JPS5726688A - Furo 3,2-b 1,8-naphthyridine-7-carboxylic acid derivative - Google Patents
Furo 3,2-b 1,8-naphthyridine-7-carboxylic acid derivativeInfo
- Publication number
- JPS5726688A JPS5726688A JP10180580A JP10180580A JPS5726688A JP S5726688 A JPS5726688 A JP S5726688A JP 10180580 A JP10180580 A JP 10180580A JP 10180580 A JP10180580 A JP 10180580A JP S5726688 A JPS5726688 A JP S5726688A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- derivative
- carboxylic acid
- acid
- give
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- SNLMOXFUCILIPL-UHFFFAOYSA-N 1,8-naphthyridine-2-carboxylic acid Chemical class C1=CC=NC2=NC(C(=O)O)=CC=C21 SNLMOXFUCILIPL-UHFFFAOYSA-N 0.000 title 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 abstract 2
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- -1 hydrobromic acid Chemical class 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 150000005058 1,8-naphthyridines Chemical class 0.000 abstract 1
- XDIRZTLVKQQKJH-UHFFFAOYSA-N 2,3,5,8-tetrahydrofuro[3,2-b][1,8]naphthyridine-7-carboxylic acid Chemical class C1=C2CC(C(=O)O)=CNC2=NC2=C1OCC2 XDIRZTLVKQQKJH-UHFFFAOYSA-N 0.000 abstract 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 1
- 239000002841 Lewis acid Substances 0.000 abstract 1
- 208000026723 Urinary tract disease Diseases 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000003242 anti bacterial agent Substances 0.000 abstract 1
- 238000010531 catalytic reduction reaction Methods 0.000 abstract 1
- 150000007517 lewis acids Chemical class 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 150000007522 mineralic acids Chemical class 0.000 abstract 1
- 150000003335 secondary amines Chemical class 0.000 abstract 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10180580A JPS5726688A (en) | 1980-07-24 | 1980-07-24 | Furo 3,2-b 1,8-naphthyridine-7-carboxylic acid derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10180580A JPS5726688A (en) | 1980-07-24 | 1980-07-24 | Furo 3,2-b 1,8-naphthyridine-7-carboxylic acid derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5726688A true JPS5726688A (en) | 1982-02-12 |
| JPS6247187B2 JPS6247187B2 (enExample) | 1987-10-06 |
Family
ID=14310345
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP10180580A Granted JPS5726688A (en) | 1980-07-24 | 1980-07-24 | Furo 3,2-b 1,8-naphthyridine-7-carboxylic acid derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5726688A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5446109A (en) * | 1993-02-23 | 1995-08-29 | Teijin Limited | Polyamide/aliphatic polyester block copolymer, process for the production thereof, and blend containing the same |
| US5854376A (en) * | 1995-03-09 | 1998-12-29 | Sekisui Kaseihin Kogyo Kabushiki Kaisha | Aliphatic ester-amide copolymer resins |
| WO2008046135A1 (en) * | 2006-10-16 | 2008-04-24 | Bionomics Limited | Novel anxiolytic compounds |
| US9023848B2 (en) | 2011-03-02 | 2015-05-05 | Bionomics Limited | Small-molecules as therapeutics |
| US9133188B2 (en) | 2011-05-12 | 2015-09-15 | Bionomics Limited | Methods for preparing naphthyridines |
| US10954231B2 (en) | 2006-10-16 | 2021-03-23 | Bionomics Limited | Anxiolytic compounds |
-
1980
- 1980-07-24 JP JP10180580A patent/JPS5726688A/ja active Granted
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5446109A (en) * | 1993-02-23 | 1995-08-29 | Teijin Limited | Polyamide/aliphatic polyester block copolymer, process for the production thereof, and blend containing the same |
| US5854376A (en) * | 1995-03-09 | 1998-12-29 | Sekisui Kaseihin Kogyo Kabushiki Kaisha | Aliphatic ester-amide copolymer resins |
| US8906912B2 (en) | 2006-10-16 | 2014-12-09 | Bionomics Limited | Anxiolytic compounds |
| US8293737B2 (en) | 2006-10-16 | 2012-10-23 | Bionomics Limited | Anxiolytic compounds |
| US8551990B2 (en) | 2006-10-16 | 2013-10-08 | Bionomics Limited | Anxiolytic compounds |
| US8614212B2 (en) | 2006-10-16 | 2013-12-24 | Bionomics Limited | Anxiolytic compounds |
| WO2008046135A1 (en) * | 2006-10-16 | 2008-04-24 | Bionomics Limited | Novel anxiolytic compounds |
| US9573945B2 (en) | 2006-10-16 | 2017-02-21 | Bionomics Limited | Anxiolytic compounds |
| JP2017105818A (ja) * | 2006-10-16 | 2017-06-15 | バイオノミクス リミテッド | 新規な抗不安薬化合物 |
| US9975892B2 (en) | 2006-10-16 | 2018-05-22 | Bionomics Limited | Anxiolytic compounds |
| US10233181B2 (en) | 2006-10-16 | 2019-03-19 | Bionomics Limited | Anxiolytic compounds |
| US10954231B2 (en) | 2006-10-16 | 2021-03-23 | Bionomics Limited | Anxiolytic compounds |
| US9023848B2 (en) | 2011-03-02 | 2015-05-05 | Bionomics Limited | Small-molecules as therapeutics |
| US9133188B2 (en) | 2011-05-12 | 2015-09-15 | Bionomics Limited | Methods for preparing naphthyridines |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6247187B2 (enExample) | 1987-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5726688A (en) | Furo 3,2-b 1,8-naphthyridine-7-carboxylic acid derivative | |
| JPS57176988A (en) | Penam-3-carboxylic acid derivative and its preparation | |
| DE3571026D1 (en) | Process for the obtention of water-free or substantially water-free formic acid by hydraulysis of methyl formiate | |
| JPS5791997A (en) | 5'-o-acylnucleoside and its preparation | |
| JPS5572177A (en) | 4,1-benzoxazepine or 4,1-benzothiazepine | |
| JPS5781486A (en) | Benzo(ij)quinolidine-2-carboxylic acid derivative | |
| JPS57183738A (en) | Aromatic carboxylic acid derivative | |
| HUT69760A (en) | Process for the preparation of in alfa-position by alkyl group substituted aldehyde | |
| JPS5643288A (en) | Cephalosporin derivative and its preparation | |
| JPS5583749A (en) | Quinolone derivative | |
| IE800355L (en) | Producing cepham compounds. | |
| JPS57209296A (en) | Tylosin derivative | |
| JPS57145898A (en) | Novel n6, n6-dimethyladenosine derivative | |
| JPS56142282A (en) | Penem-3-carboxylic acid derivative and its preparation | |
| JPS5772981A (en) | 1,8-naphthyridine derivative and its salt | |
| JPS56142283A (en) | Penem-3-carboxylic acid derivative and its preparation | |
| JPS5665840A (en) | Stabilizing method of ketone | |
| JPS57118560A (en) | Preparation of 1-sulfo-2-oxoazetidine and its intermediate | |
| JPS56150082A (en) | Dibenzo b,e oxepin derivative | |
| JPS57197280A (en) | Preparation of 2-thioxopenam derivative | |
| JPS56125386A (en) | Pyrido (2,3-d)pyrimidine derivative and its preparation | |
| JPS5721400A (en) | Novel fortimicin derivative | |
| JPS55149271A (en) | Preparation of styrene oxide | |
| JPS57163386A (en) | Cephalosporin derivative and its production | |
| JPS5785398A (en) | Novel aminoglycoside and its preparation |