CA1140574A - Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds - Google Patents
Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compoundsInfo
- Publication number
- CA1140574A CA1140574A CA000339499A CA339499A CA1140574A CA 1140574 A CA1140574 A CA 1140574A CA 000339499 A CA000339499 A CA 000339499A CA 339499 A CA339499 A CA 339499A CA 1140574 A CA1140574 A CA 1140574A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- biphenyl
- fluoro
- compound
- dichloroethenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 [1,1'-biphenyl]-3-ylmethyl compounds Chemical class 0.000 title claims abstract description 41
- 230000000749 insecticidal effect Effects 0.000 title abstract description 13
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 title description 3
- 238000000034 method Methods 0.000 claims abstract description 21
- 241000238631 Hexapoda Species 0.000 claims abstract description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 34
- 125000001153 fluoro group Chemical group F* 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 claims description 5
- 125000001475 halogen functional group Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- KPLGCNABWCOVRD-UHFFFAOYSA-N (2-methyl-3-phenylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound C1=CC=C(C=2C=CC=CC=2)C(C)=C1COC(=O)C1C(C=C(Cl)Cl)C1(C)C KPLGCNABWCOVRD-UHFFFAOYSA-N 0.000 claims 1
- MNTKCQUIQMIUAY-UHFFFAOYSA-N [3-(2-fluorophenyl)phenyl]methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(C=2C(=CC=CC=2)F)=C1 MNTKCQUIQMIUAY-UHFFFAOYSA-N 0.000 claims 1
- NUWHWZHHXMVOMT-UHFFFAOYSA-N [3-(2-methylphenyl)phenyl]methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1=CC=CC=C1C1=CC=CC(COC(=O)C2C(C2C=C(Cl)Cl)(C)C)=C1 NUWHWZHHXMVOMT-UHFFFAOYSA-N 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 49
- 239000000203 mixture Substances 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 34
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- 150000002148 esters Chemical class 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 235000010290 biphenyl Nutrition 0.000 description 23
- 239000000243 solution Substances 0.000 description 23
- 239000004305 biphenyl Substances 0.000 description 22
- 235000019441 ethanol Nutrition 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000001228 spectrum Methods 0.000 description 15
- 239000007787 solid Substances 0.000 description 14
- 230000000895 acaricidal effect Effects 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 235000008504 concentrate Nutrition 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 229960004756 ethanol Drugs 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 239000000969 carrier Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- 239000002917 insecticide Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 208000036366 Sensation of pressure Diseases 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 5
- 229960001701 chloroform Drugs 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002728 pyrethroid Substances 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- UJBOOUHRTQVGRU-UHFFFAOYSA-N 3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1 UJBOOUHRTQVGRU-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 241001521235 Spodoptera eridania Species 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000003158 alcohol group Chemical group 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 230000001276 controlling effect Effects 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- RTFPTPXBTIUISM-UHFFFAOYSA-N 1-(bromomethyl)-3-phenylbenzene Chemical compound BrCC1=CC=CC(C=2C=CC=CC=2)=C1 RTFPTPXBTIUISM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 3
- 239000000642 acaricide Substances 0.000 description 3
- 229940022682 acetone Drugs 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229960004217 benzyl alcohol Drugs 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229940070846 pyrethrins Drugs 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000012085 test solution Substances 0.000 description 3
- NPDIDUXTRAITDE-UHFFFAOYSA-N 1-methyl-3-phenylbenzene Chemical group CC1=CC=CC(C=2C=CC=CC=2)=C1 NPDIDUXTRAITDE-UHFFFAOYSA-N 0.000 description 2
- WEAUVDQUPGJTSZ-UHFFFAOYSA-N 2-(bromomethyl)-1,3-difluoro-4-phenylbenzene Chemical compound FC1=C(CBr)C(F)=CC=C1C1=CC=CC=C1 WEAUVDQUPGJTSZ-UHFFFAOYSA-N 0.000 description 2
- HFLMFOSJYVLCQL-UHFFFAOYSA-N 5-(2-fluorophenyl)-3-methylcyclohex-2-en-1-one Chemical compound C1C(C)=CC(=O)CC1C1=CC=CC=C1F HFLMFOSJYVLCQL-UHFFFAOYSA-N 0.000 description 2
- 241000238876 Acari Species 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 241000532642 Conotrachelus nenuphar Species 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 241000258913 Oncopeltus fasciatus Species 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 241000219843 Pisum Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 230000002730 additional effect Effects 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- MOMORSVRSWLPKH-UHFFFAOYSA-N ethyl 6-(2-fluorophenyl)-2-methyl-4-oxocyclohex-2-ene-1-carboxylate Chemical compound C1C(=O)C=C(C)C(C(=O)OCC)C1C1=CC=CC=C1F MOMORSVRSWLPKH-UHFFFAOYSA-N 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 235000014666 liquid concentrate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- QJOOIMSFFIUFKX-UHFFFAOYSA-N methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)C1C(C=C(Cl)Cl)C1(C)C QJOOIMSFFIUFKX-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- HTSABYAWKQAHBT-UHFFFAOYSA-N trans 3-methylcyclohexanol Natural products CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- LLMLSUSAKZVFOA-UJURSFKZSA-N (1S,3R)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(O)=O LLMLSUSAKZVFOA-UJURSFKZSA-N 0.000 description 1
- BGTLHJPGBIVQLJ-UHFFFAOYSA-N (2-methyl-3-phenylphenyl)methanol Chemical compound CC1=C(CO)C=CC=C1C1=CC=CC=C1 BGTLHJPGBIVQLJ-UHFFFAOYSA-N 0.000 description 1
- VODBTCPLHMEMAS-UHFFFAOYSA-N (3-amino-2-methylphenyl)methanol;hydrochloride Chemical compound Cl.CC1=C(N)C=CC=C1CO VODBTCPLHMEMAS-UHFFFAOYSA-N 0.000 description 1
- WVKFJUYXMBJNKD-UHFFFAOYSA-N (3-iodo-2-methylphenyl)methanol Chemical compound CC1=C(I)C=CC=C1CO WVKFJUYXMBJNKD-UHFFFAOYSA-N 0.000 description 1
- RMLZACGTCXHCGL-UHFFFAOYSA-N (3-phenylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical class CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(C=2C=CC=CC=2)=C1 RMLZACGTCXHCGL-UHFFFAOYSA-N 0.000 description 1
- WPQGAUKQYKHCLZ-QFBILLFUSA-N (4-chloro-3-phenylphenyl)methyl (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCC1=CC=C(Cl)C(C=2C=CC=CC=2)=C1 WPQGAUKQYKHCLZ-QFBILLFUSA-N 0.000 description 1
- OFCLKYBRZQUWOG-QFBILLFUSA-N (4-fluoro-3-phenylphenyl)methyl (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCC1=CC=C(F)C(C=2C=CC=CC=2)=C1 OFCLKYBRZQUWOG-QFBILLFUSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- IJYJYBHESXAIDP-UHFFFAOYSA-N 1-(bromomethyl)-3-(3-chlorophenyl)benzene Chemical compound ClC1=CC=CC(C=2C=C(CBr)C=CC=2)=C1 IJYJYBHESXAIDP-UHFFFAOYSA-N 0.000 description 1
- MBTFNFODAQPJNE-UHFFFAOYSA-N 1-(bromomethyl)-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(CBr)C=CC=2)=C1 MBTFNFODAQPJNE-UHFFFAOYSA-N 0.000 description 1
- QBELEDRHMPMKHP-UHFFFAOYSA-N 1-bromo-2-chlorobenzene Chemical compound ClC1=CC=CC=C1Br QBELEDRHMPMKHP-UHFFFAOYSA-N 0.000 description 1
- UVXXXPUFDFKYEE-UHFFFAOYSA-N 1-chloro-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(Cl)C=CC=2)=C1 UVXXXPUFDFKYEE-UHFFFAOYSA-N 0.000 description 1
- BUIPKDFUVKLJTF-UHFFFAOYSA-N 1-fluoro-2-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C(=CC=CC=2)F)=C1 BUIPKDFUVKLJTF-UHFFFAOYSA-N 0.000 description 1
- PZDAAZQDQJGXSW-UHFFFAOYSA-N 1-fluoro-4-(4-fluorophenyl)benzene Chemical compound C1=CC(F)=CC=C1C1=CC=C(F)C=C1 PZDAAZQDQJGXSW-UHFFFAOYSA-N 0.000 description 1
- ALLIZEAXNXSFGD-UHFFFAOYSA-N 1-methyl-2-phenylbenzene Chemical compound CC1=CC=CC=C1C1=CC=CC=C1 ALLIZEAXNXSFGD-UHFFFAOYSA-N 0.000 description 1
- OHAMOQALFCXZBV-UHFFFAOYSA-N 2,2-dichloroethenyl 2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)CC1C(=O)OC=C(Cl)Cl OHAMOQALFCXZBV-UHFFFAOYSA-N 0.000 description 1
- QQNQOWHUBGUGQI-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)CC1C(Cl)=O QQNQOWHUBGUGQI-UHFFFAOYSA-N 0.000 description 1
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 1
- VEQMUQZKBLIXLT-UHFFFAOYSA-N 2,3-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1C(C)C1C(O)=O VEQMUQZKBLIXLT-UHFFFAOYSA-N 0.000 description 1
- GEMLIOXWQRDDOA-UHFFFAOYSA-N 2,4-difluoro-3-methylaniline Chemical compound CC1=C(F)C=CC(N)=C1F GEMLIOXWQRDDOA-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- JUEZYTFQWZACEL-UHFFFAOYSA-N 2-nitrosoacetamide Chemical compound NC(=O)CN=O JUEZYTFQWZACEL-UHFFFAOYSA-N 0.000 description 1
- MDIQXIJPQWLFSD-UHFFFAOYSA-N 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)C(C=C(Br)Br)C1C(O)=O MDIQXIJPQWLFSD-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- KVBWBCRPWVKFQT-UHFFFAOYSA-M 3-iodobenzoate Chemical compound [O-]C(=O)C1=CC=CC(I)=C1 KVBWBCRPWVKFQT-UHFFFAOYSA-M 0.000 description 1
- VXUIDVTXKZPLSS-UHFFFAOYSA-N 4,4-dimethyl-2-[3-(2-methylphenyl)phenyl]-5h-1,3-oxazole Chemical compound CC1=CC=CC=C1C1=CC=CC(C=2OCC(C)(C)N=2)=C1 VXUIDVTXKZPLSS-UHFFFAOYSA-N 0.000 description 1
- IIZVERXSSGEDTK-UHFFFAOYSA-N 5-(2-fluorophenyl)-3-methylcyclohex-2-en-1-ol Chemical compound C1C(C)=CC(O)CC1C1=CC=CC=C1F IIZVERXSSGEDTK-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 241000253994 Acyrthosiphon pisum Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 101100025412 Arabidopsis thaliana XI-A gene Proteins 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241001301805 Epilachna Species 0.000 description 1
- 241000462639 Epilachna varivestis Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical class ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- MCVMBSBMNWUITO-QFBILLFUSA-N [3-(2-chlorophenyl)phenyl]methyl (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCC1=CC=CC(C=2C(=CC=CC=2)Cl)=C1 MCVMBSBMNWUITO-QFBILLFUSA-N 0.000 description 1
- CEHQWCFLTWFAOL-UHFFFAOYSA-N [3-(2-methylphenyl)phenyl]methanol Chemical compound CC1=CC=CC=C1C1=CC=CC(CO)=C1 CEHQWCFLTWFAOL-UHFFFAOYSA-N 0.000 description 1
- YQWLMGYFCQAYKW-PKOBYXMFSA-N [3-(3-chlorophenyl)phenyl]methyl (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCC1=CC=CC(C=2C=C(Cl)C=CC=2)=C1 YQWLMGYFCQAYKW-PKOBYXMFSA-N 0.000 description 1
- OXJWPRBJKZFLDD-PKOBYXMFSA-N [3-(3-fluorophenyl)phenyl]methyl (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCC1=CC=CC(C=2C=C(F)C=CC=2)=C1 OXJWPRBJKZFLDD-PKOBYXMFSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- YVPYQUNUQOZFHG-UHFFFAOYSA-N amidotrizoic acid Chemical compound CC(=O)NC1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I YVPYQUNUQOZFHG-UHFFFAOYSA-N 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Substances [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 230000000332 continued effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- OGVXWEOZQMAAIM-UHFFFAOYSA-N hydron;2-methylaniline;chloride Chemical group Cl.CC1=CC=CC=C1N OGVXWEOZQMAAIM-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical class [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 235000011160 magnesium carbonates Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical class [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- KERAQDGNPUOGFF-UHFFFAOYSA-N methyl 3-(2,3,4,5,6-pentafluorophenyl)benzoate Chemical compound COC(=O)C1=CC=CC(C=2C(=C(F)C(F)=C(F)C=2F)F)=C1 KERAQDGNPUOGFF-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N methyl bromide Substances BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- PKAHQJNJPDVTDP-UHFFFAOYSA-N methyl cyclopropanecarboxylate Chemical compound COC(=O)C1CC1 PKAHQJNJPDVTDP-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical class Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 235000001508 sulfur Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000007514 turning Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/966,405 US4214004A (en) | 1978-12-04 | 1978-12-04 | Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds |
| US966,405 | 1978-12-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1140574A true CA1140574A (en) | 1983-02-01 |
Family
ID=25511348
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000339499A Expired CA1140574A (en) | 1978-12-04 | 1979-11-08 | Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4214004A (OSRAM) |
| EP (2) | EP0020685B1 (OSRAM) |
| JP (2) | JPS6128653B2 (OSRAM) |
| AR (1) | AR228245A1 (OSRAM) |
| AU (1) | AU526973B2 (OSRAM) |
| BR (1) | BR7908936A (OSRAM) |
| CA (1) | CA1140574A (OSRAM) |
| DD (2) | DD157332A5 (OSRAM) |
| DK (1) | DK161141C (OSRAM) |
| EG (1) | EG13820A (OSRAM) |
| ES (1) | ES486547A1 (OSRAM) |
| GR (1) | GR74124B (OSRAM) |
| GT (1) | GT197960870A (OSRAM) |
| HU (2) | HU189627B (OSRAM) |
| IE (1) | IE49208B1 (OSRAM) |
| IL (1) | IL58744A (OSRAM) |
| MX (2) | MX5998E (OSRAM) |
| TR (1) | TR20753A (OSRAM) |
| WO (1) | WO1980001163A1 (OSRAM) |
| ZA (1) | ZA796583B (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
| US4668792A (en) * | 1978-12-04 | 1987-05-26 | Fmc Corporation | Intermediates to insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4329518A (en) * | 1979-09-18 | 1982-05-11 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4341796A (en) * | 1979-06-25 | 1982-07-27 | Fmc Corporation | Control of acarids with biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates |
| US4402973A (en) * | 1980-10-02 | 1983-09-06 | Fmc Corporation | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters |
| US4473709A (en) * | 1980-07-14 | 1984-09-25 | Fmc Corporation | Pyrethroid intermediates and process |
| US4426524A (en) | 1980-09-02 | 1984-01-17 | Fmc Corporation | Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates |
| US4339457A (en) * | 1980-10-20 | 1982-07-13 | Fmc Corporation | 3-(Pyrrol-1-yl)phenylmethyl esters and intermediates |
| US4507317A (en) * | 1981-04-30 | 1985-03-26 | Fmc Corporation | Acaricidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4451484A (en) * | 1981-04-30 | 1984-05-29 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4433182A (en) * | 1981-04-30 | 1984-02-21 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4536591A (en) * | 1981-05-21 | 1985-08-20 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4423234A (en) * | 1982-05-17 | 1983-12-27 | Fmc Corporation | Copper-catalyzed biaromatic coupling process |
| US4493844A (en) * | 1982-08-19 | 1985-01-15 | Fmc Corporation | Insecticidal 2,2'-bridged(1,1'-biphenyl)-3-ylmethyl carboxamides |
| USH49H (en) | 1983-01-10 | 1986-04-01 | Fmc Corporation | Process for producing 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylates |
| US4552892A (en) * | 1983-03-11 | 1985-11-12 | Fmc Corporation | Acaricidal difluoroethenylcyclopropanecarboxylates |
| US4465879A (en) * | 1983-08-19 | 1984-08-14 | Fmc Corporation | Process to insecticide intermediate |
| EP0152450B1 (en) * | 1983-08-19 | 1989-05-03 | FMC Corporation | Catalyzed grignard coupling process |
| US4818273A (en) * | 1983-11-14 | 1989-04-04 | The Dow Chemical Company | Substituted 1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamides, compositions containing them, and their utility as herbicides |
| DE3343092A1 (de) * | 1983-11-29 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Wasserloesliche pestizide formulierung |
| CA1284665C (en) * | 1984-07-26 | 1991-06-04 | Eric George Delmar | Process for hydroxymethylation |
| US4740637A (en) * | 1984-07-26 | 1988-04-26 | Fmc Corporation | Process for hydroxymethylation |
| US6276050B1 (en) | 1998-07-20 | 2001-08-21 | Emhart Inc. | Riveting system and process for forming a riveted joint |
| WO2012150221A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue halogenierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
| CN104560053B (zh) * | 2014-12-24 | 2016-09-14 | 北京八亿时空液晶科技股份有限公司 | 含有1,3-二氟-2-甲基苯结构的液晶化合物及其制备方法 |
| CN114560772B (zh) * | 2022-02-14 | 2023-07-28 | 南昌大学 | 一种3-甲基-2-硝基苯甲酸的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156715A (en) * | 1962-09-18 | 1964-11-10 | Robert N Haszeldine | Polyfluorinated organo-mercury compounds and their preparation |
| US4053639A (en) * | 1964-01-24 | 1977-10-11 | The Boots Company Limited | Therapeutically active phenylalkane derivatives |
| GB1140748A (en) * | 1966-06-23 | 1969-01-22 | Ici Ltd | New carboxylic acid derivatives |
| FR2010244A1 (OSRAM) * | 1968-06-06 | 1970-02-13 | Sumitomo Chemical Co | |
| BE794926A (fr) | 1971-04-23 | 1973-08-02 | Shell Int Research | Compositions biologiquement actives |
| US4024163A (en) * | 1972-05-25 | 1977-05-17 | National Research Development Corporation | Insecticides |
| US3987197A (en) * | 1972-08-17 | 1976-10-19 | Boehringer Ingelheim Gmbh | 3-(2'-fluoro-4-biphenylyl)-butyric acid and salts thereof |
| JPS5238030B2 (OSRAM) * | 1973-02-06 | 1977-09-27 | ||
| DE2528958A1 (de) * | 1975-06-28 | 1977-01-13 | Merck Patent Gmbh | Araliphatische dihalogenverbindungen und verfahren zu ihrer herstellung |
| US4130657A (en) * | 1977-10-20 | 1978-12-19 | Fmc Corporation | [1,1'-Biphenyl]-3-ylmethyl 3-(2,2-dihaloethenyl)-2,2-dimethylcyclopropanecarboxylates |
-
1978
- 1978-12-04 US US05/966,405 patent/US4214004A/en not_active Expired - Lifetime
-
1979
- 1979-11-08 CA CA000339499A patent/CA1140574A/en not_active Expired
- 1979-11-09 EP EP80900040A patent/EP0020685B1/en not_active Expired
- 1979-11-09 BR BRPI7908936-4A patent/BR7908936A/pt not_active IP Right Cessation
- 1979-11-09 EP EP82103273A patent/EP0063374B1/en not_active Expired
- 1979-11-09 WO PCT/US1979/000971 patent/WO1980001163A1/en not_active Ceased
- 1979-11-09 JP JP55500106A patent/JPS6128653B2/ja not_active Expired
- 1979-11-15 IE IE2188/79A patent/IE49208B1/en not_active IP Right Cessation
- 1979-11-19 IL IL58744A patent/IL58744A/xx not_active IP Right Cessation
- 1979-11-27 GR GR60609A patent/GR74124B/el unknown
- 1979-11-28 MX MX798508U patent/MX5998E/es unknown
- 1979-11-30 HU HU824084A patent/HU189627B/hu not_active IP Right Cessation
- 1979-11-30 AU AU53347/79A patent/AU526973B2/en not_active Ceased
- 1979-11-30 HU HU79FE1060A patent/HU182486B/hu not_active IP Right Cessation
- 1979-12-03 ES ES486547A patent/ES486547A1/es not_active Expired
- 1979-12-03 AR AR279128A patent/AR228245A1/es active
- 1979-12-03 EG EG718/79A patent/EG13820A/xx active
- 1979-12-03 TR TR20753A patent/TR20753A/xx unknown
- 1979-12-03 GT GT197960870A patent/GT197960870A/es unknown
- 1979-12-04 ZA ZA796583A patent/ZA796583B/xx unknown
- 1979-12-04 DD DD79220174A patent/DD157332A5/de unknown
- 1979-12-04 DD DD79217352A patent/DD147665A5/de unknown
-
1980
- 1980-08-01 DK DK332980A patent/DK161141C/da not_active IP Right Cessation
-
1984
- 1984-03-23 MX MX834184A patent/MX8341A/es unknown
- 1984-09-11 JP JP59188982A patent/JPS6094927A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0222741B2 (OSRAM) | 1990-05-21 |
| HU182486B (en) | 1984-01-30 |
| US4214004A (en) | 1980-07-22 |
| JPS6094927A (ja) | 1985-05-28 |
| AR228245A1 (es) | 1983-02-15 |
| MX8341A (es) | 1993-07-01 |
| DK161141B (da) | 1991-06-03 |
| WO1980001163A1 (en) | 1980-06-12 |
| DD157332A5 (de) | 1982-11-03 |
| DD147665A5 (de) | 1981-04-15 |
| AU5334779A (en) | 1980-06-12 |
| ES486547A1 (es) | 1980-09-16 |
| EP0020685A1 (en) | 1981-01-07 |
| IE792188L (en) | 1980-06-04 |
| EP0063374B1 (en) | 1984-02-22 |
| EG13820A (en) | 1983-03-31 |
| DK332980A (da) | 1980-08-01 |
| DK161141C (da) | 1991-11-18 |
| JPS6128653B2 (OSRAM) | 1986-07-01 |
| HU189627B (en) | 1986-07-28 |
| GT197960870A (es) | 1981-05-26 |
| MX5998E (es) | 1984-09-18 |
| IE49208B1 (en) | 1985-08-21 |
| JPS56500065A (OSRAM) | 1981-01-22 |
| ZA796583B (en) | 1981-06-24 |
| IL58744A (en) | 1983-06-15 |
| BR7908936A (pt) | 1981-06-30 |
| IL58744A0 (en) | 1980-02-29 |
| TR20753A (tr) | 1982-06-24 |
| EP0063374A1 (en) | 1982-10-27 |
| GR74124B (OSRAM) | 1984-06-06 |
| EP0020685A4 (en) | 1981-07-16 |
| EP0020685B1 (en) | 1983-06-15 |
| AU526973B2 (en) | 1983-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1140574A (en) | Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds | |
| US4329518A (en) | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters | |
| US4402973A (en) | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters | |
| US4263319A (en) | 4-Substituted-2-indanol insecticidal ester derivatives | |
| US4426524A (en) | Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates | |
| CA1123453A (en) | [1,1'-biphenyl]-3-ylmethyl 3-(2,2-dihaloethenyl)- 2,2-dimethylcyclopropanecarboxylates, agricultural compositions and methods of use and manufacture | |
| US4376785A (en) | Cyclopropanecarboxylates and a low fish toxic insecticide and/or acaricide containing them | |
| US4339457A (en) | 3-(Pyrrol-1-yl)phenylmethyl esters and intermediates | |
| US4200644A (en) | Arylthiovinylcyclopropanecarboxylate insecticides | |
| US4333950A (en) | (+)-4-Substituted-2-indanol insecticidal ester derivatives | |
| US4536591A (en) | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters | |
| US4375476A (en) | Insecticidal (2,6-dimethyl-3-substituted phenyl)methyl cyclopropanecarboxylates | |
| US4335252A (en) | Insecticidal pyrethroid enantiomer pair | |
| US4368205A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| US4346251A (en) | 4-Substituted-2-indanols | |
| US4408057A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| CA1171874A (en) | (1,1'-biphenyl)-3-ylmethyl derivatives as intermediates | |
| US4442296A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| US4423255A (en) | (+)-4-Substituted-2-indanols | |
| US4417078A (en) | Process for producing (+)-4-substituted-2-indanols | |
| GB2093831A (en) | 4-substituted-2-indanols and insecticidal ester derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 20000201 |