact strength |
| DE4119329A1 (de) * | 1991-06-12 | 1992-12-17 | Bayer Ag | Verwendung von kernbromierten phthalsaeurederivaten zur stabilisierung von thermoplastischen polycarbonaten gegen die einwirkung von gammastrahlen |
| DE4221581A1 (de) * | 1992-03-18 | 1993-09-23 | Bayer Ag | Verwendung von salzen in kombination mit halogenierten phthalimiden zur flammfestausruestung von glasfaserhaltigen polycarbonatformkoerpern |
| DE59611352D1 (de) * | 1995-09-21 | 2006-07-06 | Lanxess Deutschland Gmbh | Laserbeschriftbare Polymer-Formmassen |
| US6180702B1 (en) | 1999-08-09 | 2001-01-30 | Bayer Corporation | Flame retardant polycarbonate composition |
| US6753367B2 (en) | 2001-08-20 | 2004-06-22 | General Electric Company | Flame retardant polycarbonate compositions with improved weathering performance containing cyanoacrylic esters |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| US20130115436A1 (en) * | 2009-09-24 | 2013-05-09 | Bayer Materialscience Ag | Injection-molded multi-component composite systems having improved fire behaviour |
| US10329421B2 (en) | 2014-06-11 | 2019-06-25 | Sabic Global Technologies B.V. | Polycarbonate compositions, method of manufacture thereof, and articles therefrom |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2795589A (en) * | 1953-03-04 | 1957-06-11 | Velsicol Chemical Corp | Nu-substituted imides of hexachloro bicyclo [2.2.1] heptene dicarboxylic acids |
| US3005795A (en) * | 1957-12-10 | 1961-10-24 | Du Pont | Thermoplastic resins containing finely divided, fibrous polytetrafluoroethylene |
| US3243408A (en) * | 1959-05-04 | 1966-03-29 | American Cyanamid Co | Stabilized polyolefin compositions |
| US3103501A (en) * | 1961-08-03 | 1963-09-10 | - olefins containing alkylidene- | |
| US3398212A (en) * | 1963-07-01 | 1968-08-20 | Eastman Kodak Co | Bisphenol polycarbonates and polyesters containing units derived from a thiodiphenol |
| US3294871A (en) * | 1964-09-15 | 1966-12-27 | American Cyanamid Co | Poly (tetrafluoroethylene)-thermoplastic resin composition |
| US3475372A (en) * | 1966-08-18 | 1969-10-28 | Mobay Chemical Corp | Flame resistant polycarbonates |
| US3455950A (en) * | 1967-07-28 | 1969-07-15 | Universal Oil Prod Co | N,n'-bis-imides of polyhalosubstituted polyhydropolycyclicdicarboxylic acids |
| US3873567A (en) * | 1968-09-05 | 1975-03-25 | Universal Oil Prod Co | N-substituted polybromoaromatic ortho-dicarboximides |
| CH515954A (de) * | 1968-10-17 | 1971-11-30 | Bayer Ag | Selbstverlöschende Polyamid-Formmasse |
| GB1273071A (en) | 1969-03-21 | 1972-05-03 | Hooker Chemical Corp | Fire retardant additive systems |
| US3634311A (en) * | 1969-03-21 | 1972-01-11 | Hooker Chemical Corp | Ammonium hexafluoroferrate as a fire retardant additive |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| US3652715A (en) | 1969-07-01 | 1972-03-28 | Gen Electric | Curable polycarbonate compositions |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
| US3651174A (en) * | 1970-04-15 | 1972-03-21 | Gen Electric | Thermally stable alkalin earth carbonate/polytetrafluoroethylene modified polycarbonate composition |
| AU452933B2 (en) * | 1970-12-28 | 1974-09-19 | Bayer Aktiengesellschaft | Thermoplastic moulding composition and mouldings of polycarbonate having improved ease of mould release when injection moulding |
| US3671487A (en) * | 1971-05-05 | 1972-06-20 | Gen Electric | Glass reinforced polyester resins containing polytetrafluoroethylene and flame retardant additives |
| JPS5064337A (enExample) * | 1973-10-11 | 1975-05-31 | ||
| US3940366A (en) * | 1973-12-28 | 1976-02-24 | General Electric Company | Flame retardant polycarbonate composition |
| JPS50119041A (enExample) * | 1974-03-05 | 1975-09-18 | ||
| US3950307A (en) * | 1975-03-10 | 1976-04-13 | Velsicol Chemical Corporation | Halobenzoyl tetrahalophthalimides |
| US4268429A (en) | 1975-07-18 | 1981-05-19 | General Electric Company | Novel flame retardant polycarbonate compositions |
| DE2620257C3 (de) * | 1976-05-07 | 1981-12-10 | Bayer Ag, 5090 Leverkusen | Thermoplastische Polycarbonat-Formmassen mit verbesserter Entformbarkeit |
| US4110299A (en) | 1976-10-15 | 1978-08-29 | General Electric Company | Flame-retardant polycarbonate composition |
| US4113695A (en) * | 1976-10-15 | 1978-09-12 | General Electric Company | Non-opaque flame-retardant polycarbonate composition |
-
1978
- 1978-01-09 US US05/868,145 patent/US4208489A/en not_active Expired - Lifetime
- 1978-01-12 IT IT47609/78A patent/IT1103119B/it active
- 1978-01-12 JP JP159878A patent/JPS5396055A/ja active Granted
- 1978-01-13 GB GB1453/78A patent/GB1572537A/en not_active Expired
- 1978-01-13 FR FR7800980A patent/FR2381803A1/fr active Granted
- 1978-01-26 NL NLAANVRAGE7800954,A patent/NL183829C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US4208489A (en) | 1980-06-17 |
| NL183829B (nl) | 1988-09-01 |
| JPS5396055A (en) | 1978-08-22 |
| NL183829C (nl) | 1989-02-01 |
| NL7800954A (nl) | 1978-08-01 |
| GB1572537A (en) | 1980-07-30 |
| IT7847609A0 (it) | 1978-01-12 |
| FR2381803A1 (fr) | 1978-09-22 |
| IT1103119B (it) | 1985-10-14 |
| FR2381803B1 (enExample) | 1984-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS62948B2 (enExample) | ||
| US4552911A (en) | Polycarbonate molding compositions having improved flame retardance | |
| JPS6038419B2 (ja) | 難燃性のポリカ−ボネ−ト組成物 | |
| KR100420881B1 (ko) | 저휘발성방향족포스페이트에스테르화합물을함유하는카보네이트중합체수지 | |
| JPS6038418B2 (ja) | 難燃性ポリカ−ボネ−ト組成物 | |
| DE2503336A1 (de) | Polycarbonat-formmassen | |
| JP3921173B2 (ja) | 難燃性カーボネートポリマーおよびそれらの使用 | |
| US4615832A (en) | Flameproofing agents, their preparation and their use for flameproofing polycarbonates | |
| US4471104A (en) | Process for the preparation of polycarbonates having sulfonanilide terminal groups | |
| EP0375942B1 (en) | Flame retardant carbonate polymer blends | |
| JPS599578B2 (ja) | 熱可塑性成形組成物 | |
| EP0170851B1 (de) | Perfluroalkansulfonsäurearylester als Antitropfmittel in flammwidrigen Formmassen auf Basis thermoplastischer, aromatischer Polycarbonate | |
| DE2703710C2 (de) | Polycarbonatformmassen mit verbesserter Flammwidrigkeit | |
| JP3135175B2 (ja) | 耐燃性ポリカーボネート成型材料 | |
| JP2000169696A (ja) | 熱安定性に優れた難燃性ポリカ―ボネ―ト樹脂組成物 | |
| US4880864A (en) | Thermoplastic polycarbonates and blends with enhanced flame retardant properties | |
| CN1705708A (zh) | 阻燃聚碳酸酯和聚酯碳酸酯 | |
| US5124377A (en) | Flame retardant polycarbonate composition having improved impact strength | |
| US6323280B1 (en) | Flame retardant polycarbonate blends | |
| CA1189529A (en) | Flame retardant polycarbonates | |
| JPS6097954A (ja) | フタルイミド類およびその製造法 | |
| DE2740850A1 (de) | Polycarbonatformmassen mit verbesserter flammwidrigkeit | |
| JP2001181493A (ja) | 熱安定性に優れた難燃性ポリカーボネート樹脂組成物 | |
| JP3626822B2 (ja) | γ−線に対して安定化された(コ)ポリカーボネート | |
| DE2707928A1 (de) | Polycarbonatformmassen mit verbesserter flammwidrigkeit |