JPS6154768B2 - - Google Patents
Info
- Publication number
- JPS6154768B2 JPS6154768B2 JP52075635A JP7563577A JPS6154768B2 JP S6154768 B2 JPS6154768 B2 JP S6154768B2 JP 52075635 A JP52075635 A JP 52075635A JP 7563577 A JP7563577 A JP 7563577A JP S6154768 B2 JPS6154768 B2 JP S6154768B2
- Authority
- JP
- Japan
- Prior art keywords
- diamino
- hair
- atom
- hair dye
- coupling
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000010168 coupling process Methods 0.000 claims description 34
- 238000005859 coupling reaction Methods 0.000 claims description 34
- 230000008878 coupling Effects 0.000 claims description 33
- 239000000118 hair dye Substances 0.000 claims description 24
- 239000000126 substance Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 239000000975 dye Substances 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 239000000982 direct dye Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims 2
- 238000007254 oxidation reaction Methods 0.000 claims 2
- DTFKRVXLBCAIOZ-UHFFFAOYSA-N 2-methylanisole Chemical compound COC1=CC=CC=C1C DTFKRVXLBCAIOZ-UHFFFAOYSA-N 0.000 claims 1
- 238000004043 dyeing Methods 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 239000000839 emulsion Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 230000001590 oxidative effect Effects 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- 239000006071 cream Substances 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 7
- 239000007800 oxidant agent Substances 0.000 description 7
- 238000005691 oxidative coupling reaction Methods 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 150000002191 fatty alcohols Chemical class 0.000 description 6
- -1 heterocyclic hydrazones Chemical class 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- WERSDZKEJFOKJJ-UHFFFAOYSA-N 4-methoxy-5-methylbenzene-1,3-diamine Chemical compound COC1=C(C)C=C(N)C=C1N WERSDZKEJFOKJJ-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- PZRKPUQWIFJRKZ-UHFFFAOYSA-N pyrimidine-2,4,5,6-tetramine Chemical compound NC1=NC(N)=C(N)C(N)=N1 PZRKPUQWIFJRKZ-UHFFFAOYSA-N 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 4
- LQUBUCFMDWDLHL-UHFFFAOYSA-N 5-(2-methoxyethyl)benzene-1,3-diamine;dihydrochloride Chemical compound Cl.Cl.COCCC1=CC(N)=CC(N)=C1 LQUBUCFMDWDLHL-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- BSBULXMZRUJQLV-UHFFFAOYSA-N 5-methyl-4-octoxybenzene-1,3-diamine;dihydrochloride Chemical compound Cl.Cl.CCCCCCCCOC1=C(C)C=C(N)C=C1N BSBULXMZRUJQLV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 230000002110 toxicologic effect Effects 0.000 description 3
- 231100000027 toxicology Toxicity 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 2
- WQHPWSOXUFMYRJ-UHFFFAOYSA-N 1-methyl-3,5-dinitro-2-phenoxybenzene Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC1=CC=CC=C1 WQHPWSOXUFMYRJ-UHFFFAOYSA-N 0.000 description 2
- CQLYXIUHVFRXLT-UHFFFAOYSA-N 2-methoxyethylbenzene Chemical compound COCCC1=CC=CC=C1 CQLYXIUHVFRXLT-UHFFFAOYSA-N 0.000 description 2
- XSFKCGABINPZRK-UHFFFAOYSA-N 4-aminopyrazol-3-one Chemical class NC1=CN=NC1=O XSFKCGABINPZRK-UHFFFAOYSA-N 0.000 description 2
- NNKPLDDESWSLES-UHFFFAOYSA-N 4-ethoxy-5-methylbenzene-1,3-diamine;dihydrochloride Chemical compound Cl.Cl.CCOC1=C(C)C=C(N)C=C1N NNKPLDDESWSLES-UHFFFAOYSA-N 0.000 description 2
- WSGOOWHLGKOYFL-UHFFFAOYSA-N 4-methoxy-5-methylbenzene-1,3-diamine;dihydrochloride Chemical compound Cl.Cl.COC1=C(C)C=C(N)C=C1N WSGOOWHLGKOYFL-UHFFFAOYSA-N 0.000 description 2
- OZCJSIBGTRKJGX-UHFFFAOYSA-N 4-methylcyclohexa-1,5-diene-1,4-diamine Chemical compound CC1(N)CC=C(N)C=C1 OZCJSIBGTRKJGX-UHFFFAOYSA-N 0.000 description 2
- YWBXZNIBEBZZPO-UHFFFAOYSA-N 5-(2-methoxyethyl)benzene-1,3-diamine Chemical compound COCCC1=CC(N)=CC(N)=C1 YWBXZNIBEBZZPO-UHFFFAOYSA-N 0.000 description 2
- UFUHHJYOOBBUCY-UHFFFAOYSA-N 5-methyl-4-phenoxybenzene-1,3-diamine;dihydrochloride Chemical compound Cl.Cl.CC1=CC(N)=CC(N)=C1OC1=CC=CC=C1 UFUHHJYOOBBUCY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 2
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 description 1
- OOUYRFXOKGNRMR-UHFFFAOYSA-N 1-(2-methoxyethyl)-3,5-dinitrobenzene Chemical compound COCCC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 OOUYRFXOKGNRMR-UHFFFAOYSA-N 0.000 description 1
- VLDHMZXEMVVURD-UHFFFAOYSA-N 1-methyl-3,5-dinitro-2-octoxybenzene Chemical compound CCCCCCCCOC1=C(C)C=C([N+]([O-])=O)C=C1[N+]([O-])=O VLDHMZXEMVVURD-UHFFFAOYSA-N 0.000 description 1
- OBRXSWOUGTXMGW-UHFFFAOYSA-N 2-bromo-1-methyl-3,5-dinitrobenzene Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1Br OBRXSWOUGTXMGW-UHFFFAOYSA-N 0.000 description 1
- JUCSVQOEZGIMPJ-UHFFFAOYSA-N 2-ethoxy-1-methyl-3,5-dinitrobenzene Chemical compound CCOC1=C(C)C=C([N+]([O-])=O)C=C1[N+]([O-])=O JUCSVQOEZGIMPJ-UHFFFAOYSA-N 0.000 description 1
- ZZNBLJQOSZRREE-UHFFFAOYSA-N 2-methoxy-1-methyl-3,4-dinitrobenzene Chemical compound COC1=C(C)C=CC([N+]([O-])=O)=C1[N+]([O-])=O ZZNBLJQOSZRREE-UHFFFAOYSA-N 0.000 description 1
- HGUYBLVGLMAUFF-UHFFFAOYSA-N 2-methoxybenzene-1,4-diamine Chemical compound COC1=CC(N)=CC=C1N HGUYBLVGLMAUFF-UHFFFAOYSA-N 0.000 description 1
- MODIWXTUGZOVPP-UHFFFAOYSA-N 2-morpholin-4-ylpyrimidine-4,5,6-triamine Chemical compound NC1=C(N)C(N)=NC(N2CCOCC2)=N1 MODIWXTUGZOVPP-UHFFFAOYSA-N 0.000 description 1
- STMSOJGQPFGGLE-UHFFFAOYSA-N 2-n,2-n,4-n,4-n-tetramethylpyrimidine-2,4,5,6-tetramine Chemical compound CN(C)C1=NC(N)=C(N)C(N(C)C)=N1 STMSOJGQPFGGLE-UHFFFAOYSA-N 0.000 description 1
- GFKHZYMALAAJBX-UHFFFAOYSA-N 2-n,2-n-dimethylpyrimidine-2,4,5,6-tetramine Chemical compound CN(C)C1=NC(N)=C(N)C(N)=N1 GFKHZYMALAAJBX-UHFFFAOYSA-N 0.000 description 1
- HVYWMOMLDIMFJA-UHFFFAOYSA-N 3-cholesterol Natural products C1C=C2CC(O)CCC2(C)C2C1C1CCC(C(C)CCCC(C)C)C1(C)CC2 HVYWMOMLDIMFJA-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000003700 hair damage Effects 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000004988 m-phenylenediamines Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- CWERGRDVMFNCDR-UHFFFAOYSA-M thioglycolate(1-) Chemical compound [O-]C(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-M 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q5/00—Preparations for care of the hair
- A61Q5/10—Preparations for permanently dyeing the hair
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/411—Aromatic amines, i.e. where the amino group is directly linked to the aromatic nucleus
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2628999A DE2628999C2 (de) | 1976-06-28 | 1976-06-28 | Haarfärbemittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS533427A JPS533427A (en) | 1978-01-13 |
| JPS6154768B2 true JPS6154768B2 (OSRAM) | 1986-11-25 |
Family
ID=5981658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP7563577A Granted JPS533427A (en) | 1976-06-28 | 1977-06-27 | Hairrdies |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4171203A (OSRAM) |
| JP (1) | JPS533427A (OSRAM) |
| AT (1) | AT348135B (OSRAM) |
| BE (1) | BE856145A (OSRAM) |
| CH (1) | CH632925A5 (OSRAM) |
| DE (1) | DE2628999C2 (OSRAM) |
| DK (1) | DK158771C (OSRAM) |
| FR (1) | FR2356413A1 (OSRAM) |
| GB (1) | GB1581579A (OSRAM) |
| IT (1) | IT1080777B (OSRAM) |
| NL (1) | NL7706257A (OSRAM) |
| SE (1) | SE422410B (OSRAM) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2362116A1 (fr) * | 1976-08-20 | 1978-03-17 | Oreal | Metaphenylenediamines et compositions tinctoriales les contenant |
| DE2855917A1 (de) * | 1978-12-23 | 1980-07-10 | Wella Ag | Mittel und verfahren zur faerbung von haaren |
| FR2459042A1 (fr) * | 1979-06-18 | 1981-01-09 | Oreal | Nouvelles compositions tinctoriales pour cheveux contenant, comme coupleur le diamino-2,4 butoxybenzene et/ou ses sels |
| FR2461494A1 (fr) * | 1979-07-24 | 1981-02-06 | Oreal | Compositions tinctoriales pour cheveux contenant, en tant que coupleur, au moins un diamino-2,4 alkylbenzene |
| DE3011191A1 (de) * | 1980-03-22 | 1981-10-01 | Henkel KGaA, 4000 Düsseldorf | Neue kupplerkomponenten fuer oxidationshaarfarben, deren herstellung und verwendung sowie diese enthaltende haarfaerbemittel |
| US5089257A (en) * | 1980-08-21 | 1992-02-18 | Henkel Kommanditgesellschaft Auf Aktien | Preparation for the simultaneous coloring, washing, and conditioning of human hair |
| US4566876A (en) * | 1983-03-10 | 1986-01-28 | Clairol Incorporated | Meta-phenylenediamine coupler compounds and oxidative hair dye compositions and methods using same |
| DE3430513A1 (de) * | 1984-08-18 | 1986-02-27 | Wella Ag, 6100 Darmstadt | Haarfaerbemittel mit diamino-tetrafluorethoxybenzolen sowie neue diamino-tetrafluorethoxybenzole |
| DE3622784A1 (de) * | 1986-07-07 | 1988-01-21 | Wella Ag | Neue 5-alkoxy-2,4-diamino-alkylbenzole sowie haarfaerbemittel mit 5-alkoxy-2,4-diamino-alkyl-benzolen |
| USRE34745E (en) * | 1986-10-30 | 1994-09-27 | The Dow Chemical Company | High purity process for the preparation of 4,6-diamino-1,3-benzenediol |
| USH726H (en) | 1987-01-09 | 1990-01-02 | Clairol Incorporated | 2,4-bis-aryloxy-m-phenylenediamines and their use as couplers in oxidation dye compositions |
| LU86905A1 (fr) * | 1987-05-29 | 1989-01-19 | Oreal | Nouvelles metaphenylenediamines,leur procede de preparation,composes intermediaires et utilisation de ces metaphenylenediamines en tant que coupleurs pour la teinture d'oxydation des fibres keratiniques et en particulier des cheveux humains |
| LU87396A1 (fr) * | 1988-11-22 | 1990-06-12 | Oreal | Nouvelles metaphenylenediamines trialcoxy-substituees,leur procede de preparation,et leur utilisation en tant que coupleurs pour la teinture d'oxydation des fibres keratiniques et en particulier des cheveux humains |
| FR2786092B1 (fr) * | 1998-11-20 | 2002-11-29 | Oreal | Composition de teinture d'oxydation des fibres keratiniques et procede de teinture mettant en oeuvre cette composition |
| DE19959318A1 (de) * | 1999-12-09 | 2001-06-13 | Henkel Kgaa | Neue Farbstoffkombination |
| DE19959320A1 (de) * | 1999-12-09 | 2001-06-13 | Henkel Kgaa | Neue Farbstoffkombination |
| DE19959319A1 (de) * | 1999-12-09 | 2001-06-13 | Henkel Kgaa | Neue Farbstoffkombination |
| DE10034618A1 (de) * | 2000-07-17 | 2002-01-31 | Henkel Kgaa | Oxidationshaarfärbemittel |
| DE10114561A1 (de) * | 2001-03-24 | 2002-09-26 | Wella Ag | Verwendung von Mitteln enthaltend Kreatin, Kreatin und/oder deren Derivaten zur Verstärkung und Strukturverbesserung von keratinischen Fasern |
| DE10260822A1 (de) * | 2002-12-23 | 2004-07-01 | Henkel Kgaa | Neue Kupplerkomponenten |
| DE102004053653A1 (de) * | 2004-11-03 | 2006-05-04 | Henkel Kgaa | Oxidationsfärbemittel ohne Entwicklerkomponente |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1574337A (en) * | 1924-10-15 | 1926-02-23 | Bogert Marston Taylor | Dyestuff intermediates |
| US2548574A (en) * | 1947-02-27 | 1951-04-10 | Eastman Kodak Co | Sulfonamide substituted p-phenylenediamines containing o-alkoxy groups as silver halide photographic developers |
| BE625116A (OSRAM) * | 1961-11-22 | |||
| FR1426889A (fr) * | 1964-03-02 | 1966-02-04 | Oreal | Nouvelle solution tinctoriale pour cheveux |
| GB1077920A (en) * | 1964-12-18 | 1967-08-02 | Monsanto Chem Australia Ltd | Preparation of o-phenylenediamines |
| NL125337C (OSRAM) * | 1965-04-21 | |||
| US4031160A (en) * | 1965-05-06 | 1977-06-21 | Societe Anonyme Dite: L'oreal | 2-Amino-4-hydroxy-5-chloro toluene and the hydrochloride thereof |
| LU56102A1 (OSRAM) * | 1968-05-17 | 1970-01-14 | ||
| LU56722A1 (OSRAM) * | 1968-08-14 | 1970-02-16 | ||
| BE786710A (fr) * | 1971-10-04 | 1973-01-25 | Bristol Myers Co | Composition pour la teinture du cheveu avec |
| US4003699A (en) * | 1974-11-22 | 1977-01-18 | Henkel & Cie G.M.B.H. | Oxidation hair dyes based upon tetraaminopyrimidine developers |
| FR2315255A1 (fr) * | 1975-06-26 | 1977-01-21 | Oreal | Coupleurs glycoles |
-
1976
- 1976-06-28 DE DE2628999A patent/DE2628999C2/de not_active Expired
-
1977
- 1977-06-07 DK DK250777A patent/DK158771C/da active
- 1977-06-07 SE SE7706635A patent/SE422410B/xx not_active IP Right Cessation
- 1977-06-07 NL NL7706257A patent/NL7706257A/xx not_active Application Discontinuation
- 1977-06-20 US US05/807,972 patent/US4171203A/en not_active Expired - Lifetime
- 1977-06-23 IT IT24971/77A patent/IT1080777B/it active
- 1977-06-24 GB GB26498/77A patent/GB1581579A/en not_active Expired
- 1977-06-27 AT AT452577A patent/AT348135B/de not_active IP Right Cessation
- 1977-06-27 BE BE178808A patent/BE856145A/xx not_active IP Right Cessation
- 1977-06-27 JP JP7563577A patent/JPS533427A/ja active Granted
- 1977-06-28 CH CH794077A patent/CH632925A5/de not_active IP Right Cessation
- 1977-06-28 FR FR7719866A patent/FR2356413A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4171203A (en) | 1979-10-16 |
| FR2356413B1 (OSRAM) | 1981-07-31 |
| GB1581579A (en) | 1980-12-17 |
| DK250777A (da) | 1977-12-29 |
| DK158771C (da) | 1990-12-03 |
| ATA452577A (de) | 1978-06-15 |
| SE422410B (sv) | 1982-03-08 |
| AT348135B (de) | 1979-01-25 |
| NL7706257A (nl) | 1977-12-30 |
| CH632925A5 (de) | 1982-11-15 |
| DE2628999A1 (de) | 1978-01-05 |
| IT1080777B (it) | 1985-05-16 |
| JPS533427A (en) | 1978-01-13 |
| SE7706635L (sv) | 1977-12-29 |
| FR2356413A1 (fr) | 1978-01-27 |
| DE2628999C2 (de) | 1987-03-26 |
| BE856145A (fr) | 1977-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6154768B2 (OSRAM) | ||
| US4840639A (en) | Agent for dyeing hair | |
| US5047066A (en) | Dye composition for keratinous fibers containing a 2-substituted 4-aminophenol compound as a developer, and a coupling substance | |
| US4043750A (en) | Developer-coupler hair dyes based on triamino-pyrimidinones | |
| US4129413A (en) | Oxidation hair dyes based upon tetraaminopyrimidine developers and mono- and dialkyl -m- dihydroxy benzene couplers | |
| JPS6213462A (ja) | 新規アミノフエノ−ル及び酸化染毛剤中にこれを使用する方法 | |
| JPH01193248A (ja) | フェニルアミノピリジンおよびフェニルアミノメチルピリジン並びにそれらを含有する染髪製剤 | |
| JP2003527407A (ja) | ケラチン繊維を染色するための薬剤及び方法 | |
| US4129414A (en) | Oxidation hair colorants containing water-soluble polyhalogen 3-aminophenols as couplers | |
| US4213758A (en) | Oxidation hair dyes based upon tetraaminopyrimidine developers and couplers therefor | |
| CZ274698A3 (cs) | Použití aminofenolových derivátů a oxidační barvicí prostředky | |
| JPH0216282B2 (OSRAM) | ||
| US4104020A (en) | Hair dye compositions containing 4,7-diaminoindazoles | |
| JPS5967216A (ja) | 染毛剤 | |
| US4325704A (en) | Hair dyes | |
| JPH0321002B2 (OSRAM) | ||
| JPH083121A (ja) | 毛髪酸化染色用薬剤及び新規な2−アルキルアミノ−4−アミノ−1−アルキルベンゼン類 | |
| WO2001010379A2 (de) | Mittel zum färben von keratinhaltigen fasern | |
| JPS6124513A (ja) | 染毛剤 | |
| DE10336202A1 (de) | Mittel und Verfahren zur Färbung keratinischer Fasern | |
| EP0002828B1 (de) | Haarfärbemittel | |
| US4900325A (en) | Hair-dyeing preparations | |
| US3909190A (en) | Hair dyeing process and composition containing {60 -cyano-methanesulfonamido-nitrobenzene derivatives | |
| WO2000038629A1 (de) | Mittel zum färben von keratinhaltigen fasern | |
| JPS6117806B2 (OSRAM) |