JPH0220639B2 - - Google Patents
Info
- Publication number
- JPH0220639B2 JPH0220639B2 JP53164391A JP16439178A JPH0220639B2 JP H0220639 B2 JPH0220639 B2 JP H0220639B2 JP 53164391 A JP53164391 A JP 53164391A JP 16439178 A JP16439178 A JP 16439178A JP H0220639 B2 JPH0220639 B2 JP H0220639B2
- Authority
- JP
- Japan
- Prior art keywords
- methyl
- thio
- ethyl
- formula
- furanylmethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims description 99
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 72
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 66
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 49
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 45
- -1 3-pyridinylmethyl Chemical group 0.000 claims description 39
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 claims description 32
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 229910052757 nitrogen Inorganic materials 0.000 claims description 24
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 20
- 229910052760 oxygen Inorganic materials 0.000 claims description 20
- 239000001301 oxygen Substances 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 16
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 16
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 16
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 16
- 150000001412 amines Chemical class 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 12
- 125000002541 furyl group Chemical group 0.000 claims description 10
- 239000004480 active ingredient Substances 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 8
- 150000003141 primary amines Chemical class 0.000 claims description 8
- 229910052717 sulfur Chemical group 0.000 claims description 8
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 150000004677 hydrates Chemical class 0.000 claims description 7
- 239000011593 sulfur Chemical group 0.000 claims description 7
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 6
- 125000004950 trifluoroalkyl group Chemical group 0.000 claims description 6
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- NCAFZHRKGCCNIU-UHFFFAOYSA-N 1-n-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-2-nitro-1-n'-[2-(pyridin-3-ylmethylsulfanyl)ethyl]ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1COCCCNC(=C[N+]([O-])=O)NCCSCC1=CC=CN=C1 NCAFZHRKGCCNIU-UHFFFAOYSA-N 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 3
- CJAIJXCGHMBPDR-UHFFFAOYSA-N 1-cyano-2-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-3-[2-[[5-(pyrrolidin-1-ylmethyl)furan-2-yl]methylsulfanyl]ethyl]guanidine Chemical compound CN(C)CC1=CC=CC(OCCCN=C(NCCSCC=2OC(CN3CCCC3)=CC=2)NC#N)=C1 CJAIJXCGHMBPDR-UHFFFAOYSA-N 0.000 claims description 2
- QXNGOJMPAVWTPL-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n-[2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CNC)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)C)O1 QXNGOJMPAVWTPL-UHFFFAOYSA-N 0.000 claims description 2
- UVDPWSZIADJAJD-UHFFFAOYSA-N 1-n-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n'-[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)C)S1 UVDPWSZIADJAJD-UHFFFAOYSA-N 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- JFPAOJDKTIOWGQ-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCCOC1=CC=CC(CN(C)C)=C1 JFPAOJDKTIOWGQ-UHFFFAOYSA-N 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 131
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 94
- 239000000377 silicon dioxide Substances 0.000 description 65
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- 239000000243 solution Substances 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- 229910021529 ammonia Inorganic materials 0.000 description 47
- 239000000203 mixture Substances 0.000 description 38
- 239000003921 oil Substances 0.000 description 35
- 235000019198 oils Nutrition 0.000 description 35
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- 238000000921 elemental analysis Methods 0.000 description 23
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 17
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000000725 suspension Substances 0.000 description 14
- 238000001704 evaporation Methods 0.000 description 13
- 210000002784 stomach Anatomy 0.000 description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- AOAHQGSFXWFCFB-UHFFFAOYSA-N n-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-methylsulfanyl-2-nitroethenamine Chemical compound [O-][N+](=O)C=C(SC)NCCSCC1=CC=C(CN(C)C)O1 AOAHQGSFXWFCFB-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 8
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Substances OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 8
- 229960001340 histamine Drugs 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- 230000009858 acid secretion Effects 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- 229960001669 kinetin Drugs 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 150000003573 thiols Chemical class 0.000 description 6
- NLDJCWKSAHEOEF-UHFFFAOYSA-N 3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propan-1-amine Chemical compound CN(C)CC1=CC=C(COCCCN)O1 NLDJCWKSAHEOEF-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000027119 gastric acid secretion Effects 0.000 description 5
- 230000002496 gastric effect Effects 0.000 description 5
- 230000002262 irrigation Effects 0.000 description 5
- 238000003973 irrigation Methods 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 235000006408 oxalic acid Nutrition 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- JTVIRZXORWVLBQ-UHFFFAOYSA-N 1,1-bis(methylsulfanyl)-2-nitroethane Chemical compound CSC(SC)C[N+]([O-])=O JTVIRZXORWVLBQ-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241001440269 Cutina Species 0.000 description 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002540 isothiocyanates Chemical class 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 150000003335 secondary amines Chemical class 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- JFGCGQJHMUYGLU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)O1 JFGCGQJHMUYGLU-UHFFFAOYSA-N 0.000 description 3
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 3
- ZEQMMXMSZSMEND-UHFFFAOYSA-N 3-[3-[(dimethylamino)methyl]phenoxy]propan-1-amine Chemical compound CN(C)CC1=CC=CC(OCCCN)=C1 ZEQMMXMSZSMEND-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 229960004977 anhydrous lactose Drugs 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- BSGRLBPZSRZQOR-UHFFFAOYSA-N ethene-1,1-diamine Chemical compound NC(N)=C BSGRLBPZSRZQOR-UHFFFAOYSA-N 0.000 description 3
- 239000008098 formaldehyde solution Substances 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- MYZRBZJVCYSTST-UHFFFAOYSA-N methyl n-cyano-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]carbamimidothioate Chemical compound N#CNC(SC)=NCCSCC1=CC=C(CN(C)C)O1 MYZRBZJVCYSTST-UHFFFAOYSA-N 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- NXGHEDHQXXXTTP-UHFFFAOYSA-N 1,1-bis(methylsulfanyl)-2-nitroethene Chemical compound CSC(SC)=C[N+]([O-])=O NXGHEDHQXXXTTP-UHFFFAOYSA-N 0.000 description 2
- VFIAOIVGTFADLM-UHFFFAOYSA-N 1-(furan-2-yl)-n,n-dimethylmethanamine Chemical compound CN(C)CC1=CC=CO1 VFIAOIVGTFADLM-UHFFFAOYSA-N 0.000 description 2
- HOUSNMZHUSUUOY-UHFFFAOYSA-N 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-methylsulfonylguanidine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(NS(C)(=O)=O)=NCCSCC1=CC=CO1 HOUSNMZHUSUUOY-UHFFFAOYSA-N 0.000 description 2
- ZYTKLAOSEINBPB-UHFFFAOYSA-N 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]thiourea Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=S)NCCCOC1=CC=CC(CN(C)C)=C1 ZYTKLAOSEINBPB-UHFFFAOYSA-N 0.000 description 2
- CSXBYXNURIJFJB-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n-[2-(2-pyridin-2-ylethylsulfanyl)ethyl]ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCCC1=CC=CC=N1 CSXBYXNURIJFJB-UHFFFAOYSA-N 0.000 description 2
- ABCFBZANPYWGTO-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCCOC1=CC=CC(CN2CCCC2)=C1 ABCFBZANPYWGTO-UHFFFAOYSA-N 0.000 description 2
- XAHUGIRCMOVJJP-UHFFFAOYSA-N 1-n-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1-n'-[2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CNC)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCCOC1=CC=CC(CN(C)C)=C1 XAHUGIRCMOVJJP-UHFFFAOYSA-N 0.000 description 2
- VSPDYEHKAMKDNW-UHFFFAOYSA-N 2-(furan-2-ylmethylsulfanyl)ethanamine Chemical compound NCCSCC1=CC=CO1 VSPDYEHKAMKDNW-UHFFFAOYSA-N 0.000 description 2
- ZZDILASZIABWOY-UHFFFAOYSA-N 2-[2-(furan-2-ylmethylsulfanyl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCSCC1=CC=CO1 ZZDILASZIABWOY-UHFFFAOYSA-N 0.000 description 2
- QMEQRAVKGMJJIU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)S1 QMEQRAVKGMJJIU-UHFFFAOYSA-N 0.000 description 2
- HRNAFVGPCKWMQB-UHFFFAOYSA-N 3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-n-(1-methylsulfanyl-2-nitroethenyl)propan-1-amine Chemical compound [O-][N+](=O)C=C(SC)NCCCOCC1=CC=C(CN(C)C)O1 HRNAFVGPCKWMQB-UHFFFAOYSA-N 0.000 description 2
- ZQOTTYITLAZYMR-UHFFFAOYSA-N 5-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanylmethyl]furan-2-carbaldehyde Chemical compound O1C(C=O)=CC=C1CSCCN1C(=O)C2=CC=CC=C2C1=O ZQOTTYITLAZYMR-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 102000000543 Histamine Receptors Human genes 0.000 description 2
- 108010002059 Histamine Receptors Proteins 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 238000006683 Mannich reaction Methods 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- IULFXBLVJIPESI-UHFFFAOYSA-N bis(methylsulfanyl)methylidenecyanamide Chemical compound CSC(SC)=NC#N IULFXBLVJIPESI-UHFFFAOYSA-N 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000006317 cyclopropyl amino group Chemical group 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 210000003238 esophagus Anatomy 0.000 description 2
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 2
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 2
- SAMFUNCIMCICBI-UHFFFAOYSA-N methyl n-cyano-n'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]carbamimidothioate Chemical compound N#CN=C(SC)NCCCOC1=CC=CC(CN(C)C)=C1 SAMFUNCIMCICBI-UHFFFAOYSA-N 0.000 description 2
- SNTUSIFNNHYDSA-UHFFFAOYSA-N n-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]cyclopropanamine Chemical compound O1C(CSCCN)=CC=C1CNC1CC1 SNTUSIFNNHYDSA-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 125000004001 thioalkyl group Chemical group 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- CTGIVQJZUKJDNH-UHFFFAOYSA-N (3-methylfuran-2-yl)methanamine Chemical compound CC=1C=COC=1CN CTGIVQJZUKJDNH-UHFFFAOYSA-N 0.000 description 1
- VLFLVTQSJAUJOE-UHFFFAOYSA-N 1,2-bis[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-methylsulfonylguanidine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(NS(C)(=O)=O)=NCCSCC1=CC=C(CN(C)C)O1 VLFLVTQSJAUJOE-UHFFFAOYSA-N 0.000 description 1
- KDSGSXHPUKAOBT-UHFFFAOYSA-N 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-3-methylsulfonylguanidine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(NS(C)(=O)=O)=NCCCOC1=CC=CC(CN(C)C)=C1 KDSGSXHPUKAOBT-UHFFFAOYSA-N 0.000 description 1
- MIWXCCWICHRDFF-UHFFFAOYSA-N 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-methylsulfonylthiourea Chemical compound CN(C)CC1=CC=C(CSCCNC(=S)NS(C)(=O)=O)O1 MIWXCCWICHRDFF-UHFFFAOYSA-N 0.000 description 1
- GNETVHIDZPYGGD-UHFFFAOYSA-N 1-aminoethanethiol;hydrochloride Chemical compound Cl.CC(N)S GNETVHIDZPYGGD-UHFFFAOYSA-N 0.000 description 1
- CRLQDTSBEUHYID-UHFFFAOYSA-N 1-cyano-2,3-bis[2-[[5-(pyrrolidin-1-ylmethyl)furan-2-yl]methylsulfanyl]ethyl]guanidine Chemical compound C=1C=C(CN2CCCC2)OC=1CSCCN=C(NC#N)NCCSCC(O1)=CC=C1CN1CCCC1 CRLQDTSBEUHYID-UHFFFAOYSA-N 0.000 description 1
- VLGWIVJKRGHUPU-UHFFFAOYSA-N 1-cyano-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-[2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethyl]guanidine Chemical compound O1C(CNC)=CC=C1CSCCN=C(NC#N)NCCSCC1=CC=C(CN(C)C)O1 VLGWIVJKRGHUPU-UHFFFAOYSA-N 0.000 description 1
- AZNWFNAVRUBVKK-UHFFFAOYSA-N 1-cyano-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]thiourea Chemical compound CN(C)CC1=CC=C(CSCCNC(S)=NC#N)O1 AZNWFNAVRUBVKK-UHFFFAOYSA-N 0.000 description 1
- XZMFTZYZEMPDAA-UHFFFAOYSA-N 1-methylsulfanyl-2-nitroethane Chemical compound CSCC[N+]([O-])=O XZMFTZYZEMPDAA-UHFFFAOYSA-N 0.000 description 1
- HOWLPKLRJBQWHO-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n-(2-phenylethyl)ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCC1=CC=CC=C1 HOWLPKLRJBQWHO-UHFFFAOYSA-N 0.000 description 1
- VKKFWBBTGRTHQN-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n-(2-pyridin-2-ylethyl)ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCC1=CC=CC=N1 VKKFWBBTGRTHQN-UHFFFAOYSA-N 0.000 description 1
- WMJATNFOWUIKFK-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n-[2-(pyridin-3-ylmethylsulfanyl)ethyl]ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=CN=C1 WMJATNFOWUIKFK-UHFFFAOYSA-N 0.000 description 1
- MEYKPYOUVHJEIO-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n-[2-[[5-(pyrrolidin-1-ylmethyl)furan-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC(O1)=CC=C1CN1CCCC1 MEYKPYOUVHJEIO-UHFFFAOYSA-N 0.000 description 1
- RXJMINVYIGWCJX-UHFFFAOYSA-N 1-n,1-n'-bis[2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CNC)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CNC)O1 RXJMINVYIGWCJX-UHFFFAOYSA-N 0.000 description 1
- LCRPTQZNWKLIDC-UHFFFAOYSA-N 1-n,1-n'-bis[2-[[5-[(cyclopropylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound C=1C=C(CNC2CC2)OC=1CSCCNC(=C[N+](=O)[O-])NCCSCC(O1)=CC=C1CNC1CC1 LCRPTQZNWKLIDC-UHFFFAOYSA-N 0.000 description 1
- MNVPGYNNJAQSHT-UHFFFAOYSA-N 1-n,1-n'-bis[2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound S1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)C)S1 MNVPGYNNJAQSHT-UHFFFAOYSA-N 0.000 description 1
- QLDNBWAKDJVINU-UHFFFAOYSA-N 1-n,1-n'-bis[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1COCCCNC(=C[N+]([O-])=O)NCCCOCC1=CC=C(CN(C)C)O1 QLDNBWAKDJVINU-UHFFFAOYSA-N 0.000 description 1
- YVIPBGOKXPMKLS-UHFFFAOYSA-N 1-n-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitro-1-n'-(pyridin-3-ylmethyl)ethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCC1=CC=CN=C1 YVIPBGOKXPMKLS-UHFFFAOYSA-N 0.000 description 1
- LKEZDYBPLPMKIU-UHFFFAOYSA-N 1-n-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitro-1-n'-[2-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine Chemical compound CN(C)CC1=CC=CC(OCCCNC(NCCSCC=2SC(CN3CCCC3)=CC=2)=C[N+]([O-])=O)=C1 LKEZDYBPLPMKIU-UHFFFAOYSA-N 0.000 description 1
- CHMFMZYDYIQIMP-UHFFFAOYSA-N 1-n-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1COCCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)C)O1 CHMFMZYDYIQIMP-UHFFFAOYSA-N 0.000 description 1
- QVKLUOOEZJCHEE-UHFFFAOYSA-N 1-n-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-1-n'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethene-1,1-diamine Chemical compound O1C(CN(C)C)=CC=C1COCCCNC(=C[N+]([O-])=O)NCCCOC1=CC=CC(CN(C)C)=C1 QVKLUOOEZJCHEE-UHFFFAOYSA-N 0.000 description 1
- LFHLEABTNIQIQO-UHFFFAOYSA-N 1H-isoindole Chemical compound C1=CC=C2CN=CC2=C1 LFHLEABTNIQIQO-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- WZYOUIOONLJNQG-UHFFFAOYSA-N 2-(2-pyridin-2-ylethylsulfanyl)ethanamine Chemical compound NCCSCCC1=CC=CC=N1 WZYOUIOONLJNQG-UHFFFAOYSA-N 0.000 description 1
- RLCFJBUTSZWLAG-UHFFFAOYSA-N 2-(furan-2-yl)propan-2-amine Chemical compound CC(C)(N)C1=CC=CO1 RLCFJBUTSZWLAG-UHFFFAOYSA-N 0.000 description 1
- NAIGAQQUVFYXGR-UHFFFAOYSA-N 2-(pyridin-3-ylmethylsulfanyl)ethanamine Chemical compound NCCSCC1=CC=CN=C1 NAIGAQQUVFYXGR-UHFFFAOYSA-N 0.000 description 1
- ZFFTZDQKIXPDAF-UHFFFAOYSA-N 2-Furanmethanethiol Chemical compound SCC1=CC=CO1 ZFFTZDQKIXPDAF-UHFFFAOYSA-N 0.000 description 1
- VFWUYASTZCOUKN-UHFFFAOYSA-N 2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethanamine;dihydrochloride Chemical compound Cl.Cl.CC=1N=CNC=1CSCCN VFWUYASTZCOUKN-UHFFFAOYSA-N 0.000 description 1
- JRQYKULIUYUIQS-UHFFFAOYSA-N 2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethanamine Chemical compound CNCC1=CC=C(CSCCN)O1 JRQYKULIUYUIQS-UHFFFAOYSA-N 0.000 description 1
- QAEZNSMVCFSKIQ-UHFFFAOYSA-N 2-[[5-(pyrrolidin-1-ylmethyl)furan-2-yl]methylsulfanyl]ethanamine Chemical compound O1C(CSCCN)=CC=C1CN1CCCC1 QAEZNSMVCFSKIQ-UHFFFAOYSA-N 0.000 description 1
- JINABYPSNRILHF-UHFFFAOYSA-N 2-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethanamine Chemical compound S1C(CSCCN)=CC=C1CN1CCCC1 JINABYPSNRILHF-UHFFFAOYSA-N 0.000 description 1
- PNCWHIAZZSDHPU-UHFFFAOYSA-N 2-benzylsulfanylethanamine Chemical compound NCCSCC1=CC=CC=C1 PNCWHIAZZSDHPU-UHFFFAOYSA-N 0.000 description 1
- ZXTQJZFYCVPHGQ-UHFFFAOYSA-N 2-nitro-1-n,1-n'-bis[2-[[5-(pyrrolidin-1-ylmethyl)furan-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine Chemical compound C=1C=C(CN2CCCC2)OC=1CSCCNC(=C[N+](=O)[O-])NCCSCC(O1)=CC=C1CN1CCCC1 ZXTQJZFYCVPHGQ-UHFFFAOYSA-N 0.000 description 1
- XCEYHIUNUGNTKC-UHFFFAOYSA-N 2-nitro-1-n,1-n'-bis[2-[[5-[(2,2,2-trifluoroethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine Chemical compound C=1C=C(CNCC(F)(F)F)OC=1CSCCNC(=C[N+](=O)[O-])NCCSCC1=CC=C(CNCC(F)(F)F)O1 XCEYHIUNUGNTKC-UHFFFAOYSA-N 0.000 description 1
- JEVXGPPXIDYQAO-UHFFFAOYSA-N 2-nitro-1-n,1-n'-bis[2-[[5-[(propan-2-ylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine Chemical compound O1C(CNC(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CNC(C)C)O1 JEVXGPPXIDYQAO-UHFFFAOYSA-N 0.000 description 1
- QLJHFQUMFMRNQB-UHFFFAOYSA-N 2-nitro-1-n,1-n'-bis[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethene-1,1-diamine Chemical compound C=1C=CC(CN2CCCC2)=CC=1OCCCNC(=C[N+](=O)[O-])NCCCOC(C=1)=CC=CC=1CN1CCCC1 QLJHFQUMFMRNQB-UHFFFAOYSA-N 0.000 description 1
- XPQIPUZPSLAZDV-UHFFFAOYSA-N 2-pyridylethylamine Chemical compound NCCC1=CC=CC=N1 XPQIPUZPSLAZDV-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- QXKZJYVGGKDGHX-UHFFFAOYSA-N 3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propan-1-amine Chemical compound NCCCOC1=CC=CC(CN2CCCC2)=C1 QXKZJYVGGKDGHX-UHFFFAOYSA-N 0.000 description 1
- YOOXEDABRGKNFW-UHFFFAOYSA-N 3-[3-[(dimethylamino)methyl]phenoxy]-n-(1-methylsulfanyl-2-nitroethenyl)propan-1-amine Chemical compound [O-][N+](=O)C=C(SC)NCCCOC1=CC=CC(CN(C)C)=C1 YOOXEDABRGKNFW-UHFFFAOYSA-N 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NFZPVHBFPAGSOQ-UHFFFAOYSA-N C(C(=O)O)(=O)O.O1C(=CC=C1)CN Chemical compound C(C(=O)O)(=O)O.O1C(=CC=C1)CN NFZPVHBFPAGSOQ-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241001631457 Cannula Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LBQYZJBLAVHCHT-UHFFFAOYSA-N [3-[3-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]propoxy]phenyl]methanol Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCCOC1=CC=CC(CO)=C1 LBQYZJBLAVHCHT-UHFFFAOYSA-N 0.000 description 1
- 210000003815 abdominal wall Anatomy 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- SIIJRCRHAIMFNT-UHFFFAOYSA-N cyclopropanamine;hydrochloride Chemical compound Cl.NC1CC1 SIIJRCRHAIMFNT-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- UMNKXPULIDJLSU-UHFFFAOYSA-N dichlorofluoromethane Chemical compound FC(Cl)Cl UMNKXPULIDJLSU-UHFFFAOYSA-N 0.000 description 1
- 229940099364 dichlorofluoromethane Drugs 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- ZTUJDPKOHPKRMO-UHFFFAOYSA-N hydron;2,2,2-trifluoroethanamine;chloride Chemical compound Cl.NCC(F)(F)F ZTUJDPKOHPKRMO-UHFFFAOYSA-N 0.000 description 1
- RGZRSLKIOCHTSI-UHFFFAOYSA-N hydron;n-methylhydroxylamine;chloride Chemical compound Cl.CNO RGZRSLKIOCHTSI-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229940113601 irrigation solution Drugs 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- ZXGCWSSVQVDILQ-UHFFFAOYSA-N n-[2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethyl]-1-methylsulfanyl-2-nitroethenamine Chemical compound CNCC1=CC=C(CSCCNC(SC)=C[N+]([O-])=O)O1 ZXGCWSSVQVDILQ-UHFFFAOYSA-N 0.000 description 1
- ZBCBVROSNGHMBD-UHFFFAOYSA-N n-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-2,2,2-trifluoroethanamine Chemical compound NCCSCC1=CC=C(CNCC(F)(F)F)O1 ZBCBVROSNGHMBD-UHFFFAOYSA-N 0.000 description 1
- WCQQPUNXWFVIJB-UHFFFAOYSA-N n-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-n-methylhydroxylamine Chemical compound CN(O)CC1=CC=C(CSCCN)O1 WCQQPUNXWFVIJB-UHFFFAOYSA-N 0.000 description 1
- PCWNTBWNHIHCEP-UHFFFAOYSA-N n-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]propan-2-amine Chemical compound CC(C)NCC1=CC=C(CSCCN)O1 PCWNTBWNHIHCEP-UHFFFAOYSA-N 0.000 description 1
- LVNNJZGXHIGRPW-UHFFFAOYSA-N n-[[5-[2-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]-n-methylhydroxylamine Chemical compound O1C(CN(C)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)O)O1 LVNNJZGXHIGRPW-UHFFFAOYSA-N 0.000 description 1
- JBHQJZVTGMBYGX-UHFFFAOYSA-N n-[[5-[2-[[1-[2-[[5-[[hydroxy(methyl)amino]methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]-n-methylhydroxylamine Chemical compound O1C(CN(O)C)=CC=C1CSCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)O)O1 JBHQJZVTGMBYGX-UHFFFAOYSA-N 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 229940096978 oral tablet Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 210000001187 pylorus Anatomy 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 210000001186 vagus nerve Anatomy 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5371677 | 1977-12-23 | ||
| GB7844778 | 1978-11-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS54109963A JPS54109963A (en) | 1979-08-29 |
| JPH0220639B2 true JPH0220639B2 (member.php) | 1990-05-10 |
Family
ID=26267325
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP16439178A Granted JPS54109963A (en) | 1977-12-23 | 1978-12-23 | Amine derivatives* their manufacture and pharmaceutical composition containing them |
Country Status (11)
| Country | Link |
|---|---|
| US (3) | US4233302A (member.php) |
| EP (1) | EP0002930B1 (member.php) |
| JP (1) | JPS54109963A (member.php) |
| AU (1) | AU525927B2 (member.php) |
| DE (1) | DE2862355D1 (member.php) |
| DK (1) | DK581278A (member.php) |
| ES (1) | ES476305A1 (member.php) |
| FI (1) | FI783917A7 (member.php) |
| IE (1) | IE47701B1 (member.php) |
| IT (1) | IT1109339B (member.php) |
| NZ (1) | NZ189253A (member.php) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4309435A (en) * | 1978-10-16 | 1982-01-05 | Imperial Chemical Industries Ltd. | Antisecretory guanidine derivatives and pharmaceutical compositions containing them |
| JPS568352A (en) * | 1979-07-03 | 1981-01-28 | Shionogi & Co Ltd | Aminoalkylvenzene derivative |
| GB2063874B (en) * | 1979-10-22 | 1983-09-28 | Glaxo Group Ltd | Triazole derivatives processes for the preparation thereof and pharmaceutical compositions containing them |
| EP0027744B1 (en) * | 1979-10-23 | 1984-03-14 | Glaxo Group Limited | Thiophene derivatives, processes for the production thereof and pharmaceutical compositions containing them |
| US4238487A (en) * | 1979-10-31 | 1980-12-09 | Merck & Co., Inc. | Aminoalkyl benzofuran derivatives |
| YU53681A (en) * | 1980-03-08 | 1983-12-31 | Smith Kline French Lab | Process for obtaining 5-dimethylamino-methyl-2-furane methanol |
| IL63968A (en) * | 1980-10-01 | 1985-10-31 | Glaxo Group Ltd | Form 2 ranitidine hydrochloride,its preparation and pharmaceutical compositions containing it |
| JPS57102852A (en) * | 1980-12-19 | 1982-06-26 | Shionogi & Co Ltd | Dicarboxylic acid diamide |
| US4374378A (en) * | 1981-01-28 | 1983-02-15 | The United States Of America As Represented By The United States National Aeronautics And Space Administration | Scanning seismic intrusion detection method and apparatus |
| EP0057981A3 (en) | 1981-02-09 | 1982-08-25 | Beecham Group Plc | Aromatic compounds, processes for their preparation and their use |
| US4607105A (en) * | 1981-05-18 | 1986-08-19 | Bristol-Myers Company | 3-cyclobutene-1,2-dione intermediates |
| US4526973A (en) * | 1981-05-18 | 1985-07-02 | Bristol-Myers Company | Chemical compounds |
| US4546188A (en) * | 1981-05-18 | 1985-10-08 | Bristol-Myers Company | Substituted 1,2-diaminocyclobutene-3,4-diones |
| US4503051A (en) * | 1981-05-18 | 1985-03-05 | Bristol-Myers Company | Substituted 3-cyclobutene-1,2-diones, pharmaceutical compositions thereof and methods of use |
| US4539316A (en) * | 1981-05-18 | 1985-09-03 | Bristol-Myers Company | Pyridine derivatives of 1,2-diaminocyclobutene-3,4-diones |
| US4522943A (en) * | 1981-05-18 | 1985-06-11 | Bristol-Myers Company | Chemical compounds |
| US4597902A (en) * | 1981-05-20 | 1986-07-01 | A. H. Robins Company, Incorporated | N-(arylthioalkyl)-N'-(aminoalkyl)ureas |
| US4724235A (en) * | 1981-05-20 | 1988-02-09 | A. H. Robins Company, Incorporated | N-(arylthioalkyl)-N'-(aminoalkyl)ureas useful in the treatment of arrhythmia |
| US4375435A (en) * | 1981-06-03 | 1983-03-01 | Smith Kline & French Laboratories Limited | 3-,4-Dihydroimidazo (3,4-c)-1,3-pyrimidines and 4,5-dihydroimidazo (3,4-c)-1,3-diazepines |
| US4443375A (en) * | 1981-06-03 | 1984-04-17 | Smith Kline & French Laboratories Limited | Tetrahydroimidazo(3,4-c)-1,3-diazocine intermediates for production of guanidines |
| IT1168163B (it) * | 1981-08-18 | 1987-05-20 | Ausonia Farma Srl | Composto ad attivita' antiulcera, procedimento per la sua preparazione e composizioni farmaceutiche relative |
| WO1983002113A1 (fr) * | 1981-12-17 | 1983-06-23 | Yuki, Hiroshi | Derives de propenylamine et medicaments les contenant |
| US4478821A (en) * | 1982-01-26 | 1984-10-23 | The Gillette Company | Inhibition of body odor |
| DE3213509A1 (de) * | 1982-04-10 | 1983-10-20 | Basf Ag, 6700 Ludwigshafen | N-substituierte imidazol-derivate, ihre herstellung, diese enthaltende arzneimittel und ihre verwendung |
| IT1190793B (it) * | 1982-04-27 | 1988-02-24 | Magis Farmaceutici | Composti attivi nel trattamento dell'ulcera e sintomi allergici della pelle |
| DE3238867A1 (de) * | 1982-10-20 | 1984-04-26 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | Heterocyclische verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| JPS5988458A (ja) * | 1982-11-12 | 1984-05-22 | Toyama Chem Co Ltd | アミン誘導体およびその塩 |
| CA1254212A (en) * | 1982-11-12 | 1989-05-16 | Shiro Hirai | Amine derivatives, salts thereof, process for preparing the same and an anti-ulcer agent containing the same |
| NL8303965A (nl) * | 1982-12-08 | 1984-07-02 | Degussa | Nieuwe etheendiamine- en guanidine-derivaten; werkwijze voor het bereiden daarvan; geneesmiddelen die ze bevatten; werkwijze voor het bereiden van dergelijke geneesmiddelen; toepassing van de verbindingen voor het bereiden van geneesmiddelen en in de geneeskunde. |
| DE3343884A1 (de) * | 1982-12-08 | 1984-06-14 | Degussa Ag, 6000 Frankfurt | Neue ethendiamin- und guanidin-derivate |
| ES8407016A1 (es) * | 1983-03-30 | 1984-08-16 | Ferrer Int | Procedimiento de obtencion de nuevas n-ciano-formamidinas. |
| ZW6584A1 (en) * | 1983-04-18 | 1985-04-17 | Glaxo Group Ltd | Phenethanolamine derivatives |
| IT1196133B (it) * | 1984-06-06 | 1988-11-10 | Ausonia Farma Srl | Derivati furanici con attivita' antiulcera |
| IT1178026B (it) * | 1984-10-05 | 1987-09-03 | Medosan Ind Biochimi | Derivati del 2-amino-tiazolo |
| HU196979B (en) * | 1985-01-11 | 1989-02-28 | Gyogyszerkutato Intezet | Process for producing basic thioether and salt |
| US4663333A (en) * | 1985-02-04 | 1987-05-05 | G. D. Searle & Co. | Acylaminoalkylpyridines ad use in treatment of inflammation and allergy reactions |
| AU581324B2 (en) * | 1985-07-05 | 1989-02-16 | Smith Kline & French Laboratories Limited | Substituted 6-phenyl-4,5-dihydro pyradazin-3-ones |
| US4897485A (en) * | 1987-03-18 | 1990-01-30 | Ciba-Geigy Corporation | Insecticidal pyrid-3-yl-2,3-diaza-butadien-1-yl-disulfies |
| ATE86619T1 (de) * | 1987-04-06 | 1993-03-15 | Heumann Pharma Gmbh & Co | Verfahren zur herstellung von nitroethenderivaten. |
| IL87250A (en) * | 1987-08-01 | 1993-06-10 | Takeda Chemical Industries Ltd | :-unsaturated amines, process for their preparation, insecticidal/ miticidal compositions containing them |
| JPH0639466B2 (ja) * | 1987-08-03 | 1994-05-25 | 杏林製薬株式会社 | ウレア誘導体 |
| US4918086A (en) * | 1987-08-07 | 1990-04-17 | Ciba-Geigy Corporation | 1-nitro-2,2-diaminoethylene derivatives |
| GB2209163B (en) * | 1987-08-28 | 1991-04-24 | Toyama Chemical Co Ltd | Amine derivative and its salt, process for producing the same, and anti-ulcer agent containing the same |
| JPH01131172A (ja) * | 1987-08-28 | 1989-05-24 | Toyama Chem Co Ltd | アミン誘導体およびその塩、それらの製造法、並びにそれらを含有する抗潰瘍剤 |
| US4988828A (en) * | 1987-11-27 | 1991-01-29 | Fujirebio Kabushiki Kaisha | Phenoxypropyl derivatives |
| US4950789A (en) * | 1989-01-25 | 1990-08-21 | The Dow Chemical Company | Aromatic polyalkyleneoxy polyamines containing amioncarbonyl or aminothiocarbonyl moieties and a compatible mixture of high and low molecular weight polyols made therefrom |
| GB9009437D0 (en) * | 1990-04-26 | 1990-06-20 | Glaxo Group Ltd | Chemical compounds |
| FR2686084B1 (fr) * | 1992-01-10 | 1995-12-22 | Bioprojet Soc Civ | Nouveaux derives de l'imidazole, leur preparation et leurs applications therapeutiques. |
| USRE37303E1 (en) * | 1992-01-10 | 2001-07-31 | Institut National Del La Sante Et De La Recherche Medicale | Imidazole compounds and their therapeutic applications |
| DE69307310D1 (de) * | 1992-05-12 | 1997-02-20 | Zeria Pharm Co Ltd | Neue quaternäre ammoniumsalze und deren medizinische verwendung |
| EP4196793A1 (en) | 2020-08-11 | 2023-06-21 | Université de Strasbourg | H2 blockers targeting liver macrophages for the prevention and treatment of liver disease and cancer |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1338169A (en) * | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| US4024260A (en) * | 1973-05-17 | 1977-05-17 | Smith Kline & French Laboratories Limited | Ethylene derivatives |
| US4002759A (en) * | 1973-05-17 | 1977-01-11 | Smith Kline & French Laboratories Limited | Pyridylbutylamino ethylene compounds |
| GB1421792A (en) * | 1973-05-17 | 1976-01-21 | Smith Kline French Lab | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
| US4046907A (en) * | 1973-05-17 | 1977-09-06 | Smith Kline & French Laboratories Limited | Imidazole alkylaminoethylene compounds |
| GB1431589A (en) | 1973-07-13 | 1976-04-07 | Smith Kline French Lab | Ureas, thioureas and guanidines n,n-disubstituted by heterocyclo- alkylene and/or heterocycloalkylenethioalkylene groups |
| US4025527A (en) * | 1973-07-13 | 1977-05-24 | Smith Kline & French Laboratories Limited | Certain thiazoles and oxazoles |
| GB1565205A (en) * | 1975-07-31 | 1980-04-16 | Smith Kline French Lab | Heterocyclic sulphoxides |
| US4013769A (en) * | 1974-05-09 | 1977-03-22 | Smith Kline & French Laboratories Limited | Pyridyl-alkylaminoethylene compounds |
| GB1497260A (en) * | 1974-06-28 | 1978-01-05 | Smith Kline French Lab | Guanidine derivatives |
| US4093729A (en) * | 1974-06-28 | 1978-06-06 | Smith Kline & French Laboratories Limited | N-Oxy and N-amino guanidines |
| GB1564502A (en) * | 1975-07-31 | 1980-04-10 | Smith Kline French Lab | Guanidines thioureas and 1,1-diamino-2-nitroethylene derivatives |
| GB1565647A (en) | 1975-07-31 | 1980-04-23 | Smith Kline French Lab | Pharmacologically active compounds 4-substituted-imidazole-5-methanols |
| US4080459A (en) * | 1975-11-05 | 1978-03-21 | Smith Kline & French Laboratories Limited | Pyridyl-alkylaminoethylene compounds |
| US4067984A (en) * | 1975-11-05 | 1978-01-10 | Smith Kline & French Laboratories Limited | Pyridylbutylamino ethylene compounds |
| GB1565966A (en) * | 1976-08-04 | 1980-04-23 | Allen & Hanburys Ltd | Aminoalkyl furan derivatives |
| GB1601459A (en) * | 1977-05-17 | 1981-10-28 | Allen & Hanburys Ltd | Aminoalkyl thiophene derivatives |
| IE46886B1 (en) * | 1977-05-17 | 1983-10-19 | Allen & Hanburys Ltd | Aminoalkyl-benzene derivatives |
| US4203909A (en) * | 1978-09-26 | 1980-05-20 | Bristol-Myers Company | Furan compounds |
-
1978
- 1978-12-18 US US05/970,534 patent/US4233302A/en not_active Expired - Lifetime
- 1978-12-20 AU AU42735/78A patent/AU525927B2/en not_active Expired
- 1978-12-20 EP EP78300869A patent/EP0002930B1/en not_active Expired
- 1978-12-20 NZ NZ189253A patent/NZ189253A/xx unknown
- 1978-12-20 FI FI783917A patent/FI783917A7/fi unknown
- 1978-12-20 DE DE7878300869T patent/DE2862355D1/de not_active Expired
- 1978-12-21 IE IE2542/78A patent/IE47701B1/en unknown
- 1978-12-22 ES ES476305A patent/ES476305A1/es not_active Expired
- 1978-12-22 IT IT52447/78A patent/IT1109339B/it active
- 1978-12-22 DK DK581278A patent/DK581278A/da not_active Application Discontinuation
- 1978-12-23 JP JP16439178A patent/JPS54109963A/ja active Granted
-
1980
- 1980-06-06 US US06/157,203 patent/US4279911A/en not_active Expired - Lifetime
- 1980-06-06 US US06/157,195 patent/US4304780A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0002930B1 (en) | 1983-12-14 |
| IE782542L (en) | 1979-06-23 |
| FI783917A7 (fi) | 1979-06-24 |
| NZ189253A (en) | 1981-07-13 |
| EP0002930A1 (en) | 1979-07-11 |
| IE47701B1 (en) | 1984-05-30 |
| US4279911A (en) | 1981-07-21 |
| JPS54109963A (en) | 1979-08-29 |
| DE2862355D1 (en) | 1984-01-19 |
| IT7852447A0 (it) | 1978-12-22 |
| AU4273578A (en) | 1979-06-28 |
| US4304780A (en) | 1981-12-08 |
| AU525927B2 (en) | 1982-12-09 |
| ES476305A1 (es) | 1980-05-16 |
| US4233302A (en) | 1980-11-11 |
| DK581278A (da) | 1979-08-09 |
| IT1109339B (it) | 1985-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0220639B2 (member.php) | ||
| SU1380614A3 (ru) | Способ получени производных арилтиазолов или их хлористоводородных или бромистоводородных солей | |
| US4255440A (en) | Furan derivatives having selective action on histamine receptors | |
| US4239769A (en) | Pharmacologically active compounds | |
| ES2266227T3 (es) | Nuevos compuestos de (tio)urea y composiciones farmaceuticas que los contienen. | |
| EP1303483B1 (en) | Novel thiourea derivatives and the pharmaceutical compositions containing the same | |
| IE53274B1 (en) | Chemical compounds derived from cyclobutene | |
| IE46886B1 (en) | Aminoalkyl-benzene derivatives | |
| GB1604674A (en) | Aminoalkyl-benzene derivatives | |
| WO1999062892A1 (en) | Aminoazole compounds | |
| JPH0351708B2 (member.php) | ||
| US4921856A (en) | Dihydropyridazinone derivatives, a process for their preparation and pharmaceutical preparations containing these compounds | |
| WO2000009115A1 (en) | Grp receptor ligands | |
| US4169855A (en) | N'-derivatives of n-(2-mercapto-ethyl)-2-nitro-1,1-ethenediamine | |
| US5021429A (en) | Pharmacologically active aminoalkylphenyl compounds and their use | |
| US4503051A (en) | Substituted 3-cyclobutene-1,2-diones, pharmaceutical compositions thereof and methods of use | |
| US4738983A (en) | Ethylenediamine and guanidine-derivatives | |
| NO883263L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive benzimidazol-derivater. | |
| JPS58170773A (ja) | チアゾ−ル系抗潰瘍薬 | |
| GB1598628A (en) | Guanidine derivatives | |
| KR810000355B1 (ko) | 아미노 알킬푸란 유도체의 제조방법 | |
| SE454882B (sv) | Forfarande for framstellning av aminoalkylfuranderivat med terapeutisk verkan | |
| JPS61115074A (ja) | 3,4‐ジアゾール誘導体、その製法、およびその化合物を含有する医薬品 | |
| JPS61233678A (ja) | ベンジルピペラジン誘導体 | |
| WO2000009116A1 (en) | Grp receptor ligands |