JPH0224253B2 - - Google Patents
Info
- Publication number
- JPH0224253B2 JPH0224253B2 JP62230894A JP23089487A JPH0224253B2 JP H0224253 B2 JPH0224253 B2 JP H0224253B2 JP 62230894 A JP62230894 A JP 62230894A JP 23089487 A JP23089487 A JP 23089487A JP H0224253 B2 JPH0224253 B2 JP H0224253B2
- Authority
- JP
- Japan
- Prior art keywords
- compound
- aromatic
- compounds
- potassium
- trifluoroacetate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Perfluoroalkyl aromatic compounds Chemical class 0.000 claims abstract description 57
- 229910021595 Copper(I) iodide Inorganic materials 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 125000003118 aryl group Chemical group 0.000 claims abstract description 11
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims abstract description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000000010 aprotic solvent Substances 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 claims abstract description 6
- 239000011591 potassium Substances 0.000 claims abstract description 6
- 229910052700 potassium Inorganic materials 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 19
- CUNPJFGIODEJLQ-UHFFFAOYSA-M potassium;2,2,2-trifluoroacetate Chemical compound [K+].[O-]C(=O)C(F)(F)F CUNPJFGIODEJLQ-UHFFFAOYSA-M 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical group CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 6
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000005207 tetraalkylammonium group Chemical group 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 150000004694 iodide salts Chemical class 0.000 claims description 2
- 125000002346 iodo group Chemical group I* 0.000 claims description 2
- XOLAGCSLKROFTP-UHFFFAOYSA-N 5-iodonaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1I XOLAGCSLKROFTP-UHFFFAOYSA-N 0.000 claims 2
- SZFXXNVLSUTKJF-UHFFFAOYSA-N 5-bromonaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1Br SZFXXNVLSUTKJF-UHFFFAOYSA-N 0.000 claims 1
- FOHZMCAFCHLKCT-UHFFFAOYSA-N Ic1cccc2c(cccc12)C#N Chemical compound Ic1cccc2c(cccc12)C#N FOHZMCAFCHLKCT-UHFFFAOYSA-N 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 abstract description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 57
- UYCAUPASBSROMS-AWQJXPNKSA-M sodium;2,2,2-trifluoroacetate Chemical compound [Na+].[O-][13C](=O)[13C](F)(F)F UYCAUPASBSROMS-AWQJXPNKSA-M 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 230000000052 comparative effect Effects 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- MLTJLVQKLKQHPC-UHFFFAOYSA-N 5-bromo-6-methoxynaphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=C(Br)C(OC)=CC=C21 MLTJLVQKLKQHPC-UHFFFAOYSA-N 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 238000004817 gas chromatography Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- LROATHSBUUYETB-UHFFFAOYSA-M tetramethylazanium;2,2,2-trifluoroacetate Chemical compound C[N+](C)(C)C.[O-]C(=O)C(F)(F)F LROATHSBUUYETB-UHFFFAOYSA-M 0.000 description 5
- AODFBEAUIHMJNF-UHFFFAOYSA-N 6-methoxy-5-(1,1,2,2,2-pentafluoroethyl)naphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=C(C(F)(F)C(F)(F)F)C(OC)=CC=C21 AODFBEAUIHMJNF-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- JDUYPUMQALQRCN-UHFFFAOYSA-N 4-bromophenyl phenyl ether Chemical compound C1=CC(Br)=CC=C1OC1=CC=CC=C1 JDUYPUMQALQRCN-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical class OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- DDFYFBUWEBINLX-UHFFFAOYSA-M tetramethylammonium bromide Chemical compound [Br-].C[N+](C)(C)C DDFYFBUWEBINLX-UHFFFAOYSA-M 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical group C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000000039 congener Substances 0.000 description 2
- YJMNOKOLADGBKA-UHFFFAOYSA-N cyanonaphthalene Natural products C1=CC=C2C(C#N)=CC=CC2=C1 YJMNOKOLADGBKA-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229960002449 glycine Drugs 0.000 description 2
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- AJSVNRJVTNNXCZ-UHFFFAOYSA-N methyl 5-bromo-6-methoxynaphthalene-1-carboxylate Chemical compound COC1=CC=C2C(C(=O)OC)=CC=CC2=C1Br AJSVNRJVTNNXCZ-UHFFFAOYSA-N 0.000 description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 2
- AHGFDQXBCIASJK-UHFFFAOYSA-M potassium;2,2,3,3,3-pentafluoropropanoate Chemical compound [K+].[O-]C(=O)C(F)(F)C(F)(F)F AHGFDQXBCIASJK-UHFFFAOYSA-M 0.000 description 2
- 229940071089 sarcosinate Drugs 0.000 description 2
- 239000000565 sealant Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 238000006692 trifluoromethylation reaction Methods 0.000 description 2
- GLFDLEXFOHUASB-UHFFFAOYSA-N trimethyl(tetradecyl)azanium Chemical group CCCCCCCCCCCCCC[N+](C)(C)C GLFDLEXFOHUASB-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- SYSZENVIJHPFNL-UHFFFAOYSA-N (alpha-D-mannosyl)7-beta-D-mannosyl-diacetylchitobiosyl-L-asparagine, isoform B (protein) Chemical compound COC1=CC=C(I)C=C1 SYSZENVIJHPFNL-UHFFFAOYSA-N 0.000 description 1
- KEIFWROAQVVDBN-UHFFFAOYSA-N 1,2-dihydronaphthalene Chemical compound C1=CC=C2C=CCCC2=C1 KEIFWROAQVVDBN-UHFFFAOYSA-N 0.000 description 1
- GWQSENYKCGJTRI-UHFFFAOYSA-N 1-chloro-4-iodobenzene Chemical compound ClC1=CC=C(I)C=C1 GWQSENYKCGJTRI-UHFFFAOYSA-N 0.000 description 1
- VLCPISYURGTGLP-UHFFFAOYSA-N 1-iodo-3-methylbenzene Chemical compound CC1=CC=CC(I)=C1 VLCPISYURGTGLP-UHFFFAOYSA-N 0.000 description 1
- CBYAZOKPJYBCHE-UHFFFAOYSA-N 1-iodo-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(I)=C1 CBYAZOKPJYBCHE-UHFFFAOYSA-N 0.000 description 1
- NHPPIJMARIVBGU-UHFFFAOYSA-N 1-iodonaphthalene Chemical compound C1=CC=C2C(I)=CC=CC2=C1 NHPPIJMARIVBGU-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical class C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical class C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 1
- YPJUNDFVDDCYIH-UHFFFAOYSA-M 2,2,3,3,4,4,4-heptafluorobutanoate Chemical compound [O-]C(=O)C(F)(F)C(F)(F)C(F)(F)F YPJUNDFVDDCYIH-UHFFFAOYSA-M 0.000 description 1
- CXZGQIAOTKWCDB-UHFFFAOYSA-M 2,2,3,3,4,4,5,5,5-nonafluoropentanoate Chemical compound [O-]C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F CXZGQIAOTKWCDB-UHFFFAOYSA-M 0.000 description 1
- SNGREZUHAYWORS-UHFFFAOYSA-M 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate Chemical compound [O-]C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F SNGREZUHAYWORS-UHFFFAOYSA-M 0.000 description 1
- RREGHWCOJVMOQL-UHFFFAOYSA-N 2-(trifluoromethyl)naphthalene-1-carbonitrile Chemical compound C1=CC=CC2=C(C#N)C(C(F)(F)F)=CC=C21 RREGHWCOJVMOQL-UHFFFAOYSA-N 0.000 description 1
- CCZWSTFVHJPCEM-UHFFFAOYSA-N 2-iodopyridine Chemical compound IC1=CC=CC=N1 CCZWSTFVHJPCEM-UHFFFAOYSA-N 0.000 description 1
- ROIMNSWDOJCBFR-UHFFFAOYSA-N 2-iodothiophene Chemical compound IC1=CC=CS1 ROIMNSWDOJCBFR-UHFFFAOYSA-N 0.000 description 1
- SOMQJWVVMLVCLY-UHFFFAOYSA-N 3,4-dihydronaphthalene-1-carbonitrile Chemical class C1=CC=C2C(C#N)=CCCC2=C1 SOMQJWVVMLVCLY-UHFFFAOYSA-N 0.000 description 1
- FFCSRWGYGMRBGD-UHFFFAOYSA-N 3-iodoaniline Chemical compound NC1=CC=CC(I)=C1 FFCSRWGYGMRBGD-UHFFFAOYSA-N 0.000 description 1
- NDQXBRCPYKGVED-UHFFFAOYSA-N 3-iodoquinoline Chemical compound C1=CC=CC2=CC(I)=CN=C21 NDQXBRCPYKGVED-UHFFFAOYSA-N 0.000 description 1
- LRPCCFSUFGFVBO-UHFFFAOYSA-N 4-iodoisoquinoline Chemical compound C1=CC=C2C(I)=CN=CC2=C1 LRPCCFSUFGFVBO-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- DHMJKHNLPGQGDX-UHFFFAOYSA-N 5-iodo-6-methoxynaphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=C(I)C(OC)=CC=C21 DHMJKHNLPGQGDX-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- XRRIYQSWTOYYOA-UHFFFAOYSA-N C1=CC=C2C(C(=O)OC(F)(F)F)=CC=CC2=C1 Chemical compound C1=CC=C2C(C(=O)OC(F)(F)F)=CC=CC2=C1 XRRIYQSWTOYYOA-UHFFFAOYSA-N 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical class [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005577 anthracene group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- RLGQACBPNDBWTB-UHFFFAOYSA-N cetyltrimethylammonium ion Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)C RLGQACBPNDBWTB-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- RHWIHRLTIWWWCD-UHFFFAOYSA-N methyl 6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylate Chemical compound COC1=CC=C2C(C(=O)OC)=CC=CC2=C1C(F)(F)F RHWIHRLTIWWWCD-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- CYFLXLSBHQBMFT-UHFFFAOYSA-N sulfamoxole Chemical group O1C(C)=C(C)N=C1NS(=O)(=O)C1=CC=C(N)C=C1 CYFLXLSBHQBMFT-UHFFFAOYSA-N 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- WTEXQPWIUJQYJQ-UHFFFAOYSA-M tetrabutylazanium;2,2,2-trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC WTEXQPWIUJQYJQ-UHFFFAOYSA-M 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/54—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and etherified hydroxy groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/808,204 US4822904A (en) | 1985-12-12 | 1985-12-12 | Perfluoroalkylation process |
| EP87307569A EP0307519B1 (en) | 1985-12-12 | 1987-08-26 | Perfluoroalkylation process |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6475434A JPS6475434A (en) | 1989-03-22 |
| JPH0224253B2 true JPH0224253B2 (enExample) | 1990-05-29 |
Family
ID=26110803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP62230894A Granted JPS6475434A (en) | 1985-12-12 | 1987-09-14 | Perfluoroalkylation |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4822904A (enExample) |
| EP (1) | EP0307519B1 (enExample) |
| JP (1) | JPS6475434A (enExample) |
| AT (1) | ATE62651T1 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5484011A (en) * | 1986-12-19 | 1996-01-16 | Applied Materials, Inc. | Method of heating and cooling a wafer during semiconductor processing |
| FR2693456B1 (fr) * | 1992-07-10 | 1994-08-26 | Rhone Poulenc Chimie | Réactif de perfluoroalcoylation et procédé utilisant ce réactif. |
| CZ282973B6 (cs) * | 1993-03-09 | 1997-11-12 | Elf Atochem S.A. | Způsob výroby halogenovaných esterů karboxylových nebo dikarboxylových kyselin |
| DE4318069C1 (de) * | 1993-06-01 | 1994-03-31 | Cassella Ag | Verfahren zur Herstellung von 5-Brom-6-methoxy-1-naphthoesäuremethylester |
| US5475165A (en) * | 1995-01-18 | 1995-12-12 | E. I. Du Pont De Nemours And Company | Trifluoromethylation process |
| FR2730992B1 (fr) * | 1995-02-24 | 1997-04-04 | Rhone Poulenc Chimie | Procede d'obtention de composes perhalogenoalkyles et/ou acyles et agents de perhalogenoalkylation et/ou acylation susceptibles d'etre mis en oeuvre dans ce procede |
| FR2738814B1 (fr) * | 1995-09-15 | 1997-11-14 | Rhone Poulenc Chimie | Reactif, compose et procede pour la perfluoroalc(o)ylation de nucleophile, ainsi que les derives obtenus |
| EP0810993B1 (fr) * | 1995-02-24 | 2001-11-28 | Rhodia Chimie | Reactif, compose et procede pour la perfluoroalcylation de nucleophile, ainsi que les derives obtenus |
| IL117534A0 (en) * | 1995-03-24 | 1996-07-23 | Rhone Poulenc Agrochimie | Reagent and process which are useful for grafting a substituted difluoromethyl group onto a compound containing at least one electrophilic function |
| FR2732010B1 (fr) * | 1995-03-24 | 1997-06-13 | Rhone Poulenc Chimie | Reactif et procede utiles pour greffer un groupement difluoromethyle substitue sur un compose comportant au moins une fonction electrophile |
| FR2743065B1 (fr) * | 1995-12-29 | 1998-03-20 | Rhone Poulenc Chimie | Reactif et procede utiles pour greffer un groupement difluoromethyle substitue sur un compose comportant au moins une fonction electrophile |
| US6464895B2 (en) | 1995-03-24 | 2002-10-15 | Rhodia Chimie | Reagent and process which are useful for grafting a substituted difluoromethyl group onto a compound containing at least one electrophilic function |
| DE19603329A1 (de) * | 1996-01-31 | 1997-08-07 | Bayer Ag | Verfahren zur Herstellung von aromatischen Methoxycarbonsäuremethylestern |
| US6215021B1 (en) | 1998-06-17 | 2001-04-10 | Idaho Research Foundation, Inc. | Trifluoromethylating reagents and synthesizing processes |
| KR101132841B1 (ko) | 2011-03-07 | 2012-04-02 | 김영재 | 봉합사 |
| KR101185583B1 (ko) | 2011-12-27 | 2012-09-24 | 김영재 | 매듭짓는 작업이 필요 없는 봉합사 및 이를 포함하는 키트 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1156912A (en) * | 1965-05-21 | 1969-07-02 | Nat Res Dev | Araliphatic Compounds Containing Fluorine |
| CA1176269A (en) * | 1981-03-02 | 1984-10-16 | Kazimir Sestanj | N-naphthoylglycine derivatives |
| US4604406A (en) * | 1984-11-16 | 1986-08-05 | Ayerst, Mckenna & Harrison, Inc. | N-[6-methoxy-5-(perfluoroalkyl)-1-naphtholyl]-N-methylglycines and their thionaphthoyl analogs |
| US4590010A (en) * | 1985-04-18 | 1986-05-20 | Ethyl Corporation | Substituted naphthoic acid process |
-
1985
- 1985-12-12 US US06/808,204 patent/US4822904A/en not_active Expired - Fee Related
-
1987
- 1987-08-26 EP EP87307569A patent/EP0307519B1/en not_active Expired
- 1987-08-26 AT AT87307569T patent/ATE62651T1/de not_active IP Right Cessation
- 1987-09-14 JP JP62230894A patent/JPS6475434A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ATE62651T1 (de) | 1991-05-15 |
| EP0307519A1 (en) | 1989-03-22 |
| JPS6475434A (en) | 1989-03-22 |
| US4822904A (en) | 1989-04-18 |
| EP0307519B1 (en) | 1991-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0224253B2 (enExample) | ||
| CS209933B2 (en) | Method of making the 4-fluor-3-phenoxytoluen | |
| US4808748A (en) | Trifluoromethylation process | |
| EP0199646B1 (en) | Process for preparing 6-alkoxy-5-trifluoromethyl-1-naphtoic acids and novel 1-cyano-naphtalene intermediates | |
| US4814480A (en) | Trifluoromethylation process | |
| US6127583A (en) | Process for preparing acetylene derivative from a ketone compound | |
| US4814482A (en) | Trifluoromethylation process | |
| US4699993A (en) | Perfluoroalkylnaphthalene compounds | |
| US4889951A (en) | Perfluoroalkylation process | |
| JPH08277240A (ja) | α−クロルアルキルアリールケトンの製法 | |
| US4194054A (en) | Preparation of substituted fluorobenzenes | |
| CA1279873C (en) | Perfluoroalkylation process | |
| US4500471A (en) | Preparation of trifluoromethyl-benzoyl halides | |
| JPH0770037A (ja) | シアノアシルシクロプロパン化合物の製造方法とそれに用いる2−シアノアシル−4−ブタノリド化合物 | |
| CA1171430A (en) | Preparation of phenylacetonitriles carrying basic substituents | |
| CA1274838A (en) | Trifluoromethylation process | |
| JP3035672B2 (ja) | 含フッ素芳香族エステル | |
| JP2744669B2 (ja) | ハロゲノベンゼン誘導体 | |
| US5068300A (en) | Bifunctional stilbene compounds containing at least one z-configurated stilbene group, process for their preparation and their use for the preparation of polymers | |
| RU2152926C1 (ru) | Способ получения галогенметилбензоилцианидов | |
| CA1286320C (en) | Perfluoroalkylnaphthalene compounds | |
| JP2004262863A (ja) | オルトベンジジン化合物の製造法 | |
| EP0007154A1 (en) | Process for the preparation of cyclopropane derivatives, intermediates in the synthesis of pyrethroid insecticides | |
| US4502995A (en) | Nucleophilic substitution process | |
| US2563376A (en) | Substituted amino aryl acetonitriles |