JPS6234004B2 - - Google Patents
Info
- Publication number
- JPS6234004B2 JPS6234004B2 JP56066104A JP6610481A JPS6234004B2 JP S6234004 B2 JPS6234004 B2 JP S6234004B2 JP 56066104 A JP56066104 A JP 56066104A JP 6610481 A JP6610481 A JP 6610481A JP S6234004 B2 JPS6234004 B2 JP S6234004B2
- Authority
- JP
- Japan
- Prior art keywords
- copper
- toothpaste
- toothpaste composition
- composition according
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000606 toothpaste Substances 0.000 claims description 44
- 229940034610 toothpaste Drugs 0.000 claims description 37
- 239000010949 copper Substances 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 18
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 238000005498 polishing Methods 0.000 claims description 16
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 15
- 229910052802 copper Inorganic materials 0.000 claims description 15
- 239000005749 Copper compound Substances 0.000 claims description 13
- 150000001880 copper compounds Chemical class 0.000 claims description 13
- -1 organic acid copper salt Chemical class 0.000 claims description 13
- 229940108928 copper Drugs 0.000 claims description 10
- 239000000843 powder Substances 0.000 claims description 9
- 229920003023 plastic Polymers 0.000 claims description 6
- 239000004033 plastic Substances 0.000 claims description 6
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 6
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 6
- YEOCHZFPBYUXMC-UHFFFAOYSA-L copper benzoate Chemical compound [Cu+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 YEOCHZFPBYUXMC-UHFFFAOYSA-L 0.000 claims description 4
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 claims description 3
- 229920000877 Melamine resin Polymers 0.000 claims description 3
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 3
- 150000001879 copper Chemical class 0.000 claims description 3
- DYROSKSLMAPFBZ-UHFFFAOYSA-L copper;2-hydroxypropanoate Chemical compound [Cu+2].CC(O)C([O-])=O.CC(O)C([O-])=O DYROSKSLMAPFBZ-UHFFFAOYSA-L 0.000 claims description 3
- 229940014662 pantothenate Drugs 0.000 claims description 3
- 239000011713 pantothenic acid Substances 0.000 claims description 3
- 235000019161 pantothenic acid Nutrition 0.000 claims description 3
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 3
- 239000004800 polyvinyl chloride Substances 0.000 claims description 3
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical compound [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 claims description 2
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 claims description 2
- 239000004677 Nylon Substances 0.000 claims description 2
- 239000004793 Polystyrene Substances 0.000 claims description 2
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 claims description 2
- 229940114081 cinnamate Drugs 0.000 claims description 2
- 229940108925 copper gluconate Drugs 0.000 claims description 2
- VGWUQCWVUNUPMX-RJNTXXOISA-L copper;(2e,4e)-hexa-2,4-dienoate Chemical compound [Cu+2].C\C=C\C=C\C([O-])=O.C\C=C\C=C\C([O-])=O VGWUQCWVUNUPMX-RJNTXXOISA-L 0.000 claims description 2
- RSJOBNMOMQFPKQ-UHFFFAOYSA-L copper;2,3-dihydroxybutanedioate Chemical compound [Cu+2].[O-]C(=O)C(O)C(O)C([O-])=O RSJOBNMOMQFPKQ-UHFFFAOYSA-L 0.000 claims description 2
- VVYPIVJZLVJPGU-UHFFFAOYSA-L copper;2-aminoacetate Chemical compound [Cu+2].NCC([O-])=O.NCC([O-])=O VVYPIVJZLVJPGU-UHFFFAOYSA-L 0.000 claims description 2
- CMRVDFLZXRTMTH-UHFFFAOYSA-L copper;2-carboxyphenolate Chemical compound [Cu+2].OC1=CC=CC=C1C([O-])=O.OC1=CC=CC=C1C([O-])=O CMRVDFLZXRTMTH-UHFFFAOYSA-L 0.000 claims description 2
- YVNZDAXVCOOLPC-UHFFFAOYSA-L copper;2-hydroxy-2-phenylacetate Chemical compound [Cu+2].[O-]C(=O)C(O)C1=CC=CC=C1.[O-]C(=O)C(O)C1=CC=CC=C1 YVNZDAXVCOOLPC-UHFFFAOYSA-L 0.000 claims description 2
- WMYBXRITVYIFCO-UHFFFAOYSA-N copper;2-hydroxybutanedioic acid Chemical compound [Cu].OC(=O)C(O)CC(O)=O WMYBXRITVYIFCO-UHFFFAOYSA-N 0.000 claims description 2
- FWBOFUGDKHMVPI-UHFFFAOYSA-K dicopper;2-oxidopropane-1,2,3-tricarboxylate Chemical compound [Cu+2].[Cu+2].[O-]C(=O)CC([O-])(C([O-])=O)CC([O-])=O FWBOFUGDKHMVPI-UHFFFAOYSA-K 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 229920001778 nylon Polymers 0.000 claims description 2
- 229920001568 phenolic resin Polymers 0.000 claims description 2
- 235000002949 phytic acid Nutrition 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 229920000647 polyepoxide Polymers 0.000 claims description 2
- 229920002223 polystyrene Polymers 0.000 claims description 2
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 claims description 2
- 229920002994 synthetic fiber Polymers 0.000 claims description 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 claims description 2
- 229920003180 amino resin Polymers 0.000 claims 2
- 229920005989 resin Polymers 0.000 claims 2
- 239000011347 resin Substances 0.000 claims 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 claims 1
- 239000006072 paste Substances 0.000 claims 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 14
- 239000000126 substance Substances 0.000 description 10
- 230000007505 plaque formation Effects 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical class O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 239000002245 particle Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 150000002222 fluorine compounds Chemical class 0.000 description 7
- 235000011187 glycerol Nutrition 0.000 description 7
- 241000700159 Rattus Species 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 5
- 229910001431 copper ion Inorganic materials 0.000 description 5
- 239000008367 deionised water Substances 0.000 description 5
- 229910021641 deionized water Inorganic materials 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 4
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 4
- 208000002064 Dental Plaque Diseases 0.000 description 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 4
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 229960003260 chlorhexidine Drugs 0.000 description 4
- 239000000796 flavoring agent Substances 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 235000013355 food flavoring agent Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 4
- 239000000230 xanthan gum Substances 0.000 description 4
- 229920001285 xanthan gum Polymers 0.000 description 4
- 235000010493 xanthan gum Nutrition 0.000 description 4
- 229940082509 xanthan gum Drugs 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 2
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 2
- 229910016509 CuF 2 Inorganic materials 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- HPWPQTDSGXMKPM-UHFFFAOYSA-L [Cu+2].[O-]P([O-])(F)=O Chemical compound [Cu+2].[O-]P([O-])(F)=O HPWPQTDSGXMKPM-UHFFFAOYSA-L 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- HFDWIMBEIXDNQS-UHFFFAOYSA-L copper;diformate Chemical compound [Cu+2].[O-]C=O.[O-]C=O HFDWIMBEIXDNQS-UHFFFAOYSA-L 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229910021485 fumed silica Inorganic materials 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 210000004400 mucous membrane Anatomy 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 108700004121 sarkosyl Proteins 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical compound [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 description 2
- AYGJDUHQRFKLBG-UHFFFAOYSA-M sodium;1,1-dioxo-1,2-benzothiazol-3-olate;dihydrate Chemical compound O.O.[Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 AYGJDUHQRFKLBG-UHFFFAOYSA-M 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 2
- FTLYMKDSHNWQKD-UHFFFAOYSA-N (2,4,5-trichlorophenyl)boronic acid Chemical compound OB(O)C1=CC(Cl)=C(Cl)C=C1Cl FTLYMKDSHNWQKD-UHFFFAOYSA-N 0.000 description 1
- RUQDOYIAKHIMAN-DODKFZKMSA-N (nz)-n-[(e)-3-phenylprop-2-enylidene]hydroxylamine Chemical compound O\N=C/C=C/C1=CC=CC=C1 RUQDOYIAKHIMAN-DODKFZKMSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 1
- PTOKDFKDUYQOAK-UHFFFAOYSA-N 2-aminoethanol;hydrofluoride Chemical compound F.NCCO PTOKDFKDUYQOAK-UHFFFAOYSA-N 0.000 description 1
- TYBHZVUFOINFDV-UHFFFAOYSA-N 2-bromo-6-[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenol Chemical compound OC1=C(Br)C=C(Cl)C=C1CC1=CC(Cl)=CC(Br)=C1O TYBHZVUFOINFDV-UHFFFAOYSA-N 0.000 description 1
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004382 Amylase Substances 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000004287 Dehydroacetic acid Substances 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000784732 Lycaena phlaeas Species 0.000 description 1
- 229910021569 Manganese fluoride Inorganic materials 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- XOAAWQZATWQOTB-UHFFFAOYSA-N Taurine Natural products NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 1
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 description 1
- KGUHOFWIXKIURA-VQXBOQCVSA-N [(2r,3s,4s,5r,6r)-6-[(2s,3s,4s,5r)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl dodecanoate Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COC(=O)CCCCCCCCCCC)O[C@@H]1O[C@@]1(CO)[C@@H](O)[C@H](O)[C@@H](CO)O1 KGUHOFWIXKIURA-VQXBOQCVSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 230000002272 anti-calculus Effects 0.000 description 1
- 230000002882 anti-plaque Effects 0.000 description 1
- OGBUMNBNEWYMNJ-UHFFFAOYSA-N batilol Chemical class CCCCCCCCCCCCCCCCCCOCC(O)CO OGBUMNBNEWYMNJ-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 108010089934 carbohydrase Proteins 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- TVWHTOUAJSGEKT-UHFFFAOYSA-N chlorine trioxide Chemical compound [O]Cl(=O)=O TVWHTOUAJSGEKT-UHFFFAOYSA-N 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- PUHAKHQMSBQAKT-UHFFFAOYSA-L copper;butanoate Chemical compound [Cu+2].CCCC([O-])=O.CCCC([O-])=O PUHAKHQMSBQAKT-UHFFFAOYSA-L 0.000 description 1
- NSGLMHRMZITSKO-UHFFFAOYSA-L copper;dibromate Chemical compound [Cu+2].[O-]Br(=O)=O.[O-]Br(=O)=O NSGLMHRMZITSKO-UHFFFAOYSA-L 0.000 description 1
- IJCCOEGCVILSMZ-UHFFFAOYSA-L copper;dichlorate Chemical compound [Cu+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O IJCCOEGCVILSMZ-UHFFFAOYSA-L 0.000 description 1
- LLVVIWYEOKVOFV-UHFFFAOYSA-L copper;diiodate Chemical compound [Cu+2].[O-]I(=O)=O.[O-]I(=O)=O LLVVIWYEOKVOFV-UHFFFAOYSA-L 0.000 description 1
- JDPSPYBMORZJOD-UHFFFAOYSA-L copper;dodecanoate Chemical compound [Cu+2].CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O JDPSPYBMORZJOD-UHFFFAOYSA-L 0.000 description 1
- QYCVHILLJSYYBD-UHFFFAOYSA-L copper;oxalate Chemical compound [Cu+2].[O-]C(=O)C([O-])=O QYCVHILLJSYYBD-UHFFFAOYSA-L 0.000 description 1
- LZJJVTQGPPWQFS-UHFFFAOYSA-L copper;propanoate Chemical compound [Cu+2].CCC([O-])=O.CCC([O-])=O LZJJVTQGPPWQFS-UHFFFAOYSA-L 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 229940061632 dehydroacetic acid Drugs 0.000 description 1
- 235000019258 dehydroacetic acid Nutrition 0.000 description 1
- JEQRBTDTEKWZBW-UHFFFAOYSA-N dehydroacetic acid Chemical compound CC(=O)C1=C(O)OC(C)=CC1=O JEQRBTDTEKWZBW-UHFFFAOYSA-N 0.000 description 1
- PGRHXDWITVMQBC-UHFFFAOYSA-N dehydroacetic acid Natural products CC(=O)C1C(=O)OC(C)=CC1=O PGRHXDWITVMQBC-UHFFFAOYSA-N 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- CTNMMTCXUUFYAP-UHFFFAOYSA-L difluoromanganese Chemical compound F[Mn]F CTNMMTCXUUFYAP-UHFFFAOYSA-L 0.000 description 1
- DGTVXEHQMSJRPE-UHFFFAOYSA-N difluorophosphinic acid Chemical class OP(F)(F)=O DGTVXEHQMSJRPE-UHFFFAOYSA-N 0.000 description 1
- BJZIJOLEWHWTJO-UHFFFAOYSA-H dipotassium;hexafluorozirconium(2-) Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[K+].[K+].[Zr+4] BJZIJOLEWHWTJO-UHFFFAOYSA-H 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- IINNWAYUJNWZRM-UHFFFAOYSA-L erythrosin B Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C21 IINNWAYUJNWZRM-UHFFFAOYSA-L 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004403 ethyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229940043351 ethyl-p-hydroxybenzoate Drugs 0.000 description 1
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- DWYMPOCYEZONEA-UHFFFAOYSA-N fluorophosphoric acid Chemical class OP(O)(F)=O DWYMPOCYEZONEA-UHFFFAOYSA-N 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-M fluorosulfate group Chemical group S(=O)(=O)([O-])F UQSQSQZYBQSBJZ-UHFFFAOYSA-M 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- GGJOARIBACGTDV-UHFFFAOYSA-N germanium difluoride Chemical compound F[Ge]F GGJOARIBACGTDV-UHFFFAOYSA-N 0.000 description 1
- 230000001339 gustatory effect Effects 0.000 description 1
- 150000004687 hexahydrates Chemical class 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 229920013821 hydroxy alkyl cellulose Polymers 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 108010005131 levanase Proteins 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 210000000214 mouth Anatomy 0.000 description 1
- 150000004812 organic fluorine compounds Chemical class 0.000 description 1
- BHZSLLSDZFAPFH-UHFFFAOYSA-L palladium(2+);difluoride Chemical compound F[Pd]F BHZSLLSDZFAPFH-UHFFFAOYSA-L 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940068886 polyethylene glycol 300 Drugs 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- APQQUKGVNQQMJI-UHFFFAOYSA-K potassium manganese(2+) trifluoride Chemical compound [F-].[Mn+2].[K+].[F-].[F-] APQQUKGVNQQMJI-UHFFFAOYSA-K 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229940085605 saccharin sodium Drugs 0.000 description 1
- 229910002028 silica xerogel Inorganic materials 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 229940045885 sodium lauroyl sarcosinate Drugs 0.000 description 1
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 229960002799 stannous fluoride Drugs 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 229940032085 sucrose monolaurate Drugs 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- OJECAVYUFGICLI-UHFFFAOYSA-H tin(2+);zirconium(4+);hexafluoride Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[Zr+4].[Sn+2] OJECAVYUFGICLI-UHFFFAOYSA-H 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- XROWMBWRMNHXMF-UHFFFAOYSA-J titanium tetrafluoride Chemical compound [F-].[F-].[F-].[F-].[Ti+4] XROWMBWRMNHXMF-UHFFFAOYSA-J 0.000 description 1
- ASVMCHUOIVTKQQ-UHFFFAOYSA-M triethyl(methyl)azanium;fluoride Chemical compound [F-].CC[N+](C)(CC)CC ASVMCHUOIVTKQQ-UHFFFAOYSA-M 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- KCYJBQNPOFBNHE-UHFFFAOYSA-K trisodium;hydroxy-(1-hydroxy-1-phosphonatoethyl)phosphinate Chemical compound [Na+].[Na+].[Na+].OP(=O)([O-])C(O)(C)P([O-])([O-])=O KCYJBQNPOFBNHE-UHFFFAOYSA-K 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000000811 xylitol Substances 0.000 description 1
- 235000010447 xylitol Nutrition 0.000 description 1
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 description 1
- 229960002675 xylitol Drugs 0.000 description 1
- OMQSJNWFFJOIMO-UHFFFAOYSA-J zirconium tetrafluoride Chemical compound F[Zr](F)(F)F OMQSJNWFFJOIMO-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/72—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds
- A61K8/84—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds obtained by reactions otherwise than those involving only carbon-carbon unsaturated bonds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/72—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds
- A61K8/81—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds obtained by reactions involving only carbon-to-carbon unsaturated bonds
- A61K8/8141—Compositions of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by only one carboxyl radical, or of salts, anhydrides, esters, amides, imides or nitriles thereof; Compositions of derivatives of such polymers
- A61K8/8152—Homopolymers or copolymers of esters, e.g. (meth)acrylic acid esters; Compositions of derivatives of such polymers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP80102305A EP0038868B1 (de) | 1980-04-29 | 1980-04-29 | Zahnpasta |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS56169620A JPS56169620A (en) | 1981-12-26 |
| JPS6234004B2 true JPS6234004B2 (enExample) | 1987-07-24 |
Family
ID=8186672
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP6610481A Granted JPS56169620A (en) | 1980-04-29 | 1981-04-30 | Tooth paste composition |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4339429A (enExample) |
| EP (1) | EP0038868B1 (enExample) |
| JP (1) | JPS56169620A (enExample) |
| AR (1) | AR224191A1 (enExample) |
| AT (1) | ATE4776T1 (enExample) |
| AU (1) | AU537684B2 (enExample) |
| CA (1) | CA1152433A (enExample) |
| DE (1) | DE3065016D1 (enExample) |
| ES (1) | ES501712A0 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0654806U (ja) * | 1992-06-23 | 1994-07-26 | 北陵ジーアールシー工業株式会社 | 打込み方式型枠による床下換気口の取付け装置 |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0095871A3 (en) * | 1982-05-27 | 1984-06-13 | Reckitt And Colman Products Limited | Improvements in or relating to tooth treatment compositions |
| US4459282A (en) * | 1982-11-18 | 1984-07-10 | Johnson & Johnson Products Inc. | Anticaries compositions |
| US4528182A (en) * | 1983-07-13 | 1985-07-09 | Colgate-Palmolive Company | Stable antiplaque dentifrice with improved foaming |
| US4666708A (en) * | 1984-01-27 | 1987-05-19 | Oral Research Laboratories, Inc. | Dental rinse |
| US4657758A (en) * | 1984-01-27 | 1987-04-14 | Oral Research Laboratories, Inc. | Dental rinse |
| US4528181A (en) * | 1984-02-01 | 1985-07-09 | Colgate-Palmolive Company | Dentifrice containing dual sources of fluoride |
| DE3578313D1 (de) * | 1984-02-20 | 1990-07-26 | Blendax Werke Schneider Co | Mittel zur oralen hygiene. |
| US4652444A (en) * | 1984-12-14 | 1987-03-24 | National Research Laboratories | Methods and compositions for treating dental structures |
| US4708864A (en) * | 1984-12-14 | 1987-11-24 | National Research Laboratories | Method and compositions for treating dental structures |
| DE3532860C1 (de) * | 1985-09-14 | 1987-03-12 | Blendax Werke Schneider Co | Mittel zur oralen Hygiene |
| DE3600165A1 (de) * | 1986-01-07 | 1987-07-09 | Blendax Werke Schneider Co | Mittel zur oralen hygiene |
| US5057308A (en) * | 1986-11-06 | 1991-10-15 | Hill Ira D | Method of treating the oral cavity with oral hygiene preparations containing active SnF2 |
| US5057309A (en) * | 1986-11-06 | 1991-10-15 | Hill Ira D | Oral hygiene preparations |
| US6143281A (en) * | 1987-03-31 | 2000-11-07 | Smithkline Beecham P.L.C. | Dentifrice compositions |
| JP2580648B2 (ja) * | 1987-12-11 | 1997-02-12 | ライオン株式会社 | 口腔用組成物 |
| JP2580656B2 (ja) * | 1987-12-24 | 1997-02-12 | ライオン株式会社 | 口腔用組成物 |
| JP2580657B2 (ja) * | 1987-12-24 | 1997-02-12 | ライオン株式会社 | 口腔用組成物 |
| US5165913A (en) * | 1988-11-14 | 1992-11-24 | Ira Hill | Controlled release interproximal delivery system |
| GB8922594D0 (en) * | 1989-10-06 | 1989-11-22 | Unilever Plc | Oral compositions |
| JP3446214B2 (ja) * | 1991-06-21 | 2003-09-16 | ライオン株式会社 | 液状透明口腔用組成物 |
| US5211939A (en) * | 1991-09-13 | 1993-05-18 | Gillette Canada | Method for desensitizing teeth |
| DE4293451T1 (de) * | 1991-09-13 | 1994-09-08 | Gillette Canada | Polymerpartikel für zahnmedizinische Anwendungen |
| US5250288A (en) * | 1991-09-13 | 1993-10-05 | Gillette Canada, Inc. | Method for desensitizing teeth |
| US5811447A (en) | 1993-01-28 | 1998-09-22 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US6515009B1 (en) | 1991-09-27 | 2003-02-04 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US5286479A (en) * | 1991-12-10 | 1994-02-15 | The Dow Chemical Company | Oral compositions for suppressing mouth odors |
| US5298237A (en) * | 1992-01-24 | 1994-03-29 | The Trustees Of Columbia University In The City Of New York | Gel composition for reduction of gingival inflammation and retardation of dental plaque |
| US6491938B2 (en) | 1993-05-13 | 2002-12-10 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US5496539A (en) * | 1993-07-22 | 1996-03-05 | The Procter & Gamble Company | Oral compositions |
| DE4342356B4 (de) * | 1993-12-11 | 2005-04-28 | Rudolf Liebe Nachf Gmbh & Co K | Verwendung eines Zahnreinigungsmittels in Form einer Paste |
| US5578294A (en) * | 1994-05-13 | 1996-11-26 | The Procter & Gamble Company | Oral compositions |
| US5560905A (en) * | 1994-05-13 | 1996-10-01 | The Proctor & Gamble Company | Oral compositions |
| CA2199818A1 (en) * | 1994-09-15 | 1996-03-21 | Hooman Shahidi | Oral compositions |
| US5534243A (en) * | 1994-09-26 | 1996-07-09 | The Procter & Gamble Company | Aqueous oral compositions |
| US5660817A (en) * | 1994-11-09 | 1997-08-26 | Gillette Canada, Inc. | Desensitizing teeth with degradable particles |
| US5849271A (en) * | 1995-06-07 | 1998-12-15 | The Procter & Gamble Company | Oral compositions |
| US5871715A (en) * | 1997-02-28 | 1999-02-16 | Gillette Canada Inc. | Stannous fluoride gel with improved stand-up |
| US6117911A (en) | 1997-04-11 | 2000-09-12 | Neorx Corporation | Compounds and therapies for the prevention of vascular and non-vascular pathologies |
| DE19834355A1 (de) * | 1998-07-30 | 2000-02-03 | Henkel Kgaa | Entzündungshemmende Zahnpflegemittel |
| US6613083B2 (en) | 2001-05-02 | 2003-09-02 | Eckhard Alt | Stent device and method |
| US20110229534A1 (en) * | 2006-10-05 | 2011-09-22 | The Trustees Of Columbia University In The City Of New York | Non-Irritating Oral Care Formulations |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE516996A (enExample) * | 1952-02-19 | |||
| GB845611A (en) * | 1957-01-15 | 1960-08-24 | Hedley Thomas & Co Ltd | Improvements in and relating to toothpastes |
| US3044939A (en) * | 1959-02-26 | 1962-07-17 | American Chicle Co | Copper gluconate oral deodorant composition |
| US3070510A (en) * | 1959-11-03 | 1962-12-25 | Procter & Gamble | Dentifrice containing resinous cleaning agents |
| US3151027A (en) * | 1961-06-07 | 1964-09-29 | Procter & Gamble | Abrasive for dentifrice composition |
| FR3652M (fr) * | 1962-12-13 | 1965-11-02 | Procter & Gamble | Nouvelle composition dentifrice. |
| GB1055784A (en) * | 1963-06-21 | 1967-01-18 | Unilever Ltd | Polishing agent |
| US3175951A (en) * | 1963-11-08 | 1965-03-30 | Procter & Gamble | Oral compositions for caries prophylaxis |
| US3538230A (en) * | 1966-12-05 | 1970-11-03 | Lever Brothers Ltd | Oral compositions containing silica xerogels as cleaning and polishing agents |
| US3535421A (en) * | 1968-07-11 | 1970-10-20 | Procter & Gamble | Oral compositions for calculus retardation |
| US3662059A (en) * | 1969-06-02 | 1972-05-09 | Lever Brothers Ltd | Dentifrice composition |
| US3689637A (en) * | 1969-07-11 | 1972-09-05 | Lever Brothers Ltd | Dentifrice composition |
| SE367319B (enExample) | 1970-07-13 | 1974-05-27 | Astra Laekemedel Ab | |
| US3761583A (en) * | 1971-03-08 | 1973-09-25 | Witco Chemical Corp | Cuprous thiocyanate dentifrice composition |
| US4108978A (en) * | 1971-10-20 | 1978-08-22 | Beecham Inc. | Dental compositions |
| US3804946A (en) * | 1972-01-03 | 1974-04-16 | Colgate Palmolive Co | Dentifrices containing crystalline silica |
| GB1433743A (en) * | 1972-07-21 | 1976-04-28 | Unilever Ltd | Toothpastes |
| ZA737495B (en) * | 1972-10-30 | 1975-05-28 | Colgate Palmolive Co | Toothpastes |
| US4048300A (en) * | 1973-01-11 | 1977-09-13 | Colgate-Palmolive Company | Dental preparation containing materials having calcium and phosphate components |
| DE2456267A1 (de) * | 1973-12-03 | 1975-06-05 | Charles Dangelmajer | Zahnpflegemittel, insbesondere zahnpasta |
| US4007260A (en) * | 1974-01-21 | 1977-02-08 | Monsanto Company | Dentifrices |
| US4102992A (en) * | 1974-02-08 | 1978-07-25 | Beecham Group Limited | Dentifrice |
| DE2409756A1 (de) * | 1974-03-01 | 1975-09-11 | Blendax Werke Schneider Co | Zahnpflegemittel |
| US3943267A (en) * | 1974-05-17 | 1976-03-09 | Neil J. Randol | Method of remineralizing and immunizing tooth enamel for the prevention and control of tooth decay and dental caries |
| US4144321A (en) * | 1974-10-31 | 1979-03-13 | J. M. Huber Corporation | Amorphous precipitated siliceous pigments and methods for their production |
| PH12522A (en) * | 1976-02-05 | 1979-04-26 | Grace W R & Co | Oral teeth-cleaning composition |
| US4146608A (en) * | 1977-11-07 | 1979-03-27 | Lever Brothers Company | Synergistic anti-plaque mixture with tetradecylamine and copper, iron, nickel, or cobalt |
-
1980
- 1980-04-29 AT AT80102305T patent/ATE4776T1/de not_active IP Right Cessation
- 1980-04-29 DE DE8080102305T patent/DE3065016D1/de not_active Expired
- 1980-04-29 EP EP80102305A patent/EP0038868B1/de not_active Expired
-
1981
- 1981-04-09 US US06/252,406 patent/US4339429A/en not_active Expired - Lifetime
- 1981-04-10 AR AR284927A patent/AR224191A1/es active
- 1981-04-10 AU AU69419/81A patent/AU537684B2/en not_active Expired
- 1981-04-24 CA CA000376135A patent/CA1152433A/en not_active Expired
- 1981-04-28 ES ES501712A patent/ES501712A0/es active Granted
- 1981-04-30 JP JP6610481A patent/JPS56169620A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0654806U (ja) * | 1992-06-23 | 1994-07-26 | 北陵ジーアールシー工業株式会社 | 打込み方式型枠による床下換気口の取付け装置 |
Also Published As
| Publication number | Publication date |
|---|---|
| AU537684B2 (en) | 1984-07-05 |
| ATE4776T1 (de) | 1983-10-15 |
| ES8207424A1 (es) | 1982-09-16 |
| US4339429A (en) | 1982-07-13 |
| AU6941981A (en) | 1981-11-05 |
| EP0038868B1 (de) | 1983-09-28 |
| JPS56169620A (en) | 1981-12-26 |
| DE3065016D1 (en) | 1983-11-03 |
| EP0038868A1 (de) | 1981-11-04 |
| CA1152433A (en) | 1983-08-23 |
| AR224191A1 (es) | 1981-10-30 |
| ES501712A0 (es) | 1982-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6234004B2 (enExample) | ||
| US4332791A (en) | Toothpaste active against plaque comprising a copper compound and a silica polishing agent | |
| RU2552348C2 (ru) | Композиция для ухода за полостью рта, содержащая аргинин и карбонат кальция | |
| US5087444A (en) | Non-fluoride desensitizing mouthwash | |
| RU2465887C2 (ru) | Композиции для ухода за полостью рта и их применение | |
| US4891211A (en) | Stable hydrogen peroxide-releasing dentifice | |
| EP0344701B1 (en) | Oral compositions | |
| RU2270666C2 (ru) | Композиция для ухода за полостью рта и способ общей очистки, отбеливания и полировки зубов | |
| US5302374A (en) | Oral hygiene system | |
| RU2718064C2 (ru) | Композиции для ухода за полостью рта, содержащие комплексы цинк-аминокислота-галогенид | |
| US3966863A (en) | Oral hygiene compositions | |
| CA1282709C (en) | Composition for oral hygiene | |
| RU2550949C2 (ru) | Композиции, включающие основную аминокислоту и растворимую карбонатную соль | |
| US6251372B1 (en) | Oral care compositions comprising chlorite and methods | |
| US5389360A (en) | Oral compositions | |
| EP2506824B1 (en) | Non-aqueous, single tube dentrifice whitening compositions, methods of use and manufacture thereof | |
| JPH02286613A (ja) | 新規組成物 | |
| JPS6028808B2 (ja) | 歯磨組成物 | |
| CA1262528A (en) | Oral hygiene compositions containing strontium salts in the presence of fluoride | |
| EP0311260A2 (en) | Oral compositions | |
| US20200163868A1 (en) | Oral Care Compositions Comprising Charcoal | |
| US5496539A (en) | Oral compositions | |
| RU2712141C2 (ru) | Композиции для ухода за полостью рта и способы применения композиций | |
| US12447120B2 (en) | Oral care product and methods of use and manufacture thereof |