JPH0366301B2 - - Google Patents
Info
- Publication number
- JPH0366301B2 JPH0366301B2 JP60274857A JP27485785A JPH0366301B2 JP H0366301 B2 JPH0366301 B2 JP H0366301B2 JP 60274857 A JP60274857 A JP 60274857A JP 27485785 A JP27485785 A JP 27485785A JP H0366301 B2 JPH0366301 B2 JP H0366301B2
- Authority
- JP
- Japan
- Prior art keywords
- ethyl
- fluoro
- difluoro
- dihydroquinol
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 nitro, formyl Chemical group 0.000 claims description 61
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000006684 polyhaloalkyl group Chemical group 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 239000007787 solid Substances 0.000 description 109
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 99
- 239000000203 mixture Substances 0.000 description 90
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 86
- 239000000243 solution Substances 0.000 description 80
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- 239000000047 product Substances 0.000 description 75
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 70
- 238000000034 method Methods 0.000 description 66
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 64
- 238000000921 elemental analysis Methods 0.000 description 59
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- 150000001875 compounds Chemical class 0.000 description 55
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 44
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 239000011541 reaction mixture Substances 0.000 description 34
- 238000003756 stirring Methods 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical group [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- 239000002904 solvent Substances 0.000 description 25
- 239000000284 extract Substances 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 22
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 22
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 17
- 239000003921 oil Substances 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000012043 crude product Substances 0.000 description 15
- DTQVDTLACAAQTR-DYCDLGHISA-N trifluoroacetic acid-d1 Chemical compound [2H]OC(=O)C(F)(F)F DTQVDTLACAAQTR-DYCDLGHISA-N 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 238000001035 drying Methods 0.000 description 14
- 239000011592 zinc chloride Substances 0.000 description 14
- 235000005074 zinc chloride Nutrition 0.000 description 14
- 238000000746 purification Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 229910052796 boron Inorganic materials 0.000 description 11
- 229910052751 metal Inorganic materials 0.000 description 11
- 239000002184 metal Substances 0.000 description 11
- 229910052763 palladium Inorganic materials 0.000 description 11
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 9
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 230000007246 mechanism Effects 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 229910052723 transition metal Inorganic materials 0.000 description 7
- 150000003624 transition metals Chemical class 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 238000006467 substitution reaction Methods 0.000 description 6
- HETSDWRDICBRSQ-UHFFFAOYSA-N 3h-quinolin-4-one Chemical compound C1=CC=C2C(=O)CC=NC2=C1 HETSDWRDICBRSQ-UHFFFAOYSA-N 0.000 description 5
- XRIJMVGESWLDJS-UHFFFAOYSA-N 7-bromo-1,2-diethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C(Br)C(F)=C2N(CC)C(CC)=CC(=O)C2=C1 XRIJMVGESWLDJS-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- XIWXAORZDXFWAS-UHFFFAOYSA-N ethyl 7-bromo-6,8-difluoro-4-oxo-1h-quinoline-3-carboxylate Chemical compound FC1=C(Br)C(F)=CC2=C(O)C(C(=O)OCC)=CN=C21 XIWXAORZDXFWAS-UHFFFAOYSA-N 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 150000007942 carboxylates Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical compound C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 150000004820 halides Chemical group 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- XJDDLMJULQGRLU-UHFFFAOYSA-N 1,3-dioxane-4,6-dione Chemical compound O=C1CC(=O)OCO1 XJDDLMJULQGRLU-UHFFFAOYSA-N 0.000 description 3
- XKUJZHBAHYWIFJ-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-phenylquinolin-4-one Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=CC=C1 XKUJZHBAHYWIFJ-UHFFFAOYSA-N 0.000 description 3
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 3
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 229910052776 Thorium Inorganic materials 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910001873 dinitrogen Inorganic materials 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- ITRNHLRSYSFNHE-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-[3-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=CC(CO)=C1 ITRNHLRSYSFNHE-UHFFFAOYSA-N 0.000 description 2
- QOFSNTNYXPPBBP-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-[4-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(CO)C=C1 QOFSNTNYXPPBBP-UHFFFAOYSA-N 0.000 description 2
- FOSGDMCYDGVEDG-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-phenylquinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=CC=C1 FOSGDMCYDGVEDG-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- LWSVHWFSULYYSW-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(4-methylsulfinylphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(S(C)=O)C=C1 LWSVHWFSULYYSW-UHFFFAOYSA-N 0.000 description 2
- BUIPKDFUVKLJTF-UHFFFAOYSA-N 1-fluoro-2-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C(=CC=CC=2)F)=C1 BUIPKDFUVKLJTF-UHFFFAOYSA-N 0.000 description 2
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- IQCPYFIIMNLQNU-UHFFFAOYSA-N 2-bromo-1,3-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(Br)=C1F IQCPYFIIMNLQNU-UHFFFAOYSA-N 0.000 description 2
- KJRAPRROUUCCPO-UHFFFAOYSA-N 3-(2-fluorophenyl)benzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C(=CC=CC=2)F)=C1 KJRAPRROUUCCPO-UHFFFAOYSA-N 0.000 description 2
- NOLTZCNNKXLYKY-UHFFFAOYSA-N 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-4-fluoroaniline Chemical compound C1=CC(CO[Si](C)(C)C(C)(C)C)=CC=C1C1=CC(N)=CC=C1F NOLTZCNNKXLYKY-UHFFFAOYSA-N 0.000 description 2
- KOWPUNQBGWIERF-UHFFFAOYSA-N 3-bromo-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Br)=C1 KOWPUNQBGWIERF-UHFFFAOYSA-N 0.000 description 2
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 2
- KGHJSTHVTOSNLM-UHFFFAOYSA-N 4-fluoro-3-phenylaniline Chemical compound NC1=CC=C(F)C(C=2C=CC=CC=2)=C1 KGHJSTHVTOSNLM-UHFFFAOYSA-N 0.000 description 2
- AUILVXAGJMIFSR-UHFFFAOYSA-N 7-(3-chloro-4-hydroxyphenyl)-1-ethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(O)C(Cl)=C1 AUILVXAGJMIFSR-UHFFFAOYSA-N 0.000 description 2
- AIEZCQMIUTYPEA-UHFFFAOYSA-N 7-[3-(aminomethyl)phenyl]-1-ethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=CC(CN)=C1 AIEZCQMIUTYPEA-UHFFFAOYSA-N 0.000 description 2
- SRCXAUZAGCYTRB-UHFFFAOYSA-N 7-[4-(aminomethyl)phenyl]-1-ethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(CN)C=C1 SRCXAUZAGCYTRB-UHFFFAOYSA-N 0.000 description 2
- CUAHJGQRZKXGFM-UHFFFAOYSA-N 7-bromo-1,2-diethyl-6-fluoroquinolin-4-one Chemical compound FC1=C(Br)C=C2N(CC)C(CC)=CC(=O)C2=C1 CUAHJGQRZKXGFM-UHFFFAOYSA-N 0.000 description 2
- UBPKZDPHQCFOAS-UHFFFAOYSA-N 7-bromo-2-ethyl-6,8-difluoro-1-propylquinolin-4-one Chemical compound FC1=C(Br)C(F)=C2N(CCC)C(CC)=CC(=O)C2=C1 UBPKZDPHQCFOAS-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical class [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000005661 deetherification reaction Methods 0.000 description 2
- 150000001983 dialkylethers Chemical class 0.000 description 2
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000644 isotonic solution Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 2
- NARKKHODBQOGIW-UHFFFAOYSA-N n-[4-(1-ethyl-6-fluoro-4-oxoquinolin-7-yl)phenyl]acetamide Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(NC(C)=O)C=C1 NARKKHODBQOGIW-UHFFFAOYSA-N 0.000 description 2
- KFGNVOOXXOHECR-UHFFFAOYSA-N n-[4-(1-ethyl-6-fluoro-4-oxoquinolin-7-yl)phenyl]formamide Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(NC=O)C=C1 KFGNVOOXXOHECR-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- CHSMNMOHKSNOKO-UHFFFAOYSA-L zinc;dichloride;hydrate Chemical compound O.[Cl-].[Cl-].[Zn+2] CHSMNMOHKSNOKO-UHFFFAOYSA-L 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- FSWNRRSWFBXQCL-UHFFFAOYSA-N (3-bromophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1 FSWNRRSWFBXQCL-UHFFFAOYSA-N 0.000 description 1
- IRUTYUASCLKQAL-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-(2-methoxyphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=CC=C1OC IRUTYUASCLKQAL-UHFFFAOYSA-N 0.000 description 1
- FTKNDITYOPTRIJ-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-(3-methoxyphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=CC(OC)=C1 FTKNDITYOPTRIJ-UHFFFAOYSA-N 0.000 description 1
- ORWCWPLOIFZQQB-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-(4-methoxyphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C=C1 ORWCWPLOIFZQQB-UHFFFAOYSA-N 0.000 description 1
- BUXVWCQVVRAVIL-UHFFFAOYSA-N 1,2-diethyl-6,8-difluoro-7-(4-methylsulfinylphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(S(C)=O)C=C1 BUXVWCQVVRAVIL-UHFFFAOYSA-N 0.000 description 1
- SNAKOWJOEGJHEO-UHFFFAOYSA-N 1,2-diethyl-6-fluoro-7-[3-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound C1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=CC(CO)=C1 SNAKOWJOEGJHEO-UHFFFAOYSA-N 0.000 description 1
- WPBSNIVLKBJUSZ-UHFFFAOYSA-N 1,2-diethyl-6-fluoro-7-[4-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound C1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(CO)C=C1 WPBSNIVLKBJUSZ-UHFFFAOYSA-N 0.000 description 1
- PWMWNFMRSKOCEY-UHFFFAOYSA-N 1-Phenyl-1,2-ethanediol Chemical compound OCC(O)C1=CC=CC=C1 PWMWNFMRSKOCEY-UHFFFAOYSA-N 0.000 description 1
- IPWBFGUBXWMIPR-UHFFFAOYSA-N 1-bromo-2-fluorobenzene Chemical compound FC1=CC=CC=C1Br IPWBFGUBXWMIPR-UHFFFAOYSA-N 0.000 description 1
- JTLAIKFGRHDNQM-UHFFFAOYSA-N 1-bromo-2-fluoroethane Chemical compound FCCBr JTLAIKFGRHDNQM-UHFFFAOYSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- YEUYZNNBXLMFCW-UHFFFAOYSA-N 1-bromo-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(Br)C=C1 YEUYZNNBXLMFCW-UHFFFAOYSA-N 0.000 description 1
- XQPJCFCLGSWKNB-UHFFFAOYSA-N 1-butyl-6,8-difluoro-7-(4-methoxyphenyl)quinolin-4-one Chemical compound FC1=C2N(CCCC)C=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C=C1 XQPJCFCLGSWKNB-UHFFFAOYSA-N 0.000 description 1
- GCWNPQWIRCZHBN-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(3-methylsulfonylphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=CC(S(C)(=O)=O)=C1 GCWNPQWIRCZHBN-UHFFFAOYSA-N 0.000 description 1
- LNXSQGNKKSYAQY-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(4-hydroxyphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(O)C=C1 LNXSQGNKKSYAQY-UHFFFAOYSA-N 0.000 description 1
- NQPXZCNXCMUGKF-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(4-methoxyphenyl)quinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C=C1 NQPXZCNXCMUGKF-UHFFFAOYSA-N 0.000 description 1
- DNUNYVNGXCRDKU-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-[3-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=CC(CO)=C1 DNUNYVNGXCRDKU-UHFFFAOYSA-N 0.000 description 1
- YWLMIBISARCYOK-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-[4-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(CO)C=C1 YWLMIBISARCYOK-UHFFFAOYSA-N 0.000 description 1
- JECYYYSTEIAQIX-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-phenylquinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=CC=C1 JECYYYSTEIAQIX-UHFFFAOYSA-N 0.000 description 1
- VOPQPNICJZAKLN-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(4-methoxyphenyl)quinolin-4-one Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C=C1 VOPQPNICJZAKLN-UHFFFAOYSA-N 0.000 description 1
- SEJHTZZVDVBFQD-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(4-nitrophenyl)quinolin-4-one Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C([N+]([O-])=O)C=C1 SEJHTZZVDVBFQD-UHFFFAOYSA-N 0.000 description 1
- BADZHYLPRBDORA-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[3-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=CC(CO)=C1 BADZHYLPRBDORA-UHFFFAOYSA-N 0.000 description 1
- MRXVFNDSYCJPPC-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[4-(hydroxymethyl)phenyl]quinolin-4-one Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(CO)C=C1 MRXVFNDSYCJPPC-UHFFFAOYSA-N 0.000 description 1
- UZRWCXBSPNFXAK-UHFFFAOYSA-N 1-fluoro-2-(4-methylphenyl)benzene Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1F UZRWCXBSPNFXAK-UHFFFAOYSA-N 0.000 description 1
- LVYJIIRJQDEGBR-UHFFFAOYSA-N 1-fluoro-2-iodoethane Chemical compound FCCI LVYJIIRJQDEGBR-UHFFFAOYSA-N 0.000 description 1
- OPOFPVOALIOZBR-UHFFFAOYSA-N 1-fluoroquinolin-4-one Chemical compound C1=CC=C2N(F)C=CC(=O)C2=C1 OPOFPVOALIOZBR-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- CNZCYRZOPBSJOA-UHFFFAOYSA-N 10-bromo-9-fluoro-3-methyl-7-oxo-2,3-dihydro-(7h)-pyrido-(1,2,3-de)-1,4-benzoxazine-6-carboxylic acid Chemical compound O1CC(C)N2C=C(C(O)=O)C(=O)C3=C2C1=C(Br)C(F)=C3 CNZCYRZOPBSJOA-UHFFFAOYSA-N 0.000 description 1
- WCVOGSZTONGSQY-UHFFFAOYSA-N 2,4,6-trichloroanisole Chemical compound COC1=C(Cl)C=C(Cl)C=C1Cl WCVOGSZTONGSQY-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- KSOKVAQWSPTDEI-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]-1,3-dihydrobenzo[f][1,3]benzoxazine Chemical compound FC(F)(F)C1=CC=CC(N2CC3=C4C=CC=CC4=CC=C3OC2)=C1 KSOKVAQWSPTDEI-UHFFFAOYSA-N 0.000 description 1
- LLVJIRFAZIKHEZ-UHFFFAOYSA-N 2-[n-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-n-(furan-2-ylmethyl)acetamide Chemical compound C1=CC(F)=CC=C1N(S(=O)(=O)C=1C=C2OCCOC2=CC=1)CC(=O)NCC1=CC=CO1 LLVJIRFAZIKHEZ-UHFFFAOYSA-N 0.000 description 1
- HRZTZLCMURHWFY-UHFFFAOYSA-N 2-bromo-1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1Br HRZTZLCMURHWFY-UHFFFAOYSA-N 0.000 description 1
- AVUSAMCYDUMVNY-UHFFFAOYSA-N 2-bromo-3-fluoro-6-nitrophenol Chemical compound OC1=C(Br)C(F)=CC=C1[N+]([O-])=O AVUSAMCYDUMVNY-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- HEMQRALQJLCVBR-UHFFFAOYSA-N 2-chloro-2,3-dimethylbutane Chemical compound CC(C)C(C)(C)Cl HEMQRALQJLCVBR-UHFFFAOYSA-N 0.000 description 1
- DERAACKMMNJAFU-UHFFFAOYSA-N 2-ethoxy-1,3-dioxane-4,6-dione Chemical compound CCOC1OC(=O)CC(=O)O1 DERAACKMMNJAFU-UHFFFAOYSA-N 0.000 description 1
- BWLBGMIXKSTLSX-UHFFFAOYSA-N 2-hydroxyisobutyric acid Chemical compound CC(C)(O)C(O)=O BWLBGMIXKSTLSX-UHFFFAOYSA-N 0.000 description 1
- WTCXPFYKVHTDGH-UHFFFAOYSA-N 3-(2-fluoro-5-nitrophenyl)benzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C(=CC=C(C=2)[N+]([O-])=O)F)=C1 WTCXPFYKVHTDGH-UHFFFAOYSA-N 0.000 description 1
- WADSJYLPJPTMLN-UHFFFAOYSA-N 3-(cycloundecen-1-yl)-1,2-diazacycloundec-2-ene Chemical compound C1CCCCCCCCC=C1C1=NNCCCCCCCC1 WADSJYLPJPTMLN-UHFFFAOYSA-N 0.000 description 1
- NUDDKKLQNVWKRU-UHFFFAOYSA-N 3-bromo-2,4-difluoroaniline Chemical compound NC1=CC=C(F)C(Br)=C1F NUDDKKLQNVWKRU-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- KXEAZJHCOWBLLF-UHFFFAOYSA-N 3-methyl-3-(3-methylpentan-3-yloxy)pentane Chemical compound CCC(C)(CC)OC(C)(CC)CC KXEAZJHCOWBLLF-UHFFFAOYSA-N 0.000 description 1
- PPVRULRFHMTTGL-UHFFFAOYSA-N 4-(1,2-diethyl-6,8-difluoro-4-oxoquinolin-7-yl)benzenesulfonyl chloride Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(S(Cl)(=O)=O)C=C1 PPVRULRFHMTTGL-UHFFFAOYSA-N 0.000 description 1
- YEEOPVGSVXIWJB-UHFFFAOYSA-N 4-(1,2-diethyl-6-fluoro-4-oxoquinolin-7-yl)benzenesulfonamide Chemical compound C1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(S(N)(=O)=O)C=C1 YEEOPVGSVXIWJB-UHFFFAOYSA-N 0.000 description 1
- LXWXFEPILUQTNC-UHFFFAOYSA-N 4-(1-ethyl-6,8-difluoro-4-oxoquinolin-7-yl)benzoic acid Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(C(O)=O)C=C1 LXWXFEPILUQTNC-UHFFFAOYSA-N 0.000 description 1
- IPKZGPDAYWNAOB-UHFFFAOYSA-N 4-(1-ethyl-6-fluoro-4-oxoquinolin-7-yl)benzaldehyde Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(C=O)C=C1 IPKZGPDAYWNAOB-UHFFFAOYSA-N 0.000 description 1
- KFJGASIZRHTXEP-UHFFFAOYSA-N 4-(1-ethyl-6-fluoro-4-oxoquinolin-7-yl)benzenesulfonamide Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(S(N)(=O)=O)C=C1 KFJGASIZRHTXEP-UHFFFAOYSA-N 0.000 description 1
- GQTUIFCLGQHDPR-UHFFFAOYSA-N 4-(2-fluoro-5-nitrophenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC([N+]([O-])=O)=CC=C1F GQTUIFCLGQHDPR-UHFFFAOYSA-N 0.000 description 1
- SLKZDWAZOKIEEU-UHFFFAOYSA-N 4-(2-fluorophenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC=C1F SLKZDWAZOKIEEU-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FPIQNBOUYZLESW-UHFFFAOYSA-N 4-bromo-2-chloro-1-methoxybenzene Chemical compound COC1=CC=C(Br)C=C1Cl FPIQNBOUYZLESW-UHFFFAOYSA-N 0.000 description 1
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 1
- ASQTXNXHVQHICY-UHFFFAOYSA-N 6,8-difluoro-7-(4-hydroxyphenyl)-1-methylquinolin-4-one Chemical compound FC1=C2N(C)C=CC(=O)C2=CC(F)=C1C1=CC=C(O)C=C1 ASQTXNXHVQHICY-UHFFFAOYSA-N 0.000 description 1
- ZBLVCZKIRHJVAJ-UHFFFAOYSA-N 6,8-difluoro-7-(4-methoxyphenyl)-1-methylquinolin-4-one Chemical compound C1=CC(OC)=CC=C1C1=C(F)C=C2C(=O)C=CN(C)C2=C1F ZBLVCZKIRHJVAJ-UHFFFAOYSA-N 0.000 description 1
- JMGWBYUXRDNGHY-UHFFFAOYSA-N 6,8-difluoro-7-(4-methoxyphenyl)-1-propylquinolin-4-one Chemical compound FC1=C2N(CCC)C=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C=C1 JMGWBYUXRDNGHY-UHFFFAOYSA-N 0.000 description 1
- LRDCEDKUAFFMGP-UHFFFAOYSA-N 6-fluoro-1-(4-fluorophenyl)-7-(4-hydroxyphenyl)quinolin-4-one Chemical compound C1=CC(O)=CC=C1C(C(=C1)F)=CC2=C1C(=O)C=CN2C1=CC=C(F)C=C1 LRDCEDKUAFFMGP-UHFFFAOYSA-N 0.000 description 1
- FPXKLMKSPFMQIB-UHFFFAOYSA-N 7-(3-chloro-4-methoxyphenyl)-1,2-diethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C(Cl)=C1 FPXKLMKSPFMQIB-UHFFFAOYSA-N 0.000 description 1
- GHLGPBPKHAGKFA-UHFFFAOYSA-N 7-(3-chloro-4-methoxyphenyl)-1-ethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(OC)C(Cl)=C1 GHLGPBPKHAGKFA-UHFFFAOYSA-N 0.000 description 1
- ZIFOUKDTOQOWGD-UHFFFAOYSA-N 7-(4-aminophenyl)-1-ethyl-6-fluoroquinolin-4-one Chemical compound C1=C2N(CC)C=CC(=O)C2=CC(F)=C1C1=CC=C(N)C=C1 ZIFOUKDTOQOWGD-UHFFFAOYSA-N 0.000 description 1
- STCHKPXEQNTRCY-UHFFFAOYSA-N 7-[4-(aminomethyl)phenyl]-1,2-diethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C2N(CC)C(CC)=CC(=O)C2=CC(F)=C1C1=CC=C(CN)C=C1 STCHKPXEQNTRCY-UHFFFAOYSA-N 0.000 description 1
- WLTBDUWBJNOQJD-UHFFFAOYSA-N 7-bromo-1-ethyl-6,8-difluoroquinolin-4-one Chemical compound FC1=C(Br)C(F)=C2N(CC)C=CC(=O)C2=C1 WLTBDUWBJNOQJD-UHFFFAOYSA-N 0.000 description 1
- QCLSWROVIZLOSY-UHFFFAOYSA-N 7-bromo-2-ethyl-6,8-difluoro-1-(2-fluoroethyl)quinolin-4-one Chemical compound FC1=C(Br)C(F)=C2N(CCF)C(CC)=CC(=O)C2=C1 QCLSWROVIZLOSY-UHFFFAOYSA-N 0.000 description 1
- 150000005640 7-haloquinolines Chemical class 0.000 description 1
- GMRNMKFXXUOVGO-UHFFFAOYSA-N 8-bromo-7-fluoro-3-methyl-3,4-dihydro-2h-1,4-benzoxazine Chemical compound FC1=CC=C2NC(C)COC2=C1Br GMRNMKFXXUOVGO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910014263 BrF3 Inorganic materials 0.000 description 1
- NFJJDUQLDFMJSH-UHFFFAOYSA-N C(C)C=1N(C2=C(C(=C(C=C2C(C=1)=O)F)C=1SC=C(C=1)C)F)CC Chemical compound C(C)C=1N(C2=C(C(=C(C=C2C(C=1)=O)F)C=1SC=C(C=1)C)F)CC NFJJDUQLDFMJSH-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 240000007857 Castanea sativa Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- 240000002853 Nelumbo nucifera Species 0.000 description 1
- 235000006508 Nelumbo nucifera Nutrition 0.000 description 1
- 235000006510 Nelumbo pentapetala Nutrition 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- SNTZGENQEQKPHV-UHFFFAOYSA-N O1CC=NC2=CC(C(=O)OCC)=CC=C21 Chemical compound O1CC=NC2=CC(C(=O)OCC)=CC=C21 SNTZGENQEQKPHV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 241000384512 Trachichthyidae Species 0.000 description 1
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- FKVTWUJHAYVCEB-UHFFFAOYSA-N [4-(2-fluoro-5-nitrophenyl)phenyl]methanol Chemical compound C1=CC(CO)=CC=C1C1=CC([N+]([O-])=O)=CC=C1F FKVTWUJHAYVCEB-UHFFFAOYSA-N 0.000 description 1
- GXBHMVSXKQHTNM-UHFFFAOYSA-K [Pb+2].[Cl-].[Na+].[Cl-].[Cl-] Chemical compound [Pb+2].[Cl-].[Na+].[Cl-].[Cl-] GXBHMVSXKQHTNM-UHFFFAOYSA-K 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- KOECVEZYLNOEQX-UHFFFAOYSA-N azanium;oxolane;fluoride Chemical compound [NH4+].[F-].C1CCOC1 KOECVEZYLNOEQX-UHFFFAOYSA-N 0.000 description 1
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- GCSVCUMDOQKEMT-UHFFFAOYSA-N butan-1-amine;hydrofluoride Chemical compound [H+].[F-].CCCCN GCSVCUMDOQKEMT-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000004472 dialkylaminosulfonyl group Chemical group 0.000 description 1
- USLKCMBGQFYUFI-UHFFFAOYSA-N dichloromethane;tribromoborane Chemical compound ClCCl.BrB(Br)Br USLKCMBGQFYUFI-UHFFFAOYSA-N 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- JJYTYHBWIUKUMO-UHFFFAOYSA-N diethyl 2-[(8-bromo-7-fluoro-3-methyl-3,4-dihydro-2h-1,4-benzoxazin-2-yl)methylidene]propanedioate Chemical compound FC1=CC=C2NC(C)C(C=C(C(=O)OCC)C(=O)OCC)OC2=C1Br JJYTYHBWIUKUMO-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- HLXVUXRVLVIMEF-UHFFFAOYSA-N ethyl 10-bromo-9-fluoro-3-methyl-7-oxo-2,3-dihydro-(7h)-pyrido-(1,2,3-de)-1,4-benzoxazine-6-carboxylate Chemical compound CC1COC2=C(Br)C(F)=CC3=C2N1C=C(C(=O)OCC)C3=O HLXVUXRVLVIMEF-UHFFFAOYSA-N 0.000 description 1
- LAMDIXRVIXZIRW-UHFFFAOYSA-N ethyl 6-fluoro-4-oxo-7-phenyl-1h-quinoline-3-carboxylate Chemical compound FC1=CC2=C(O)C(C(=O)OCC)=CN=C2C=C1C1=CC=CC=C1 LAMDIXRVIXZIRW-UHFFFAOYSA-N 0.000 description 1
- BTHLIMLVTPLDGK-UHFFFAOYSA-N ethyl 9-fluoro-10-(4-aminosulfonylphenyl)-3-methyl-7-oxo-2,3-dihydro-(7h)-pyrido(1,2,3-de)-1,4-benzoxazine-6-carboxylate Chemical compound FC1=CC(=C23)C(=O)C(C(=O)OCC)=CN2C(C)COC3=C1C1=CC=C(S(N)(=O)=O)C=C1 BTHLIMLVTPLDGK-UHFFFAOYSA-N 0.000 description 1
- IUPUOYVWGFRXPX-UHFFFAOYSA-N ethyl 9-fluoro-10-(4-chlorosulfonylphenyl)-3-methyl-7-oxo-2,3-dihydro-(7h)-pyrido-(1,2,3-de)-1,4-benzoxazine-6-carboxylate Chemical compound FC1=CC(=C23)C(=O)C(C(=O)OCC)=CN2C(C)COC3=C1C1=CC=C(S(Cl)(=O)=O)C=C1 IUPUOYVWGFRXPX-UHFFFAOYSA-N 0.000 description 1
- GIAXBPVMGJGVAW-UHFFFAOYSA-N ethyl 9-fluoro-10-phenyl-3-methyl-7-oxo-2,3-dihydro-(7h)-pyrido-(1,2,3-de)-1,4-benzoxazine-6-carboxylate Chemical compound FC1=CC(=C23)C(=O)C(C(=O)OCC)=CN2C(C)COC3=C1C1=CC=CC=C1 GIAXBPVMGJGVAW-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- WUOIAOOSKMHJOV-UHFFFAOYSA-N ethyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(CC)C1=CC=CC=C1 WUOIAOOSKMHJOV-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical class C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical group [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- PKAUVIXBZJUYRV-UHFFFAOYSA-N methane;hydroiodide Chemical compound C.I PKAUVIXBZJUYRV-UHFFFAOYSA-N 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N methyl monoether Natural products COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- IMCCZKHIPVEUEI-UHFFFAOYSA-N n,n-difluoroaniline Chemical compound FN(F)C1=CC=CC=C1 IMCCZKHIPVEUEI-UHFFFAOYSA-N 0.000 description 1
- RGUOJYYIMVSCNC-UHFFFAOYSA-N n,n-dimethylformamide;2-methylpropanoic acid Chemical compound CN(C)C=O.CC(C)C(O)=O RGUOJYYIMVSCNC-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MGNPLIACIXIYJE-UHFFFAOYSA-N n-fluoroaniline Chemical compound FNC1=CC=CC=C1 MGNPLIACIXIYJE-UHFFFAOYSA-N 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- VEDDBHYQWFOITD-UHFFFAOYSA-N para-bromobenzyl alcohol Chemical compound OCC1=CC=C(Br)C=C1 VEDDBHYQWFOITD-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 125000005009 perfluoropropyl group Chemical group FC(C(C(F)(F)F)(F)F)(F)* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 229940021222 peritoneal dialysis isotonic solution Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 229940053390 pretz Drugs 0.000 description 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- XHFLOLLMZOTPSM-UHFFFAOYSA-M sodium;hydrogen carbonate;hydrate Chemical class [OH-].[Na+].OC(O)=O XHFLOLLMZOTPSM-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- GKYPJLUHGAJKEM-UHFFFAOYSA-N tin;dihydrate Chemical compound O.O.[Sn] GKYPJLUHGAJKEM-UHFFFAOYSA-N 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000006276 transfer reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Landscapes
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US67914684A | 1984-12-06 | 1984-12-06 | |
| US679146 | 1984-12-06 | ||
| US679150 | 1984-12-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS61143365A JPS61143365A (ja) | 1986-07-01 |
| JPH0366301B2 true JPH0366301B2 (fr) | 1991-10-16 |
Family
ID=24725757
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP27485785A Granted JPS61143365A (ja) | 1984-12-06 | 1985-12-06 | 置換ジヒドロキノロンカルボン酸 |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS61143365A (fr) |
| ZA (1) | ZA859283B (fr) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013029548A1 (fr) | 2011-08-31 | 2013-03-07 | Otsuka Pharmaceutical Co., Ltd. | Composé quinolone |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE245638T1 (de) * | 1994-08-12 | 2003-08-15 | Toyama Chemical Co Ltd | Neue chinolon- oder naphthyridoncarbonsäurederivate oder deren salze |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5630964A (en) * | 1979-08-22 | 1981-03-28 | Kyorin Pharmaceut Co Ltd | Novel substituted quinolinecarboxylic acid and its preparation |
-
1985
- 1985-12-04 ZA ZA859283A patent/ZA859283B/xx unknown
- 1985-12-06 JP JP27485785A patent/JPS61143365A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5630964A (en) * | 1979-08-22 | 1981-03-28 | Kyorin Pharmaceut Co Ltd | Novel substituted quinolinecarboxylic acid and its preparation |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013029548A1 (fr) | 2011-08-31 | 2013-03-07 | Otsuka Pharmaceutical Co., Ltd. | Composé quinolone |
| EP3318557A2 (fr) | 2011-08-31 | 2018-05-09 | Otsuka Pharmaceutical Co., Ltd. | Composé de quinolone |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS61143365A (ja) | 1986-07-01 |
| ZA859283B (en) | 1987-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4623650A (en) | Antibiotic derivatives of 7-phenyl-1,4-dihydro-4-oxo-3-quinolinecarboxylic acids | |
| KR940007305B1 (ko) | 8-위치에서 치환된 퀴놀론카복실산 유도체, 이의 제조방법 및 이를 함유하는 약제학적 조성물 | |
| JPH03206078A (ja) | １Ｈ―イミダゾ〔４，５―ｃ〕キノリン類の製造方法 | |
| JPH0696557B2 (ja) | ベンゾヘテロ環化合物 | |
| JPH08505881A (ja) | キノリンアミンの製造方法 | |
| JP2532192B2 (ja) | １−アミノ−２−フルオロシクロプロパン | |
| HUT77314A (hu) | Kinolon- vagy naftiridon-karbonsav-származékok és sóik, e vegyületeket tartalmazó gyógyszerkészítmény és alkalmazásuk | |
| WO2005026147A1 (fr) | Derive d'acide quinolonecarboxylique 7-(4-substitue 3-cyclopropylaminomethyl-1-pyrrolidinyle) | |
| Gerster et al. | Synthesis, absolute configuration, and antibacterial activity of 6, 7-dihydro-5, 8-dimethyl-9-fluoro-1-oxo-1H, 5H-benzo [ij] quinolizine-2-carboxylic acid | |
| EP0184384B1 (fr) | Acides dihydroquinolonecarboxyliques substitués et compositions antibactériennes les contenant | |
| CN108822035B (zh) | 一种4-取代苯硫基异喹啉-1(2h)-酮类化合物的制备方法 | |
| JPH0366301B2 (fr) | ||
| TW200815388A (en) | Chromane and chromene derivatives and uses thereof | |
| JPWO2019131695A1 (ja) | １−［５−（２−フルオロフェニル）−１−（ピリジン−３−イルスルホニル）−１ｈ−ピロ−ル−３−イル］−ｎ−メチルメタンアミンモノフマル酸塩の製造法 | |
| JP2000513019A (ja) | 置換されたインダゾール誘導体製造のための方法及び中間体 | |
| US5039682A (en) | 6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acid derivatives and intermediates therefor | |
| TW200808730A (en) | Process for synthesizing piperazine-piperidine compounds | |
| JPH0678335B2 (ja) | アザスピロキノロン化合物、その製法および抗菌組成物 | |
| CN100422170C (zh) | 喹诺酮羧酸衍生物的制备方法 | |
| US5104868A (en) | Tricyclic derivatives of 7-substituted-6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acids and esters | |
| US5233091A (en) | 6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acid derivatives and intermediates therefor | |
| JPH0753715B2 (ja) | ベンゾヘテロ環化合物 | |
| US5103040A (en) | 6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acid derivatives and intermediates therefor | |
| WO2010020672A1 (fr) | Nouveaux dérivés de phénylquinoléine-acide carboxylique-pyridine utiles comme modulateurs des récepteurs nicotiniques à l'acétylcholine | |
| KR101097415B1 (ko) | 치환된 벤조티아지노인돌의 제조 방법 |