JPS6125757B2 - - Google Patents
Info
- Publication number
- JPS6125757B2 JPS6125757B2 JP59083619A JP8361984A JPS6125757B2 JP S6125757 B2 JPS6125757 B2 JP S6125757B2 JP 59083619 A JP59083619 A JP 59083619A JP 8361984 A JP8361984 A JP 8361984A JP S6125757 B2 JPS6125757 B2 JP S6125757B2
- Authority
- JP
- Japan
- Prior art keywords
- acid
- enzyme
- composition
- alkali metal
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims abstract description 64
- 239000003599 detergent Substances 0.000 claims abstract description 36
- -1 boric acid or borax Chemical class 0.000 claims abstract description 26
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000007788 liquid Substances 0.000 claims abstract description 16
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 13
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims abstract description 10
- 230000002255 enzymatic effect Effects 0.000 claims abstract description 6
- 235000010265 sodium sulphite Nutrition 0.000 claims abstract description 6
- 229910021538 borax Inorganic materials 0.000 claims abstract description 5
- 235000010339 sodium tetraborate Nutrition 0.000 claims abstract description 5
- 239000004328 sodium tetraborate Substances 0.000 claims abstract description 5
- 150000001639 boron compounds Chemical class 0.000 claims abstract description 3
- 102000004190 Enzymes Human genes 0.000 claims description 35
- 108090000790 Enzymes Proteins 0.000 claims description 35
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 230000000087 stabilizing effect Effects 0.000 claims description 8
- 239000001384 succinic acid Substances 0.000 claims description 8
- 239000003381 stabilizer Substances 0.000 claims description 7
- 239000000463 material Substances 0.000 claims description 5
- 239000012736 aqueous medium Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 230000006641 stabilisation Effects 0.000 claims description 3
- 238000011105 stabilization Methods 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 235000011044 succinic acid Nutrition 0.000 claims 1
- 150000003839 salts Chemical class 0.000 abstract description 9
- 229920005862 polyol Polymers 0.000 abstract description 8
- 150000003077 polyols Chemical class 0.000 abstract description 8
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 abstract description 4
- 239000004327 boric acid Substances 0.000 abstract description 4
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 abstract description 2
- 229940088598 enzyme Drugs 0.000 description 31
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 150000003863 ammonium salts Chemical class 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 235000011187 glycerol Nutrition 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 3
- 241000194108 Bacillus licheniformis Species 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229940001482 sodium sulfite Drugs 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000000271 synthetic detergent Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 102000013142 Amylases Human genes 0.000 description 2
- 108010065511 Amylases Proteins 0.000 description 2
- 102000005575 Cellulases Human genes 0.000 description 2
- 108010084185 Cellulases Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 2
- 108090000787 Subtilisin Proteins 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 235000019418 amylase Nutrition 0.000 description 2
- 229940025131 amylases Drugs 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 229910052810 boron oxide Inorganic materials 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical compound OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- 108010020132 microbial serine proteinases Proteins 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical group C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical class CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- OIYFAQRHWMVENL-UHFFFAOYSA-N 2-(4-oxopyran-3-yl)acetic acid Chemical compound OC(=O)CC1=COC=CC1=O OIYFAQRHWMVENL-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- GDTSJMKGXGJFGQ-UHFFFAOYSA-N 3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound O1B([O-])OB2OB([O-])OB1O2 GDTSJMKGXGJFGQ-UHFFFAOYSA-N 0.000 description 1
- 239000004382 Amylase Substances 0.000 description 1
- 229910011255 B2O3 Inorganic materials 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- DSLZVSRJTYRBFB-LLEIAEIESA-N D-glucaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O DSLZVSRJTYRBFB-LLEIAEIESA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 108010056079 Subtilisins Proteins 0.000 description 1
- 102000005158 Subtilisins Human genes 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- AENYAMPVQFAKHY-UHFFFAOYSA-N boric acid;potassium Chemical compound [K].OB(O)O AENYAMPVQFAKHY-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000001461 cytolytic effect Effects 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- FGRVOLIFQGXPCT-UHFFFAOYSA-L dipotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[K+].[O-]S([O-])(=O)=S FGRVOLIFQGXPCT-UHFFFAOYSA-L 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229960002163 hydrogen peroxide Drugs 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002366 lipolytic effect Effects 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052752 metalloid Inorganic materials 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- DJEHXEMURTVAOE-UHFFFAOYSA-M potassium bisulfite Chemical compound [K+].OS([O-])=O DJEHXEMURTVAOE-UHFFFAOYSA-M 0.000 description 1
- 229940099427 potassium bisulfite Drugs 0.000 description 1
- 235000010259 potassium hydrogen sulphite Nutrition 0.000 description 1
- RWPGFSMJFRPDDP-UHFFFAOYSA-L potassium metabisulfite Chemical compound [K+].[K+].[O-]S(=O)S([O-])(=O)=O RWPGFSMJFRPDDP-UHFFFAOYSA-L 0.000 description 1
- 229940043349 potassium metabisulfite Drugs 0.000 description 1
- 235000010263 potassium metabisulphite Nutrition 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- JVUYWILPYBCNNG-UHFFFAOYSA-N potassium;oxido(oxo)borane Chemical compound [K+].[O-]B=O JVUYWILPYBCNNG-UHFFFAOYSA-N 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- ZDQYSKICYIVCPN-UHFFFAOYSA-L sodium succinate (anhydrous) Chemical compound [Na+].[Na+].[O-]C(=O)CCC([O-])=O ZDQYSKICYIVCPN-UHFFFAOYSA-L 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 229940001474 sodium thiosulfate Drugs 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Enzymes And Modification Thereof (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8311314 | 1983-04-26 | ||
| GB838311314A GB8311314D0 (en) | 1983-04-26 | 1983-04-26 | Aqueous enzyme-containing compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS59217799A JPS59217799A (ja) | 1984-12-07 |
| JPS6125757B2 true JPS6125757B2 (enExample) | 1986-06-17 |
Family
ID=10541698
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59083619A Granted JPS59217799A (ja) | 1983-04-26 | 1984-04-25 | 水性酵素液体洗剤組成物 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4532064A (enExample) |
| EP (1) | EP0126505B1 (enExample) |
| JP (1) | JPS59217799A (enExample) |
| AT (1) | ATE24740T1 (enExample) |
| AU (1) | AU555127B2 (enExample) |
| BR (1) | BR8401898A (enExample) |
| CA (1) | CA1231652A (enExample) |
| DE (1) | DE3461936D1 (enExample) |
| DK (1) | DK207484A (enExample) |
| GB (1) | GB8311314D0 (enExample) |
| GR (1) | GR80000B (enExample) |
| NO (1) | NO158427C (enExample) |
| NZ (1) | NZ207918A (enExample) |
| PT (1) | PT78474B (enExample) |
| ZA (1) | ZA843057B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0344036U (enExample) * | 1989-09-09 | 1991-04-24 |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| US4537706A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid to stabilize enzymes |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| GR851574B (enExample) * | 1984-06-28 | 1985-11-25 | Procter & Gamble | |
| JPS61266671A (ja) * | 1985-05-14 | 1986-11-26 | 三菱鉱業セメント株式会社 | 曇り防止用テイツシユ |
| ZA865095B (en) * | 1985-07-26 | 1988-02-24 | Colgate Palmolive Co | Fabric softening liquid detergent |
| SE468518B (sv) * | 1985-07-26 | 1993-02-01 | Colgate Palmolive Co | Stabiliserad textilmjukgoerande enzyminnehaallande foerstaerkt flytande detergentkomposition och dess anvaendning vid tvaett av textilier |
| NZ216791A (en) * | 1985-07-26 | 1988-07-28 | Colgate Palmolive Co | Stabilised, built, enzyme-containing liquid detergents |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| US4797225A (en) * | 1986-09-08 | 1989-01-10 | Colgate-Palmolive Company | Nonaqueous liquid nonionic laundry detergent composition containing an alkali metal dithionite or sulfite reduction bleaching agent and method of use |
| US4935158A (en) * | 1986-10-30 | 1990-06-19 | Aszman Harry W | Solid detergent cleaning composition, reusable cleaning pad containing same and method of manufacture |
| US4842758A (en) * | 1986-10-31 | 1989-06-27 | Colgate-Palmolive Company | Stabilized enzyme system for use in aqueous liquid built detergent compositions |
| US4759865A (en) * | 1986-11-06 | 1988-07-26 | Colgate-Palmolive Company | Pasty acid detergent composition |
| GB2200132B (en) * | 1986-12-15 | 1991-09-18 | Colgate Palmolive Co | Stabilised enzyme systems and compositions containing them |
| US4800037A (en) * | 1987-06-05 | 1989-01-24 | Lever Brothers Company | Process for making a heavy duty liquid detergent composition |
| US6287841B1 (en) | 1988-02-11 | 2001-09-11 | Genencor International, Inc. | High alkaline serine protease |
| CN1056187C (zh) | 1988-02-11 | 2000-09-06 | 金克克国际有限公司 | 新的蛋白水解酶及其在洗涤剂中的应用 |
| AU3667189A (en) * | 1988-06-23 | 1990-01-04 | Unilever Plc | Enzyme-containing liquid detergents |
| US5156761A (en) * | 1988-07-20 | 1992-10-20 | Dorrit Aaslyng | Method of stabilizing an enzymatic liquid detergent composition |
| US5275753A (en) * | 1989-01-10 | 1994-01-04 | The Procter & Gamble Company | Stabilized alkaline liquid detergent compositions containing enzyme and peroxygen bleach |
| GB8900496D0 (en) * | 1989-01-10 | 1989-03-08 | Procter & Gamble | Liquid detergent composition containing enzyme and enzyme stabilization system |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| US5089163A (en) * | 1989-01-30 | 1992-02-18 | Lever Brothers Company, Division Of Conopco, Inc. | Enzymatic liquid detergent composition |
| ES2095240T3 (es) * | 1989-11-30 | 1997-02-16 | Clorox Co | Detergente oxidante acuoso liquido estable. |
| US5221495A (en) * | 1990-04-13 | 1993-06-22 | Colgate-Palmolive Company | Enzyme stabilizing composition and stabilized enzyme containing built detergent compositions |
| US5364553A (en) * | 1990-04-13 | 1994-11-15 | Colgate-Palmolive Company | Stabilized built aqueous liquid softergent compositions |
| BR9205959A (pt) * | 1991-04-30 | 1994-07-26 | Procter & Gamble | Detergentes líquidos reforçados com complexo bórico-poliol para inibir enzima proteolítica |
| AU2014892A (en) * | 1991-04-30 | 1992-12-21 | Procter & Gamble Company, The | Liquid detergents with an aryl boronic acid |
| US5442100A (en) * | 1992-08-14 | 1995-08-15 | The Procter & Gamble Company | β-aminoalkyl and β-N-peptidylaminoalkyl boronic acids |
| DE69427911T2 (de) * | 1993-06-21 | 2002-04-04 | Roche Diagnostics Corp., Indianapolis | Stabilisator für diagnostische reagentien |
| US5672213A (en) * | 1995-08-18 | 1997-09-30 | Alcon Laboratories, Inc. | Liquid enzyme compositions containing aromatic acid derivatives |
| US6342381B1 (en) | 1998-02-27 | 2002-01-29 | Buckman Laboratories Internationals, Inc. | Enzyme stabilization with pre-superpolyamide or pre-fiber-forming polyamide oligomers |
| DE69920272T3 (de) * | 1998-12-16 | 2015-01-08 | Unilever N.V. | Durchsichtige oder lichtdurchlässige flüssige enzym- und antioxidantenthaltende zusammensetzungen in klaren flaschen |
| ATE278755T1 (de) * | 1999-09-02 | 2004-10-15 | Colgate Palmolive Co | Zusammensetzungen zur textilpflege enthaltend polymere polycarboxylate und harnstoff-derivate |
| US6537958B1 (en) | 1999-11-10 | 2003-03-25 | The Procter & Gamble Company | Bleaching compositions |
| CA2408083A1 (en) * | 2000-06-15 | 2001-12-20 | Unilever Plc | Concentrated liquid detergent composition |
| US6546583B1 (en) | 2000-07-11 | 2003-04-15 | Bamed Ag | Toothbrush |
| DZ3349A1 (fr) | 2000-07-28 | 2002-02-07 | Henkel Kgaa | Nouvelle enzyme amylolytique issue de bacillus sp. a 7-7 (dsm 12368) ainsi que produits de lavage et nettoyage contenant ledit enzyme amylolytique |
| DE10153792A1 (de) | 2001-10-31 | 2003-05-22 | Henkel Kgaa | Neue Alkalische Protease-Varianten und Wasch- und Reinigungsmittel enthaltend diese neuen Alkalischen Protease-Varianten |
| DE10162727A1 (de) | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus gibsonii (DSM 14391) und Wasch-und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10162728A1 (de) | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus gibsonii (DSM 14393) und Wasch-und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10163884A1 (de) | 2001-12-22 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus sp. (DSM 14392) und Wasch- und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| US7448556B2 (en) | 2002-08-16 | 2008-11-11 | Henkel Kgaa | Dispenser bottle for at least two active fluids |
| DE10257387A1 (de) | 2002-12-06 | 2004-06-24 | Henkel Kgaa | Mehrkomponenten-Flüssigwaschmittel |
| US7332315B2 (en) * | 2005-08-17 | 2008-02-19 | Colgate-Palmolive Company | Method to remove bisulfite by-products from enzyme compositions |
| JP4871672B2 (ja) * | 2006-08-03 | 2012-02-08 | 花王株式会社 | 粉末洗剤用増強剤 |
| CN104673532A (zh) * | 2008-01-04 | 2015-06-03 | 宝洁公司 | 包含糖基水解酶的衣物洗涤剂组合物 |
| EP2455760B1 (en) * | 2009-07-15 | 2016-04-13 | Panasonic Healthcare Holdings Co., Ltd. | Analysis reagent and analysis device having the analysis reagent carried therein |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3634266A (en) * | 1969-07-23 | 1972-01-11 | Procter & Gamble | Liquid detergent compositions containing amylolytic enzymes |
| CH540335A (de) * | 1970-09-28 | 1973-08-15 | Kronwitter & Co | Flüssiges biologisches Wasch-, Reinigungs- und Geschirrspülmittel |
| FI61715C (fi) * | 1976-11-01 | 1982-09-10 | Unilever Nv | Enzymer innehaollande stabiliserad flytande detergentkomposition |
| US4238345A (en) * | 1978-05-22 | 1980-12-09 | Economics Laboratory, Inc. | Stabilized liquid enzyme-containing detergent compositions |
| US4243546A (en) * | 1979-03-23 | 1981-01-06 | The Drackett Company | Stable aqueous compositions containing enzymes |
| US4243543A (en) * | 1979-05-11 | 1981-01-06 | Economics Laboratory, Inc. | Stabilized liquid enzyme-containing detergent compositions |
| US4261868A (en) * | 1979-08-08 | 1981-04-14 | Lever Brothers Company | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| EP0080748B1 (en) * | 1981-11-13 | 1985-07-10 | Unilever N.V. | Enzymatic liquid cleaning composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
-
1983
- 1983-04-26 GB GB838311314A patent/GB8311314D0/en active Pending
-
1984
- 1984-04-09 US US06/597,942 patent/US4532064A/en not_active Expired - Lifetime
- 1984-04-19 AU AU27080/84A patent/AU555127B2/en not_active Ceased
- 1984-04-19 NZ NZ207918A patent/NZ207918A/en unknown
- 1984-04-24 PT PT78474A patent/PT78474B/pt unknown
- 1984-04-24 BR BR8401898A patent/BR8401898A/pt not_active IP Right Cessation
- 1984-04-25 EP EP84200584A patent/EP0126505B1/en not_active Expired
- 1984-04-25 AT AT84200584T patent/ATE24740T1/de not_active IP Right Cessation
- 1984-04-25 JP JP59083619A patent/JPS59217799A/ja active Granted
- 1984-04-25 GR GR74501A patent/GR80000B/el unknown
- 1984-04-25 CA CA000452693A patent/CA1231652A/en not_active Expired
- 1984-04-25 DE DE8484200584T patent/DE3461936D1/de not_active Expired
- 1984-04-25 NO NO841629A patent/NO158427C/no not_active IP Right Cessation
- 1984-04-25 DK DK207484A patent/DK207484A/da not_active Application Discontinuation
- 1984-04-25 ZA ZA843057A patent/ZA843057B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0344036U (enExample) * | 1989-09-09 | 1991-04-24 |
Also Published As
| Publication number | Publication date |
|---|---|
| DK207484D0 (da) | 1984-04-25 |
| BR8401898A (pt) | 1984-12-04 |
| DK207484A (da) | 1984-10-27 |
| NZ207918A (en) | 1986-06-11 |
| NO158427C (no) | 1988-09-14 |
| NO841629L (no) | 1984-10-29 |
| EP0126505A1 (en) | 1984-11-28 |
| AU555127B2 (en) | 1986-09-11 |
| ATE24740T1 (de) | 1987-01-15 |
| PT78474B (en) | 1986-08-28 |
| US4532064A (en) | 1985-07-30 |
| PT78474A (en) | 1984-05-01 |
| CA1231652A (en) | 1988-01-19 |
| DE3461936D1 (en) | 1987-02-12 |
| GB8311314D0 (en) | 1983-06-02 |
| ZA843057B (en) | 1985-11-27 |
| NO158427B (no) | 1988-05-30 |
| GR80000B (enExample) | 1984-10-31 |
| AU2708084A (en) | 1984-11-01 |
| EP0126505B1 (en) | 1987-01-07 |
| JPS59217799A (ja) | 1984-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6125757B2 (enExample) | ||
| EP0080223B1 (en) | Enzymatic liquid detergent composition | |
| EP0139329B1 (en) | Dishwashing compositions | |
| EP0080748B1 (en) | Enzymatic liquid cleaning composition | |
| CA1092036A (en) | Enzymatic liquid detergent compositions | |
| USH1776H (en) | Enzyme-containing heavy duty liquid detergent | |
| US9695461B2 (en) | Method for adapting a hydrolytic enzyme to a component that stabilizes the hydrolytic enzyme | |
| JP2001507727A (ja) | 有機ジアミンを含有した皿洗い洗剤組成物 | |
| IE911245A1 (en) | Enzyme stabilizing composition and stabilized enzyme¹containing built detergent compositions | |
| US3985686A (en) | Detergent compositions containing enzymes | |
| RU2709994C2 (ru) | Моющее и чистящее средство, содержащее комбинацию амилазы и протеазы | |
| JPH0139720B2 (enExample) | ||
| JPH02504649A (ja) | 皿を洗いすすぐための酵素組成物 | |
| JPH02227500A (ja) | 酵素系液体洗剤組成物 | |
| CA1297440C (en) | Fabric softening liquid detergent | |
| US4842769A (en) | Stabilized fabric softening built detergent composition containing enzymes | |
| AU618036B2 (en) | Machine dishwashing compositions | |
| FI61716B (fi) | Enzymer innehaollande vattenhaltig flytande detergentkomposition som uppvisar aennu baettre lagerhaollbarhet | |
| EP0608258A1 (en) | Aqueous enzymatic detergent compositions | |
| EP3864119B1 (de) | Flüssige zusammensetzung mit dihydroxyterephthalsäurediamid-verbindung und hoher tensidmenge | |
| EP0181651A2 (en) | Enzymatic detergent composition |