JPH029595B2 - - Google Patents
Info
- Publication number
- JPH029595B2 JPH029595B2 JP56003961A JP396181A JPH029595B2 JP H029595 B2 JPH029595 B2 JP H029595B2 JP 56003961 A JP56003961 A JP 56003961A JP 396181 A JP396181 A JP 396181A JP H029595 B2 JPH029595 B2 JP H029595B2
- Authority
- JP
- Japan
- Prior art keywords
- acid
- weight
- dimethyl
- monomethyl
- vinylphosphonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical class OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 5
- YROIHKKJDMNYRB-UHFFFAOYSA-N 2-acetyloxyethylphosphonic acid Chemical compound CC(=O)OCCP(O)(O)=O YROIHKKJDMNYRB-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 239000002253 acid Substances 0.000 description 22
- -1 2-acetoxyethanephosphonic acid diester Chemical class 0.000 description 16
- 238000003756 stirring Methods 0.000 description 14
- GRKZBWJKCYATKH-UHFFFAOYSA-N 2-dimethoxyphosphorylethyl acetate Chemical compound COP(=O)(OC)CCOC(C)=O GRKZBWJKCYATKH-UHFFFAOYSA-N 0.000 description 12
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- CQCXMYUCNSJSKG-UHFFFAOYSA-N 1-dimethoxyphosphorylethene Chemical compound COP(=O)(OC)C=C CQCXMYUCNSJSKG-UHFFFAOYSA-N 0.000 description 10
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 10
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 10
- XHDNNRGTROLZCF-UHFFFAOYSA-N ethenyl(methoxy)phosphinic acid Chemical compound COP(O)(=O)C=C XHDNNRGTROLZCF-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 238000009835 boiling Methods 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical class OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- IPZJMMRIOCINCK-UHFFFAOYSA-N dimethylphosphorylbenzene Chemical compound CP(C)(=O)C1=CC=CC=C1 IPZJMMRIOCINCK-UHFFFAOYSA-N 0.000 description 2
- LRMLWYXJORUTBG-UHFFFAOYSA-N dimethylphosphorylmethane Chemical compound CP(C)(C)=O LRMLWYXJORUTBG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- ZOSLXSXTWULQTE-UHFFFAOYSA-N ethenyl(ethoxy)phosphinic acid Chemical compound CCOP(O)(=O)C=C ZOSLXSXTWULQTE-UHFFFAOYSA-N 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- TTZPPHVMXXHUBH-UHFFFAOYSA-N 1,1,3-trimethyl-3-phenylurea Chemical compound CN(C)C(=O)N(C)C1=CC=CC=C1 TTZPPHVMXXHUBH-UHFFFAOYSA-N 0.000 description 1
- DREPONDJUKIQLX-UHFFFAOYSA-N 1-[ethenyl(ethoxy)phosphoryl]oxyethane Chemical compound CCOP(=O)(C=C)OCC DREPONDJUKIQLX-UHFFFAOYSA-N 0.000 description 1
- LOUZURPQCYZSJH-UHFFFAOYSA-N 1-chloro-2-dichlorophosphorylethane Chemical compound ClCCP(Cl)(Cl)=O LOUZURPQCYZSJH-UHFFFAOYSA-N 0.000 description 1
- MNZAKDODWSQONA-UHFFFAOYSA-N 1-dibutylphosphorylbutane Chemical compound CCCCP(=O)(CCCC)CCCC MNZAKDODWSQONA-UHFFFAOYSA-N 0.000 description 1
- MLSZIADXWDYFKM-UHFFFAOYSA-N 1-dichlorophosphorylethene Chemical group ClP(Cl)(=O)C=C MLSZIADXWDYFKM-UHFFFAOYSA-N 0.000 description 1
- PPDZLUVUQQGIOJ-UHFFFAOYSA-N 1-dihexylphosphorylhexane Chemical compound CCCCCCP(=O)(CCCCCC)CCCCCC PPDZLUVUQQGIOJ-UHFFFAOYSA-N 0.000 description 1
- SIDULKZCBGMXJL-UHFFFAOYSA-N 1-dimethylphosphoryldodecane Chemical compound CCCCCCCCCCCCP(C)(C)=O SIDULKZCBGMXJL-UHFFFAOYSA-N 0.000 description 1
- AXGURKDDROHGQI-UHFFFAOYSA-N 1-dimethylphosphorylicosane Chemical compound CCCCCCCCCCCCCCCCCCCCP(C)(C)=O AXGURKDDROHGQI-UHFFFAOYSA-N 0.000 description 1
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 description 1
- WCTWAAFIWRIEKH-UHFFFAOYSA-N 1-ethyl-4-methyl-2,3-dihydro-1$l^{5}-phosphole 1-oxide Chemical compound CCP1(=O)CCC(C)=C1 WCTWAAFIWRIEKH-UHFFFAOYSA-N 0.000 description 1
- IUUONVQOMMQAEH-UHFFFAOYSA-N 1-methyl-2,3-dihydro-1$l^{5}-phosphole 1-oxide Chemical compound CP1(=O)CCC=C1 IUUONVQOMMQAEH-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- CFTFTZJSSBAKIG-UHFFFAOYSA-N 2-acetyloxyethyl(methoxy)phosphinic acid Chemical compound COP(O)(=O)CCOC(C)=O CFTFTZJSSBAKIG-UHFFFAOYSA-N 0.000 description 1
- JBXJSCWXXCDNEH-UHFFFAOYSA-N 2-dibutoxyphosphorylethyl acetate Chemical compound CCCCOP(=O)(CCOC(C)=O)OCCCC JBXJSCWXXCDNEH-UHFFFAOYSA-N 0.000 description 1
- JHYNEQNPKGIOQF-UHFFFAOYSA-N 3,4-dihydro-2h-phosphole Chemical compound C1CC=PC1 JHYNEQNPKGIOQF-UHFFFAOYSA-N 0.000 description 1
- GNETVOUSGGAEDK-UHFFFAOYSA-N 4-bis[4-(dimethylamino)phenyl]phosphanyl-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1P(C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 GNETVOUSGGAEDK-UHFFFAOYSA-N 0.000 description 1
- KOYJWFGMEBETBU-UHFFFAOYSA-N 6-ethoxy-1,3-benzothiazol-2-amine Chemical compound CCOC1=CC=C2N=C(N)SC2=C1 KOYJWFGMEBETBU-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- KAMCEHJUSMHEMI-UHFFFAOYSA-N benzyl(diethyl)phosphane Chemical compound CCP(CC)CC1=CC=CC=C1 KAMCEHJUSMHEMI-UHFFFAOYSA-N 0.000 description 1
- CHQVQXZFZHACQQ-UHFFFAOYSA-M benzyl(triethyl)azanium;bromide Chemical compound [Br-].CC[N+](CC)(CC)CC1=CC=CC=C1 CHQVQXZFZHACQQ-UHFFFAOYSA-M 0.000 description 1
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- TXXACRDXEHKXKD-UHFFFAOYSA-M benzyl(trimethyl)phosphanium;chloride Chemical compound [Cl-].C[P+](C)(C)CC1=CC=CC=C1 TXXACRDXEHKXKD-UHFFFAOYSA-M 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- RUIYWYGWEKMQHZ-UHFFFAOYSA-N chloromethyl(dimethyl)phosphane dihydrochloride Chemical compound Cl.Cl.CP(C)CCl RUIYWYGWEKMQHZ-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- ASWXNYNXAOQCCD-UHFFFAOYSA-N dichloro(triphenyl)-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1P(Cl)(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 ASWXNYNXAOQCCD-UHFFFAOYSA-N 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- HZHUAESPXGNNFV-UHFFFAOYSA-N diethyl(methyl)phosphane Chemical compound CCP(C)CC HZHUAESPXGNNFV-UHFFFAOYSA-N 0.000 description 1
- WQAWEUZTDVWTDB-UHFFFAOYSA-N dimethyl(oxo)phosphanium Chemical compound C[P+](C)=O WQAWEUZTDVWTDB-UHFFFAOYSA-N 0.000 description 1
- QVTPAZHGNYBKHE-UHFFFAOYSA-N dimethyl(propyl)phosphane Chemical compound CCCP(C)C QVTPAZHGNYBKHE-UHFFFAOYSA-N 0.000 description 1
- HBGPKEQLRZIWSC-UHFFFAOYSA-N dimethyl-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound CP(C)(=S)C1=CC=CC=C1 HBGPKEQLRZIWSC-UHFFFAOYSA-N 0.000 description 1
- GOJNABIZVJCYFL-UHFFFAOYSA-N dimethylphosphinic acid Chemical compound CP(C)(O)=O GOJNABIZVJCYFL-UHFFFAOYSA-N 0.000 description 1
- YTMRJBAHYSIRMZ-UHFFFAOYSA-N dioctylphosphinic acid Chemical compound CCCCCCCCP(O)(=O)CCCCCCCC YTMRJBAHYSIRMZ-UHFFFAOYSA-N 0.000 description 1
- BEQVQKJCLJBTKZ-UHFFFAOYSA-N diphenylphosphinic acid Chemical compound C=1C=CC=CC=1P(=O)(O)C1=CC=CC=C1 BEQVQKJCLJBTKZ-UHFFFAOYSA-N 0.000 description 1
- KJCUDAFCCWQRIM-UHFFFAOYSA-N dodecyl-dimethyl-sulfanylidene-$l^{5}-phosphane Chemical compound CCCCCCCCCCCCP(C)(C)=S KJCUDAFCCWQRIM-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- NXHKQBCTZHECQF-UHFFFAOYSA-N ethyl(methyl)phosphinic acid Chemical compound CCP(C)(O)=O NXHKQBCTZHECQF-UHFFFAOYSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- DHOUOTPZYIKUDF-UHFFFAOYSA-N imino(triphenyl)-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=N)C1=CC=CC=C1 DHOUOTPZYIKUDF-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 1
- RLDXWNAZJDJGCX-UHFFFAOYSA-N methoxy(propyl)phosphinic acid Chemical compound CCCP(O)(=O)OC RLDXWNAZJDJGCX-UHFFFAOYSA-N 0.000 description 1
- MHERPFVRWOTBSF-UHFFFAOYSA-N methyl(phenyl)phosphane Chemical class CPC1=CC=CC=C1 MHERPFVRWOTBSF-UHFFFAOYSA-N 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical compound CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ORSUTASIQKBEFU-UHFFFAOYSA-N n,n-diethylbutan-1-amine Chemical compound CCCCN(CC)CC ORSUTASIQKBEFU-UHFFFAOYSA-N 0.000 description 1
- IMNDHOCGZLYMRO-UHFFFAOYSA-N n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=CC=C1 IMNDHOCGZLYMRO-UHFFFAOYSA-N 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- VEAKFMJLSNJWPI-UHFFFAOYSA-N n-[diethylamino(ethyl)phosphoryl]-n-ethylethanamine Chemical compound CCN(CC)P(=O)(CC)N(CC)CC VEAKFMJLSNJWPI-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- FTMKAMVLFVRZQX-UHFFFAOYSA-N octadecylphosphonic acid Chemical compound CCCCCCCCCCCCCCCCCCP(O)(O)=O FTMKAMVLFVRZQX-UHFFFAOYSA-N 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- 125000005538 phosphinite group Chemical group 0.000 description 1
- 150000004850 phospholanes Chemical class 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- NSETWVJZUWGCKE-UHFFFAOYSA-N propylphosphonic acid Chemical compound CCCP(O)(O)=O NSETWVJZUWGCKE-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- FBOJNMRAZJRCNS-UHFFFAOYSA-M tetraethylphosphanium;chloride Chemical compound [Cl-].CC[P+](CC)(CC)CC FBOJNMRAZJRCNS-UHFFFAOYSA-M 0.000 description 1
- DDFYFBUWEBINLX-UHFFFAOYSA-M tetramethylammonium bromide Chemical compound [Br-].C[N+](C)(C)C DDFYFBUWEBINLX-UHFFFAOYSA-M 0.000 description 1
- 150000003582 thiophosphoric acids Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- 125000006617 triphenylamine group Chemical group 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- KCTAHLRCZMOTKM-UHFFFAOYSA-N tripropylphosphane Chemical compound CCCP(CCC)CCC KCTAHLRCZMOTKM-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4068—Esters of pyrophosphonic acids; Esters of phosphonic acid anhydrides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3826—Acyclic unsaturated acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3895—Pyrophosphonic acids; phosphonic acid anhydrides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4015—Esters of acyclic unsaturated acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Fireproofing Substances (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803001894 DE3001894A1 (de) | 1980-01-19 | 1980-01-19 | Verfahren zur herstellung von vinyphophonsaeurederivaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS56104894A JPS56104894A (en) | 1981-08-20 |
| JPH029595B2 true JPH029595B2 (enExample) | 1990-03-02 |
Family
ID=6092476
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP396181A Granted JPS56104894A (en) | 1980-01-19 | 1981-01-16 | Manufacture of vinylphosphoric acid derivative |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4388252A (enExample) |
| EP (1) | EP0032663B1 (enExample) |
| JP (1) | JPS56104894A (enExample) |
| CA (1) | CA1158661A (enExample) |
| DE (2) | DE3001894A1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3110975A1 (de) * | 1981-03-20 | 1982-09-30 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von vinylphosphonsaeure |
| DE3110976A1 (de) * | 1981-03-20 | 1982-10-07 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von vinylphosphonsaeuredichlorid und 2-chlorethanphosphonsaeuredichlorid |
| DE3120438A1 (de) * | 1981-05-22 | 1982-12-23 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von vinylphonsaeurediestern |
| DE3120437A1 (de) * | 1981-05-22 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von vinylphosphonsaeure |
| DE3210419A1 (de) * | 1982-03-22 | 1983-09-22 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von derivaten der vinylphosphon- oder vinylpyrophosphonsaeure |
| DE3314569A1 (de) * | 1983-04-22 | 1984-10-25 | Cassella Ag, 6000 Frankfurt | Vernetzte hydrophile copolymerisate, ihre herstellung und verwendung |
| US4738870A (en) * | 1986-03-27 | 1988-04-19 | The Dow Chemical Company | Adherent photopolymerizable compositions |
| DE3622786A1 (de) * | 1986-07-07 | 1988-02-04 | Benckiser Knapsack Gmbh | Verfahren zur herstellung von vinyldiphosphonsaeure und ihren salzen |
| DE3724653A1 (de) * | 1987-07-25 | 1989-02-02 | Henkel Kgaa | Olefinische diphosphonsaeuren, verfahren zu ihrer herstellung und ihre verwendung als thresholder sowie komplexierend wirkende, olefinische diphosphonsaeuren enthaltende zusammensetzungen |
| EP0329595B1 (de) * | 1988-02-19 | 1996-05-08 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Alkenylphosphinsäurealkylestern |
| DE4014483A1 (de) * | 1990-05-07 | 1991-11-14 | Basf Ag | Verfahren zur herstellung von vinylphosphonsaeurederivaten |
| DE4303648A1 (de) * | 1993-02-09 | 1994-08-11 | Basf Ag | Verwendung von Aminovinylphosphonsäureestern als Lichtschutzmittel und Stabilisatoren für organisches Material |
| DE4342570C1 (de) * | 1993-12-14 | 1995-09-21 | Hoechst Ag | Verfahren zur kontinuierlichen Herstellung von Vinylphosphonsäuredialkylestern |
| DE4416018A1 (de) * | 1994-05-06 | 1995-11-09 | Hoechst Ag | Verfahren zur Herstellung von Vinylphophonsäuren |
| DE19501336A1 (de) * | 1995-01-18 | 1996-07-25 | Hoechst Ag | Verfahren zur Herstellung von Vinylphosphonsäuredimethylester aus 2-Acetoxyethanphosphonsäuredimethylester |
| WO1996024599A1 (en) * | 1995-02-10 | 1996-08-15 | Akzo Nobel N.V. | Synthesis of a hydrocarbylvinyl phosphonic acid hydrocarbyl ester |
| DE10054218A1 (de) | 2000-11-02 | 2002-05-08 | Basf Ag | Verfahren zur Herstellung von Alkenylphosphonsäure-Derivaten |
| US7057065B2 (en) * | 2003-03-19 | 2006-06-06 | Rhodia Inc. | Process for production of vinylphosphonic acids and silyl esters thereof |
| DE10350674A1 (de) | 2003-10-30 | 2005-06-02 | Basf Ag | Verfahren zur Herstellung eines Alkenylphosphonsäure-Derivats |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3062792A (en) * | 1960-03-01 | 1962-11-06 | Eastman Kodak Co | Polymers derived from tetraalkyl vinylidenediphosphonates |
| DE2127821C3 (de) * | 1971-06-04 | 1981-04-30 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Acyloxyalkanphosphonsäurediestern bzw. Acyloxyalkanphosphinsäureestern |
| DE2758580A1 (de) * | 1977-12-29 | 1979-07-05 | Hoechst Ag | Verfahren zur herstellung von phosphin- und phosphonsaeure-anhydriden |
-
1980
- 1980-01-19 DE DE19803001894 patent/DE3001894A1/de not_active Withdrawn
-
1981
- 1981-01-07 EP EP81100040A patent/EP0032663B1/de not_active Expired
- 1981-01-07 DE DE8181100040T patent/DE3160156D1/de not_active Expired
- 1981-01-12 US US06/224,316 patent/US4388252A/en not_active Expired - Lifetime
- 1981-01-16 CA CA000368657A patent/CA1158661A/en not_active Expired
- 1981-01-16 JP JP396181A patent/JPS56104894A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS56104894A (en) | 1981-08-20 |
| EP0032663A2 (de) | 1981-07-29 |
| US4388252A (en) | 1983-06-14 |
| DE3001894A1 (de) | 1981-07-23 |
| DE3160156D1 (en) | 1983-05-19 |
| EP0032663B1 (de) | 1983-04-13 |
| EP0032663A3 (en) | 1981-10-28 |
| CA1158661A (en) | 1983-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH029595B2 (enExample) | ||
| Z. Kiss et al. | An overview of the synthesis of phosphinates and phosphinic amides | |
| JP6788253B2 (ja) | アルケニルリン化合物の製造方法 | |
| JP2895155B2 (ja) | アルキル亜ホスホン酸ジエステル類および/またはジアルキル亜ホスフィン酸エステル類の製造方法 | |
| JPH0249317B2 (enExample) | ||
| CA1185262A (en) | Process for preparing vinylphosphonic acid | |
| US4548762A (en) | Process for the preparation of vinylphosphonic acid dichloride and 2-chloroethanephosphonic acid dichloride | |
| Keglevich et al. | Synthesis of phosphinic acid derivatives; traditional versus up-to-date synthetic procedures | |
| US4426336A (en) | Process for the preparation of vinylphosphonic acid derivatives and the use thereof | |
| CA2286824A1 (en) | Method for producing vinyl phosphonic acid compounds | |
| JPH0257557B2 (enExample) | ||
| US5811575A (en) | Process for preparing vinyl-phosphonic acids | |
| Bravo-Altamirano et al. | Palladium-Catalyzed Dehydrative Allylation of Hypophosphorous Acid with Allylic Alcohols. Preparation of Cinnamyl-H-Phosphinic Acid | |
| IE60912B1 (en) | Process for synthesis of aminomethylene phosphonoalkylphosphinates | |
| EP0038466B1 (de) | Verfahren zur Herstellung von Vinylphosphonsäurederivaten | |
| Aksnes et al. | Investigation of the reaction between dialkylphosphine oxides and carbontetrachloride | |
| SU584009A1 (ru) | Способ получени -метакрилоксиэтилдиалкилфосфонатов | |
| US4708824A (en) | Process for the preparation of chloro(phenyl)phospines | |
| Gazizov et al. | Synthesis of (4-hydroxy-3, 5-di-tert-butylphenyl)-chloromethanediphenylphosphine oxide and its reactions with aprotic nucleophilic reagents | |
| US4427602A (en) | Process for the preparation of vinylphosphonic acid dichloride and 2-chloroethanephosphonic acid dichloride | |
| JP2777985B2 (ja) | セレノアルケニルホスホン酸エステルおよびその製造方法 | |
| McClard et al. | SYNTHESIS OF AN UNREACTIVE YLID DESIGNED AS A‒C‒P‒C‒P DIPHOSPHATE ISOSTERE SYNTHON | |
| SU996421A1 (ru) | Способ получени дихлорангидридов непредельных фосфонистых кислот | |
| SU252332A1 (ru) | Способ получения оловоорганических производных | |
| Konovalova et al. | Perkov reaction in series of mixed bis (1, 1, 3-trihydroperfluoropropyl) alkyl phosphites |