JPH027298B2 - - Google Patents
Info
- Publication number
- JPH027298B2 JPH027298B2 JP56122518A JP12251881A JPH027298B2 JP H027298 B2 JPH027298 B2 JP H027298B2 JP 56122518 A JP56122518 A JP 56122518A JP 12251881 A JP12251881 A JP 12251881A JP H027298 B2 JPH027298 B2 JP H027298B2
- Authority
- JP
- Japan
- Prior art keywords
- tertiary
- reaction
- aromatic compound
- hydroxylated aromatic
- pyrocatechol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 239000003054 catalyst Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 9
- 150000001491 aromatic compounds Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 230000006208 butylation Effects 0.000 claims description 7
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical group CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 claims description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 4
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 8
- 230000008859 change Effects 0.000 description 8
- XESZUVZBAMCAEJ-UHFFFAOYSA-N 4-tert-butylcatechol Chemical compound CC(C)(C)C1=CC=C(O)C(O)=C1 XESZUVZBAMCAEJ-UHFFFAOYSA-N 0.000 description 6
- 150000002170 ethers Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 4
- 239000003456 ion exchange resin Substances 0.000 description 4
- 229920003303 ion-exchange polymer Polymers 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- BJEMXPVDXFSROA-UHFFFAOYSA-N 3-butylbenzene-1,2-diol Chemical compound CCCCC1=CC=CC(O)=C1O BJEMXPVDXFSROA-UHFFFAOYSA-N 0.000 description 2
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000010555 transalkylation reaction Methods 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- NUMQCACRALPSHD-UHFFFAOYSA-N tert-butyl ethyl ether Chemical compound CCOC(C)(C)C NUMQCACRALPSHD-UHFFFAOYSA-N 0.000 description 1
- 238000006276 transfer reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/16—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by condensation involving hydroxy groups of phenols or alcohols or the ether or mineral ester group derived therefrom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT24025/80A IT1132537B (it) | 1980-08-06 | 1980-08-06 | Procedimento per la terbutilazione di composti idrossiaromatici |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5767529A JPS5767529A (en) | 1982-04-24 |
| JPH027298B2 true JPH027298B2 (enExample) | 1990-02-16 |
Family
ID=11211545
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56122518A Granted JPS5767529A (en) | 1980-08-06 | 1981-08-06 | Tertiary butyration of hydroxylated aromatic compound |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4370506A (enExample) |
| JP (1) | JPS5767529A (enExample) |
| BE (1) | BE889864A (enExample) |
| DE (1) | DE3130428C2 (enExample) |
| DK (1) | DK332481A (enExample) |
| FR (1) | FR2488250B1 (enExample) |
| GB (1) | GB2081710B (enExample) |
| IT (1) | IT1132537B (enExample) |
| NL (1) | NL8103720A (enExample) |
| NO (1) | NO154574C (enExample) |
| SE (1) | SE8104709L (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR9202890A (pt) * | 1992-07-22 | 1994-02-01 | Rhodia | Aperfeicoamento em processo para obtencao de terciobutilfenois |
| CN100357241C (zh) * | 2002-09-12 | 2007-12-26 | 株式会社可乐丽 | 制备4-烷基苯酚的方法 |
| JP4509506B2 (ja) * | 2002-12-09 | 2010-07-21 | 株式会社クラレ | 4−アルキルフェノール類の製造方法 |
| FR3010717B1 (fr) * | 2013-09-19 | 2015-11-06 | Rhodia Operations | Composition empechant la polymerisation de monomeres a insaturation ethylenique et son elimination avant polymerisation |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2291804A (en) * | 1939-12-08 | 1942-08-04 | Burton T Bush Inc | Alkylation of phenols |
| US2448942A (en) * | 1944-05-09 | 1948-09-07 | Shell Dev | Alkylation of phenolic compounds |
| US2802884A (en) * | 1952-05-31 | 1957-08-13 | Koppers Co Inc | Alkylation-dealkylation catalysts |
| DE2021526A1 (de) * | 1970-05-02 | 1971-12-02 | Union Rheinische Braunkohlen | Verfahren zur Herstellung von Alkylphenolgemischen |
| DE2740590A1 (de) * | 1977-09-09 | 1979-03-29 | Basf Ag | Verfahren zur herstellung von tert.- butylderivaten aromatischer hydroxyverbindungen |
-
1980
- 1980-08-06 IT IT24025/80A patent/IT1132537B/it active
-
1981
- 1981-07-23 GB GB8122739A patent/GB2081710B/en not_active Expired
- 1981-07-24 DK DK332481A patent/DK332481A/da not_active Application Discontinuation
- 1981-07-24 US US06/286,612 patent/US4370506A/en not_active Expired - Lifetime
- 1981-07-31 DE DE3130428A patent/DE3130428C2/de not_active Expired
- 1981-08-04 NO NO812644A patent/NO154574C/no unknown
- 1981-08-05 BE BE0/205584A patent/BE889864A/fr not_active IP Right Cessation
- 1981-08-05 FR FR8115193A patent/FR2488250B1/fr not_active Expired
- 1981-08-05 SE SE8104709A patent/SE8104709L/xx not_active Application Discontinuation
- 1981-08-06 JP JP56122518A patent/JPS5767529A/ja active Granted
- 1981-08-06 NL NL8103720A patent/NL8103720A/nl not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2488250B1 (fr) | 1985-06-14 |
| FR2488250A1 (fr) | 1982-02-12 |
| JPS5767529A (en) | 1982-04-24 |
| NL8103720A (nl) | 1982-03-01 |
| US4370506A (en) | 1983-01-25 |
| DE3130428A1 (de) | 1982-03-18 |
| GB2081710B (en) | 1984-01-25 |
| NO154574C (no) | 1986-10-29 |
| GB2081710A (en) | 1982-02-24 |
| IT8024025A0 (it) | 1980-08-06 |
| IT1132537B (it) | 1986-07-02 |
| BE889864A (fr) | 1982-02-05 |
| DK332481A (da) | 1982-02-07 |
| NO812644L (no) | 1982-02-08 |
| SE8104709L (sv) | 1982-02-07 |
| DE3130428C2 (de) | 1983-05-11 |
| NO154574B (no) | 1986-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2448942A (en) | Alkylation of phenolic compounds | |
| US4918244A (en) | Preparation of MTBE from TBA and methanol | |
| US2470902A (en) | Alkylation of phenols | |
| US2051473A (en) | Production of alkylated phenolic bodies | |
| US4754077A (en) | Antioxidant synthesis | |
| US3274260A (en) | Method for producing monoalkyl ethers of dihydric phenols | |
| US4153810A (en) | Process for the preparation of alkyl ethers | |
| US2560666A (en) | Process for producing 4-tertiary-butyl-3-methylphenol | |
| JPH027298B2 (enExample) | ||
| Karuppannasamy et al. | Reactions of phenols and alcohols over thoria: Mechanism of ether formation | |
| US4324920A (en) | Process for the preparation of ortho-(hydrocarbylthio)-phenols | |
| KR101674220B1 (ko) | 알릴 알코올의 전위 방법 | |
| JP2634889B2 (ja) | フェノール化合物のアラルキル化法 | |
| US5430183A (en) | Para-hydroxyalkylation of hydroxylated aromatic compounds | |
| US6049015A (en) | Method for C-alkylating hydroxylated aromatic compounds | |
| GB2136419A (en) | Preparation of meta-isopropylphenol | |
| DE60018077T2 (de) | Perfluorosulfonylmethide verbindungen; deren verwendung bei der herstellung von c-c bindungen | |
| US2881219A (en) | Alkylation of arylols | |
| US4307253A (en) | Process for the preparation of alkyl aryl ethers | |
| US2781404A (en) | Synthesis of ortho-alkyl-p-alkoxyphenols | |
| US3267154A (en) | Mixed salts of aluminum as ortho-alkylation catalysts | |
| EP0116712B1 (en) | Synthesis of hindered phenols | |
| US4236032A (en) | Preparation of 6-t-butyl alkyl-substituted phenols | |
| US2887515A (en) | Preparation of tertiary butyl-x- | |
| US2158518A (en) | Production of aromatic aldehydes |