JPS5927328B2 - 芳香族アルデヒドの製造方法 - Google Patents
芳香族アルデヒドの製造方法Info
- Publication number
- JPS5927328B2 JPS5927328B2 JP49082703A JP8270374A JPS5927328B2 JP S5927328 B2 JPS5927328 B2 JP S5927328B2 JP 49082703 A JP49082703 A JP 49082703A JP 8270374 A JP8270374 A JP 8270374A JP S5927328 B2 JPS5927328 B2 JP S5927328B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- carbon atoms
- acid
- aldehyde
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003934 aromatic aldehydes Chemical class 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 18
- 150000001408 amides Chemical class 0.000 claims description 15
- 229910052763 palladium Inorganic materials 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003172 aldehyde group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- -1 organic acid chlorides Chemical class 0.000 description 10
- 150000001299 aldehydes Chemical class 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 150000001805 chlorine compounds Chemical class 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- DVIHKVWYFXLBEM-UHFFFAOYSA-N 2-hydroxybenzoyl chloride Chemical compound OC1=CC=CC=C1C(Cl)=O DVIHKVWYFXLBEM-UHFFFAOYSA-N 0.000 description 2
- AUZQQIPZESHNMG-UHFFFAOYSA-N 3-methoxysalicylic acid Chemical compound COC1=CC=CC(C(O)=O)=C1O AUZQQIPZESHNMG-UHFFFAOYSA-N 0.000 description 2
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- 239000003607 modifier Substances 0.000 description 2
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- GGYVTHJIUNGKFZ-UHFFFAOYSA-N 1-methylpiperidin-2-one Chemical compound CN1CCCCC1=O GGYVTHJIUNGKFZ-UHFFFAOYSA-N 0.000 description 1
- LNWWQYYLZVZXKS-UHFFFAOYSA-N 1-pyrrolidin-1-ylethanone Chemical compound CC(=O)N1CCCC1 LNWWQYYLZVZXKS-UHFFFAOYSA-N 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- XRMKRSLIPPGLFO-UHFFFAOYSA-N 3-methyl-2-propan-2-ylbenzoic acid Chemical compound CC(C)C1=C(C)C=CC=C1C(O)=O XRMKRSLIPPGLFO-UHFFFAOYSA-N 0.000 description 1
- WHSXTWFYRGOBGO-UHFFFAOYSA-N 3-methylsalicylic acid Chemical compound CC1=CC=CC(C(O)=O)=C1O WHSXTWFYRGOBGO-UHFFFAOYSA-N 0.000 description 1
- HRMCXDSWURAYFR-UHFFFAOYSA-N 3-phenoxyphthalic acid Chemical compound OC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1C(O)=O HRMCXDSWURAYFR-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- LPYJNQIKRLHJND-UHFFFAOYSA-N 5-butyl-2-hydroxybenzoic acid Chemical compound CCCCC1=CC=C(O)C(C(O)=O)=C1 LPYJNQIKRLHJND-UHFFFAOYSA-N 0.000 description 1
- WYIAFSIUYJGIPU-UHFFFAOYSA-N 5-ethyl-2-hydroxybenzoic acid Chemical compound CCC1=CC=C(O)C(C(O)=O)=C1 WYIAFSIUYJGIPU-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- JQSXKJRPFRHGLA-UHFFFAOYSA-N 6-hydroxy-2,3-dimethylbenzoic acid Chemical compound CC1=CC=C(O)C(C(O)=O)=C1C JQSXKJRPFRHGLA-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 238000006280 Rosenmund reaction Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- GXMIHVHJTLPVKL-UHFFFAOYSA-N n,n,2-trimethylpropanamide Chemical compound CC(C)C(=O)N(C)C GXMIHVHJTLPVKL-UHFFFAOYSA-N 0.000 description 1
- MEXKFCWMWJZDMF-UHFFFAOYSA-N n,n-dibutylacetamide Chemical compound CCCCN(C(C)=O)CCCC MEXKFCWMWJZDMF-UHFFFAOYSA-N 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- MBHINSULENHCMF-UHFFFAOYSA-N n,n-dimethylpropanamide Chemical compound CCC(=O)N(C)C MBHINSULENHCMF-UHFFFAOYSA-N 0.000 description 1
- LMTGCJANOQOGPI-UHFFFAOYSA-N n-methyl-n-phenylacetamide Chemical compound CC(=O)N(C)C1=CC=CC=C1 LMTGCJANOQOGPI-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- YQUVCSBJEUQKSH-UHFFFAOYSA-N protochatechuic acid Natural products OC(=O)C1=CC=C(O)C(O)=C1 YQUVCSBJEUQKSH-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- WKOLLVMJNQIZCI-UHFFFAOYSA-N vanillic acid Chemical compound COC1=CC(C(O)=O)=CC=C1O WKOLLVMJNQIZCI-UHFFFAOYSA-N 0.000 description 1
- TUUBOHWZSQXCSW-UHFFFAOYSA-N vanillic acid Natural products COC1=CC(O)=CC(C(O)=O)=C1 TUUBOHWZSQXCSW-UHFFFAOYSA-N 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/41—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by hydrogenolysis or reduction of carboxylic groups or functional derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7326713 | 1973-07-20 | ||
| FR7326713A FR2237871B1 (enExample) | 1973-07-20 | 1973-07-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5041831A JPS5041831A (enExample) | 1975-04-16 |
| JPS5927328B2 true JPS5927328B2 (ja) | 1984-07-05 |
Family
ID=9122916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP49082703A Expired JPS5927328B2 (ja) | 1973-07-20 | 1974-07-18 | 芳香族アルデヒドの製造方法 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4111998A (enExample) |
| JP (1) | JPS5927328B2 (enExample) |
| BE (1) | BE817890A (enExample) |
| BR (1) | BR7405876D0 (enExample) |
| CH (1) | CH592036A5 (enExample) |
| DE (1) | DE2434534C2 (enExample) |
| FR (1) | FR2237871B1 (enExample) |
| GB (1) | GB1479684A (enExample) |
| IT (1) | IT1017309B (enExample) |
| LU (1) | LU70574A1 (enExample) |
| NL (1) | NL7409474A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6353931U (enExample) * | 1986-09-27 | 1988-04-11 | ||
| JPH0381452U (enExample) * | 1989-12-11 | 1991-08-20 | ||
| US10639268B2 (en) | 2014-07-28 | 2020-05-05 | Shiseido Company, Ltd. | Oily cosmetic |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH625969A5 (enExample) | 1977-07-15 | 1981-10-30 | Buehler Ag Geb | |
| US5124487A (en) * | 1991-08-05 | 1992-06-23 | Occidental Chemical Corporation | Catalytic reduction of nitriles to aldehydes |
| US20030125583A1 (en) * | 2000-09-25 | 2003-07-03 | Kathe Baumann | Process for preparing fluorine-containing benzaldehydes |
| EP3109226A1 (en) * | 2015-06-25 | 2016-12-28 | Basf Se | Process for preparing vanillin |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3517066A (en) * | 1968-03-22 | 1970-06-23 | Hoffmann La Roche | Rosenmund process |
-
1973
- 1973-07-20 FR FR7326713A patent/FR2237871B1/fr not_active Expired
-
1974
- 1974-07-12 NL NL7409474A patent/NL7409474A/xx not_active Application Discontinuation
- 1974-07-17 BR BR5876/74A patent/BR7405876D0/pt unknown
- 1974-07-18 DE DE2434534A patent/DE2434534C2/de not_active Expired
- 1974-07-18 US US05/489,715 patent/US4111998A/en not_active Expired - Lifetime
- 1974-07-18 JP JP49082703A patent/JPS5927328B2/ja not_active Expired
- 1974-07-19 GB GB32195/74A patent/GB1479684A/en not_active Expired
- 1974-07-19 IT IT25383/74A patent/IT1017309B/it active
- 1974-07-19 LU LU70574A patent/LU70574A1/xx unknown
- 1974-07-19 BE BE146771A patent/BE817890A/xx not_active IP Right Cessation
- 1974-07-19 CH CH1002374A patent/CH592036A5/xx not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6353931U (enExample) * | 1986-09-27 | 1988-04-11 | ||
| JPH0381452U (enExample) * | 1989-12-11 | 1991-08-20 | ||
| US10639268B2 (en) | 2014-07-28 | 2020-05-05 | Shiseido Company, Ltd. | Oily cosmetic |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2237871A1 (enExample) | 1975-02-14 |
| LU70574A1 (enExample) | 1975-05-21 |
| NL7409474A (nl) | 1975-01-22 |
| DE2434534A1 (de) | 1975-02-06 |
| GB1479684A (en) | 1977-07-13 |
| BE817890A (fr) | 1975-01-20 |
| CH592036A5 (enExample) | 1977-10-14 |
| DE2434534C2 (de) | 1983-04-28 |
| IT1017309B (it) | 1977-07-20 |
| US4111998A (en) | 1978-09-05 |
| JPS5041831A (enExample) | 1975-04-16 |
| FR2237871B1 (enExample) | 1976-12-03 |
| BR7405876D0 (pt) | 1975-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR850000383A (ko) | 디메틸아민의 제조방법 | |
| McKeon et al. | The palladium (II) catalyzed vinyl interchange reaction—I | |
| KR960008109B1 (ko) | 3-펜텐니트릴의 이성화에 의한 4-펜텐니트릴의 제조방법 | |
| JPS638929B2 (enExample) | ||
| EP0031244A1 (en) | Process for producing methanol from synthesis gas with palladium-calcium catalysts | |
| JPS5927328B2 (ja) | 芳香族アルデヒドの製造方法 | |
| Tang et al. | Polymer-supported Pd (II) Wacker-type catalysts. Part III. Isomerisation of alkene double bond | |
| KR950003329B1 (ko) | 알데히드 및/또는 케톤의 수소화 방법 | |
| Young et al. | Investigations on the Stereoisomerism of Unsaturated Compounds. VIII. The Catalytic Hydrogenation of Butadiene1 | |
| BRPI0508693B1 (pt) | Processo para produção de álcoois purificados | |
| Elderfield et al. | The Reaction of o-Phenylenediamines with Ketones. V. Further Studies with Dibenzyl Ketones1, 2 | |
| US4052459A (en) | Process for the manufacture of alkylacetophenones | |
| US4250116A (en) | Production of methyl and ethylamines with rhodium-iron catalysts | |
| JPS593454B2 (ja) | トリメチルヒドロキノンの製造法 | |
| US4410755A (en) | Method to purify alpha-methyl styrene prior to catalytic hydrogenation | |
| JPS5848528B2 (ja) | シボウゾクジアルデヒドノ セイゾウホウホウ | |
| Hers et al. | The Preparation of 1-C14-Labeled Glucose, Mannose and Fructose1 | |
| US5616733A (en) | Preparation method for 2-coumaranone | |
| US3971830A (en) | Process for the semihydrogenation of citral to citronellal | |
| Wang et al. | Study on the mechanism of ethanol synthesis from syngas by in-situ chemical trapping and isotopic exchange reactions | |
| SU1344403A1 (ru) | Катализатор дл получени аминонитрилов | |
| US4507518A (en) | Dehydration of 2,5-dimethyl-2,5-hexanediol | |
| SU938516A1 (ru) | Способ получени водорода | |
| RU2026278C1 (ru) | Способ получения пентациклотетрадекана | |
| US3037061A (en) | Process for the production of nitroalkenes and nitroalcohols |