JPH0133487B2 - - Google Patents
Info
- Publication number
- JPH0133487B2 JPH0133487B2 JP62145024A JP14502487A JPH0133487B2 JP H0133487 B2 JPH0133487 B2 JP H0133487B2 JP 62145024 A JP62145024 A JP 62145024A JP 14502487 A JP14502487 A JP 14502487A JP H0133487 B2 JPH0133487 B2 JP H0133487B2
- Authority
- JP
- Japan
- Prior art keywords
- polymer
- capping agent
- electrophilic
- polymerization
- chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 claims description 149
- 239000003795 chemical substances by application Substances 0.000 claims description 84
- 238000006116 polymerization reaction Methods 0.000 claims description 66
- 230000000269 nucleophilic effect Effects 0.000 claims description 53
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 46
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 39
- 239000000178 monomer Substances 0.000 claims description 39
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 27
- 239000005711 Benzoic acid Substances 0.000 claims description 23
- 235000010233 benzoic acid Nutrition 0.000 claims description 23
- 239000004305 biphenyl Substances 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 23
- 235000010290 biphenyl Nutrition 0.000 claims description 22
- -1 phenoxyphenyl Chemical group 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 11
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 238000012643 polycondensation polymerization Methods 0.000 claims description 8
- 239000003153 chemical reaction reagent Substances 0.000 claims description 7
- ITVUPWDTDWMACZ-UHFFFAOYSA-N (4-phenoxyphenyl)-phenylmethanone Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1C(=O)C1=CC=CC=C1 ITVUPWDTDWMACZ-UHFFFAOYSA-N 0.000 claims description 5
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 claims description 5
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229920001519 homopolymer Polymers 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- FJFCENCQWXKBSW-UHFFFAOYSA-N phenyl-(4-thiophen-2-ylphenyl)methanone Chemical compound C=1C=C(C=2SC=CC=2)C=CC=1C(=O)C1=CC=CC=C1 FJFCENCQWXKBSW-UHFFFAOYSA-N 0.000 claims description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 47
- 239000000243 solution Substances 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 33
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 27
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 27
- 229910015900 BF3 Inorganic materials 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000000047 product Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 19
- 239000012039 electrophile Substances 0.000 description 19
- 150000004820 halides Chemical class 0.000 description 19
- 239000003607 modifier Substances 0.000 description 18
- 239000002667 nucleating agent Substances 0.000 description 17
- AOOZVQGGMFGGEE-UHFFFAOYSA-N 4-phenoxybenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1OC1=CC=CC=C1 AOOZVQGGMFGGEE-UHFFFAOYSA-N 0.000 description 14
- 238000002474 experimental method Methods 0.000 description 14
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- 238000003756 stirring Methods 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 239000012038 nucleophile Substances 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 238000010791 quenching Methods 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- 238000005917 acylation reaction Methods 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- 229960005215 dichloroacetic acid Drugs 0.000 description 6
- 230000000171 quenching effect Effects 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical group ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 5
- QIZPONOMFWAPRR-UHFFFAOYSA-N 4-phenoxybenzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1OC1=CC=CC=C1 QIZPONOMFWAPRR-UHFFFAOYSA-N 0.000 description 4
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 4
- BSILAEQTGTZMIW-UHFFFAOYSA-N bis(4-phenoxyphenyl)methanone Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1C(=O)C(C=C1)=CC=C1OC1=CC=CC=C1 BSILAEQTGTZMIW-UHFFFAOYSA-N 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 229920002493 poly(chlorotrifluoroethylene) Polymers 0.000 description 4
- 239000005023 polychlorotrifluoroethylene (PCTFE) polymer Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 150000003457 sulfones Chemical class 0.000 description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 4
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 4
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- HPMLGNIUXVXALD-UHFFFAOYSA-N benzoyl fluoride Chemical compound FC(=O)C1=CC=CC=C1 HPMLGNIUXVXALD-UHFFFAOYSA-N 0.000 description 3
- 230000001588 bifunctional effect Effects 0.000 description 3
- 230000008033 biological extinction Effects 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- JDUYPUMQALQRCN-UHFFFAOYSA-N 4-bromophenyl phenyl ether Chemical compound C1=CC(Br)=CC=C1OC1=CC=CC=C1 JDUYPUMQALQRCN-UHFFFAOYSA-N 0.000 description 2
- ZSBDGXGICLIJGD-UHFFFAOYSA-N 4-phenoxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC=C1 ZSBDGXGICLIJGD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 238000004581 coalescence Methods 0.000 description 2
- 238000000748 compression moulding Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical compound C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- PSCMQHVBLHHWTO-UHFFFAOYSA-K indium(iii) chloride Chemical compound Cl[In](Cl)Cl PSCMQHVBLHHWTO-UHFFFAOYSA-K 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229920000090 poly(aryl ether) Polymers 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- UVJHZDCPNOXCSI-UHFFFAOYSA-M sodium;4-phenoxybenzenesulfonate Chemical compound [Na+].C1=CC(S(=O)(=O)[O-])=CC=C1OC1=CC=CC=C1 UVJHZDCPNOXCSI-UHFFFAOYSA-M 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- CFTSORNHIUMCGF-UHFFFAOYSA-N (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene Chemical compound C=1C=CC=CC=1C(C(F)(F)F)(C(F)(F)F)C1=CC=CC=C1 CFTSORNHIUMCGF-UHFFFAOYSA-N 0.000 description 1
- JTPSHEWWGCFFLA-UHFFFAOYSA-N 1,2-diphenoxynaphthalene Chemical compound C=1C=C2C=CC=CC2=C(OC=2C=CC=CC=2)C=1OC1=CC=CC=C1 JTPSHEWWGCFFLA-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- JTNRGGLCSLZOOQ-UHFFFAOYSA-N 1,3-diphenoxybenzene Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1OC1=CC=CC=C1 JTNRGGLCSLZOOQ-UHFFFAOYSA-N 0.000 description 1
- MOSLPKHPMJVHDM-UHFFFAOYSA-N 1,5-diphenoxynaphthalene Chemical compound C=1C=CC2=C(OC=3C=CC=CC=3)C=CC=C2C=1OC1=CC=CC=C1 MOSLPKHPMJVHDM-UHFFFAOYSA-N 0.000 description 1
- PYIFQWWZCFQJQJ-UHFFFAOYSA-N 1-benzhydryl-4-nitrobenzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 PYIFQWWZCFQJQJ-UHFFFAOYSA-N 0.000 description 1
- ZJDRDTZQVOCKPI-UHFFFAOYSA-N 1-benzofuran-2-carbonyl chloride Chemical compound C1=CC=C2OC(C(=O)Cl)=CC2=C1 ZJDRDTZQVOCKPI-UHFFFAOYSA-N 0.000 description 1
- FBPXUTVNRKEJNP-UHFFFAOYSA-N 1-phenoxy-2-(2-phenoxyphenyl)benzene Chemical group C=1C=CC=C(C=2C(=CC=CC=2)OC=2C=CC=CC=2)C=1OC1=CC=CC=C1 FBPXUTVNRKEJNP-UHFFFAOYSA-N 0.000 description 1
- RGCAQUUSBHVLJD-UHFFFAOYSA-N 1-phenoxy-4-(4-phenoxyphenyl)benzene Chemical group C=1C=C(C=2C=CC(OC=3C=CC=CC=3)=CC=2)C=CC=1OC1=CC=CC=C1 RGCAQUUSBHVLJD-UHFFFAOYSA-N 0.000 description 1
- DABOOAVTBIRGHP-UHFFFAOYSA-N 1-phenoxynaphthalene Chemical compound C=1C=CC2=CC=CC=C2C=1OC1=CC=CC=C1 DABOOAVTBIRGHP-UHFFFAOYSA-N 0.000 description 1
- VUJPBQLLLURKBZ-UHFFFAOYSA-N 2-chlorobenzene-1,4-disulfonyl chloride Chemical compound ClC1=CC(S(Cl)(=O)=O)=CC=C1S(Cl)(=O)=O VUJPBQLLLURKBZ-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- TTZXIWBOKOZOPL-UHFFFAOYSA-N 3-phenoxybenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 TTZXIWBOKOZOPL-UHFFFAOYSA-N 0.000 description 1
- RXNYJUSEXLAVNQ-UHFFFAOYSA-N 4,4'-Dihydroxybenzophenone Chemical class C1=CC(O)=CC=C1C(=O)C1=CC=C(O)C=C1 RXNYJUSEXLAVNQ-UHFFFAOYSA-N 0.000 description 1
- SLZSWGIZRAZLHB-UHFFFAOYSA-N 4-(2-phenylphenoxy)benzoyl fluoride Chemical compound C1=CC(C(=O)F)=CC=C1OC1=CC=CC=C1C1=CC=CC=C1 SLZSWGIZRAZLHB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- PNVYMQAFGHBAET-UHFFFAOYSA-N 4-(4-phenylphenoxy)benzoyl fluoride Chemical compound C1=CC(C(=O)F)=CC=C1OC1=CC=C(C=2C=CC=CC=2)C=C1 PNVYMQAFGHBAET-UHFFFAOYSA-N 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 1
- NNJMFJSKMRYHSR-UHFFFAOYSA-N 4-phenylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC=C1 NNJMFJSKMRYHSR-UHFFFAOYSA-N 0.000 description 1
- PVDVXFXKVDQWQM-UHFFFAOYSA-N 4-phenylsulfanylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1SC1=CC=CC=C1 PVDVXFXKVDQWQM-UHFFFAOYSA-N 0.000 description 1
- JQBIDIBXWQMJHG-UHFFFAOYSA-N 5-naphthalen-1-yloxynaphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(OC3=C4C=CC=C(C4=CC=C3)C(=O)Cl)=CC=CC2=C1 JQBIDIBXWQMJHG-UHFFFAOYSA-N 0.000 description 1
- XFHSQGVSHGJMRX-UHFFFAOYSA-N 6-naphthalen-2-yloxynaphthalene-2-carbonyl chloride Chemical compound C1=CC=CC2=CC(OC3=CC4=CC=C(C=C4C=C3)C(=O)Cl)=CC=C21 XFHSQGVSHGJMRX-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 150000008365 aromatic ketones Chemical class 0.000 description 1
- 238000010420 art technique Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- ALIQZUMMPOYCIS-UHFFFAOYSA-N benzene-1,3-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 ALIQZUMMPOYCIS-UHFFFAOYSA-N 0.000 description 1
- SOPOWEFATMBHSM-UHFFFAOYSA-N benzoic acid;1,1'-biphenyl Chemical compound OC(=O)C1=CC=CC=C1.C1=CC=CC=C1C1=CC=CC=C1 SOPOWEFATMBHSM-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- WIHYRWSUJJYTDX-UHFFFAOYSA-N dibenzofuran-2-carbonyl chloride Chemical compound C1=CC=C2C3=CC(C(=O)Cl)=CC=C3OC2=C1 WIHYRWSUJJYTDX-UHFFFAOYSA-N 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000002265 electronic spectrum Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007863 gel particle Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- MQZJWWZUARZRCU-UHFFFAOYSA-N naphthalene-1-carbonyl fluoride Chemical compound C1=CC=C2C(C(=O)F)=CC=CC2=C1 MQZJWWZUARZRCU-UHFFFAOYSA-N 0.000 description 1
- XNLBCXGRQWUJLU-UHFFFAOYSA-N naphthalene-2-carbonyl chloride Chemical compound C1=CC=CC2=CC(C(=O)Cl)=CC=C21 XNLBCXGRQWUJLU-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NFBOHOGPQUYFRF-UHFFFAOYSA-N oxanthrene Chemical compound C1=CC=C2OC3=CC=CC=C3OC2=C1 NFBOHOGPQUYFRF-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920005547 polycyclic aromatic hydrocarbon Polymers 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 229920006339 polymers by type Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 238000007868 post-polymerization treatment Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229920013730 reactive polymer Polymers 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- LNVSGXFZYRXTIL-UHFFFAOYSA-N thianthrene-2-carbonyl chloride Chemical compound C1=CC=C2SC3=CC(C(=O)Cl)=CC=C3SC2=C1 LNVSGXFZYRXTIL-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
- 238000002061 vacuum sublimation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G61/00—Macromolecular compounds obtained by reactions forming a carbon-to-carbon link in the main chain of the macromolecule
- C08G61/12—Macromolecular compounds containing atoms other than carbon in the main chain of the macromolecule
- C08G61/127—Macromolecular compounds containing atoms other than carbon in the main chain of the macromolecule derived from carbon dioxide, carbonyl halide, carboxylic acids or their derivatives
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62988775A | 1975-11-07 | 1975-11-07 | |
| US629887 | 1975-11-07 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP63308707A Division JPH01245019A (ja) | 1975-11-07 | 1988-12-06 | 重合体の製法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6354429A JPS6354429A (ja) | 1988-03-08 |
| JPH0133487B2 true JPH0133487B2 (enExample) | 1989-07-13 |
Family
ID=24524906
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13313476A Granted JPS5284300A (en) | 1975-11-07 | 1976-11-05 | Ketone and sulfone polymer |
| JP62145024A Granted JPS6354429A (ja) | 1975-11-07 | 1987-06-09 | ケトンおよびスルホン重合体の製造方法 |
| JP63308707A Granted JPH01245019A (ja) | 1975-11-07 | 1988-12-06 | 重合体の製法 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13313476A Granted JPS5284300A (en) | 1975-11-07 | 1976-11-05 | Ketone and sulfone polymer |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP63308707A Granted JPH01245019A (ja) | 1975-11-07 | 1988-12-06 | 重合体の製法 |
Country Status (5)
| Country | Link |
|---|---|
| JP (3) | JPS5284300A (enExample) |
| CA (1) | CA1112393A (enExample) |
| DE (1) | DE2650943A1 (enExample) |
| FR (1) | FR2330712A1 (enExample) |
| GB (1) | GB1567190A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1112393A (en) * | 1975-11-07 | 1981-11-10 | Klaus J. Dahl | Ketone and sulfone polymers |
| DE2730128C3 (de) * | 1976-07-08 | 1982-04-29 | Imperial Chemical Industries Ltd., London | Aromatische Polyäthersulfone und-ketone und deren Copolymere und Verfahren zu deren Herstellung |
| US4361693A (en) * | 1981-07-08 | 1982-11-30 | Raychem Corporation | Preparation of poly(arylene ketones) using thio- and dithiocarbonic acid derivatives |
| WO1984003891A1 (en) * | 1983-03-31 | 1984-10-11 | Raychem Corp | Preparation of aromatic polymers |
| ES8700677A1 (es) * | 1984-10-11 | 1986-11-16 | Raychem Corp | Metodo para la preparacion de un oligomero de arileno cetonao arileno sulfona |
| DE4424042A1 (de) | 1994-07-11 | 1996-01-18 | Basf Ag | Schwefeloxide und deren Halogenderivate als elektrophiles Endgruppenverschlußreagens bei der elektrophilen Synthese von Polyaryletherketonen |
| GB201409127D0 (en) * | 2014-05-22 | 2014-07-09 | Ketonex Ltd | Method |
| CN115010926B (zh) * | 2022-07-05 | 2023-06-20 | 中国科学院长春应用化学研究所 | 一种聚砜树脂及其制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2206835A1 (de) * | 1971-02-16 | 1972-10-26 | Raychem Corp., Menlo Park, Calif. (V.StA.) | Polyketone und Verfahren zu ihrer Herstellung |
| US3914298A (en) * | 1971-02-16 | 1975-10-21 | Raychem Corp | Biphenylyloxybenzoyl halides |
| SE407419B (sv) * | 1973-07-12 | 1979-03-26 | Raychem Corp | Smeltbearbetbar aromatisk polyketon |
| GB1541568A (en) * | 1975-08-20 | 1979-03-07 | Ici Ltd | Aromatic polymers |
| CA1112393A (en) * | 1975-11-07 | 1981-11-10 | Klaus J. Dahl | Ketone and sulfone polymers |
| DK158532C (da) * | 1987-07-14 | 1990-10-29 | Niro Atomizer As | Toerreapparat, der arbejder med fluid bed, og lejeplade dertil |
-
1976
- 1976-11-01 CA CA264,516A patent/CA1112393A/en not_active Expired
- 1976-11-05 FR FR7633454A patent/FR2330712A1/fr active Granted
- 1976-11-05 GB GB46173/76A patent/GB1567190A/en not_active Expired
- 1976-11-05 JP JP13313476A patent/JPS5284300A/ja active Granted
- 1976-11-08 DE DE19762650943 patent/DE2650943A1/de active Granted
-
1987
- 1987-06-09 JP JP62145024A patent/JPS6354429A/ja active Granted
-
1988
- 1988-12-06 JP JP63308707A patent/JPH01245019A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5284300A (en) | 1977-07-13 |
| CA1112393A (en) | 1981-11-10 |
| JPH0428732B2 (enExample) | 1992-05-15 |
| GB1567190A (en) | 1980-05-14 |
| FR2330712A1 (fr) | 1977-06-03 |
| DE2650943C2 (enExample) | 1987-09-10 |
| JPS6354429A (ja) | 1988-03-08 |
| DE2650943A1 (de) | 1977-05-12 |
| JPS6260411B2 (enExample) | 1987-12-16 |
| FR2330712B1 (enExample) | 1983-05-27 |
| JPH01245019A (ja) | 1989-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4247682A (en) | Aromatic ketone and sulfone polymers and process for the preparation thereof | |
| US3442857A (en) | Boron trifluoride-hydrogen fluoride catalyzed synthesis of poly(aromatic sulfone) and poly(aromatic ketone) polymers | |
| US3953400A (en) | Polyketones and methods therefor | |
| US3956240A (en) | Novel polyketones | |
| US4826947A (en) | Preparation of poly(arylene ether ketones) | |
| EP0124276A2 (en) | Preparation of aromatic polymers | |
| US4709007A (en) | Preparation of aromatic polymers | |
| US4229564A (en) | Friedel-Crafts polymerization of monomers in the preparation of polyketones and polysulfones | |
| JPS604210B2 (ja) | 電気絶縁重合の製法 | |
| JPH0133487B2 (enExample) | ||
| US4052365A (en) | Manufacture of crystallizable polymeric phenylene ether sulphone ketones | |
| US5145938A (en) | Preparation of poly(arylene ether ketones) | |
| JPS61211336A (ja) | ポリ(アリールエーテルケトン)の改良製造法 | |
| US4113699A (en) | Production of aromatic polymers | |
| JPS6191223A (ja) | 芳香族オリゴマーの製法 | |
| US4593086A (en) | Preparation of aromatic ketone-sulfone copolymers | |
| US4808693A (en) | Aryl ether ketone copolymers | |
| JPH0730178B2 (ja) | ポリ(アリーレンエーテルケトン)の製造方法 | |
| US4912195A (en) | Preparation of aromatic polymers using a specified quantity of Lewis acid | |
| KR930004616B1 (ko) | 폴리(아릴렌 에테르 케톤)의 제조방법 | |
| EP0191839B1 (en) | Aryl ether ketone copolymers | |
| US4024314A (en) | Electrical conductor insulated by a polyketones | |
| JPH0739488B2 (ja) | 非晶質重合体及びその製造方法 | |
| GB1569602A (en) | Production of aromatic polymers | |
| JPH0245520A (ja) | 結晶性芳香族ポリ(チオ)エーテルケトンの製造方法 |