JPS6135211B2 - - Google Patents
Info
- Publication number
 - JPS6135211B2 JPS6135211B2 JP53154288A JP15428878A JPS6135211B2 JP S6135211 B2 JPS6135211 B2 JP S6135211B2 JP 53154288 A JP53154288 A JP 53154288A JP 15428878 A JP15428878 A JP 15428878A JP S6135211 B2 JPS6135211 B2 JP S6135211B2
 - Authority
 - JP
 - Japan
 - Prior art keywords
 - polyamine
 - water
 - mol
 - soluble
 - amine
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Expired
 
Links
- 229920000768 polyamine Polymers 0.000 claims description 194
 - 239000000203 mixture Substances 0.000 claims description 66
 - -1 polyethylene Polymers 0.000 claims description 43
 - 239000004698 Polyethylene Substances 0.000 claims description 37
 - 229920000573 polyethylene Polymers 0.000 claims description 37
 - 239000004952 Polyamide Substances 0.000 claims description 34
 - 229920001281 polyalkylene Polymers 0.000 claims description 34
 - 229920002647 polyamide Polymers 0.000 claims description 34
 - 150000001412 amines Chemical class 0.000 claims description 33
 - WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 26
 - 239000007795 chemical reaction product Substances 0.000 claims description 24
 - BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims description 23
 - 238000006243 chemical reaction Methods 0.000 claims description 23
 - PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 21
 - 150000001875 compounds Chemical class 0.000 claims description 21
 - 239000002253 acid Substances 0.000 claims description 18
 - RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 claims description 16
 - 125000001931 aliphatic group Chemical group 0.000 claims description 16
 - QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 14
 - SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims description 12
 - 125000003277 amino group Chemical group 0.000 claims description 12
 - 125000004432 carbon atom Chemical group C* 0.000 claims description 11
 - 238000009833 condensation Methods 0.000 claims description 11
 - 230000005494 condensation Effects 0.000 claims description 11
 - 238000004519 manufacturing process Methods 0.000 claims description 11
 - 239000003795 chemical substances by application Substances 0.000 claims description 10
 - 150000003951 lactams Chemical class 0.000 claims description 9
 - 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
 - IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 8
 - OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 8
 - 150000007513 acids Chemical class 0.000 claims description 8
 - LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 claims description 8
 - 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 8
 - 125000001302 tertiary amino group Chemical group 0.000 claims description 8
 - 229910052757 nitrogen Inorganic materials 0.000 claims description 7
 - 239000002699 waste material Substances 0.000 claims description 7
 - ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 claims description 6
 - 229910021529 ammonia Inorganic materials 0.000 claims description 6
 - 239000007788 liquid Substances 0.000 claims description 6
 - 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
 - 239000012736 aqueous medium Substances 0.000 claims description 3
 - 229910052799 carbon Inorganic materials 0.000 claims 3
 - 239000004480 active ingredient Substances 0.000 claims 2
 - 239000000654 additive Substances 0.000 claims 2
 - 230000000996 additive effect Effects 0.000 claims 2
 - 125000000524 functional group Chemical group 0.000 claims 1
 - 150000003141 primary amines Chemical group 0.000 claims 1
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 61
 - 239000000243 solution Substances 0.000 description 44
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
 - 239000007864 aqueous solution Substances 0.000 description 31
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
 - 230000014759 maintenance of location Effects 0.000 description 16
 - WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 14
 - 230000000694 effects Effects 0.000 description 12
 - 239000011541 reaction mixture Substances 0.000 description 12
 - 238000003756 stirring Methods 0.000 description 11
 - QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
 - VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 7
 - 239000001361 adipic acid Substances 0.000 description 7
 - 235000011037 adipic acid Nutrition 0.000 description 7
 - 229960001124 trientine Drugs 0.000 description 7
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
 - 229920001131 Pulp (paper) Polymers 0.000 description 6
 - 230000002378 acidificating effect Effects 0.000 description 6
 - 238000000034 method Methods 0.000 description 6
 - 230000035484 reaction time Effects 0.000 description 6
 - 230000007935 neutral effect Effects 0.000 description 5
 - 238000002360 preparation method Methods 0.000 description 5
 - 239000000047 product Substances 0.000 description 5
 - FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
 - 239000012752 auxiliary agent Substances 0.000 description 4
 - 238000009835 boiling Methods 0.000 description 4
 - JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 4
 - KMBPCQSCMCEPMU-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-methylpropane-1,3-diamine Chemical compound NCCCN(C)CCCN KMBPCQSCMCEPMU-UHFFFAOYSA-N 0.000 description 4
 - LSHROXHEILXKHM-UHFFFAOYSA-N n'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine Chemical compound NCCNCCNCCNCCNCCN LSHROXHEILXKHM-UHFFFAOYSA-N 0.000 description 4
 - 239000000725 suspension Substances 0.000 description 4
 - FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 4
 - SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
 - NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
 - POGBEGTVYWWXSF-UHFFFAOYSA-N 2-[bis(3-aminopropyl)amino]ethanol Chemical compound NCCCN(CCO)CCCN POGBEGTVYWWXSF-UHFFFAOYSA-N 0.000 description 3
 - QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
 - KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
 - IBVAQQYNSHJXBV-UHFFFAOYSA-N adipic acid dihydrazide Chemical compound NNC(=O)CCCCC(=O)NN IBVAQQYNSHJXBV-UHFFFAOYSA-N 0.000 description 3
 - DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 3
 - OTBHHUPVCYLGQO-UHFFFAOYSA-N bis(3-aminopropyl)amine Chemical compound NCCCNCCCN OTBHHUPVCYLGQO-UHFFFAOYSA-N 0.000 description 3
 - 238000001816 cooling Methods 0.000 description 3
 - 238000002474 experimental method Methods 0.000 description 3
 - 239000000835 fiber Substances 0.000 description 3
 - 238000005188 flotation Methods 0.000 description 3
 - 239000001257 hydrogen Substances 0.000 description 3
 - 229910052739 hydrogen Inorganic materials 0.000 description 3
 - 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
 - 239000000463 material Substances 0.000 description 3
 - ZKKMLXOYLORBLV-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-ethylpropane-1,3-diamine Chemical compound NCCCN(CC)CCCN ZKKMLXOYLORBLV-UHFFFAOYSA-N 0.000 description 3
 - 239000000049 pigment Substances 0.000 description 3
 - 238000004062 sedimentation Methods 0.000 description 3
 - VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
 - FDMXADMEKAUMIV-NSCUHMNNSA-N (e)-prop-1-ene-1,2-diamine Chemical compound C\C(N)=C/N FDMXADMEKAUMIV-NSCUHMNNSA-N 0.000 description 2
 - XAZDZMUGHYYPQM-UHFFFAOYSA-N 1-chloro-3-(3-chloro-2-hydroxypropoxy)propan-2-ol Chemical compound ClCC(O)COCC(O)CCl XAZDZMUGHYYPQM-UHFFFAOYSA-N 0.000 description 2
 - RXFCIXRFAJRBSG-UHFFFAOYSA-N 3,2,3-tetramine Chemical compound NCCCNCCNCCCN RXFCIXRFAJRBSG-UHFFFAOYSA-N 0.000 description 2
 - KRPRVQWGKLEFKN-UHFFFAOYSA-N 3-(3-aminopropoxy)propan-1-amine Chemical compound NCCCOCCCN KRPRVQWGKLEFKN-UHFFFAOYSA-N 0.000 description 2
 - SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 2
 - UQXNEWQGGVUVQA-UHFFFAOYSA-N 8-aminooctanoic acid Chemical compound NCCCCCCCC(O)=O UQXNEWQGGVUVQA-UHFFFAOYSA-N 0.000 description 2
 - NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
 - 239000005995 Aluminium silicate Substances 0.000 description 2
 - VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
 - VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
 - OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
 - VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
 - NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
 - 239000004743 Polypropylene Substances 0.000 description 2
 - GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
 - 235000012211 aluminium silicate Nutrition 0.000 description 2
 - 229960002684 aminocaproic acid Drugs 0.000 description 2
 - IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 2
 - 238000010790 dilution Methods 0.000 description 2
 - 239000012895 dilution Substances 0.000 description 2
 - XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
 - 238000004821 distillation Methods 0.000 description 2
 - 238000001914 filtration Methods 0.000 description 2
 - 238000005984 hydrogenation reaction Methods 0.000 description 2
 - 238000002347 injection Methods 0.000 description 2
 - 239000007924 injection Substances 0.000 description 2
 - NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
 - VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
 - 239000011976 maleic acid Substances 0.000 description 2
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
 - IMENJLNZKOMSMC-UHFFFAOYSA-N n'-[2-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine Chemical compound NCCNCCNCCNCCNCCNCCNCCN IMENJLNZKOMSMC-UHFFFAOYSA-N 0.000 description 2
 - 229920000962 poly(amidoamine) Polymers 0.000 description 2
 - 238000006068 polycondensation reaction Methods 0.000 description 2
 - 229920001155 polypropylene Polymers 0.000 description 2
 - 230000001737 promoting effect Effects 0.000 description 2
 - KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
 - 238000010992 reflux Methods 0.000 description 2
 - 150000003839 salts Chemical class 0.000 description 2
 - CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
 - 239000011780 sodium chloride Substances 0.000 description 2
 - 239000007787 solid Substances 0.000 description 2
 - ATHGHQPFGPMSJY-UHFFFAOYSA-N spermidine Chemical compound NCCCCNCCCN ATHGHQPFGPMSJY-UHFFFAOYSA-N 0.000 description 2
 - 238000003860 storage Methods 0.000 description 2
 - 239000000126 substance Substances 0.000 description 2
 - LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
 - JEQDSBVHLKBEIZ-REOHCLBHSA-N (2s)-2-chloropropanoyl chloride Chemical compound C[C@H](Cl)C(Cl)=O JEQDSBVHLKBEIZ-REOHCLBHSA-N 0.000 description 1
 - HFBHOAHFRNLZGN-LURJTMIESA-N (2s)-2-formamido-4-methylpentanoic acid Chemical compound CC(C)C[C@@H](C(O)=O)NC=O HFBHOAHFRNLZGN-LURJTMIESA-N 0.000 description 1
 - NGDLSKPZMOTRTR-OAPYJULQSA-N (4z)-4-heptadecylidene-3-hexadecyloxetan-2-one Chemical compound CCCCCCCCCCCCCCCC\C=C1/OC(=O)C1CCCCCCCCCCCCCCCC NGDLSKPZMOTRTR-OAPYJULQSA-N 0.000 description 1
 - 125000006702 (C1-C18) alkyl group Chemical group 0.000 description 1
 - QBIAZVPERXOGAL-OWOJBTEDSA-N (e)-prop-1-ene-1,3-diamine Chemical compound NC\C=C\N QBIAZVPERXOGAL-OWOJBTEDSA-N 0.000 description 1
 - PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
 - KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
 - VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
 - DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 1
 - YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
 - ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 1
 - OVISMSJCKCDOPU-UHFFFAOYSA-N 1,6-dichlorohexane Chemical compound ClCCCCCCCl OVISMSJCKCDOPU-UHFFFAOYSA-N 0.000 description 1
 - FYBFGAFWCBMEDG-UHFFFAOYSA-N 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one Chemical compound C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)C=C)C1 FYBFGAFWCBMEDG-UHFFFAOYSA-N 0.000 description 1
 - PVBMXMKIKMJQRK-UHFFFAOYSA-N 1-chloro-4-(4-chlorobutoxy)butane Chemical compound ClCCCCOCCCCCl PVBMXMKIKMJQRK-UHFFFAOYSA-N 0.000 description 1
 - RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
 - VUSYFNXNYLAECV-UHFFFAOYSA-N 2,3-bis(chloromethyl)oxirane Chemical compound ClCC1OC1CCl VUSYFNXNYLAECV-UHFFFAOYSA-N 0.000 description 1
 - JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
 - SVDDJQGVOFZBNX-UHFFFAOYSA-N 2-chloroethyl carbonochloridate Chemical compound ClCCOC(Cl)=O SVDDJQGVOFZBNX-UHFFFAOYSA-N 0.000 description 1
 - ZAXCZCOUDLENMH-UHFFFAOYSA-N 3,3,3-tetramine Chemical compound NCCCNCCCNCCCN ZAXCZCOUDLENMH-UHFFFAOYSA-N 0.000 description 1
 - QPIOXOJERGNNMX-UHFFFAOYSA-N 3-(3-aminopropylsulfanyl)propan-1-amine Chemical compound NCCCSCCCN QPIOXOJERGNNMX-UHFFFAOYSA-N 0.000 description 1
 - USNBVHYUYWSPNK-UHFFFAOYSA-N 3-[3-(3-aminopropoxy)-2,2-dimethylpropoxy]propan-1-amine Chemical compound NCCCOCC(C)(C)COCCCN USNBVHYUYWSPNK-UHFFFAOYSA-N 0.000 description 1
 - CJCOYIXVZLLXHJ-UHFFFAOYSA-N 3-[4-(3-aminopropoxy)phenoxy]propan-1-amine Chemical compound NCCCOC1=CC=C(OCCCN)C=C1 CJCOYIXVZLLXHJ-UHFFFAOYSA-N 0.000 description 1
 - XYIPVIYOQCSMHP-UHFFFAOYSA-N 3-[[4-(3-aminopropoxymethyl)cyclohexyl]methoxy]propan-1-amine Chemical compound NCCCOCC1CCC(COCCCN)CC1 XYIPVIYOQCSMHP-UHFFFAOYSA-N 0.000 description 1
 - FRXLFVNGTPQFEJ-UHFFFAOYSA-N 3-bromopropanoyl bromide Chemical compound BrCCC(Br)=O FRXLFVNGTPQFEJ-UHFFFAOYSA-N 0.000 description 1
 - INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
 - LFEAJBLOEPTINE-UHFFFAOYSA-N 4-(chloromethyl)-1,3-dioxolan-2-one Chemical compound ClCC1COC(=O)O1 LFEAJBLOEPTINE-UHFFFAOYSA-N 0.000 description 1
 - HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
 - QCFYJCYNJLBDRT-UHFFFAOYSA-N Bis(2-chloro-1-methylethyl)ether Chemical compound ClCC(C)OC(C)CCl QCFYJCYNJLBDRT-UHFFFAOYSA-N 0.000 description 1
 - ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
 - 241000218645 Cedrus Species 0.000 description 1
 - VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
 - ZFIVKAOQEXOYFY-UHFFFAOYSA-N Diepoxybutane Chemical compound C1OC1C1OC1 ZFIVKAOQEXOYFY-UHFFFAOYSA-N 0.000 description 1
 - QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
 - 239000004593 Epoxy Substances 0.000 description 1
 - JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
 - 240000000731 Fagus sylvatica Species 0.000 description 1
 - 235000010099 Fagus sylvatica Nutrition 0.000 description 1
 - CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
 - VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
 - 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
 - ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
 - KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
 - NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
 - LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
 - QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
 - FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
 - 239000002671 adjuvant Substances 0.000 description 1
 - 125000000217 alkyl group Chemical group 0.000 description 1
 - 125000002947 alkylene group Chemical group 0.000 description 1
 - 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
 - 125000003368 amide group Chemical group 0.000 description 1
 - 150000001408 amides Chemical class 0.000 description 1
 - 150000008064 anhydrides Chemical class 0.000 description 1
 - JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
 - 125000003118 aryl group Chemical group 0.000 description 1
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
 - KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
 - 229910000019 calcium carbonate Inorganic materials 0.000 description 1
 - BELZJFWUNQWBES-UHFFFAOYSA-N caldopentamine Chemical compound NCCCNCCCNCCCNCCCN BELZJFWUNQWBES-UHFFFAOYSA-N 0.000 description 1
 - FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
 - 229940106681 chloroacetic acid Drugs 0.000 description 1
 - AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
 - 230000001112 coagulating effect Effects 0.000 description 1
 - 238000005345 coagulation Methods 0.000 description 1
 - 230000015271 coagulation Effects 0.000 description 1
 - 238000006482 condensation reaction Methods 0.000 description 1
 - VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
 - 230000003247 decreasing effect Effects 0.000 description 1
 - 230000001419 dependent effect Effects 0.000 description 1
 - 150000004985 diamines Chemical class 0.000 description 1
 - 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
 - 150000001991 dicarboxylic acids Chemical class 0.000 description 1
 - GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
 - 238000009826 distribution Methods 0.000 description 1
 - AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
 - 239000003623 enhancer Substances 0.000 description 1
 - 150000002148 esters Chemical class 0.000 description 1
 - 229940052303 ethers for general anesthesia Drugs 0.000 description 1
 - UPCIBFUJJLCOQG-UHFFFAOYSA-L ethyl-[2-[2-[ethyl(dimethyl)azaniumyl]ethyl-methylamino]ethyl]-dimethylazanium;dibromide Chemical compound [Br-].[Br-].CC[N+](C)(C)CCN(C)CC[N+](C)(C)CC UPCIBFUJJLCOQG-UHFFFAOYSA-L 0.000 description 1
 - 239000000194 fatty acid Substances 0.000 description 1
 - 239000001530 fumaric acid Substances 0.000 description 1
 - 239000007789 gas Substances 0.000 description 1
 - 150000004820 halides Chemical class 0.000 description 1
 - 238000010438 heat treatment Methods 0.000 description 1
 - 125000000623 heterocyclic group Chemical group 0.000 description 1
 - 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
 - 238000009775 high-speed stirring Methods 0.000 description 1
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
 - 150000002484 inorganic compounds Chemical class 0.000 description 1
 - 229910010272 inorganic material Inorganic materials 0.000 description 1
 - GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 1
 - 239000002609 medium Substances 0.000 description 1
 - FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
 - LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
 - 239000010812 mixed waste Substances 0.000 description 1
 - 238000002156 mixing Methods 0.000 description 1
 - QMXSDTGNCZVWTB-UHFFFAOYSA-N n',n'-bis(3-aminopropyl)propane-1,3-diamine Chemical class NCCCN(CCCN)CCCN QMXSDTGNCZVWTB-UHFFFAOYSA-N 0.000 description 1
 - CMDGBXZMCXCQFG-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-butylpropane-1,3-diamine Chemical compound CCCCN(CCCN)CCCN CMDGBXZMCXCQFG-UHFFFAOYSA-N 0.000 description 1
 - AQGNVWRYTKPRMR-UHFFFAOYSA-N n'-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine Chemical compound NCCNCCNCCNCCNCCNCCN AQGNVWRYTKPRMR-UHFFFAOYSA-N 0.000 description 1
 - BTJCQNIQJYIKBU-UHFFFAOYSA-N n'-[3-[2-(3-aminopropylamino)ethylamino]propyl]propane-1,3-diamine Chemical compound NCCCNCCCNCCNCCCN BTJCQNIQJYIKBU-UHFFFAOYSA-N 0.000 description 1
 - QHJABUZHRJTCAR-UHFFFAOYSA-N n'-methylpropane-1,3-diamine Chemical compound CNCCCN QHJABUZHRJTCAR-UHFFFAOYSA-N 0.000 description 1
 - ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
 - 238000006386 neutralization reaction Methods 0.000 description 1
 - MVAOEXBRERPGIT-UHFFFAOYSA-N octamine Chemical compound N.N.N.N.N.N.N.N MVAOEXBRERPGIT-UHFFFAOYSA-N 0.000 description 1
 - 239000001301 oxygen Substances 0.000 description 1
 - 229910052760 oxygen Inorganic materials 0.000 description 1
 - SCHTXWZFMCQMBH-UHFFFAOYSA-N pentane-1,3,5-triamine Chemical compound NCCC(N)CCN SCHTXWZFMCQMBH-UHFFFAOYSA-N 0.000 description 1
 - PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
 - 238000005325 percolation Methods 0.000 description 1
 - 125000004193 piperazinyl group Chemical group 0.000 description 1
 - 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
 - 238000006116 polymerization reaction Methods 0.000 description 1
 - 229920005862 polyol Polymers 0.000 description 1
 - 150000003077 polyols Chemical class 0.000 description 1
 - 239000011591 potassium Substances 0.000 description 1
 - 229910052700 potassium Inorganic materials 0.000 description 1
 - 235000019260 propionic acid Nutrition 0.000 description 1
 - AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
 - IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
 - 239000002994 raw material Substances 0.000 description 1
 - 239000011347 resin Substances 0.000 description 1
 - 229920005989 resin Polymers 0.000 description 1
 - 238000000926 separation method Methods 0.000 description 1
 - 239000011122 softwood Substances 0.000 description 1
 - PFNFFQXMRSDOHW-UHFFFAOYSA-N spermine Chemical compound NCCCNCCCCNCCCN PFNFFQXMRSDOHW-UHFFFAOYSA-N 0.000 description 1
 - 239000007858 starting material Substances 0.000 description 1
 - 229910052717 sulfur Inorganic materials 0.000 description 1
 - 239000011593 sulfur Substances 0.000 description 1
 - 230000002195 synergetic effect Effects 0.000 description 1
 - 125000003396 thiol group Chemical group [H]S* 0.000 description 1
 - VSRBKQFNFZQRBM-UHFFFAOYSA-N tuaminoheptane Chemical compound CCCCCC(C)N VSRBKQFNFZQRBM-UHFFFAOYSA-N 0.000 description 1
 - 229960003986 tuaminoheptane Drugs 0.000 description 1
 - 229960000834 vinyl ether Drugs 0.000 description 1
 - 229920002554 vinyl polymer Polymers 0.000 description 1
 - NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
 - 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
 - C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
 - C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
 - C08G69/48—Polymers modified by chemical after-treatment
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
 - C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
 - C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
 - C08G73/02—Polyamines
 - C08G73/0206—Polyalkylene(poly)amines
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
 - C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
 - C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
 - C08G73/02—Polyamines
 - C08G73/028—Polyamidoamines
 
 - 
        
- D—TEXTILES; PAPER
 - D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
 - D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
 - D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
 - D21H17/20—Macromolecular organic compounds
 - D21H17/33—Synthetic macromolecular compounds
 - D21H17/46—Synthetic macromolecular compounds obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds
 - D21H17/54—Synthetic macromolecular compounds obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds obtained by reactions forming in the main chain of the macromolecule a linkage containing nitrogen
 - D21H17/55—Polyamides; Polyaminoamides; Polyester-amides
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Chemical Kinetics & Catalysis (AREA)
 - Health & Medical Sciences (AREA)
 - Medicinal Chemistry (AREA)
 - Polymers & Plastics (AREA)
 - Organic Chemistry (AREA)
 - General Chemical & Material Sciences (AREA)
 - Polyamides (AREA)
 - Paper (AREA)
 - Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| DE2756431A DE2756431C2 (de) | 1977-12-17 | 1977-12-17 | Amidgruppenhaltige Polyamine | 
Publications (2)
| Publication Number | Publication Date | 
|---|---|
| JPS5490399A JPS5490399A (en) | 1979-07-18 | 
| JPS6135211B2 true JPS6135211B2 (h) | 1986-08-12 | 
Family
ID=6026477
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| JP15428878A Granted JPS5490399A (en) | 1977-12-17 | 1978-12-15 | Amide group containing polyamine | 
Country Status (9)
| Country | Link | 
|---|---|
| US (2) | US4250299A (h) | 
| EP (1) | EP0002474B2 (h) | 
| JP (1) | JPS5490399A (h) | 
| BR (1) | BR7808244A (h) | 
| CA (1) | CA1121547A (h) | 
| DE (2) | DE2756431C2 (h) | 
| ES (1) | ES476042A1 (h) | 
| FI (1) | FI64179C (h) | 
| NO (1) | NO149111C (h) | 
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| DE2934854A1 (de) * | 1979-08-29 | 1981-09-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von stickstoffhaltigen kondensationsprodukten und deren verwendung | 
| DE2949870A1 (de) * | 1979-12-12 | 1981-06-19 | Hoechst Ag, 6230 Frankfurt | Kondensationsprodukte zur erhoehung der nassfestigkeit von papier | 
| US4347339A (en) * | 1981-05-08 | 1982-08-31 | Nalco Chemical Company | Cationic block copolymers | 
| DE3135830A1 (de) * | 1981-09-10 | 1983-03-24 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von wasserloeslichen, stickstoffhaltigen kondensationsprodukten und deren verwendung bei der papierherstellung | 
| GB2141130B (en) * | 1983-06-09 | 1986-11-12 | Grace W R & Co | Polyamidoaminepolyamines | 
| US4689374A (en) * | 1983-06-09 | 1987-08-25 | W. R. Grace & Co. | Water soluble polyamidoaminepolyamine having weight average molecular weight of at least 5×105 | 
| DE3323732A1 (de) * | 1983-07-01 | 1985-01-17 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche, von esterbindungen weitgehend freie reaktionsprodukte aus epihalogenhydrin in wasserloeslichen basischen polyamidoaminen, verfahren zu ihrer herstellung und ihre verwendung | 
| US4851557A (en) * | 1985-06-20 | 1989-07-25 | Benckiser-Knapsack Gmbh | Copper-containing polymers, a process for their preparation and their use as fungicides | 
| DE3662051D1 (en) * | 1985-06-20 | 1989-03-16 | Benckiser Knapsack Gmbh | Copper-containing polymers, process for their preparation, and their application as fungicides | 
| US4870119A (en) * | 1986-11-24 | 1989-09-26 | Sandoz Ltd. | Water-soluble polyamides containing aromatic groups | 
| DE3704173A1 (de) * | 1987-02-11 | 1988-08-25 | Wolff Walsrode Ag | Neue mittel fuer die papierherstellung | 
| DE3721057C2 (de) * | 1987-06-26 | 1996-08-22 | Bayer Ag | Wasserlösliche, basische Polykondensate, Verfahren zu ihrer Herstellung, diese enthaltende Retentionsmittel und ihre Verwendung zur Herstellung von Papier | 
| US4995944A (en) * | 1988-09-16 | 1991-02-26 | Dearborn Chemical Company Ltd. | Controlling deposits on paper machine felts using cationic polymer and cationic surfactant mixture | 
| DE4200715A1 (de) * | 1992-01-14 | 1993-07-15 | Bayer Ag | Vinylpolymerisat-dispersionen | 
| BE1008134A3 (nl) * | 1994-03-16 | 1996-01-23 | Dsm Nv | Bereiding van stervormig vertakte polymeren. | 
| CA2186622A1 (en) * | 1994-03-31 | 1995-10-12 | Nancy S. Clungeon | Wet strength resin composition and methods of making the same | 
| DE19520092A1 (de) * | 1995-06-01 | 1996-12-05 | Bayer Ag | Verfahren zur Papierveredlung unter Verwendung von Polyisocyanaten mit anionischen Gruppen | 
| DE19537003A1 (de) * | 1995-10-04 | 1997-04-10 | Inventa Ag | Haftvermittler auf Polyamidbasis | 
| US5813693A (en) * | 1996-02-26 | 1998-09-29 | Trw Vechiclesafety Systems Inc. | Releasable attachment for air bag deployment door | 
| US6171445B1 (en) | 1999-07-30 | 2001-01-09 | Hercules Incorporated | Process for controlling deposit of sticky material | 
| DE19940955A1 (de) * | 1999-08-28 | 2001-03-01 | Basf Ag | Verfahren zur Herstellung von Papier, Pappe und Karton | 
| US6673205B2 (en) * | 2001-05-10 | 2004-01-06 | Fort James Corporation | Use of hydrophobically modified polyaminamides with polyethylene glycol esters in paper products | 
| US20050136205A1 (en) * | 2003-12-12 | 2005-06-23 | Georg Stoppelmann | Thermoplastic multilayer composite | 
| CA2553421C (en) * | 2004-02-26 | 2009-10-13 | Pulp And Paper Research Institute Of Canada | Epichlorohydrin based polymers containing primary amino groups as additives in papermaking | 
| CA2568665C (en) * | 2004-06-01 | 2009-10-06 | Pulp And Paper Research Institute Of Canada | Papermaking additive | 
| WO2008131071A1 (en) * | 2007-04-17 | 2008-10-30 | Kemira Chemicals Inc. | Acidified polyamidoamine adhesives, method of manufacture, and use for creping and ply bond applications | 
| KR101679885B1 (ko) * | 2008-11-18 | 2016-11-25 | 솔레니스 테크놀러지스 케이맨, 엘.피. | 소수성 개질된 폴리(아미노아미드) | 
| US20120247697A1 (en) | 2011-03-29 | 2012-10-04 | Kemira Oyj | Polyamine Polyamidoamine Epihaloohydrin Compositions and Processes for Preparing and Using the Same | 
| WO2013046060A1 (en) | 2011-09-30 | 2013-04-04 | Kemira Oyj | Paper and methods of making paper | 
| US9777434B2 (en) | 2011-12-22 | 2017-10-03 | Kemira Dyj | Compositions and methods of making paper products | 
| US10624986B2 (en) * | 2012-09-26 | 2020-04-21 | Kemira Oyj | Absorbent materials, products including absorbent materials, compositions, and methods of making absorbent materials | 
| PL236334B1 (pl) * | 2014-06-05 | 2020-12-28 | Arctic Paper Kostrzyn Spolka Akcyjna | Powłoka do druku strumieniowego nakładana jedno-lub dwustronnie na papier | 
| ES2976724T3 (es) * | 2020-07-23 | 2024-08-07 | Evonik Operations Gmbh | Dispersantes de poliamidoamina | 
| EP4551742A1 (en) * | 2022-07-07 | 2025-05-14 | Basf Se | Use of a composition comprising a polyaminoamide type compound for copper nanotwin electrodeposition | 
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| NL110447C (h) * | 1957-09-05 | |||
| BE635350A (h) * | 1962-07-24 | |||
| US3329657A (en) * | 1963-05-17 | 1967-07-04 | American Cyanamid Co | Water soluble cross linked cationic polyamide polyamines | 
| US3250664A (en) * | 1963-10-24 | 1966-05-10 | Scott Paper Co | Process of preparing wet strength paper containing ph independent nylon-type resins | 
| GB1147984A (en) | 1965-07-07 | 1969-04-10 | Carves Simon Ltd | Improvements in or relating to the production of alkylene polyamines | 
| DE1771043C3 (de) * | 1968-03-27 | 1979-05-23 | Bayer Ag, 5090 Leverkusen | Selbstvernetzende wasserlösliche Produkte und deren Verwendung als Naßfestmittel für Papier | 
| DE1927599C3 (de) * | 1968-06-06 | 1978-11-02 | National Starch And Chemical Corp., New York, N.Y. (V.St.A.) | Verfahren zur Herstellung von kationischen Harzen und deren Verwendung als Mittel zur Verbesserung der Trocken- und Naßfestigkeit und der Pigmentretentionseigenschaften von Papier | 
| DE1771814C2 (de) * | 1968-07-16 | 1974-05-09 | Bayer Ag, 5090 Leverkusen | Hilfsmittel-Verwendung für die Papierfabrikation | 
| DE1802435C3 (de) * | 1968-10-11 | 1979-01-18 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von vernetzten Harzen auf der Basis von basischen Polyamidoaminen und deren Verwendung als Entwässerungs-, Retentions- und Flockungsmittel bei der Papierherstellung | 
| BE791128A (fr) * | 1971-11-12 | 1973-05-09 | Bayer Ag | Polyamines contenant des groupes acides et leur procede de preparation | 
| DE2502874C2 (de) * | 1975-01-24 | 1976-08-05 | Wolff Walsrode Ag | Hilfsmittel zur Verbesserung der Retention,Entwaesserung und Aufbereitung,insbesondere bei der Papierherstellung | 
- 
        1977
        
- 1977-12-17 DE DE2756431A patent/DE2756431C2/de not_active Expired
 
 - 
        1978
        
- 1978-12-01 NO NO784040A patent/NO149111C/no unknown
 - 1978-12-04 DE DE7878101531T patent/DE2862186D1/de not_active Expired
 - 1978-12-04 EP EP78101531A patent/EP0002474B2/de not_active Expired
 - 1978-12-15 CA CA000318031A patent/CA1121547A/en not_active Expired
 - 1978-12-15 ES ES476042A patent/ES476042A1/es not_active Expired
 - 1978-12-15 JP JP15428878A patent/JPS5490399A/ja active Granted
 - 1978-12-15 BR BR7808244A patent/BR7808244A/pt unknown
 - 1978-12-15 US US05/969,822 patent/US4250299A/en not_active Expired - Lifetime
 - 1978-12-15 FI FI783858A patent/FI64179C/fi not_active IP Right Cessation
 
 - 
        1980
        
- 1980-07-14 US US06/167,879 patent/US4319019A/en not_active Expired - Lifetime
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| FI64179C (fi) | 1983-10-10 | 
| CA1121547A (en) | 1982-04-06 | 
| DE2756431A1 (de) | 1979-06-21 | 
| NO149111B (no) | 1983-11-07 | 
| DE2862186D1 (en) | 1983-03-24 | 
| FI64179B (fi) | 1983-06-30 | 
| DE2756431C2 (de) | 1985-05-15 | 
| ES476042A1 (es) | 1979-04-16 | 
| NO149111C (no) | 1984-02-15 | 
| EP0002474B2 (de) | 1987-08-19 | 
| US4319019A (en) | 1982-03-09 | 
| EP0002474A1 (de) | 1979-06-27 | 
| US4250299A (en) | 1981-02-10 | 
| BR7808244A (pt) | 1979-08-14 | 
| FI783858A7 (fi) | 1979-06-18 | 
| NO784040L (no) | 1979-07-17 | 
| EP0002474B1 (de) | 1983-02-16 | 
| JPS5490399A (en) | 1979-07-18 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| JPS6135211B2 (h) | ||
| FI61904B (fi) | Foerfarande foer framstaellning av kvaevehaltiga kondensationsprodukter | |
| EP3180474B1 (en) | Process to improve performance of wet-strength resins through base activation | |
| AU2004230842A1 (en) | Synthesis of high solids resins from amine terminated polyamides | |
| JPH01229027A (ja) | 窒素含有水溶性化合物 | |
| US5644021A (en) | Synthesis of high solids-content wet-strength resin | |
| CN104640906A (zh) | 来自新的交联剂的高效湿强度树脂 | |
| US4689374A (en) | Water soluble polyamidoaminepolyamine having weight average molecular weight of at least 5×105 | |
| US3932363A (en) | Polyamines containing acid groups | |
| US4250112A (en) | Polyalkylenepolyamines containing quaternary dialkylammonium groups | |
| GB2141130A (en) | Polyamidoaminepolyamines | |
| US4250298A (en) | Polyamines containing amide groups | |
| FI84079B (fi) | Foerfarande foer framstaellning av polyaminopolyamider innehaollande halogenhydrinfunktionalitet. | |
| US4673729A (en) | Paper auxiliary from condensation product of aliphatic polyol-ether-amine and compound polyfunctional toward amino groups | |
| US4384110A (en) | Polyamines containing urea groups prepared from lactam or aminocarboxylic acid | |
| US4166002A (en) | Polyamines containing acid groups that are useful in papermaking | |
| US4254255A (en) | Aqueous reaction of polyamine with alkylene dihalide in presence of emulsifier | |
| US3869343A (en) | Cationic thermosetting resin for improving wet strength of paper | |
| JPS6360160B2 (h) | ||
| NO133846B (h) |