JPS5827788B2 - 置換ピリジンの製法 - Google Patents
置換ピリジンの製法Info
- Publication number
- JPS5827788B2 JPS5827788B2 JP52105730A JP10573077A JPS5827788B2 JP S5827788 B2 JPS5827788 B2 JP S5827788B2 JP 52105730 A JP52105730 A JP 52105730A JP 10573077 A JP10573077 A JP 10573077A JP S5827788 B2 JPS5827788 B2 JP S5827788B2
- Authority
- JP
- Japan
- Prior art keywords
- ketone
- manufacturing
- catalyst
- ammonia
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 title claims description 28
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 150000003222 pyridines Chemical class 0.000 title claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 42
- 239000003054 catalyst Substances 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 229910021529 ammonia Inorganic materials 0.000 claims description 21
- 150000002576 ketones Chemical class 0.000 claims description 18
- -1 aliphatic oxo compound Chemical class 0.000 claims description 14
- 239000007789 gas Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 230000000737 periodic effect Effects 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- 239000011261 inert gas Substances 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 230000018044 dehydration Effects 0.000 claims description 3
- 238000006297 dehydration reaction Methods 0.000 claims description 3
- 238000006356 dehydrogenation reaction Methods 0.000 claims description 3
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000468 ketone group Chemical group 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 30
- YFKBXYGUSOXJGS-UHFFFAOYSA-N 1,3-Diphenyl-2-propanone Chemical compound C=1C=CC=CC=1CC(=O)CC1=CC=CC=C1 YFKBXYGUSOXJGS-UHFFFAOYSA-N 0.000 description 17
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- OTKCEEWUXHVZQI-UHFFFAOYSA-N 1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CC=C1 OTKCEEWUXHVZQI-UHFFFAOYSA-N 0.000 description 10
- 238000009835 boiling Methods 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000011777 magnesium Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- VAXDNHLGUWFZSI-UHFFFAOYSA-N 2-benzyl-3-phenylpyridine Chemical compound N=1C=CC=C(C=2C=CC=CC=2)C=1CC1=CC=CC=C1 VAXDNHLGUWFZSI-UHFFFAOYSA-N 0.000 description 8
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 7
- 229910052749 magnesium Inorganic materials 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 6
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 5
- WKAXDAMWMOBXMP-UHFFFAOYSA-N 2,3-diphenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CN=C1C1=CC=CC=C1 WKAXDAMWMOBXMP-UHFFFAOYSA-N 0.000 description 4
- WTYYKZLGTHPLPZ-UHFFFAOYSA-N 2-phenyl-1-pyridin-2-ylethanone Chemical compound C=1C=CC=NC=1C(=O)CC1=CC=CC=C1 WTYYKZLGTHPLPZ-UHFFFAOYSA-N 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 3
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XROWMBWRMNHXMF-UHFFFAOYSA-J titanium tetrafluoride Chemical compound [F-].[F-].[F-].[F-].[Ti+4] XROWMBWRMNHXMF-UHFFFAOYSA-J 0.000 description 3
- JLIDVCMBCGBIEY-UHFFFAOYSA-N 1-penten-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- MFUVDXOKPBAHMC-UHFFFAOYSA-N magnesium;dinitrate;hexahydrate Chemical compound O.O.O.O.O.O.[Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MFUVDXOKPBAHMC-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- LABTWGUMFABVFG-ONEGZZNKSA-N (3E)-pent-3-en-2-one Chemical compound C\C=C\C(C)=O LABTWGUMFABVFG-ONEGZZNKSA-N 0.000 description 1
- YFAXBCVQHGDMFU-UHFFFAOYSA-N 2-benzyl-4-methyl-3-phenylpyridine Chemical compound C=1C=CC=CC=1C=1C(C)=CC=NC=1CC1=CC=CC=C1 YFAXBCVQHGDMFU-UHFFFAOYSA-N 0.000 description 1
- CEPIHTOEZYEPGI-UHFFFAOYSA-N 2-benzyl-6-methyl-3-phenylpyridine Chemical compound C=1C=CC=CC=1CC1=NC(C)=CC=C1C1=CC=CC=C1 CEPIHTOEZYEPGI-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical group NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- SLFQXPJDEWMICP-UHFFFAOYSA-N 4-methyl-2,3-diphenylpyridine Chemical compound C=1C=CC=CC=1C=1C(C)=CC=NC=1C1=CC=CC=C1 SLFQXPJDEWMICP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- LDDQLRUQCUTJBB-UHFFFAOYSA-N ammonium fluoride Chemical compound [NH4+].[F-] LDDQLRUQCUTJBB-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- LDDQLRUQCUTJBB-UHFFFAOYSA-O azanium;hydrofluoride Chemical compound [NH4+].F LDDQLRUQCUTJBB-UHFFFAOYSA-O 0.000 description 1
- XTKDAFGWCDAMPY-UHFFFAOYSA-N azaperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCN(C=2N=CC=CC=2)CC1 XTKDAFGWCDAMPY-UHFFFAOYSA-N 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000012438 extruded product Nutrition 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/08—Preparation by ring-closure
- C07D213/09—Preparation by ring-closure involving the use of ammonia, amines, amine salts, or nitriles
- C07D213/12—Preparation by ring-closure involving the use of ammonia, amines, amine salts, or nitriles from unsaturated compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/920,246 US4155592A (en) | 1977-08-07 | 1978-06-29 | Seat back with adjustable lumbar supporter |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772712694 DE2712694A1 (de) | 1977-03-23 | 1977-03-23 | Verfahren zur herstellung substituierter pyridine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS53119877A JPS53119877A (en) | 1978-10-19 |
| JPS5827788B2 true JPS5827788B2 (ja) | 1983-06-11 |
Family
ID=6004406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP52105730A Expired JPS5827788B2 (ja) | 1977-03-23 | 1977-09-02 | 置換ピリジンの製法 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4169951A (ja�@�@) |
| JP (1) | JPS5827788B2 (ja�@�@) |
| BE (1) | BE858389A (ja�@�@) |
| BR (1) | BR7705881A (ja�@�@) |
| CA (1) | CA1115705A (ja�@�@) |
| CH (1) | CH631706A5 (ja�@�@) |
| DE (1) | DE2712694A1 (ja�@�@) |
| FR (1) | FR2384758A1 (ja�@�@) |
| GB (1) | GB1550724A (ja�@�@) |
| IL (1) | IL52883A (ja�@�@) |
| IT (1) | IT1143596B (ja�@�@) |
| NL (1) | NL184001C (ja�@�@) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4871859A (en) * | 1988-03-02 | 1989-10-03 | Hoechst Celanese Corporation | Process for preparing pyridine carboxylic acid esters |
| EP1492784A4 (en) * | 2002-03-28 | 2006-03-29 | Merck & Co Inc | SUBSTITUTED 2,3-DIPHENYLPYRIDINES |
| AU2007292436A1 (en) * | 2006-09-07 | 2008-03-13 | Allergan, Inc. | Heteroaromatic compounds having sphingosine-1-phosphate (S1P) receptor agonist biological activity |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA655703A (en) * | 1963-01-08 | R. Hargrave Kenneth | Production of pyridine bases | |
| US2877228A (en) * | 1952-10-20 | 1959-03-10 | Phillips Petroleum Co | Production of substituted pyridines |
| US2780626A (en) * | 1953-08-13 | 1957-02-05 | Research Corp | 2, 6-alkylpyridines |
| US2926074A (en) * | 1954-04-30 | 1960-02-23 | Phillips Petroleum Co | Apparatus for production of substituted pyridines |
| GB917765A (en) * | 1960-11-10 | 1963-02-06 | Distillers Co Yeast Ltd | Production of pyridine bases |
| GB920526A (en) * | 1960-11-17 | 1963-03-06 | Distillers Co Yeast Ltd | Production of pyridine bases |
| GB924527A (en) * | 1961-02-17 | 1963-04-24 | Distillers Co Yeast Ltd | Production of pyridine bases |
| US3932421A (en) * | 1967-07-13 | 1976-01-13 | Koei Chemical Company, Ltd. | Process for producing alkylpyridines |
| US3946020A (en) * | 1970-12-28 | 1976-03-23 | Koei Chemical Co., Ltd. | Process for producing pyridine bases |
| BE790121A (fr) * | 1971-10-15 | 1973-02-01 | Degussa | Catalyseurs pour la preparation de pyridine et de 3-methylpyridine |
| DE2224160C3 (de) * | 1972-05-18 | 1979-10-04 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Katalysatoren für die Herstellung von Pyridin und 3-Methylpyridin |
| DE2239801C3 (de) * | 1972-08-12 | 1979-08-23 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Katalysatoren |
| SU567724A1 (ru) * | 1974-07-19 | 1977-08-05 | Предприятие П/Я В-8585 | Способ получени алкилпиридинов |
| DE2449340C2 (de) * | 1974-10-17 | 1987-04-09 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Pyridin und 3-Methylpyridin |
| GB1495233A (en) * | 1976-01-30 | 1977-12-14 | Ici Ltd | Manufacture of pyridine and methylpyridines |
-
1977
- 1977-03-23 DE DE19772712694 patent/DE2712694A1/de active Granted
- 1977-09-01 IT IT50863/77A patent/IT1143596B/it active
- 1977-09-02 IL IL52883A patent/IL52883A/xx unknown
- 1977-09-02 BR BR7705881A patent/BR7705881A/pt unknown
- 1977-09-02 BE BE6046131A patent/BE858389A/xx not_active IP Right Cessation
- 1977-09-02 CH CH1074977A patent/CH631706A5/de not_active IP Right Cessation
- 1977-09-02 JP JP52105730A patent/JPS5827788B2/ja not_active Expired
- 1977-09-02 GB GB36772/77A patent/GB1550724A/en not_active Expired
- 1977-09-02 NL NLAANVRAGE7709709,A patent/NL184001C/xx not_active IP Right Cessation
- 1977-09-05 FR FR7726896A patent/FR2384758A1/fr active Granted
- 1977-09-06 US US05/830,982 patent/US4169951A/en not_active Expired - Lifetime
- 1977-10-17 CA CA288,852A patent/CA1115705A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1143596B (it) | 1986-10-22 |
| FR2384758B1 (ja�@�@) | 1982-07-16 |
| NL184001C (nl) | 1989-03-16 |
| IL52883A (en) | 1980-06-30 |
| JPS53119877A (en) | 1978-10-19 |
| CH631706A5 (de) | 1982-08-31 |
| DE2712694A1 (de) | 1978-09-28 |
| BE858389A (fr) | 1978-03-02 |
| DE2712694C2 (ja�@�@) | 1988-07-21 |
| US4169951A (en) | 1979-10-02 |
| GB1550724A (en) | 1979-08-22 |
| FR2384758A1 (fr) | 1978-10-20 |
| BR7705881A (pt) | 1978-09-26 |
| IL52883A0 (en) | 1977-11-30 |
| CA1115705A (en) | 1982-01-05 |
| NL7709709A (nl) | 1978-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Uno et al. | A new method of synthesis of arylmalononitriles catalysed by a palladium complex | |
| CA1132572A (en) | Process for producing 2-chloro-5- trichloromethyl pyridine | |
| EP0078410A2 (en) | Process for producing 3-chloro-5-trifluoromethylpyridines | |
| JPS5850215B2 (ja) | 置換ピリジンの製法 | |
| JPS632939B2 (ja�@�@) | ||
| JPS5827788B2 (ja) | 置換ピリジンの製法 | |
| US5028713A (en) | Ammoxidation of methyl substituted heteroaromatics to make heteroaromatic nitriles | |
| JPS6135181B2 (ja�@�@) | ||
| JPS5827789B2 (ja) | 置換ピリジンの製造法 | |
| US2744904A (en) | Process of preparing pyridine and 3-picoline | |
| JPS639495B2 (ja�@�@) | ||
| JPS58131933A (ja) | アントラキノンの製法 | |
| JPS6021981B2 (ja) | シアノピリジン類の製造法 | |
| JPS6313988B2 (ja�@�@) | ||
| US6118003A (en) | Processes for producing 3-cyanopyridine from 2-methyl-1,5-pentanediamine | |
| JPS5910662B2 (ja) | 置換ピリジンの製法 | |
| US3020281A (en) | Method of preparing quinoline | |
| JPH0219108B2 (ja�@�@) | ||
| JP4723090B2 (ja) | ヘテロ芳香族アルデヒド類の製造方法 | |
| US2680742A (en) | Production of | |
| JPS6130666B2 (ja�@�@) | ||
| US3766239A (en) | Ammoxidation of chloromethyl compounds | |
| US3020280A (en) | Quinoline synthesis | |
| JPS6130667B2 (ja�@�@) | ||
| US2502125A (en) | Debromination of polybromopyridine |