JPH0314034B2 - - Google Patents
Info
- Publication number
- JPH0314034B2 JPH0314034B2 JP24693285A JP24693285A JPH0314034B2 JP H0314034 B2 JPH0314034 B2 JP H0314034B2 JP 24693285 A JP24693285 A JP 24693285A JP 24693285 A JP24693285 A JP 24693285A JP H0314034 B2 JPH0314034 B2 JP H0314034B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- carbon atoms
- piperidino
- chloro
- benzimidazole
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 124
- 125000004432 carbon atom Chemical group C* 0.000 claims description 50
- -1 2-(5-bromo-4-piperidino-2-pyridylmethylsulfinyl)-5-methoxy- (1H)-Benzimidazole 2-(3-bromo-4-piperidino-2-pyridylmethylsulfinyl)-5-methoxy-(1H) -Benzimidazole Chemical compound 0.000 claims description 47
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 239000001257 hydrogen Substances 0.000 claims description 26
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 150000002367 halogens Chemical class 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 17
- 238000004519 manufacturing process Methods 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001589 carboacyl group Chemical group 0.000 claims description 6
- 239000002702 enteric coating Substances 0.000 claims description 6
- 238000009505 enteric coating Methods 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 239000011737 fluorine Chemical group 0.000 claims description 5
- 229910052731 fluorine Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- 208000018522 Gastrointestinal disease Diseases 0.000 claims description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical group SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 3
- 239000002552 dosage form Substances 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 54
- 238000002360 preparation method Methods 0.000 description 44
- 238000000034 method Methods 0.000 description 41
- 238000002844 melting Methods 0.000 description 40
- 230000008018 melting Effects 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- 239000000243 solution Substances 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 34
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 239000003153 chemical reaction reagent Substances 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 23
- 239000000460 chlorine Substances 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 108091006112 ATPases Proteins 0.000 description 8
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 8
- 229910052794 bromium Inorganic materials 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 229960000212 aminophenazone Drugs 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- RBGGMTQEVZWWLW-UHFFFAOYSA-N 1-methoxybenzimidazole Chemical compound C1=CC=C2N(OC)C=NC2=C1 RBGGMTQEVZWWLW-UHFFFAOYSA-N 0.000 description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical group OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 150000001204 N-oxides Chemical class 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000001340 alkali metals Chemical group 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 230000027119 gastric acid secretion Effects 0.000 description 5
- 230000002496 gastric effect Effects 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- VCJIRTWLMWNXEA-UHFFFAOYSA-N (3-chloropyridin-2-yl)methanol Chemical compound OCC1=NC=CC=C1Cl VCJIRTWLMWNXEA-UHFFFAOYSA-N 0.000 description 4
- HPYNZHMRTTWQTB-UHFFFAOYSA-N 2,3-dimethylpyridine Chemical compound CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 4
- UPLJAGWBVJMLFE-UHFFFAOYSA-N 3,4-dichloro-2,5-dimethylpyridine Chemical compound CC1=CN=C(C)C(Cl)=C1Cl UPLJAGWBVJMLFE-UHFFFAOYSA-N 0.000 description 4
- CZRYJFFARPJRPV-UHFFFAOYSA-N 4-[3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]pyridin-4-yl]morpholine Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=CC=1N1CCOCC1 CZRYJFFARPJRPV-UHFFFAOYSA-N 0.000 description 4
- ZAIQFLZYGDWOEI-UHFFFAOYSA-N 5-bromo-2-methyl-4-piperidin-1-ylpyridine Chemical compound C1=NC(C)=CC(N2CCCCC2)=C1Br ZAIQFLZYGDWOEI-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 150000001556 benzimidazoles Chemical class 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 210000001156 gastric mucosa Anatomy 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 210000004907 gland Anatomy 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 238000011534 incubation Methods 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- QGKYTDJYIYERGS-UHFFFAOYSA-N (3,4-dichloro-5-methylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1Cl QGKYTDJYIYERGS-UHFFFAOYSA-N 0.000 description 3
- XFHVRZUGLAROJP-UHFFFAOYSA-N (3,4-dichloropyridin-2-yl)methanol Chemical compound OCC1=NC=CC(Cl)=C1Cl XFHVRZUGLAROJP-UHFFFAOYSA-N 0.000 description 3
- PWSNYRUGVHMGRC-UHFFFAOYSA-N (3-bromo-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCCCC2)=C1Br PWSNYRUGVHMGRC-UHFFFAOYSA-N 0.000 description 3
- WDLXVLGKXIXOES-UHFFFAOYSA-N (3-chloro-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCCCC2)=C1Cl WDLXVLGKXIXOES-UHFFFAOYSA-N 0.000 description 3
- VRPLVCJRLDUGAI-UHFFFAOYSA-N (5-bromo-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound C1=NC(CO)=CC(N2CCCCC2)=C1Br VRPLVCJRLDUGAI-UHFFFAOYSA-N 0.000 description 3
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 3
- VFCKEQUOAZFXGU-UHFFFAOYSA-N 2-[(3-chloro-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=CC=1N1CCCCC1 VFCKEQUOAZFXGU-UHFFFAOYSA-N 0.000 description 3
- RKTIAZVXWYFNJG-UHFFFAOYSA-N 3,4-dichloro-2-methylpyridine Chemical compound CC1=NC=CC(Cl)=C1Cl RKTIAZVXWYFNJG-UHFFFAOYSA-N 0.000 description 3
- WOWKPCRREBTZCL-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)pyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC=C1Cl WOWKPCRREBTZCL-UHFFFAOYSA-N 0.000 description 3
- PYLXNWKUFQTPTQ-UHFFFAOYSA-N 4-[3-chloro-2-(chloromethyl)pyridin-1-ium-4-yl]morpholine;chloride Chemical compound [Cl-].ClCC1=[NH+]C=CC(N2CCOCC2)=C1Cl PYLXNWKUFQTPTQ-UHFFFAOYSA-N 0.000 description 3
- CHFVGTTVCFOOQD-UHFFFAOYSA-N 4-[3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]-5-methylpyridin-4-yl]morpholine Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=C(C)C=1N1CCOCC1 CHFVGTTVCFOOQD-UHFFFAOYSA-N 0.000 description 3
- KRRDLNHLFUBQFG-UHFFFAOYSA-N 5-bromo-2,3-dimethyl-1-oxido-4-piperidin-1-ylpyridin-1-ium Chemical compound CC1=C(C)[N+]([O-])=CC(Br)=C1N1CCCCC1 KRRDLNHLFUBQFG-UHFFFAOYSA-N 0.000 description 3
- JTHURIIQMPMBFU-UHFFFAOYSA-N 5-bromo-2,3-dimethyl-1-oxidopyridin-1-ium Chemical compound CC1=CC(Br)=C[N+]([O-])=C1C JTHURIIQMPMBFU-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 208000007107 Stomach Ulcer Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 238000009825 accumulation Methods 0.000 description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 230000001262 anti-secretory effect Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000001120 cytoprotective effect Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- TWUUUBWBMOSBKE-UHFFFAOYSA-N (3-chloro-4-morpholin-4-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCOCC2)=C1Cl TWUUUBWBMOSBKE-UHFFFAOYSA-N 0.000 description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 2
- ZFOWOWQBRONGLV-UHFFFAOYSA-N 2-[(3-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Br)=NC=CC=1N1CCCCC1 ZFOWOWQBRONGLV-UHFFFAOYSA-N 0.000 description 2
- JHBWVIDNVCIRMJ-UHFFFAOYSA-N 2-[(5-bromo-3-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N1C2=CC(OC)=CC=C2N=C1SCC(C=1C)=NC=C(Br)C=1N1CCCCC1 JHBWVIDNVCIRMJ-UHFFFAOYSA-N 0.000 description 2
- ZUCIATQKHDWAJZ-UHFFFAOYSA-N 2-[(5-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(N=CC=1Br)=CC=1N1CCCCC1 ZUCIATQKHDWAJZ-UHFFFAOYSA-N 0.000 description 2
- CMKNCJBRUHFRKG-UHFFFAOYSA-N 2-[(5-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(N=CC=1Br)=CC=1N1CCCCC1 CMKNCJBRUHFRKG-UHFFFAOYSA-N 0.000 description 2
- GNCLPNMQEGMNTG-UHFFFAOYSA-N 2-methylpyridin-4-amine Chemical compound CC1=CC(N)=CC=N1 GNCLPNMQEGMNTG-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- FRNWZAKNPBDLLD-UHFFFAOYSA-N 3-bromo-2-methyl-4-piperidin-1-ylpyridine Chemical compound CC1=NC=CC(N2CCCCC2)=C1Br FRNWZAKNPBDLLD-UHFFFAOYSA-N 0.000 description 2
- VCEMMBPLSHOSEL-UHFFFAOYSA-N 3-chloro-2,5-dimethylpyridin-4-amine Chemical compound CC1=CN=C(C)C(Cl)=C1N VCEMMBPLSHOSEL-UHFFFAOYSA-N 0.000 description 2
- LHFOSVHQCUPVHK-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC(N2CCCCC2)=C1Cl LHFOSVHQCUPVHK-UHFFFAOYSA-N 0.000 description 2
- KGFNSPQDTPEMRZ-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-n,n,5-trimethylpyridin-4-amine;hydrochloride Chemical compound Cl.CN(C)C1=C(C)C=NC(CCl)=C1Cl KGFNSPQDTPEMRZ-UHFFFAOYSA-N 0.000 description 2
- AGWBEYQZGBQXLL-UHFFFAOYSA-N 3-chloro-2-methylpyridin-4-amine Chemical compound CC1=NC=CC(N)=C1Cl AGWBEYQZGBQXLL-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- JMMGKUIFANVGPL-UHFFFAOYSA-N 5-bromo-2,3-dimethyl-4-piperidin-1-ylpyridine Chemical compound CC1=NC=C(Br)C(N2CCCCC2)=C1C JMMGKUIFANVGPL-UHFFFAOYSA-N 0.000 description 2
- NEEHOROWKICRQK-UHFFFAOYSA-N 5-bromo-2-methyl-1-oxidopyridin-1-ium Chemical compound CC1=CC=C(Br)C=[N+]1[O-] NEEHOROWKICRQK-UHFFFAOYSA-N 0.000 description 2
- OFKWIQJLYCKDNY-UHFFFAOYSA-N 5-bromo-2-methylpyridine Chemical compound CC1=CC=C(Br)C=N1 OFKWIQJLYCKDNY-UHFFFAOYSA-N 0.000 description 2
- MZWNGLQAOUQLHF-UHFFFAOYSA-N 5-bromo-4-chloro-2,3-dimethylpyridine Chemical compound CC1=NC=C(Br)C(Cl)=C1C MZWNGLQAOUQLHF-UHFFFAOYSA-N 0.000 description 2
- ILMHAGCURJPNRZ-UHFFFAOYSA-N 6-methoxy-1h-benzimidazole Chemical compound COC1=CC=C2N=CNC2=C1 ILMHAGCURJPNRZ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000012131 assay buffer Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- CJGYSWNGNKCJSB-YVLZZHOMSA-N bucladesine Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](OC(=O)CCC)[C@@H]2N1C(N=CN=C2NC(=O)CCC)=C2N=C1 CJGYSWNGNKCJSB-YVLZZHOMSA-N 0.000 description 2
- 229960005263 bucladesine Drugs 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 235000011148 calcium chloride Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- WFPZPJSADLPSON-UHFFFAOYSA-N dinitrogen tetraoxide Chemical compound [O-][N+](=O)[N+]([O-])=O WFPZPJSADLPSON-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000011533 pre-incubation Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- UWUIYVLZNYZKSU-UHFFFAOYSA-N (3-chloro-5-methyl-4-morpholin-4-ylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1N1CCOCC1 UWUIYVLZNYZKSU-UHFFFAOYSA-N 0.000 description 1
- BTYCKDRWPXPNSB-UHFFFAOYSA-N (3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1N1CCCCC1 BTYCKDRWPXPNSB-UHFFFAOYSA-N 0.000 description 1
- ACDAPUOXXWLLSC-UHFFFAOYSA-N (3-methylpyridin-2-yl)methanol Chemical compound CC1=CC=CN=C1CO ACDAPUOXXWLLSC-UHFFFAOYSA-N 0.000 description 1
- GYZILYPKQZEUGO-UHFFFAOYSA-N (5-bromo-3-methyl-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound CC1=C(CO)N=CC(Br)=C1N1CCCCC1 GYZILYPKQZEUGO-UHFFFAOYSA-N 0.000 description 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- INOGLHRUEYDAHX-UHFFFAOYSA-N 1-chlorobenzotriazole Chemical compound C1=CC=C2N(Cl)N=NC2=C1 INOGLHRUEYDAHX-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- MUDNQZQFQQUJAD-UHFFFAOYSA-N 2,2-difluoro-5h-[1,3]dioxolo[4,5-f]benzimidazole Chemical compound C1=C2OC(F)(F)OC2=CC2=C1NC=N2 MUDNQZQFQQUJAD-UHFFFAOYSA-N 0.000 description 1
- QWLULCKKOHDCIE-UHFFFAOYSA-N 2,3-dimethyl-1-oxidopyridin-1-ium Chemical compound CC1=CC=C[N+]([O-])=C1C QWLULCKKOHDCIE-UHFFFAOYSA-N 0.000 description 1
- OQLYLAOKFUUBBI-UHFFFAOYSA-N 2,5-dimethylpyridin-3-amine Chemical compound CC1=CN=C(C)C(N)=C1 OQLYLAOKFUUBBI-UHFFFAOYSA-N 0.000 description 1
- DDSMLGAVXJGVGA-UHFFFAOYSA-N 2-[(3-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1[S+]([O-])CC(C=1Br)=NC=CC=1N1CCCCC1 DDSMLGAVXJGVGA-UHFFFAOYSA-N 0.000 description 1
- BWWWXFGSYQGHPZ-UHFFFAOYSA-N 2-[(3-chloro-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(C=1Cl)=NC=CC=1N1CCCCC1 BWWWXFGSYQGHPZ-UHFFFAOYSA-N 0.000 description 1
- REMOEVBLPGHDOR-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=C(C)C=1N1CCCCC1 REMOEVBLPGHDOR-UHFFFAOYSA-N 0.000 description 1
- WMXSKTKPJVQGIW-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-5,6-difluoro-8,10-dioxa-1,3-diazatricyclo[5.3.2.04,11]dodeca-2,4,6,11-tetraene Chemical compound CC1=CN=C(CS(=O)C=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)C(Cl)=C1N1CCCCC1 WMXSKTKPJVQGIW-UHFFFAOYSA-N 0.000 description 1
- VLSRVDFXIZCCEW-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole Chemical compound CC1=CN=C(CS(=O)C=2NC3=CC=C(OC(F)(F)C(F)F)C=C3N=2)C(Cl)=C1N1CCCCC1 VLSRVDFXIZCCEW-UHFFFAOYSA-N 0.000 description 1
- IBKGSZATXCWQOT-UHFFFAOYSA-N 2-methyl-4-piperidin-1-ylpyridine Chemical compound C1=NC(C)=CC(N2CCCCC2)=C1 IBKGSZATXCWQOT-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- BYTAAJQQCAJNQX-UHFFFAOYSA-N 3-bromo-2-(chloromethyl)-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC(N2CCCCC2)=C1Br BYTAAJQQCAJNQX-UHFFFAOYSA-N 0.000 description 1
- OUVKCXCGLFTNKP-UHFFFAOYSA-N 3-bromo-2-methyl-1-oxido-4-piperidin-1-ylpyridin-1-ium Chemical compound C1=[N+]([O-])C(C)=C(Br)C(N2CCCCC2)=C1 OUVKCXCGLFTNKP-UHFFFAOYSA-N 0.000 description 1
- CCPAJOONEPOBLS-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-5-methyl-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.CC1=CN=C(CCl)C(Cl)=C1N1CCCCC1 CCPAJOONEPOBLS-UHFFFAOYSA-N 0.000 description 1
- YVECRFPOTBFEGF-UHFFFAOYSA-N 4,5-difluoro-6,8-dihydro-[1,3]dioxolo[4,5-e]benzimidazole-7-thione Chemical compound FC1=C2OCOC2=C2N=C(S)NC2=C1F YVECRFPOTBFEGF-UHFFFAOYSA-N 0.000 description 1
- DAOZBJCTEPJGES-UHFFFAOYSA-N 4-chloro-2-methylpyridine Chemical compound CC1=CC(Cl)=CC=N1 DAOZBJCTEPJGES-UHFFFAOYSA-N 0.000 description 1
- UIUCDMJOXYLFHF-UHFFFAOYSA-N 5-(1,1,2,2-tetrafluoroethoxy)-1,3-dihydrobenzimidazole-2-thione Chemical compound FC(F)C(F)(F)OC1=CC=C2NC(S)=NC2=C1 UIUCDMJOXYLFHF-UHFFFAOYSA-N 0.000 description 1
- PVWAMZCIAHXKJP-UHFFFAOYSA-N 5-bromo-2,3-dimethylpyridine Chemical compound CC1=CC(Br)=CN=C1C PVWAMZCIAHXKJP-UHFFFAOYSA-N 0.000 description 1
- KPUDVWQAYFTOER-UHFFFAOYSA-N 5-bromo-2-(chloromethyl)-3-methyl-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.CC1=C(CCl)N=CC(Br)=C1N1CCCCC1 KPUDVWQAYFTOER-UHFFFAOYSA-N 0.000 description 1
- NRYCZYOFAHEKLJ-UHFFFAOYSA-N 5-bromo-2-(chloromethyl)-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.C1=NC(CCl)=CC(N2CCCCC2)=C1Br NRYCZYOFAHEKLJ-UHFFFAOYSA-N 0.000 description 1
- KOFBRZWVWJCLGM-UHFFFAOYSA-N 5-methoxy-1,3-dihydrobenzimidazole-2-thione Chemical compound COC1=CC=C2NC(S)=NC2=C1 KOFBRZWVWJCLGM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 238000006064 ATPase reaction Methods 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DEMUZPGGDHEYKC-UHFFFAOYSA-N CC1=C(CS(=O)C=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)N=CC(Br)=C1N1CCCCC1 Chemical compound CC1=C(CS(=O)C=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)N=CC(Br)=C1N1CCCCC1 DEMUZPGGDHEYKC-UHFFFAOYSA-N 0.000 description 1
- CQSXSQBOWQLXEI-UHFFFAOYSA-N CC1=CN=C(CSC=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)C(Cl)=C1N1CCCCC1 Chemical compound CC1=CN=C(CSC=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)C(Cl)=C1N1CCCCC1 CQSXSQBOWQLXEI-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- IYHFHYMAZAWOHI-UHFFFAOYSA-N CN(C)C1=C(C)C=NC(CS(=O)C=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)=C1Cl Chemical compound CN(C)C1=C(C)C=NC(CS(=O)C=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)=C1Cl IYHFHYMAZAWOHI-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RMMXTBMQSGEXHJ-FTOQCNSHSA-N Cc1c(N([14CH3])[14CH3])c(=O)n(-c2ccccc2)n1C Chemical compound Cc1c(N([14CH3])[14CH3])c(=O)n(-c2ccccc2)n1C RMMXTBMQSGEXHJ-FTOQCNSHSA-N 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 208000007882 Gastritis Diseases 0.000 description 1
- 206010064147 Gastrointestinal inflammation Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010022653 Intestinal haemorrhages Diseases 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- 241000860832 Yoda Species 0.000 description 1
- 201000008629 Zollinger-Ellison syndrome Diseases 0.000 description 1
- ZEMJDCGDDDMDHY-UHFFFAOYSA-N [3-chloro-4-(dimethylamino)-5-methylpyridin-2-yl]methanol Chemical compound CN(C)C1=C(C)C=NC(CO)=C1Cl ZEMJDCGDDDMDHY-UHFFFAOYSA-N 0.000 description 1
- GKULEHOYWKQEQE-UHFFFAOYSA-N [Br].C1CC2CCN1NC2 Chemical compound [Br].C1CC2CCN1NC2 GKULEHOYWKQEQE-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 1
- 229960001380 cimetidine Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229960002986 dinoprostone Drugs 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 210000002599 gastric fundus Anatomy 0.000 description 1
- 201000000052 gastrinoma Diseases 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000000762 glandular Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- JYJVVHFRSFVEJM-UHFFFAOYSA-N iodosobenzene Chemical compound O=IC1=CC=CC=C1 JYJVVHFRSFVEJM-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229940031958 magnesium carbonate hydroxide Drugs 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000011587 new zealand white rabbit Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 238000010653 organometallic reaction Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- RMHMFHUVIITRHF-UHFFFAOYSA-N pirenzepine Chemical compound C1CN(C)CCN1CC(=O)N1C2=NC=CC=C2NC(=O)C2=CC=CC=C21 RMHMFHUVIITRHF-UHFFFAOYSA-N 0.000 description 1
- 229960004633 pirenzepine Drugs 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 1
- 229940127293 prostanoid Drugs 0.000 description 1
- 150000003814 prostanoids Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 210000004767 rumen Anatomy 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003452 sulfinic acid derivatives Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- AFSIIZRPQXBCFM-UHFFFAOYSA-N tert-butyl perchlorate Chemical compound CC(C)(C)OCl(=O)(=O)=O AFSIIZRPQXBCFM-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Landscapes
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB848427836A GB8427836D0 (en) | 1984-11-02 | 1984-11-02 | Chemical compounds |
GB8427836 | 1984-11-02 | ||
GB8432515 | 1984-12-21 | ||
GB8518043 | 1985-07-17 |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS61109788A JPS61109788A (ja) | 1986-05-28 |
JPH0314034B2 true JPH0314034B2 (fr) | 1991-02-25 |
Family
ID=10569197
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP24693285A Granted JPS61109788A (ja) | 1984-11-02 | 1985-11-01 | 複素環式化合物 |
Country Status (3)
Country | Link |
---|---|
JP (1) | JPS61109788A (fr) |
GB (1) | GB8427836D0 (fr) |
ZA (1) | ZA858401B (fr) |
-
1984
- 1984-11-02 GB GB848427836A patent/GB8427836D0/en active Pending
-
1985
- 1985-11-01 JP JP24693285A patent/JPS61109788A/ja active Granted
- 1985-11-01 ZA ZA858401A patent/ZA858401B/xx unknown
Also Published As
Publication number | Publication date |
---|---|
GB8427836D0 (en) | 1984-12-12 |
ZA858401B (en) | 1987-06-24 |
JPS61109788A (ja) | 1986-05-28 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0184322B1 (fr) | Benzimidazoles | |
KR850000272B1 (ko) | 1이미도 디설파미드의 제조방법 | |
DE3855549T2 (de) | Benzimidazol-Derivate und therapeutische, diese enthaltende Mittel gegen Ulcer | |
US4457927A (en) | Pyrido[2,1-b]quinazolinone derivatives and the preparation and use thereof | |
JPH0471077B2 (fr) | ||
US4777172A (en) | Pyrimidylalkylthio benzimidale compounds, pharmaceutical compositions and use | |
KR950001015B1 (ko) | 술폭시드 유도체의 제조방법 | |
KR0142815B1 (ko) | 신규한 5-피롤릴-6-할로게노-2피리딜메틸설피닐벤즈이미다졸 유도체 | |
US5250527A (en) | Pyridyl containing benzimidazoles, compositions and use | |
DE69715188T2 (de) | Verfahren und zwischenprodukte zur herstellung von 4-trifluoromethylbiphenyl-2-carbonsaüre,(2-(2h-(1,2,4) triazol-3-ylmethyl)-1,2,3,4-tetrahydro-isoquinolin-6-yl)-amide | |
EP0246774A1 (fr) | Composés chimiques | |
EP0053789A1 (fr) | Dérivés de 2-pyridinecarboxamide, leur procédé de préparation et une composition pharmaceutique utilisable comme agent anti-allergique | |
US4859679A (en) | Antiulcer (alkyldithio) quinoline derivatives | |
JPH0314034B2 (fr) | ||
HU193362B (en) | Process for preparing imidazole derivatives | |
EP0200450A2 (fr) | Dérivés tricycliquesdes thiadiazole oxydes | |
JPS6216469A (ja) | 2−置換シクロヘプトイミダゾ−ル誘導体、抗潰瘍剤及びその製造方法 | |
JPS61238786A (ja) | ピリジン誘導体 | |
EP0298134A1 (fr) | Derives d'amides aromatiques heterocycliques de l'acide carboxylique, procedes de preparation et composition pharmaceutique les contenant | |
JPS62145083A (ja) | 縮合イミダゾ−ル誘導体 | |
PL163654B1 (pl) | Sposób wytwarzania nowych pochodnych imidazoiu PL PL PL | |
JPH05331164A (ja) | アンジオテンシンii拮抗性イソインドール誘導体 | |
JPH064625B2 (ja) | 置換イソキノリン誘導体および抗潰瘍剤 | |
EP0201198B1 (fr) | Dérivés de pyridine | |
KR100479019B1 (ko) | 캐테콜히드라존유도체,이의제조방법및그를함유한약제학적조성물 |