JPS5536434A - 4-phenyl-4-oxo-2-butenoic acid derivative and its preparation - Google Patents
4-phenyl-4-oxo-2-butenoic acid derivative and its preparationInfo
- Publication number
- JPS5536434A JPS5536434A JP11006578A JP11006578A JPS5536434A JP S5536434 A JPS5536434 A JP S5536434A JP 11006578 A JP11006578 A JP 11006578A JP 11006578 A JP11006578 A JP 11006578A JP S5536434 A JPS5536434 A JP S5536434A
- Authority
- JP
- Japan
- Prior art keywords
- halogen
- oxo
- phenyl
- lower alkyl
- butenoic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- PLPDHGOODMBBGN-VOTSOKGWSA-N (e)-4-oxo-4-phenylbut-2-enoic acid Chemical class OC(=O)\C=C\C(=O)C1=CC=CC=C1 PLPDHGOODMBBGN-VOTSOKGWSA-N 0.000 title abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 5
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 150000001875 compounds Chemical class 0.000 abstract 4
- 150000002367 halogens Chemical class 0.000 abstract 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 abstract 2
- 125000005843 halogen group Chemical group 0.000 abstract 2
- IJUIPRDMWWBTTQ-UHFFFAOYSA-N 3-phenyl-1h-pyridazin-6-one Chemical class N1C(=O)C=CC(C=2C=CC=CC=2)=N1 IJUIPRDMWWBTTQ-UHFFFAOYSA-N 0.000 abstract 1
- JDXFDXTZXXJCQT-UHFFFAOYSA-N 4-(3-bromophenyl)-4-oxobut-2-enoic acid Chemical compound OC(=O)C=CC(=O)C1=CC=CC(Br)=C1 JDXFDXTZXXJCQT-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 230000002140 halogenating effect Effects 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 238000001228 spectrum Methods 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11006578A JPS5536434A (en) | 1978-09-07 | 1978-09-07 | 4-phenyl-4-oxo-2-butenoic acid derivative and its preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11006578A JPS5536434A (en) | 1978-09-07 | 1978-09-07 | 4-phenyl-4-oxo-2-butenoic acid derivative and its preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5536434A true JPS5536434A (en) | 1980-03-14 |
| JPS6116265B2 JPS6116265B2 (enExample) | 1986-04-28 |
Family
ID=14526166
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP11006578A Granted JPS5536434A (en) | 1978-09-07 | 1978-09-07 | 4-phenyl-4-oxo-2-butenoic acid derivative and its preparation |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5536434A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4454155A (en) * | 1981-10-22 | 1984-06-12 | Roussel Uclaf | Pharmaceutical compositions containing a mono-substituted derivative of 4-phenyl-4-oxobuten-2-oic acid, and methods of using them in treating gastric and gastroduodenal ailments |
| US4473583A (en) * | 1981-10-22 | 1984-09-25 | Roussel Uclaf | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them |
| US4483868A (en) * | 1980-04-24 | 1984-11-20 | Roussel Uclaf | Gastro-protecting activity |
| US4486429A (en) * | 1981-10-22 | 1984-12-04 | Roussel Uclaf | Amino derivatives of 4-phenyl 4-oxobuten-2-oic acid, pharmaceutical compositions containing them, and methods for preparing and therapeutically using them |
| US4814348A (en) * | 1983-01-24 | 1989-03-21 | Roussel Uclaf | Therapeutic compositions containing derivatives of acrylic acid having an oxygen-containing heterocycle, therapeutic treatment therewith and new compounds |
| US5886210A (en) * | 1996-08-22 | 1999-03-23 | Rohm And Haas Company | Method for preparing aromatic compounds |
| WO2003097568A1 (en) * | 2002-05-15 | 2003-11-27 | Sankio Chemical Co., Ltd. | Process for producing 4-phenyl-4-oxo-2-butenoic ester derivative |
-
1978
- 1978-09-07 JP JP11006578A patent/JPS5536434A/ja active Granted
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4483868A (en) * | 1980-04-24 | 1984-11-20 | Roussel Uclaf | Gastro-protecting activity |
| US4454155A (en) * | 1981-10-22 | 1984-06-12 | Roussel Uclaf | Pharmaceutical compositions containing a mono-substituted derivative of 4-phenyl-4-oxobuten-2-oic acid, and methods of using them in treating gastric and gastroduodenal ailments |
| US4473583A (en) * | 1981-10-22 | 1984-09-25 | Roussel Uclaf | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them |
| US4486429A (en) * | 1981-10-22 | 1984-12-04 | Roussel Uclaf | Amino derivatives of 4-phenyl 4-oxobuten-2-oic acid, pharmaceutical compositions containing them, and methods for preparing and therapeutically using them |
| US4814348A (en) * | 1983-01-24 | 1989-03-21 | Roussel Uclaf | Therapeutic compositions containing derivatives of acrylic acid having an oxygen-containing heterocycle, therapeutic treatment therewith and new compounds |
| US5886210A (en) * | 1996-08-22 | 1999-03-23 | Rohm And Haas Company | Method for preparing aromatic compounds |
| WO2003097568A1 (en) * | 2002-05-15 | 2003-11-27 | Sankio Chemical Co., Ltd. | Process for producing 4-phenyl-4-oxo-2-butenoic ester derivative |
| US7161022B2 (en) | 2002-05-15 | 2007-01-09 | Fujifilm Finechemicals Co., Ltd. | Process for producing 4-phenyl-4-oxo-2-butenoic ester derivative |
| KR101005969B1 (ko) | 2002-05-15 | 2011-01-05 | 메이지 세이까 가부시끼가이샤 | 4-페닐-4-옥소-2-부텐산 에스테르 유도체의 제조방법 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6116265B2 (enExample) | 1986-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS54148788A (en) | 1,2-disubstituted-4-halogenoimidazole-5-acetic acid derivative and its preparation | |
| JPS5536434A (en) | 4-phenyl-4-oxo-2-butenoic acid derivative and its preparation | |
| DE3060919D1 (en) | Isoxazolecarboxylic acid anilides, their preparation, fungicidal compositions and process for combating fungi | |
| JPS57181069A (en) | Delta2-1,2,4-triazolin-5-one and its preparation and use | |
| JPS56113744A (en) | Benzoate derivative, its preparation, and use of said derivative | |
| JPS5515460A (en) | Novel 2-substituted-benzoylpropionic acid derivative | |
| JPS5665838A (en) | Preparation of beta-alkoxymethoxymethyl halide | |
| JPS565139A (en) | Chlorination catalyst for alkylbenzene nucleus | |
| JPS5524124A (en) | 5-fluorouracil derivative and its preparation | |
| JPS5661365A (en) | Dimethoxyphthalazinone derivative and its preparation | |
| JPS5511503A (en) | Condensed heterocyclic compound | |
| JPS57206644A (en) | Preparation of 4-(4- (anilino)phenoxy)-2-pentenoic acid derivative | |
| JPS54128567A (en) | 1-substituted-4-acyl-2-pyrrolecarboxylic acid derivative | |
| JPS5287129A (en) | 4-trifluoromethyl phenoxy phenoxyankane carboxylic acid | |
| JPS5545638A (en) | Exo-5-halomethyl-endo-2,3-trimethylene norbornane | |
| JPS5414961A (en) | Novel 3-hydroxyazetidine-3-carboxylic derivative | |
| JPS5618971A (en) | Alpha-halogeno-beta-benzosulfimidopropionitrile and its preparation | |
| JPS57193444A (en) | Sulfonate derivative, its preparation and antilipemic agent containing the same | |
| JPS54128599A (en) | Pyrrolobenzazepin derivative | |
| JPS57197234A (en) | Preparation of perfluoroalkyl compound | |
| JPS5436257A (en) | Substituted benzoic acid amide | |
| JPS5643271A (en) | Production of 4-benzoyl-5-hydroxypyrazole | |
| JPS554322A (en) | 2-phenyl-substituted-1-phthalazone derivative | |
| JPS56169673A (en) | 4-benzoylpyrazole derivative | |
| JPS57116027A (en) | Fluoroalkyl alpha,beta-dichloropropionate |