JPS5661354A - Nicotinic acid derivative - Google Patents
Nicotinic acid derivativeInfo
- Publication number
- JPS5661354A JPS5661354A JP13674079A JP13674079A JPS5661354A JP S5661354 A JPS5661354 A JP S5661354A JP 13674079 A JP13674079 A JP 13674079A JP 13674079 A JP13674079 A JP 13674079A JP S5661354 A JPS5661354 A JP S5661354A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- acid derivative
- lower alkyl
- compound
- nicotinic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical class OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 title abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- -1 2,3-Di-t-butylthio-1,6-dihydronicotinic acid methyl ester Chemical compound 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- HXIPLHBIHBQWGY-UHFFFAOYSA-N 2,3-dihydropyridine-3-carboxylic acid Chemical class OC(=O)C1CN=CC=C1 HXIPLHBIHBQWGY-UHFFFAOYSA-N 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 150000001450 anions Chemical class 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 239000003814 drug Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000000575 pesticide Substances 0.000 abstract 1
- 239000002994 raw material Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13674079A JPS5661354A (en) | 1979-10-23 | 1979-10-23 | Nicotinic acid derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13674079A JPS5661354A (en) | 1979-10-23 | 1979-10-23 | Nicotinic acid derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5661354A true JPS5661354A (en) | 1981-05-26 |
| JPS6326750B2 JPS6326750B2 (enExample) | 1988-05-31 |
Family
ID=15182389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13674079A Granted JPS5661354A (en) | 1979-10-23 | 1979-10-23 | Nicotinic acid derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5661354A (enExample) |
-
1979
- 1979-10-23 JP JP13674079A patent/JPS5661354A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6326750B2 (enExample) | 1988-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5395977A (en) | 1,4-dihydropyrimidine compounds and process for their preparation | |
| JPS55130991A (en) | Pyrazole phosphate esters, their preparation and insecticide and acaricide | |
| JPS5661354A (en) | Nicotinic acid derivative | |
| JPS5528955A (en) | Novel glycerophosphoric acid derivative, its salt, their preparation, and carcinostatic agent containing the same. | |
| JPS559060A (en) | Thia(oxa)zolidinecarboxylic acid derivative and its prepatation | |
| JPS5589254A (en) | Substituted isovaleric acid derivative | |
| JPS5716855A (en) | 4-guanidinomethylcyclohexanecarboxylic acid ester and its preparation | |
| JPS5579395A (en) | Novel germanium compound | |
| JPS5452075A (en) | Isoxazolium salt and its preparation | |
| JPS5677268A (en) | Oxazoleacetic acid derivative | |
| JPS5540656A (en) | Substituted quinoline-carboxylic acid derivative | |
| JPS5759896A (en) | Production of thiazolineazetidinone derivative | |
| JPS54112856A (en) | Preparation of thiophene derivative | |
| JPS5643270A (en) | Production of 4-benzoyl-5-hydroxypyrazole | |
| JPS54128578A (en) | Pyridine sulfenic acid amide and ester, their preparation, and carcinostatic action improver | |
| JPS5711975A (en) | Aminophenyltetrazole derivative and salt thereof | |
| JPS5649367A (en) | Preparation of novel pyrazole derivative | |
| JPS5610168A (en) | Pyridine carboxylic acid amide derivative and its production | |
| JPS54115356A (en) | 1-substituted-5,6,-dithiocalicene derivative and its preparation | |
| JPS5461128A (en) | Peptide derivative | |
| JPS5540651A (en) | 3-(4-(4'-halogenobenzyloxy)phenoxy propyl-)phosphorylethanolamine | |
| JPS55139378A (en) | 6-diarylmethyleneindolitidine derivative | |
| JPS5441858A (en) | 6-alkenyl-bicyclo3,1,0hexane-3-ene-2-one derivative and its preparation | |
| JPS5585560A (en) | Azetidinone derivative | |
| JPS5551065A (en) | Aminopyrrole derivative |