JPH0419973B2 - - Google Patents
Info
- Publication number
- JPH0419973B2 JPH0419973B2 JP58093311A JP9331183A JPH0419973B2 JP H0419973 B2 JPH0419973 B2 JP H0419973B2 JP 58093311 A JP58093311 A JP 58093311A JP 9331183 A JP9331183 A JP 9331183A JP H0419973 B2 JPH0419973 B2 JP H0419973B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- diphenyl
- compound according
- hydroxyphenyl
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims description 144
- 239000000203 mixture Substances 0.000 claims description 89
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 38
- 150000003839 salts Chemical class 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 15
- 206010028980 Neoplasm Diseases 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 7
- WERYXYBDKMZEQL-UHFFFAOYSA-N 1,4-butanediol Substances OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 5
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 231100000252 nontoxic Toxicity 0.000 claims description 5
- 230000003000 nontoxic effect Effects 0.000 claims description 5
- PSQMPCHNHXVJKQ-UHFFFAOYSA-N 4-(2,3-diphenyloxolan-2-yl)phenol Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC=CC=2)C(C=2C=CC=CC=2)CCO1 PSQMPCHNHXVJKQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- VDEALWYBHYSLSS-UHFFFAOYSA-N 1,2-bis(4-hydroxyphenyl)-1-phenylbutane-1,4-diol Chemical compound C=1C=CC=CC=1C(O)(C=1C=CC(O)=CC=1)C(CCO)C1=CC=C(O)C=C1 VDEALWYBHYSLSS-UHFFFAOYSA-N 0.000 claims description 3
- FNDFQVSARMSYGF-UHFFFAOYSA-N 1-(4-hydroxyphenyl)-1,2-diphenylbutane-1,4-diol Chemical compound C=1C=CC=CC=1C(O)(C=1C=CC(O)=CC=1)C(CCO)C1=CC=CC=C1 FNDFQVSARMSYGF-UHFFFAOYSA-N 0.000 claims description 3
- NXFNODKYDRLSQI-UHFFFAOYSA-N 4-(2,3-diphenyloxan-2-yl)phenol Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC=CC=2)C(C=2C=CC=CC=2)CCCO1 NXFNODKYDRLSQI-UHFFFAOYSA-N 0.000 claims description 3
- JRAPAWFDOQVLLC-UHFFFAOYSA-N 4-(4-hydroxy-1,2-diphenylbut-1-enyl)phenol Chemical compound C=1C=CC=CC=1C(CCO)=C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 JRAPAWFDOQVLLC-UHFFFAOYSA-N 0.000 claims description 3
- FXFXZVNVLVWXKZ-UHFFFAOYSA-N 4-(4-methoxyphenyl)-3,4-diphenylbut-3-en-1-ol Chemical compound C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)=C(CCO)C1=CC=CC=C1 FXFXZVNVLVWXKZ-UHFFFAOYSA-N 0.000 claims description 3
- FLFXAXUWSALLDV-UHFFFAOYSA-N 4-(5-hydroxy-1,2-diphenylpent-1-enyl)phenol Chemical compound C=1C=CC=CC=1C(CCCO)=C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 FLFXAXUWSALLDV-UHFFFAOYSA-N 0.000 claims description 3
- KJYBEHXAXJZIIF-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)-2-phenyloxolan-3-yl]phenol Chemical compound C1=CC(O)=CC=C1C1C(C=2C=CC(O)=CC=2)(C=2C=CC=CC=2)OCC1 KJYBEHXAXJZIIF-UHFFFAOYSA-N 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 3
- 230000001419 dependent effect Effects 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 claims description 3
- NGCCIJKMKNEEJB-UHFFFAOYSA-N 2-[4-(4-bromo-1,2-diphenylbut-1-enyl)phenoxy]-n,n-dimethylethanamine Chemical compound C1=CC(OCCN(C)C)=CC=C1C(C=1C=CC=CC=1)=C(CCBr)C1=CC=CC=C1 NGCCIJKMKNEEJB-UHFFFAOYSA-N 0.000 claims description 2
- XIWBHBPMBIXYBK-UHFFFAOYSA-N 4-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-3-en-1-ol Chemical class C1=CC(OCCN(C)C)=CC=C1C(C=1C=CC=CC=1)=C(CCO)C1=CC=CC=C1 XIWBHBPMBIXYBK-UHFFFAOYSA-N 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 229940088597 hormone Drugs 0.000 claims description 2
- 239000005556 hormone Substances 0.000 claims description 2
- 239000002246 antineoplastic agent Substances 0.000 claims 3
- UZOFIRLHVOJCOI-UHFFFAOYSA-N 2-(4-but-1-enylphenoxy)-N,N-dimethylethanamine Chemical compound CN(C)CCOC1=CC=C(C=C1)C=CCC UZOFIRLHVOJCOI-UHFFFAOYSA-N 0.000 claims 1
- AWNHCKLJXWHSSM-UHFFFAOYSA-N 4-but-1-enylphenol Chemical compound CCC=CC1=CC=C(O)C=C1 AWNHCKLJXWHSSM-UHFFFAOYSA-N 0.000 claims 1
- CYYZDBDROVLTJU-UHFFFAOYSA-N 4-n-Butylphenol Chemical compound CCCCC1=CC=C(O)C=C1 CYYZDBDROVLTJU-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 117
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 75
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 75
- 238000004458 analytical method Methods 0.000 description 72
- 238000002844 melting Methods 0.000 description 66
- 230000008018 melting Effects 0.000 description 66
- 239000000047 product Substances 0.000 description 63
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 53
- -1 1-phenyl-1,2-bis(4-hydroxyphenyl)butan-1-ol Chemical compound 0.000 description 52
- 239000000243 solution Substances 0.000 description 51
- 238000004519 manufacturing process Methods 0.000 description 50
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 239000002904 solvent Substances 0.000 description 45
- 238000001704 evaporation Methods 0.000 description 44
- 238000000034 method Methods 0.000 description 41
- 230000008020 evaporation Effects 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- 230000000875 corresponding effect Effects 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 25
- OTKCEEWUXHVZQI-UHFFFAOYSA-N 1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CC=C1 OTKCEEWUXHVZQI-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 19
- 229910052938 sodium sulfate Inorganic materials 0.000 description 19
- 235000011152 sodium sulphate Nutrition 0.000 description 19
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- 230000000694 effects Effects 0.000 description 17
- 125000006239 protecting group Chemical group 0.000 description 16
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 15
- 241000700159 Rattus Species 0.000 description 13
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 13
- 150000001241 acetals Chemical class 0.000 description 13
- 239000003208 petroleum Substances 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 11
- 230000001833 anti-estrogenic effect Effects 0.000 description 11
- 230000000259 anti-tumor effect Effects 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- 230000001076 estrogenic effect Effects 0.000 description 10
- 150000002989 phenols Chemical class 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 8
- 229940011871 estrogen Drugs 0.000 description 8
- 239000000262 estrogen Substances 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 229960003387 progesterone Drugs 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- 206010067572 Oestrogenic effect Diseases 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 201000008274 breast adenocarcinoma Diseases 0.000 description 7
- 229960005309 estradiol Drugs 0.000 description 7
- 229930182833 estradiol Natural products 0.000 description 7
- 239000012452 mother liquor Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000000186 progesterone Substances 0.000 description 7
- WKJJQUMMGNNHFY-UHFFFAOYSA-N 2,2,3-triphenyloxolane Chemical compound C=1C=CC=CC=1C1(C=2C=CC=CC=2)OCCC1C1=CC=CC=C1 WKJJQUMMGNNHFY-UHFFFAOYSA-N 0.000 description 6
- ARSRBNBHOADGJU-UHFFFAOYSA-N 7,12-dimethyltetraphene Chemical compound C1=CC2=CC=CC=C2C2=C1C(C)=C(C=CC=C1)C1=C2C ARSRBNBHOADGJU-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- VFZRZRDOXPRTSC-UHFFFAOYSA-N DMBA Natural products COC1=CC(OC)=CC(C=O)=C1 VFZRZRDOXPRTSC-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 230000029936 alkylation Effects 0.000 description 6
- 238000005804 alkylation reaction Methods 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 241000699666 Mus <mouse, genus> Species 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 238000006297 dehydration reaction Methods 0.000 description 5
- 239000000328 estrogen antagonist Substances 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 238000002955 isolation Methods 0.000 description 5
- 229960004616 medroxyprogesterone Drugs 0.000 description 5
- FRQMUZJSZHZSGN-HBNHAYAOSA-N medroxyprogesterone Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](O)(C(C)=O)CC[C@H]21 FRQMUZJSZHZSGN-HBNHAYAOSA-N 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 206010006187 Breast cancer Diseases 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- ADSXDBCZNVXTRD-UHFFFAOYSA-N [Mg]C1=CC=CC=C1 Chemical class [Mg]C1=CC=CC=C1 ADSXDBCZNVXTRD-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 102000015694 estrogen receptors Human genes 0.000 description 4
- 108010038795 estrogen receptors Proteins 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 description 4
- 229960002985 medroxyprogesterone acetate Drugs 0.000 description 4
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 4
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 208000037965 uterine sarcoma Diseases 0.000 description 4
- 210000004291 uterus Anatomy 0.000 description 4
- XNKCGQLMBAAZNI-UHFFFAOYSA-N 1,2-diphenylpentan-1-one Chemical compound C=1C=CC=CC=1C(CCC)C(=O)C1=CC=CC=C1 XNKCGQLMBAAZNI-UHFFFAOYSA-N 0.000 description 3
- CILUUGLLYLAHMG-UHFFFAOYSA-N 1-[4-[2-(dimethylamino)ethoxy]phenyl]-1,2-diphenylbutane-1,4-diol Chemical compound C1=CC(OCCN(C)C)=CC=C1C(O)(C=1C=CC=CC=1)C(CCO)C1=CC=CC=C1 CILUUGLLYLAHMG-UHFFFAOYSA-N 0.000 description 3
- JKTORXLUQLQJCM-UHFFFAOYSA-N 4-phosphonobutylphosphonic acid Chemical compound OP(O)(=O)CCCCP(O)(O)=O JKTORXLUQLQJCM-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- 206010061535 Ovarian neoplasm Diseases 0.000 description 3
- 206010060862 Prostate cancer Diseases 0.000 description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 229940125782 compound 2 Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000002642 lithium compounds Chemical class 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 230000003472 neutralizing effect Effects 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 3
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 2
- LHYPZUUJSDZPLA-UHFFFAOYSA-N 1,1,2-triphenylbutane-1,4-diol Chemical compound C=1C=CC=CC=1C(O)(C=1C=CC=CC=1)C(CCO)C1=CC=CC=C1 LHYPZUUJSDZPLA-UHFFFAOYSA-N 0.000 description 2
- DMEMGWVPQDYWGU-UHFFFAOYSA-N 1,2-diphenyl-1-(4-phenylmethoxyphenyl)butane-1,4-diol Chemical compound C=1C=CC=CC=1C(O)(C=1C=CC(OCC=2C=CC=CC=2)=CC=1)C(CCO)C1=CC=CC=C1 DMEMGWVPQDYWGU-UHFFFAOYSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 2
- PLALKSRAHVYFOH-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(=O)CC1=CC=CC=C1 PLALKSRAHVYFOH-UHFFFAOYSA-N 0.000 description 2
- FVFJAVRTRYUKHX-UHFFFAOYSA-N 1-but-1-enyl-4-phenylmethoxybenzene Chemical compound C1=CC(C=CCC)=CC=C1OCC1=CC=CC=C1 FVFJAVRTRYUKHX-UHFFFAOYSA-N 0.000 description 2
- NMPVEAUIHMEAQP-UHFFFAOYSA-N 2-Bromoacetaldehyde Chemical compound BrCC=O NMPVEAUIHMEAQP-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- XKVFMXBWOGJTSO-UHFFFAOYSA-N 3,4,4-triphenylbut-3-enyl acetate Chemical compound C=1C=CC=CC=1C(CCOC(=O)C)=C(C=1C=CC=CC=1)C1=CC=CC=C1 XKVFMXBWOGJTSO-UHFFFAOYSA-N 0.000 description 2
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 2
- HZPJJMOFPSHKFE-UHFFFAOYSA-N 4-(4-chloro-1,2-diphenylbut-1-enyl)phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC=CC=1)=C(CCCl)C1=CC=CC=C1 HZPJJMOFPSHKFE-UHFFFAOYSA-N 0.000 description 2
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 2
- QQOPSVMETZSWAY-UHFFFAOYSA-N 5-hydroxy-1,2-diphenylpentan-1-one Chemical compound C=1C=CC=CC=1C(CCCO)C(=O)C1=CC=CC=C1 QQOPSVMETZSWAY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- 238000003747 Grignard reaction Methods 0.000 description 2
- 206010033128 Ovarian cancer Diseases 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- 125000003277 amino group Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940046836 anti-estrogen Drugs 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- 229940117916 cinnamic aldehyde Drugs 0.000 description 2
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 150000003944 halohydrins Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000003431 steroids Chemical class 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003527 tetrahydropyrans Chemical group 0.000 description 2
- 230000004614 tumor growth Effects 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- ZNGCOAMLQHZNRG-ZIADKAODSA-N (z)-3,4-diphenyl-4-(4-phenylmethoxyphenyl)but-3-en-1-ol Chemical compound C=1C=CC=CC=1C(/CCO)=C(C=1C=CC(OCC=2C=CC=CC=2)=CC=1)/C1=CC=CC=C1 ZNGCOAMLQHZNRG-ZIADKAODSA-N 0.000 description 1
- FXFXZVNVLVWXKZ-FCQUAONHSA-N (z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-en-1-ol Chemical compound C1=CC(OC)=CC=C1C(\C=1C=CC=CC=1)=C(\CCO)C1=CC=CC=C1 FXFXZVNVLVWXKZ-FCQUAONHSA-N 0.000 description 1
- XIWBHBPMBIXYBK-QPLCGJKRSA-N (z)-4-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-3-en-1-ol Chemical compound C1=CC(OCCN(C)C)=CC=C1C(\C=1C=CC=CC=1)=C(\CCO)C1=CC=CC=C1 XIWBHBPMBIXYBK-QPLCGJKRSA-N 0.000 description 1
- QIDUHGHFWAMMPV-UHFFFAOYSA-N 1,1-diphenylethylbenzene Chemical group C=1C=CC=CC=1C(C=1C=CC=CC=1)(C)C1=CC=CC=C1 QIDUHGHFWAMMPV-UHFFFAOYSA-N 0.000 description 1
- LNGQXSMOGRIZPH-UHFFFAOYSA-N 1,1-diphenylpent-4-enylbenzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(CCC=C)C1=CC=CC=C1 LNGQXSMOGRIZPH-UHFFFAOYSA-N 0.000 description 1
- ZIJPGCNSGZRWKK-UHFFFAOYSA-N 1,2-bis[4-(oxan-2-yloxy)phenyl]ethanone Chemical compound C=1C=C(OC2OCCCC2)C=CC=1C(=O)CC(C=C1)=CC=C1OC1CCCCO1 ZIJPGCNSGZRWKK-UHFFFAOYSA-N 0.000 description 1
- FZKYPDHQCTZVJP-UHFFFAOYSA-N 1,2-diphenyl-4-phenylmethoxybutan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C=1C=CC=CC=1)CCOCC1=CC=CC=C1 FZKYPDHQCTZVJP-UHFFFAOYSA-N 0.000 description 1
- 125000006091 1,3-dioxolane group Chemical group 0.000 description 1
- IJSQTGSLZCKWJK-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidin-2-one;hydrochloride Chemical compound Cl.ClCCN1CCCC1=O IJSQTGSLZCKWJK-UHFFFAOYSA-N 0.000 description 1
- WURYGXOOEHRPPV-UHFFFAOYSA-N 1-(4-bromo-1,2-diphenylbut-1-enyl)-4-methoxybenzene Chemical compound C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)=C(CCBr)C1=CC=CC=C1 WURYGXOOEHRPPV-UHFFFAOYSA-N 0.000 description 1
- BKLMXWAPCVIPKU-UHFFFAOYSA-N 1-(4-hydroxyphenyl)-1,2-diphenylpentane-1,5-diol Chemical compound C=1C=CC=CC=1C(O)(C=1C=CC(O)=CC=1)C(CCCO)C1=CC=CC=C1 BKLMXWAPCVIPKU-UHFFFAOYSA-N 0.000 description 1
- OWZPYCCOKXFTGF-UHFFFAOYSA-N 1-(4-methoxyphenyl)-1,2-diphenylbutane-1,4-diol Chemical compound C1=CC(OC)=CC=C1C(O)(C=1C=CC=CC=1)C(CCO)C1=CC=CC=C1 OWZPYCCOKXFTGF-UHFFFAOYSA-N 0.000 description 1
- GRWFFAVCTXIPJC-UHFFFAOYSA-N 1-(4-methoxyphenyl)-4-(oxan-2-yloxy)-1,2-diphenylbutan-1-ol Chemical compound C1=CC(OC)=CC=C1C(O)(C=1C=CC=CC=1)C(C=1C=CC=CC=1)CCOC1OCCCC1 GRWFFAVCTXIPJC-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical class CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- ZQUZYEDVYSOWAA-ZIADKAODSA-N 1-[(z)-4-chloro-1,2-diphenylbut-1-enyl]-4-phenylmethoxybenzene Chemical compound C=1C=CC=CC=1C(/CCCl)=C(C=1C=CC(OCC=2C=CC=CC=2)=CC=1)/C1=CC=CC=C1 ZQUZYEDVYSOWAA-ZIADKAODSA-N 0.000 description 1
- VGTRKUYMXFQZSB-UHFFFAOYSA-N 1-[2-[4-(4-bromo-1,2-diphenylbut-1-enyl)phenoxy]ethyl]pyrrolidine Chemical compound C=1C=CC=CC=1C(CCBr)=C(C=1C=CC(OCCN2CCCC2)=CC=1)C1=CC=CC=C1 VGTRKUYMXFQZSB-UHFFFAOYSA-N 0.000 description 1
- BBONCMSOTMZSKX-UHFFFAOYSA-N 1-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]aziridine Chemical compound C=1C=CC=CC=1C(CCCl)=C(C=1C=CC(OCCN2CC2)=CC=1)C1=CC=CC=C1 BBONCMSOTMZSKX-UHFFFAOYSA-N 0.000 description 1
- WCTPTYPYCYGTNN-UHFFFAOYSA-N 1-[2-[4-(4-chloro-1,2-diphenylbutyl)phenoxy]ethyl]piperidine Chemical compound C=1C=CC=CC=1C(CCCl)C(C=1C=CC(OCCN2CCCCC2)=CC=1)C1=CC=CC=C1 WCTPTYPYCYGTNN-UHFFFAOYSA-N 0.000 description 1
- YYCMJEVLOQWYHJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)-2,3-diphenyloxolane Chemical compound C1=CC(OC)=CC=C1C1(C=2C=CC=CC=2)C(C=2C=CC=CC=2)CCO1 YYCMJEVLOQWYHJ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- BXCJNAKRMHHNOT-UHFFFAOYSA-N 2-[4-(2,3-diphenyloxolan-2-yl)phenoxy]-n,n-diethylethanamine Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C1(C=2C=CC=CC=2)C(C=2C=CC=CC=2)CCO1 BXCJNAKRMHHNOT-UHFFFAOYSA-N 0.000 description 1
- FEXCPMJYLYUGGR-UHFFFAOYSA-N 2-[4-(2,3-diphenyloxolan-2-yl)phenoxy]-n,n-dimethylethanamine Chemical compound C1=CC(OCCN(C)C)=CC=C1C1(C=2C=CC=CC=2)C(C=2C=CC=CC=2)CCO1 FEXCPMJYLYUGGR-UHFFFAOYSA-N 0.000 description 1
- XFCLJVABOIYOMF-UHFFFAOYSA-N 2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]-N,N-dimethylethanamine Chemical compound C1=CC(OCCN(C)C)=CC=C1C(C=1C=CC=CC=1)=C(CCCl)C1=CC=CC=C1 XFCLJVABOIYOMF-UHFFFAOYSA-N 0.000 description 1
- TXWWGMSCPHUOAJ-UHFFFAOYSA-N 2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]-n,n-diethylethanamine Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C(CCCl)C1=CC=CC=C1 TXWWGMSCPHUOAJ-UHFFFAOYSA-N 0.000 description 1
- JRRNFVYBQZUFBD-UHFFFAOYSA-N 3,4,4-triphenylbut-3-en-1-ol Chemical compound C=1C=CC=CC=1C(CCO)=C(C=1C=CC=CC=1)C1=CC=CC=C1 JRRNFVYBQZUFBD-UHFFFAOYSA-N 0.000 description 1
- ZZIXSULNXMZPIO-UHFFFAOYSA-N 3,4,4-triphenylbut-3-enyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC(C=1C=CC=CC=1)=C(C=1C=CC=CC=1)C1=CC=CC=C1 ZZIXSULNXMZPIO-UHFFFAOYSA-N 0.000 description 1
- ZNGCOAMLQHZNRG-UHFFFAOYSA-N 3,4-diphenyl-4-(4-phenylmethoxyphenyl)but-3-en-1-ol Chemical compound C=1C=CC=CC=1C(CCO)=C(C=1C=CC(OCC=2C=CC=CC=2)=CC=1)C1=CC=CC=C1 ZNGCOAMLQHZNRG-UHFFFAOYSA-N 0.000 description 1
- ZSPTYLOMNJNZNG-UHFFFAOYSA-N 3-Buten-1-ol Chemical compound OCCC=C ZSPTYLOMNJNZNG-UHFFFAOYSA-N 0.000 description 1
- XHGNQURGUIITDC-UHFFFAOYSA-N 4,4-diethoxy-1,2-diphenylbutan-1-one Chemical compound C=1C=CC=CC=1C(CC(OCC)OCC)C(=O)C1=CC=CC=C1 XHGNQURGUIITDC-UHFFFAOYSA-N 0.000 description 1
- JBKWVPNJBOPBGD-UHFFFAOYSA-N 4,5,5-triphenylpent-4-en-1-ol Chemical compound C=1C=CC=CC=1C(CCCO)=C(C=1C=CC=CC=1)C1=CC=CC=C1 JBKWVPNJBOPBGD-UHFFFAOYSA-N 0.000 description 1
- ZBERHTFUROFVEM-UHFFFAOYSA-N 4,5,5-triphenylpent-4-enyl acetate Chemical compound C=1C=CC=CC=1C(CCCOC(=O)C)=C(C=1C=CC=CC=1)C1=CC=CC=C1 ZBERHTFUROFVEM-UHFFFAOYSA-N 0.000 description 1
- LJOBGVGUZNXOMF-UHFFFAOYSA-N 4-(4-chloro-1,2-diphenylbutyl)phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC=CC=1)C(CCCl)C1=CC=CC=C1 LJOBGVGUZNXOMF-UHFFFAOYSA-N 0.000 description 1
- JBTLRKILCVYDSI-UHFFFAOYSA-N 4-(4-hydroxy-1,2-diphenylbutyl)phenol Chemical compound C=1C=CC=CC=1C(CCO)C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 JBTLRKILCVYDSI-UHFFFAOYSA-N 0.000 description 1
- LYIZDDWMXAZTDO-UHFFFAOYSA-N 4-(5-chloro-1,2-diphenylpent-1-enyl)phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC=CC=1)=C(CCCCl)C1=CC=CC=C1 LYIZDDWMXAZTDO-UHFFFAOYSA-N 0.000 description 1
- IUABKZOBHQPBEN-UHFFFAOYSA-N 4-(5-chloro-1-hydroxy-1,2-diphenylpentyl)phenol Chemical compound C1=CC(O)=CC=C1C(O)(C=1C=CC=CC=1)C(CCCCl)C1=CC=CC=C1 IUABKZOBHQPBEN-UHFFFAOYSA-N 0.000 description 1
- FXQHVEZHLRGMOX-UHFFFAOYSA-N 4-(oxan-2-yloxy)-1,2-diphenylbutan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C=1C=CC=CC=1)CCOC1CCCCO1 FXQHVEZHLRGMOX-UHFFFAOYSA-N 0.000 description 1
- JRAPAWFDOQVLLC-QURGRASLSA-N 4-[(e)-4-hydroxy-1,2-diphenylbut-1-enyl]phenol Chemical compound C=1C=CC=CC=1C(/CCO)=C(C=1C=CC(O)=CC=1)\C1=CC=CC=C1 JRAPAWFDOQVLLC-QURGRASLSA-N 0.000 description 1
- HNNONRFQWBRXHY-UHFFFAOYSA-N 4-[4-bromo-1-(4-hydroxyphenyl)-1-phenylbut-1-en-2-yl]phenol Chemical compound C1=CC(O)=CC=C1C(CCBr)=C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 HNNONRFQWBRXHY-UHFFFAOYSA-N 0.000 description 1
- KLULEXWOUIDYCB-UHFFFAOYSA-N 4-[4-bromo-1-(4-hydroxyphenyl)-1-phenylbutan-2-yl]phenol Chemical compound C1=CC(O)=CC=C1C(CCBr)C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 KLULEXWOUIDYCB-UHFFFAOYSA-N 0.000 description 1
- KYMWFFAYZBWEJG-UHFFFAOYSA-N 4-[4-hydroxy-1-(4-hydroxyphenyl)-1-phenylbut-1-en-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(CCO)=C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 KYMWFFAYZBWEJG-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- PQIAGCGZPGAYFV-UHFFFAOYSA-N 5-(oxan-2-yloxy)-1,2-diphenylpentan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C=1C=CC=CC=1)CCCOC1CCCCO1 PQIAGCGZPGAYFV-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 208000036832 Adenocarcinoma of ovary Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 206010001488 Aggression Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102220595577 Major vault protein_R24A_mutation Human genes 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 238000011785 NMRI mouse Methods 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- 206010061328 Ovarian epithelial cancer Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- MKYQPGPNVYRMHI-UHFFFAOYSA-N Triphenylethylene Chemical compound C=1C=CC=CC=1C=C(C=1C=CC=CC=1)C1=CC=CC=C1 MKYQPGPNVYRMHI-UHFFFAOYSA-N 0.000 description 1
- TWVVUHGYKKOEMB-UHFFFAOYSA-N [4-[4-[2-(dimethylamino)ethoxy]phenyl]-4-hydroxy-3,4-diphenylbutyl] acetate Chemical compound C1=CC(OCCN(C)C)=CC=C1C(O)(C=1C=CC=CC=1)C(CCOC(C)=O)C1=CC=CC=C1 TWVVUHGYKKOEMB-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001344 alkene derivatives Chemical class 0.000 description 1
- 150000001336 alkenes Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- DOAYJPJLHNHQSU-UHFFFAOYSA-N aluminum;lithium;hydrate Chemical compound [Li].O.[Al] DOAYJPJLHNHQSU-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- XTKDAFGWCDAMPY-UHFFFAOYSA-N azaperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCN(C=2N=CC=CC=2)CC1 XTKDAFGWCDAMPY-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000029918 bioluminescence Effects 0.000 description 1
- 238000005415 bioluminescence Methods 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- NLAMRLZPVVKXTK-UHFFFAOYSA-N but-1-enyl acetate Chemical class CCC=COC(C)=O NLAMRLZPVVKXTK-UHFFFAOYSA-N 0.000 description 1
- IEKXSSZASGLISC-UHFFFAOYSA-N but-3-enyl acetate Chemical class CC(=O)OCCC=C IEKXSSZASGLISC-UHFFFAOYSA-N 0.000 description 1
- PCDHSSHKDZYLLI-UHFFFAOYSA-N butan-1-one Chemical compound CCC[C]=O PCDHSSHKDZYLLI-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000000039 congener Substances 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 210000000172 cytosol Anatomy 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 229960004750 estramustine phosphate Drugs 0.000 description 1
- ADFOJJHRTBFFOF-RBRWEJTLSA-N estramustine phosphate Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)OP(O)(O)=O)[C@@H]4[C@@H]3CCC2=C1 ADFOJJHRTBFFOF-RBRWEJTLSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000003840 hydrochlorides Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005917 in vivo anti-tumor Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 208000013371 ovarian adenocarcinoma Diseases 0.000 description 1
- 201000006588 ovary adenocarcinoma Diseases 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- LHTVMBMETNGEAN-UHFFFAOYSA-N pent-1-en-1-ol Chemical class CCCC=CO LHTVMBMETNGEAN-UHFFFAOYSA-N 0.000 description 1
- SIPDUQYOKFRSKR-UHFFFAOYSA-N phenyl-(2-phenylmethoxyphenyl)methanone Chemical compound C=1C=CC=C(OCC=2C=CC=CC=2)C=1C(=O)C1=CC=CC=C1 SIPDUQYOKFRSKR-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000001072 progestational effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012521 purified sample Substances 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- WINYCIXPFGVTOS-UHFFFAOYSA-M sodium;dichloromethane;hydroxide Chemical compound [OH-].[Na+].ClCCl WINYCIXPFGVTOS-UHFFFAOYSA-M 0.000 description 1
- 206010041823 squamous cell carcinoma Diseases 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Furan Compounds (AREA)
- Pyrane Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI821879A FI67538C (fi) | 1982-05-27 | 1982-05-27 | Foerfarande foer framstaellning av (z)-1,2-difenyl-1-(4-(2-(n n-dimetylamino)etoxi)fenyl)-1-buten |
| FI821879 | 1982-05-27 | ||
| GB8218414 | 1982-06-25 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2114935A Division JPH037239A (ja) | 1982-05-27 | 1990-04-26 | 新規なアルカン誘導体の製造法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS58216129A JPS58216129A (ja) | 1983-12-15 |
| JPH0419973B2 true JPH0419973B2 (enExample) | 1992-03-31 |
Family
ID=8515594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58093311A Granted JPS58216129A (ja) | 1982-05-27 | 1983-05-25 | 新規なアルカンおよびアルケン誘導体ならびにそれを有効成分とする医薬 |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS58216129A (enExample) |
| AT (1) | AT383344B (enExample) |
| DK (1) | DK165785C (enExample) |
| FI (1) | FI67538C (enExample) |
| HK (1) | HK8389A (enExample) |
| NO (2) | NO158096C (enExample) |
| ZA (1) | ZA833803B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0776661A1 (en) | 1992-10-27 | 1997-06-04 | Nippon Kayaku Kabushiki Kaisha | Combined preparation of antiestrogen and glucocorticoid for the treatment of autoimmune disease |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9126209D0 (en) * | 1991-12-10 | 1992-02-12 | Orion Yhtymae Oy | Drug formulations for parenteral use |
| GB9207437D0 (en) * | 1992-04-03 | 1992-05-20 | Orion Yhtymae Oy | Topical administration of toremifene and its metabolites |
| TW593256B (en) * | 1999-11-16 | 2004-06-21 | Hormos Medical Oy Ltd | Triphenylalkene derivatives and their use as selective estrogen receptor modulators |
| FI20030747A0 (fi) * | 2003-05-19 | 2003-05-19 | Orion Corp | Toremifeenin kiteytysmenetelmä |
| CN106397226A (zh) * | 2016-04-19 | 2017-02-15 | 福安药业集团宁波天衡制药有限公司 | 一种他莫昔芬的新制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1079747A (en) * | 1965-07-07 | 1967-08-16 | Ici Ltd | Alkene derivatives |
| HU172948B (hu) * | 1976-02-05 | 1979-01-28 | Gyogyszerkutato Intezet | Sposob poluchenija osnovnykh proizvodnykh trifenil-alkenov |
-
1982
- 1982-05-27 FI FI821879A patent/FI67538C/fi not_active IP Right Cessation
-
1983
- 1983-05-25 ZA ZA833803A patent/ZA833803B/xx unknown
- 1983-05-25 JP JP58093311A patent/JPS58216129A/ja active Granted
- 1983-05-26 DK DK236683A patent/DK165785C/da not_active IP Right Cessation
- 1983-05-26 AT AT0192983A patent/AT383344B/de not_active IP Right Cessation
- 1983-05-26 NO NO831874A patent/NO158096C/no not_active IP Right Cessation
-
1989
- 1989-01-26 HK HK8389A patent/HK8389A/en not_active IP Right Cessation
-
1996
- 1996-01-26 NO NO1996002C patent/NO1996002I1/no unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0776661A1 (en) | 1992-10-27 | 1997-06-04 | Nippon Kayaku Kabushiki Kaisha | Combined preparation of antiestrogen and glucocorticoid for the treatment of autoimmune disease |
Also Published As
| Publication number | Publication date |
|---|---|
| FI821879L (fi) | 1983-11-28 |
| NO831874L (no) | 1983-11-28 |
| NO1996002I1 (no) | 1996-01-26 |
| ZA833803B (en) | 1984-02-29 |
| DK236683A (da) | 1983-11-28 |
| AT383344B (de) | 1987-06-25 |
| NO158096B (no) | 1988-04-05 |
| DK165785C (da) | 1993-06-14 |
| HK8389A (en) | 1989-02-03 |
| FI821879A0 (fi) | 1982-05-27 |
| JPS58216129A (ja) | 1983-12-15 |
| FI67538C (fi) | 1985-04-10 |
| DK236683D0 (da) | 1983-05-26 |
| DK165785B (da) | 1993-01-18 |
| NO158096C (no) | 1988-07-13 |
| FI67538B (fi) | 1984-12-31 |
| ATA192983A (de) | 1986-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4696949A (en) | Novel tri-phenyl alkane and alkene derivatives and their preparation and use | |
| JPH0678257B2 (ja) | 新規なアルケン誘導体の製造法 | |
| US5491173A (en) | Tri-phenyl alkene derivatives and their preparation and use | |
| JPS6149297B2 (enExample) | ||
| AP188A (en) | Novel aryloxy alcohol benzenes, processes for their preparation as well as the pharmaceutical compositions containing them. | |
| EP0078158B1 (en) | Novel alkane and alkene derivatives and their preparation and use | |
| JPH0419973B2 (enExample) | ||
| DE60121809T2 (de) | Materialien und verfahren zur herstellung von stilbenen | |
| WO1993012089A1 (en) | New bht ether compounds and their use as hypolipidemic and antiatherosclerotic drugs | |
| US3506653A (en) | Non-steroid hormonal agents | |
| EP0074873A1 (fr) | Dérivés de phénoxy-3 propanol-2, leur préparation et leur application en thérapeutique | |
| JPS5943955B2 (ja) | 新規なジベンゾピラン中間体およびその製造法 | |
| JPS6026387B2 (ja) | シンナミルモラノリン誘導体 | |
| CA1101860A (en) | Tetrahydro benzo [c] quinoline 9 (8h) ones useful as intermediates in the productions of pharmaceuticals | |
| KR790001321B1 (ko) | 디벤조 피란류의 제조방법 | |
| US2333486A (en) | Estrogenic agents | |
| JPS61503032A (ja) | 立体異性的に純粋な17α−エチニル−エストラ−2−エン−17β−オ−ルおよびその17β−エステル、製造方法および用途 | |
| JPS6348853B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| EXPY | Cancellation because of completion of term |