JPH0222741B2 - - Google Patents
Info
- Publication number
- JPH0222741B2 JPH0222741B2 JP59188982A JP18898284A JPH0222741B2 JP H0222741 B2 JPH0222741 B2 JP H0222741B2 JP 59188982 A JP59188982 A JP 59188982A JP 18898284 A JP18898284 A JP 18898284A JP H0222741 B2 JPH0222741 B2 JP H0222741B2
- Authority
- JP
- Japan
- Prior art keywords
- biphenyl
- methyl
- mol
- reaction mixture
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 [1,1'-biphenyl]-3-ylmethyl compounds Chemical class 0.000 claims description 34
- 125000001153 fluoro group Chemical group F* 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000001475 halogen functional group Chemical group 0.000 claims description 3
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- 239000000203 mixture Substances 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 150000002148 esters Chemical class 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 230000000749 insecticidal effect Effects 0.000 description 14
- 230000000895 acaricidal effect Effects 0.000 description 13
- 238000000034 method Methods 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 235000008504 concentrate Nutrition 0.000 description 9
- 241000238631 Hexapoda Species 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000004927 clay Substances 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- 239000002917 insecticide Substances 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 238000002329 infrared spectrum Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002728 pyrethroid Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- RTFPTPXBTIUISM-UHFFFAOYSA-N 1-(bromomethyl)-3-phenylbenzene Chemical class BrCC1=CC=CC(C=2C=CC=CC=2)=C1 RTFPTPXBTIUISM-UHFFFAOYSA-N 0.000 description 4
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 4
- 241000238876 Acari Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 125000003158 alcohol group Chemical group 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- NPDIDUXTRAITDE-UHFFFAOYSA-N 1-methyl-3-phenylbenzene Chemical group CC1=CC=CC(C=2C=CC=CC=2)=C1 NPDIDUXTRAITDE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 3
- CEHQWCFLTWFAOL-UHFFFAOYSA-N [3-(2-methylphenyl)phenyl]methanol Chemical compound CC1=CC=CC=C1C1=CC=CC(CO)=C1 CEHQWCFLTWFAOL-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 3
- 229940070846 pyrethrins Drugs 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000012085 test solution Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- BGTLHJPGBIVQLJ-UHFFFAOYSA-N (2-methyl-3-phenylphenyl)methanol Chemical compound CC1=C(CO)C=CC=C1C1=CC=CC=C1 BGTLHJPGBIVQLJ-UHFFFAOYSA-N 0.000 description 2
- VODBTCPLHMEMAS-UHFFFAOYSA-N (3-amino-2-methylphenyl)methanol;hydrochloride Chemical group Cl.CC1=C(N)C=CC=C1CO VODBTCPLHMEMAS-UHFFFAOYSA-N 0.000 description 2
- WVKFJUYXMBJNKD-UHFFFAOYSA-N (3-iodo-2-methylphenyl)methanol Chemical compound CC1=C(I)C=CC=C1CO WVKFJUYXMBJNKD-UHFFFAOYSA-N 0.000 description 2
- VFIQBQAZDAFZKR-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-methylcyclohexan-1-ol Chemical compound C1C(C)CCCC1(O)C1=CC=CC(Cl)=C1 VFIQBQAZDAFZKR-UHFFFAOYSA-N 0.000 description 2
- MBTFNFODAQPJNE-UHFFFAOYSA-N 1-(bromomethyl)-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(CBr)C=CC=2)=C1 MBTFNFODAQPJNE-UHFFFAOYSA-N 0.000 description 2
- UVXXXPUFDFKYEE-UHFFFAOYSA-N 1-chloro-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(Cl)C=CC=2)=C1 UVXXXPUFDFKYEE-UHFFFAOYSA-N 0.000 description 2
- BUIPKDFUVKLJTF-UHFFFAOYSA-N 1-fluoro-2-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C(=CC=CC=2)F)=C1 BUIPKDFUVKLJTF-UHFFFAOYSA-N 0.000 description 2
- WEAUVDQUPGJTSZ-UHFFFAOYSA-N 2-(bromomethyl)-1,3-difluoro-4-phenylbenzene Chemical compound FC1=C(CBr)C(F)=CC=C1C1=CC=CC=C1 WEAUVDQUPGJTSZ-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical class CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- UJBOOUHRTQVGRU-UHFFFAOYSA-N 3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1 UJBOOUHRTQVGRU-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 241000253994 Acyrthosiphon pisum Species 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 241000532642 Conotrachelus nenuphar Species 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 241001521235 Spodoptera eridania Species 0.000 description 2
- 241000256251 Spodoptera frugiperda Species 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 239000000642 acaricide Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- MOMORSVRSWLPKH-UHFFFAOYSA-N ethyl 6-(2-fluorophenyl)-2-methyl-4-oxocyclohex-2-ene-1-carboxylate Chemical compound C1C(=O)C=C(C)C(C(=O)OCC)C1C1=CC=CC=C1F MOMORSVRSWLPKH-UHFFFAOYSA-N 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 235000014666 liquid concentrate Nutrition 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N methyl bromide Substances BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- LLMLSUSAKZVFOA-UJURSFKZSA-N (1S,3R)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(O)=O LLMLSUSAKZVFOA-UJURSFKZSA-N 0.000 description 1
- CHLAOFANYRDCPD-UJURSFKZSA-N (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(Cl)=O CHLAOFANYRDCPD-UJURSFKZSA-N 0.000 description 1
- WNUWIGVXOYQIHQ-UHFFFAOYSA-N (2,6-difluoro-3-phenylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=C(F)C=CC(C=2C=CC=CC=2)=C1F WNUWIGVXOYQIHQ-UHFFFAOYSA-N 0.000 description 1
- XINQFOMFQFGGCQ-UHFFFAOYSA-L (2-dodecoxy-2-oxoethyl)-[6-[(2-dodecoxy-2-oxoethyl)-dimethylazaniumyl]hexyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCCCOC(=O)C[N+](C)(C)CCCCCC[N+](C)(C)CC(=O)OCCCCCCCCCCCC XINQFOMFQFGGCQ-UHFFFAOYSA-L 0.000 description 1
- QJANIQCEDPJNLO-UHFFFAOYSA-N (2-methyl-3-nitrophenyl)methanol Chemical compound CC1=C(CO)C=CC=C1[N+]([O-])=O QJANIQCEDPJNLO-UHFFFAOYSA-N 0.000 description 1
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- JHVWXYIBBBNXBL-UHFFFAOYSA-N 1,3-dibromo-2-(bromomethyl)-4-phenylbenzene Chemical compound BrCC1=C(Br)C=CC(C=2C=CC=CC=2)=C1Br JHVWXYIBBBNXBL-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- GUXRLULKFQOZJU-UHFFFAOYSA-N 1-(bromomethyl)-3-(2-fluorophenyl)benzene Chemical compound FC1=CC=CC=C1C1=CC=CC(CBr)=C1 GUXRLULKFQOZJU-UHFFFAOYSA-N 0.000 description 1
- IJYJYBHESXAIDP-UHFFFAOYSA-N 1-(bromomethyl)-3-(3-chlorophenyl)benzene Chemical compound ClC1=CC=CC(C=2C=C(CBr)C=CC=2)=C1 IJYJYBHESXAIDP-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- JRGGUPZKKTVKOV-UHFFFAOYSA-N 1-bromo-3-chlorobenzene Chemical compound ClC1=CC=CC(Br)=C1 JRGGUPZKKTVKOV-UHFFFAOYSA-N 0.000 description 1
- QHDHNVFIKWGRJR-UHFFFAOYSA-N 1-cyclohexenol Chemical compound OC1=CCCCC1 QHDHNVFIKWGRJR-UHFFFAOYSA-N 0.000 description 1
- OBWNDFMWFPAURN-UHFFFAOYSA-N 1-ethyl-2-methyl-3-phenylbenzene Chemical compound CCC1=CC=CC(C=2C=CC=CC=2)=C1C OBWNDFMWFPAURN-UHFFFAOYSA-N 0.000 description 1
- VEQMUQZKBLIXLT-UHFFFAOYSA-N 2,3-dimethylcyclopropane-1-carboxylic acid Chemical class CC1C(C)C1C(O)=O VEQMUQZKBLIXLT-UHFFFAOYSA-N 0.000 description 1
- VAKQOVUDENJBNU-UHFFFAOYSA-N 2,4-dibromo-1-[3-(bromomethyl)phenyl]benzene Chemical compound BrCC1=CC=CC(C=2C(=CC(Br)=CC=2)Br)=C1 VAKQOVUDENJBNU-UHFFFAOYSA-N 0.000 description 1
- XVNJBDKWBSRNOE-UHFFFAOYSA-N 2-(3-bromophenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C=C(Br)C=CC=2)=N1 XVNJBDKWBSRNOE-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- GXUQMKBQDGPMKZ-UHFFFAOYSA-N 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GXUQMKBQDGPMKZ-UHFFFAOYSA-N 0.000 description 1
- JUEZYTFQWZACEL-UHFFFAOYSA-N 2-nitrosoacetamide Chemical compound NC(=O)CN=O JUEZYTFQWZACEL-UHFFFAOYSA-N 0.000 description 1
- LLMLSUSAKZVFOA-UHFFFAOYSA-N 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(O)=O LLMLSUSAKZVFOA-UHFFFAOYSA-N 0.000 description 1
- IAZJDWZUCUHVPQ-UHFFFAOYSA-N 3-(2-methylphenyl)benzoic acid Chemical compound CC1=CC=CC=C1C1=CC=CC(C(O)=O)=C1 IAZJDWZUCUHVPQ-UHFFFAOYSA-N 0.000 description 1
- VXUIDVTXKZPLSS-UHFFFAOYSA-N 4,4-dimethyl-2-[3-(2-methylphenyl)phenyl]-5h-1,3-oxazole Chemical compound CC1=CC=CC=C1C1=CC=CC(C=2OCC(C)(C)N=2)=C1 VXUIDVTXKZPLSS-UHFFFAOYSA-N 0.000 description 1
- HFLMFOSJYVLCQL-UHFFFAOYSA-N 5-(2-fluorophenyl)-3-methylcyclohex-2-en-1-one Chemical compound C1C(C)=CC(=O)CC1C1=CC=CC=C1F HFLMFOSJYVLCQL-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 241000532667 Conotrachelus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241001301805 Epilachna Species 0.000 description 1
- 241000462639 Epilachna varivestis Species 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 241001454294 Tetranychus Species 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- NUWHWZHHXMVOMT-UHFFFAOYSA-N [3-(2-methylphenyl)phenyl]methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1=CC=CC=C1C1=CC=CC(COC(=O)C2C(C2C=C(Cl)Cl)(C)C)=C1 NUWHWZHHXMVOMT-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- XTNRHLDLGNQMCW-UHFFFAOYSA-N acetic acid;1,1'-biphenyl Chemical compound CC(O)=O.C1=CC=CC=C1C1=CC=CC=C1 XTNRHLDLGNQMCW-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003124 biologic agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- QJOOIMSFFIUFKX-UHFFFAOYSA-N methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)C1C(C=C(Cl)Cl)C1(C)C QJOOIMSFFIUFKX-UHFFFAOYSA-N 0.000 description 1
- NPXOIGSBRLCOSD-UHFFFAOYSA-N methyl 3-iodobenzoate Chemical compound COC(=O)C1=CC=CC(I)=C1 NPXOIGSBRLCOSD-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003090 pesticide formulation Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical class Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 235000001508 sulfur Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- HTSABYAWKQAHBT-UHFFFAOYSA-N trans 3-methylcyclohexanol Natural products CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/966,405 US4214004A (en) | 1978-12-04 | 1978-12-04 | Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds |
| US966405 | 1997-11-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6094927A JPS6094927A (ja) | 1985-05-28 |
| JPH0222741B2 true JPH0222741B2 (OSRAM) | 1990-05-21 |
Family
ID=25511348
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP55500106A Expired JPS6128653B2 (OSRAM) | 1978-12-04 | 1979-11-09 | |
| JP59188982A Granted JPS6094927A (ja) | 1978-12-04 | 1984-09-11 | 置換〔1,1′−ビフエニル〕−3−イルメチル化合物 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP55500106A Expired JPS6128653B2 (OSRAM) | 1978-12-04 | 1979-11-09 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4214004A (OSRAM) |
| EP (2) | EP0020685B1 (OSRAM) |
| JP (2) | JPS6128653B2 (OSRAM) |
| AR (1) | AR228245A1 (OSRAM) |
| AU (1) | AU526973B2 (OSRAM) |
| BR (1) | BR7908936A (OSRAM) |
| CA (1) | CA1140574A (OSRAM) |
| DD (2) | DD147665A5 (OSRAM) |
| DK (1) | DK161141C (OSRAM) |
| EG (1) | EG13820A (OSRAM) |
| ES (1) | ES486547A1 (OSRAM) |
| GR (1) | GR74124B (OSRAM) |
| GT (1) | GT197960870A (OSRAM) |
| HU (2) | HU189627B (OSRAM) |
| IE (1) | IE49208B1 (OSRAM) |
| IL (1) | IL58744A (OSRAM) |
| MX (2) | MX5998E (OSRAM) |
| TR (1) | TR20753A (OSRAM) |
| WO (1) | WO1980001163A1 (OSRAM) |
| ZA (1) | ZA796583B (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
| US4668792A (en) * | 1978-12-04 | 1987-05-26 | Fmc Corporation | Intermediates to insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4329518A (en) * | 1979-09-18 | 1982-05-11 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4341796A (en) * | 1979-06-25 | 1982-07-27 | Fmc Corporation | Control of acarids with biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates |
| US4402973A (en) * | 1980-10-02 | 1983-09-06 | Fmc Corporation | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters |
| US4473709A (en) * | 1980-07-14 | 1984-09-25 | Fmc Corporation | Pyrethroid intermediates and process |
| US4426524A (en) | 1980-09-02 | 1984-01-17 | Fmc Corporation | Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates |
| US4339457A (en) * | 1980-10-20 | 1982-07-13 | Fmc Corporation | 3-(Pyrrol-1-yl)phenylmethyl esters and intermediates |
| US4451484A (en) * | 1981-04-30 | 1984-05-29 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4433182A (en) * | 1981-04-30 | 1984-02-21 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4507317A (en) * | 1981-04-30 | 1985-03-26 | Fmc Corporation | Acaricidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4536591A (en) * | 1981-05-21 | 1985-08-20 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4423234A (en) * | 1982-05-17 | 1983-12-27 | Fmc Corporation | Copper-catalyzed biaromatic coupling process |
| US4493844A (en) * | 1982-08-19 | 1985-01-15 | Fmc Corporation | Insecticidal 2,2'-bridged(1,1'-biphenyl)-3-ylmethyl carboxamides |
| USH49H (en) | 1983-01-10 | 1986-04-01 | Fmc Corporation | Process for producing 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylates |
| US4552892A (en) * | 1983-03-11 | 1985-11-12 | Fmc Corporation | Acaricidal difluoroethenylcyclopropanecarboxylates |
| US4465879A (en) * | 1983-08-19 | 1984-08-14 | Fmc Corporation | Process to insecticide intermediate |
| WO1985001045A1 (en) * | 1983-08-19 | 1985-03-14 | Fmc Corporation | Catalyzed grignard coupling process |
| US4818273A (en) * | 1983-11-14 | 1989-04-04 | The Dow Chemical Company | Substituted 1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamides, compositions containing them, and their utility as herbicides |
| DE3343092A1 (de) * | 1983-11-29 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Wasserloesliche pestizide formulierung |
| CA1284665C (en) * | 1984-07-26 | 1991-06-04 | Eric George Delmar | Process for hydroxymethylation |
| US4740637A (en) * | 1984-07-26 | 1988-04-26 | Fmc Corporation | Process for hydroxymethylation |
| US6276050B1 (en) | 1998-07-20 | 2001-08-21 | Emhart Inc. | Riveting system and process for forming a riveted joint |
| WO2012150221A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue halogenierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
| CN104560053B (zh) * | 2014-12-24 | 2016-09-14 | 北京八亿时空液晶科技股份有限公司 | 含有1,3-二氟-2-甲基苯结构的液晶化合物及其制备方法 |
| CN114560772B (zh) * | 2022-02-14 | 2023-07-28 | 南昌大学 | 一种3-甲基-2-硝基苯甲酸的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156715A (en) * | 1962-09-18 | 1964-11-10 | Robert N Haszeldine | Polyfluorinated organo-mercury compounds and their preparation |
| US4053639A (en) * | 1964-01-24 | 1977-10-11 | The Boots Company Limited | Therapeutically active phenylalkane derivatives |
| GB1140748A (en) * | 1966-06-23 | 1969-01-22 | Ici Ltd | New carboxylic acid derivatives |
| CS167886B2 (OSRAM) * | 1968-06-06 | 1976-05-28 | ||
| BE794926A (fr) | 1971-04-23 | 1973-08-02 | Shell Int Research | Compositions biologiquement actives |
| US4024163A (en) * | 1972-05-25 | 1977-05-17 | National Research Development Corporation | Insecticides |
| US3987197A (en) * | 1972-08-17 | 1976-10-19 | Boehringer Ingelheim Gmbh | 3-(2'-fluoro-4-biphenylyl)-butyric acid and salts thereof |
| JPS5238030B2 (OSRAM) * | 1973-02-06 | 1977-09-27 | ||
| DE2528958A1 (de) * | 1975-06-28 | 1977-01-13 | Merck Patent Gmbh | Araliphatische dihalogenverbindungen und verfahren zu ihrer herstellung |
| US4130657A (en) * | 1977-10-20 | 1978-12-19 | Fmc Corporation | [1,1'-Biphenyl]-3-ylmethyl 3-(2,2-dihaloethenyl)-2,2-dimethylcyclopropanecarboxylates |
-
1978
- 1978-12-04 US US05/966,405 patent/US4214004A/en not_active Expired - Lifetime
-
1979
- 1979-11-08 CA CA000339499A patent/CA1140574A/en not_active Expired
- 1979-11-09 JP JP55500106A patent/JPS6128653B2/ja not_active Expired
- 1979-11-09 EP EP80900040A patent/EP0020685B1/en not_active Expired
- 1979-11-09 WO PCT/US1979/000971 patent/WO1980001163A1/en not_active Ceased
- 1979-11-09 BR BRPI7908936-4A patent/BR7908936A/pt not_active IP Right Cessation
- 1979-11-09 EP EP82103273A patent/EP0063374B1/en not_active Expired
- 1979-11-15 IE IE2188/79A patent/IE49208B1/en not_active IP Right Cessation
- 1979-11-19 IL IL58744A patent/IL58744A/xx not_active IP Right Cessation
- 1979-11-27 GR GR60609A patent/GR74124B/el unknown
- 1979-11-28 MX MX798508U patent/MX5998E/es unknown
- 1979-11-30 HU HU824084A patent/HU189627B/hu not_active IP Right Cessation
- 1979-11-30 AU AU53347/79A patent/AU526973B2/en not_active Ceased
- 1979-11-30 HU HU79FE1060A patent/HU182486B/hu not_active IP Right Cessation
- 1979-12-03 GT GT197960870A patent/GT197960870A/es unknown
- 1979-12-03 AR AR279128A patent/AR228245A1/es active
- 1979-12-03 TR TR20753A patent/TR20753A/xx unknown
- 1979-12-03 ES ES486547A patent/ES486547A1/es not_active Expired
- 1979-12-03 EG EG718/79A patent/EG13820A/xx active
- 1979-12-04 DD DD79217352A patent/DD147665A5/de unknown
- 1979-12-04 ZA ZA796583A patent/ZA796583B/xx unknown
- 1979-12-04 DD DD79220174A patent/DD157332A5/de unknown
-
1980
- 1980-08-01 DK DK332980A patent/DK161141C/da not_active IP Right Cessation
-
1984
- 1984-03-23 MX MX834184A patent/MX8341A/es unknown
- 1984-09-11 JP JP59188982A patent/JPS6094927A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0063374A1 (en) | 1982-10-27 |
| AU5334779A (en) | 1980-06-12 |
| EP0020685A1 (en) | 1981-01-07 |
| EP0020685A4 (en) | 1981-07-16 |
| EP0020685B1 (en) | 1983-06-15 |
| DD157332A5 (de) | 1982-11-03 |
| ES486547A1 (es) | 1980-09-16 |
| ZA796583B (en) | 1981-06-24 |
| HU182486B (en) | 1984-01-30 |
| IE792188L (en) | 1980-06-04 |
| EP0063374B1 (en) | 1984-02-22 |
| IL58744A (en) | 1983-06-15 |
| JPS6094927A (ja) | 1985-05-28 |
| AU526973B2 (en) | 1983-02-10 |
| IE49208B1 (en) | 1985-08-21 |
| AR228245A1 (es) | 1983-02-15 |
| GT197960870A (es) | 1981-05-26 |
| TR20753A (tr) | 1982-06-24 |
| DD147665A5 (de) | 1981-04-15 |
| GR74124B (OSRAM) | 1984-06-06 |
| BR7908936A (pt) | 1981-06-30 |
| IL58744A0 (en) | 1980-02-29 |
| MX5998E (es) | 1984-09-18 |
| DK332980A (da) | 1980-08-01 |
| CA1140574A (en) | 1983-02-01 |
| MX8341A (es) | 1993-07-01 |
| DK161141C (da) | 1991-11-18 |
| JPS6128653B2 (OSRAM) | 1986-07-01 |
| WO1980001163A1 (en) | 1980-06-12 |
| HU189627B (en) | 1986-07-28 |
| US4214004A (en) | 1980-07-22 |
| JPS56500065A (OSRAM) | 1981-01-22 |
| EG13820A (en) | 1983-03-31 |
| DK161141B (da) | 1991-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0222741B2 (OSRAM) | ||
| US4329518A (en) | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters | |
| EP0003336B1 (en) | Insecticidal perhaloalkylvinylcyclopropanecarboxylates | |
| US4402973A (en) | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters | |
| EP0001712B1 (en) | (1,1'-biphenyl)-3-ylmethyl 3-(2,2-dihaloethenyl)-2,2-dimethylcyclopropanecarboxylates, agricultural compositions and methods of use and manufacture | |
| JPS622574B2 (OSRAM) | ||
| US4333950A (en) | (+)-4-Substituted-2-indanol insecticidal ester derivatives | |
| US4536591A (en) | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters | |
| US4204071A (en) | 4-Aryl-3-butenoic acids and lower alkyl esters | |
| JPH0212941B2 (OSRAM) | ||
| CA1293267C (en) | Carboxylic acid esters, methods for production thereof and insecticides containing them as the active ingredient | |
| US4152455A (en) | Insecticidal α-trifluoromethyl-3-phenoxybenzyl carboxylates | |
| US4375476A (en) | Insecticidal (2,6-dimethyl-3-substituted phenyl)methyl cyclopropanecarboxylates | |
| US4335252A (en) | Insecticidal pyrethroid enantiomer pair | |
| US4368205A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| US4346251A (en) | 4-Substituted-2-indanols | |
| US4162366A (en) | α-TRIFLUOROMETHYL-3-PHENOXYBENZYL ALCOHOL | |
| US4408057A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| US4267359A (en) | Novel carboxylic acid esters | |
| CA1171874A (en) | (1,1'-biphenyl)-3-ylmethyl derivatives as intermediates | |
| US4442296A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| JPS6049197B2 (ja) | フツ素含有フエニル酢酸エステルの製造のための中間体およびその製造方法 |