JP4392061B2 - ヘテロ環誘導体および抗血栓剤としてのその使用 - Google Patents
ヘテロ環誘導体および抗血栓剤としてのその使用 Download PDFInfo
- Publication number
- JP4392061B2 JP4392061B2 JP54504198A JP54504198A JP4392061B2 JP 4392061 B2 JP4392061 B2 JP 4392061B2 JP 54504198 A JP54504198 A JP 54504198A JP 54504198 A JP54504198 A JP 54504198A JP 4392061 B2 JP4392061 B2 JP 4392061B2
- Authority
- JP
- Japan
- Prior art keywords
- amino
- added
- acid
- compound
- dichloromethane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000003146 anticoagulant agent Substances 0.000 title description 13
- 229960004676 antithrombotic agent Drugs 0.000 title description 6
- 125000000623 heterocyclic group Chemical group 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims description 441
- -1 methoxy, phenyloxy Chemical group 0.000 claims description 277
- 125000000217 alkyl group Chemical group 0.000 claims description 105
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 52
- 125000003118 aryl group Chemical group 0.000 claims description 47
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 29
- 125000001424 substituent group Chemical group 0.000 claims description 24
- 150000001413 amino acids Chemical class 0.000 claims description 22
- 125000005842 heteroatom Chemical group 0.000 claims description 21
- 229910052717 sulfur Inorganic materials 0.000 claims description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 229910052760 oxygen Inorganic materials 0.000 claims description 17
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 150000002367 halogens Chemical class 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 238000011282 treatment Methods 0.000 claims description 13
- 229920006395 saturated elastomer Polymers 0.000 claims description 12
- 239000003814 drug Substances 0.000 claims description 10
- 201000010099 disease Diseases 0.000 claims description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 9
- 208000007536 Thrombosis Diseases 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 230000002785 anti-thrombosis Effects 0.000 claims description 5
- 239000012634 fragment Substances 0.000 claims description 5
- 230000002265 prevention Effects 0.000 claims description 5
- 150000008575 L-amino acids Chemical class 0.000 claims description 4
- 239000004475 Arginine Substances 0.000 claims description 3
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 claims description 3
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 claims description 3
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 claims description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- CDULPPOISZOUTK-UHFFFAOYSA-N 2-azaniumyl-3,4-dihydro-1h-naphthalene-2-carboxylate Chemical compound C1=CC=C2CC(N)(C(O)=O)CCC2=C1 CDULPPOISZOUTK-UHFFFAOYSA-N 0.000 claims description 2
- UCUNFLYVYCGDHP-BYPYZUCNSA-N L-methionine sulfone Chemical compound CS(=O)(=O)CC[C@H](N)C(O)=O UCUNFLYVYCGDHP-BYPYZUCNSA-N 0.000 claims description 2
- 239000004472 Lysine Substances 0.000 claims description 2
- 239000002671 adjuvant Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- VVWUWTAURHNLGY-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-1-carboxylate Chemical compound C1CCCC2C(C(=O)O)NCCC21 VVWUWTAURHNLGY-UHFFFAOYSA-N 0.000 claims 1
- NSENYWQRQUNUGD-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-3-carboxylate Chemical compound C1CCCC2CNC(C(=O)O)CC21 NSENYWQRQUNUGD-UHFFFAOYSA-N 0.000 claims 1
- OXFGRWIKQDSSLY-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinolin-2-ium-1-carboxylate Chemical compound C1=CC=C2C(C(=O)O)NCCC2=C1 OXFGRWIKQDSSLY-UHFFFAOYSA-N 0.000 claims 1
- BWKMGYQJPOAASG-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CNC(C(=O)O)CC2=C1 BWKMGYQJPOAASG-UHFFFAOYSA-N 0.000 claims 1
- XJEVHMGJSYVQBQ-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-amine Chemical compound C1=CC=C2C(N)CCC2=C1 XJEVHMGJSYVQBQ-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 590
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 324
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 291
- 238000000034 method Methods 0.000 description 204
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 191
- 239000000243 solution Substances 0.000 description 171
- 239000000203 mixture Substances 0.000 description 170
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 170
- 229910001868 water Inorganic materials 0.000 description 153
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 141
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 129
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 118
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 114
- 238000005160 1H NMR spectroscopy Methods 0.000 description 109
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 102
- 238000003756 stirring Methods 0.000 description 99
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 94
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 88
- 239000011541 reaction mixture Substances 0.000 description 80
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 73
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 72
- 238000000668 atmospheric pressure chemical ionisation mass spectrometry Methods 0.000 description 71
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 69
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 62
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 62
- 239000002904 solvent Substances 0.000 description 61
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 59
- 239000007787 solid Substances 0.000 description 57
- 239000000741 silica gel Substances 0.000 description 50
- 229910002027 silica gel Inorganic materials 0.000 description 50
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 50
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 49
- 238000006243 chemical reaction Methods 0.000 description 49
- 239000012044 organic layer Substances 0.000 description 43
- 229920005989 resin Polymers 0.000 description 43
- 239000011347 resin Substances 0.000 description 43
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 39
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 38
- 239000003921 oil Substances 0.000 description 37
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 36
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 34
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 34
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 34
- 229910052938 sodium sulfate Inorganic materials 0.000 description 34
- 235000011152 sodium sulphate Nutrition 0.000 description 34
- 125000003545 alkoxy group Chemical group 0.000 description 33
- 125000004432 carbon atom Chemical group C* 0.000 description 33
- 239000012230 colorless oil Substances 0.000 description 32
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 31
- 235000019341 magnesium sulphate Nutrition 0.000 description 31
- 238000002844 melting Methods 0.000 description 30
- 230000008018 melting Effects 0.000 description 30
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 29
- 238000000746 purification Methods 0.000 description 29
- 239000012267 brine Substances 0.000 description 27
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 26
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 26
- 238000001914 filtration Methods 0.000 description 26
- 229910052757 nitrogen Inorganic materials 0.000 description 26
- 239000000377 silicon dioxide Substances 0.000 description 26
- 229960000583 acetic acid Drugs 0.000 description 25
- 238000004587 chromatography analysis Methods 0.000 description 25
- 239000007864 aqueous solution Substances 0.000 description 24
- 239000012458 free base Substances 0.000 description 23
- 239000010410 layer Substances 0.000 description 23
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 23
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 22
- 125000006239 protecting group Chemical group 0.000 description 22
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 20
- 229940024606 amino acid Drugs 0.000 description 20
- 235000001014 amino acid Nutrition 0.000 description 20
- 229910052799 carbon Chemical class 0.000 description 19
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 19
- 239000000725 suspension Substances 0.000 description 19
- 108090000190 Thrombin Proteins 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- 125000003342 alkenyl group Chemical group 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 17
- 150000001412 amines Chemical class 0.000 description 17
- 229960004072 thrombin Drugs 0.000 description 17
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 16
- 125000001769 aryl amino group Chemical group 0.000 description 16
- 229910052739 hydrogen Inorganic materials 0.000 description 16
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 16
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- 125000002252 acyl group Chemical group 0.000 description 14
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 14
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 14
- 235000017557 sodium bicarbonate Nutrition 0.000 description 14
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 14
- 229940122388 Thrombin inhibitor Drugs 0.000 description 13
- 125000000304 alkynyl group Chemical group 0.000 description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 13
- 238000004440 column chromatography Methods 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 13
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 12
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 12
- 239000003868 thrombin inhibitor Substances 0.000 description 12
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 11
- LWDVTRXNUGVQES-UHFFFAOYSA-N 6-(aminomethyl)isoquinolin-1-amine Chemical compound NC1=NC=CC2=CC(CN)=CC=C21 LWDVTRXNUGVQES-UHFFFAOYSA-N 0.000 description 11
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 230000002209 hydrophobic effect Effects 0.000 description 11
- 238000010532 solid phase synthesis reaction Methods 0.000 description 11
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- 125000001072 heteroaryl group Chemical group 0.000 description 10
- 125000001624 naphthyl group Chemical group 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 230000000144 pharmacologic effect Effects 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- 239000003039 volatile agent Substances 0.000 description 10
- LNOLJFCCYQZFBQ-BUHFOSPRSA-N (ne)-n-[(4-nitrophenyl)-phenylmethylidene]hydroxylamine Chemical compound C=1C=C([N+]([O-])=O)C=CC=1C(=N/O)/C1=CC=CC=C1 LNOLJFCCYQZFBQ-BUHFOSPRSA-N 0.000 description 9
- DWLYVEYCCPEHLX-UHFFFAOYSA-N 4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride Chemical compound COC1=CC(C)=C(S(Cl)(=O)=O)C(C)=C1C DWLYVEYCCPEHLX-UHFFFAOYSA-N 0.000 description 9
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 238000005859 coupling reaction Methods 0.000 description 9
- 238000010511 deprotection reaction Methods 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 238000004128 high performance liquid chromatography Methods 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000012279 sodium borohydride Substances 0.000 description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 description 9
- 230000001225 therapeutic effect Effects 0.000 description 9
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical group ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 8
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- 108010022999 Serine Proteases Proteins 0.000 description 8
- 102000012479 Serine Proteases Human genes 0.000 description 8
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 8
- 239000002024 ethyl acetate extract Substances 0.000 description 8
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 238000005897 peptide coupling reaction Methods 0.000 description 8
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 7
- ZQLGDZJSXZXKLU-UHFFFAOYSA-N 6-(aminomethyl)isoquinolin-1-amine;hydrochloride Chemical compound Cl.NC1=NC=CC2=CC(CN)=CC=C21 ZQLGDZJSXZXKLU-UHFFFAOYSA-N 0.000 description 7
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 7
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 7
- 238000004873 anchoring Methods 0.000 description 7
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 230000008878 coupling Effects 0.000 description 7
- 229940079593 drug Drugs 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 238000000605 extraction Methods 0.000 description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 7
- 125000004043 oxo group Chemical group O=* 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- XXRTUTXQDPQYDA-UHFFFAOYSA-N thieno[3,2-c]pyridine;hydrochloride Chemical compound Cl.N1=CC=C2SC=CC2=C1 XXRTUTXQDPQYDA-UHFFFAOYSA-N 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 6
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 6
- 108010080798 N(alpha)-(2-naphthylsulfonylglycyl)-4-amidinophenylalanine piperidide Proteins 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- NEDMOHHWRPHBAL-MERQFXBCSA-N benzyl (2s)-pyrrolidin-1-ium-2-carboxylate;chloride Chemical compound Cl.O=C([C@H]1NCCC1)OCC1=CC=CC=C1 NEDMOHHWRPHBAL-MERQFXBCSA-N 0.000 description 6
- 229910052796 boron Inorganic materials 0.000 description 6
- 239000002027 dichloromethane extract Substances 0.000 description 6
- ULRLHEXGRUWQLQ-UHFFFAOYSA-N diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)NC(=O)OC(C)(C)C ULRLHEXGRUWQLQ-UHFFFAOYSA-N 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 6
- 238000004108 freeze drying Methods 0.000 description 6
- 238000005984 hydrogenation reaction Methods 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- HQEIPVHJHZTMDP-JEDNCBNOSA-N methyl (2s)-pyrrolidine-2-carboxylate;hydrochloride Chemical compound Cl.COC(=O)[C@@H]1CCCN1 HQEIPVHJHZTMDP-JEDNCBNOSA-N 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 5
- 239000005711 Benzoic acid Substances 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 5
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical group NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- 125000004181 carboxyalkyl group Chemical group 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 5
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 5
- 230000035699 permeability Effects 0.000 description 5
- 239000008363 phosphate buffer Substances 0.000 description 5
- 108090000765 processed proteins & peptides Proteins 0.000 description 5
- 238000007127 saponification reaction Methods 0.000 description 5
- 238000010898 silica gel chromatography Methods 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000001544 thienyl group Chemical group 0.000 description 5
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 4
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- DFGBZXMIKBTZGK-UHFFFAOYSA-N 7-methoxyisoquinolin-1-amine Chemical compound C1=CN=C(N)C2=CC(OC)=CC=C21 DFGBZXMIKBTZGK-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- ZGUNAGUHMKGQNY-SSDOTTSWSA-N D-alpha-phenylglycine Chemical compound OC(=O)[C@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-SSDOTTSWSA-N 0.000 description 4
- 150000008574 D-amino acids Chemical class 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- 101000712605 Theromyzon tessulatum Theromin Proteins 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 4
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 4
- 150000003862 amino acid derivatives Chemical class 0.000 description 4
- 229940127219 anticoagulant drug Drugs 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 150000001721 carbon Chemical class 0.000 description 4
- 150000007942 carboxylates Chemical group 0.000 description 4
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 4
- 210000001035 gastrointestinal tract Anatomy 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- MSQACBWWAIBWIC-UHFFFAOYSA-N hydron;piperazine;chloride Chemical compound Cl.C1CNCCN1 MSQACBWWAIBWIC-UHFFFAOYSA-N 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- OQGJVKZPYPFGTN-UHFFFAOYSA-N n-(6-formylisoquinolin-1-yl)benzamide Chemical compound N=1C=CC2=CC(C=O)=CC=C2C=1NC(=O)C1=CC=CC=C1 OQGJVKZPYPFGTN-UHFFFAOYSA-N 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- YYFIGOPUHPDIBO-UHFFFAOYSA-N propanoic acid;hydrochloride Chemical compound Cl.CCC(O)=O YYFIGOPUHPDIBO-UHFFFAOYSA-N 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- 239000003001 serine protease inhibitor Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- YFUUYSQSNCVZEY-CABCVRRESA-N (2s)-1-[(2r)-2-acetamido-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1C[C@@H](NC(C)=O)C(=O)N1[C@H](C(O)=O)CCC1 YFUUYSQSNCVZEY-CABCVRRESA-N 0.000 description 3
- DCLQRYQVDOXHAX-WDYNHAJCSA-N (2s)-1-[(2r)-2-acetamido-3-(4-phenylphenyl)propanoyl]-n-[(1-aminoisoquinolin-6-yl)methyl]pyrrolidine-2-carboxamide Chemical compound C([C@@H](NC(=O)C)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C(C=C1)=CC=C1C1=CC=CC=C1 DCLQRYQVDOXHAX-WDYNHAJCSA-N 0.000 description 3
- ZJVNMFUPWKLVEF-PKTZIBPZSA-N (2s)-1-[(2r)-2-acetamido-3-phenylpropanoyl]-n-[(1-aminoisoquinolin-6-yl)methyl]pyrrolidine-2-carboxamide Chemical compound C([C@@H](NC(=O)C)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C1=CC=CC=C1 ZJVNMFUPWKLVEF-PKTZIBPZSA-N 0.000 description 3
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical group C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 3
- SCZNXLWKYFICFV-UHFFFAOYSA-N 1,2,3,4,5,7,8,9-octahydropyrido[1,2-b]diazepine Chemical compound C1CCCNN2CCCC=C21 SCZNXLWKYFICFV-UHFFFAOYSA-N 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- ZESKRVSPQJVIMH-UHFFFAOYSA-N 1,3-dimethoxypropan-2-ol Chemical compound COCC(O)COC ZESKRVSPQJVIMH-UHFFFAOYSA-N 0.000 description 3
- FPYFLECMGUTMQO-UHFFFAOYSA-N 1,3-dimethoxypropan-2-yl methanesulfonate Chemical compound COCC(COC)OS(C)(=O)=O FPYFLECMGUTMQO-UHFFFAOYSA-N 0.000 description 3
- SZNOIFCVHBOKDB-UHFFFAOYSA-N 1-aminoisoquinoline-7-carbonitrile Chemical compound C1=C(C#N)C=C2C(N)=NC=CC2=C1 SZNOIFCVHBOKDB-UHFFFAOYSA-N 0.000 description 3
- 238000004293 19F NMR spectroscopy Methods 0.000 description 3
- HDVHFHONOKCUHQ-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1,4-benzoxazepine Chemical compound C1NCCOC2=CC=CC=C21 HDVHFHONOKCUHQ-UHFFFAOYSA-N 0.000 description 3
- LKMJVFRMDSNFRT-UHFFFAOYSA-N 2-(methoxymethyl)oxirane Chemical compound COCC1CO1 LKMJVFRMDSNFRT-UHFFFAOYSA-N 0.000 description 3
- JXDSAGQPKRLOGM-YDALLXLXSA-N 2-[1-[(2s)-2-[(1-aminoisoquinoline-6-carbonyl)amino]propanoyl]piperidin-4-yl]oxyacetic acid;hydrochloride Chemical compound Cl.O=C([C@@H](NC(=O)C=1C=C2C=CN=C(N)C2=CC=1)C)N1CCC(OCC(O)=O)CC1 JXDSAGQPKRLOGM-YDALLXLXSA-N 0.000 description 3
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 3
- KFYXVTLWTKYPLL-UHFFFAOYSA-N 4-(4-bromophenoxy)oxane Chemical compound C1=CC(Br)=CC=C1OC1CCOCC1 KFYXVTLWTKYPLL-UHFFFAOYSA-N 0.000 description 3
- ZOHSCBXEKHQRRV-UHFFFAOYSA-N 4-(oxan-4-yloxy)benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1OC1CCOCC1 ZOHSCBXEKHQRRV-UHFFFAOYSA-N 0.000 description 3
- UEZOWZMPPATEKU-UHFFFAOYSA-N 4-[(4-bromophenyl)methoxy]oxane Chemical compound C1=CC(Br)=CC=C1COC1CCOCC1 UEZOWZMPPATEKU-UHFFFAOYSA-N 0.000 description 3
- ZZDMBYKFNRDSKR-UHFFFAOYSA-N 4-benzyl-3,5-dihydro-2h-1,4-benzoxazepine Chemical compound C1COC2=CC=CC=C2CN1CC1=CC=CC=C1 ZZDMBYKFNRDSKR-UHFFFAOYSA-N 0.000 description 3
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 3
- AFXVXXUGDMGQAM-UHFFFAOYSA-N 7-(aminomethyl)isoquinolin-1-amine Chemical compound C1=CN=C(N)C2=CC(CN)=CC=C21 AFXVXXUGDMGQAM-UHFFFAOYSA-N 0.000 description 3
- LXAVILSQSMMEEB-UHFFFAOYSA-N 7-methoxy-3,4-dihydro-1h-isoquinoline-2-sulfonyl chloride Chemical compound C1CN(S(Cl)(=O)=O)CC2=CC(OC)=CC=C21 LXAVILSQSMMEEB-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- DRXRCMODCCAVQK-UHFFFAOYSA-N Cl.CN(NC(=O)N1CCNCC1)C Chemical compound Cl.CN(NC(=O)N1CCNCC1)C DRXRCMODCCAVQK-UHFFFAOYSA-N 0.000 description 3
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 3
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 3
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 3
- 125000005085 alkoxycarbonylalkoxy group Chemical group 0.000 description 3
- 125000001118 alkylidene group Chemical group 0.000 description 3
- 125000004103 aminoalkyl group Chemical group 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- 150000001602 bicycloalkyls Chemical group 0.000 description 3
- 230000023555 blood coagulation Effects 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- LPSMMAHYAIVSQW-UHFFFAOYSA-N chembl2354423 Chemical compound OC1=CC=CC=C1C=NCC1=CC=CC=C1 LPSMMAHYAIVSQW-UHFFFAOYSA-N 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000021615 conjugation Effects 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 3
- 238000001212 derivatisation Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-M ethanimidate Chemical compound CC([O-])=N DLFVBJFMPXGRIB-UHFFFAOYSA-M 0.000 description 3
- RAHXQTIRIXWLHN-KGQXAQPSSA-N ethyl 2-[[(2r)-1-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]amino]acetate;hydrochloride Chemical compound Cl.C([C@@H](NCC(=O)OCC)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C1=CC=C(OC)C=C1 RAHXQTIRIXWLHN-KGQXAQPSSA-N 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- CATCEAMVLJKHPY-RPWUZVMVSA-N ethyl n-[(2r)-1-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate Chemical compound C([C@@H](NC(=O)OCC)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C1=CC=C(OC)C=C1 CATCEAMVLJKHPY-RPWUZVMVSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- IWMQAUYDCYPLFK-UHFFFAOYSA-N furo[3,2-c]pyridin-4-amine Chemical compound NC1=NC=CC2=C1C=CO2 IWMQAUYDCYPLFK-UHFFFAOYSA-N 0.000 description 3
- 229960002449 glycine Drugs 0.000 description 3
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 230000001976 improved effect Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 125000005647 linker group Chemical group 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- XJTFHPJDCFATKX-UHFFFAOYSA-N methyl 3-(1-aminoisoquinolin-6-yl)-2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]propanoate;hydrochloride Chemical compound Cl.C1=CC=CC2=CC(S(=O)(=O)NCC(=O)NC(CC=3C=C4C=CN=C(N)C4=CC=3)C(=O)OC)=CC=C21 XJTFHPJDCFATKX-UHFFFAOYSA-N 0.000 description 3
- JJZSSAFQMKULNF-UHFFFAOYSA-N methyl 3-[4-(methylamino)piperidin-1-yl]-3-oxopropanoate;hydrochloride Chemical compound Cl.CNC1CCN(C(=O)CC(=O)OC)CC1 JJZSSAFQMKULNF-UHFFFAOYSA-N 0.000 description 3
- BIXZAEXNDGCIEU-LEWJYISDSA-N methyl n-[(1r)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]carbamate Chemical compound C1([C@@H](NC(=O)OC)C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)CCCCC1 BIXZAEXNDGCIEU-LEWJYISDSA-N 0.000 description 3
- UVICIAUWWQPIDT-LEWJYISDSA-N methyl n-[(1r)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate Chemical compound C1([C@H](C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)NC(=O)OC)=CC=CC=C1 UVICIAUWWQPIDT-LEWJYISDSA-N 0.000 description 3
- OJVSEHLMRCLAFY-UHFFFAOYSA-N methyl propanoate;hydrochloride Chemical compound Cl.CCC(=O)OC OJVSEHLMRCLAFY-UHFFFAOYSA-N 0.000 description 3
- CLEPLLSXCINGDT-UHFFFAOYSA-N n-[(1-aminoisoquinolin-6-yl)methyl]-2-[3-(cyclohexylmethylsulfonylamino)-6-methyl-2-oxopyridin-1-yl]acetamide;hydrochloride Chemical compound Cl.O=C1N(CC(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)C(C)=CC=C1NS(=O)(=O)CC1CCCCC1 CLEPLLSXCINGDT-UHFFFAOYSA-N 0.000 description 3
- CHHOGAXEDDUADQ-BQAIUKQQSA-N n-[(3s)-1-[(1-aminoisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxynaphthalene-2-sulfonamide;hydrochloride Chemical compound Cl.C1=CN=C(N)C2=CC(CN3CC[C@@H](C3=O)NS(=O)(=O)C=3C=CC4=CC=C(C=C4C=3)OC)=CC=C21 CHHOGAXEDDUADQ-BQAIUKQQSA-N 0.000 description 3
- AJUXPZYEAQUZPG-BDQAORGHSA-N n-[(3s)-1-[(4-aminofuro[3,2-c]pyridin-2-yl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxynaphthalene-2-sulfonamide;hydrochloride Chemical compound Cl.N1=CC=C2OC(CN3CC[C@@H](C3=O)NS(=O)(=O)C=3C=CC4=CC=C(C=C4C=3)OC)=CC2=C1N AJUXPZYEAQUZPG-BDQAORGHSA-N 0.000 description 3
- PLUBMYGGIPAHKJ-UHFFFAOYSA-N n-[3-(1-aminoisoquinolin-6-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-7-methoxynaphthalene-2-sulfonamide;hydrochloride Chemical compound Cl.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)NC(CC=1C=C2C=CN=C(N)C2=CC=1)C(=O)N1CCC(C)CC1 PLUBMYGGIPAHKJ-UHFFFAOYSA-N 0.000 description 3
- PJAOTVAHBAEGRY-UHFFFAOYSA-N n-[3-(1-aminoisoquinolin-6-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]naphthalene-2-sulfonamide;hydrochloride Chemical compound Cl.C1CC(C)CCN1C(=O)C(NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CC=C(C(N)=NC=C2)C2=C1 PJAOTVAHBAEGRY-UHFFFAOYSA-N 0.000 description 3
- DRQCLQSHMSBYBY-UHFFFAOYSA-N n-[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]acetamide;hydrochloride Chemical compound Cl.CC=1C=2CCC(C)(C)OC=2C(C)=C(C)C=1S(=O)(=O)NCC(=O)NC(CC=1C=C2C=CN=C(N)C2=CC=1)C(=O)N1CCCCC1 DRQCLQSHMSBYBY-UHFFFAOYSA-N 0.000 description 3
- JIBHSYSCMZZKEE-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-4-(1,3-dimethoxypropan-2-yloxy)benzenesulfonamide Chemical compound C1=CC(OC(COC)COC)=CC=C1S(=O)(=O)NC(C(=O)N1CCC(C)CC1)CC1=CC2=C(N)N=CC=C2S1 JIBHSYSCMZZKEE-UHFFFAOYSA-N 0.000 description 3
- WOSLDKHKULSKTH-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-4-(2-methoxyethoxy)benzenesulfonamide Chemical compound C1=CC(OCCOC)=CC=C1S(=O)(=O)NC(C(=O)N1CCC(C)CC1)CC1=CC2=C(N)N=CC=C2S1 WOSLDKHKULSKTH-UHFFFAOYSA-N 0.000 description 3
- UDIITLBSPBGADJ-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-4-(oxan-4-yloxy)benzenesulfonamide Chemical compound C1CC(C)CCN1C(=O)C(NS(=O)(=O)C=1C=CC(OC2CCOCC2)=CC=1)CC1=CC2=C(N)N=CC=C2S1 UDIITLBSPBGADJ-UHFFFAOYSA-N 0.000 description 3
- FHIDFRWHRKREHL-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-4-(oxan-4-yloxymethyl)benzenesulfonamide Chemical compound C1CC(C)CCN1C(=O)C(NS(=O)(=O)C=1C=CC(COC2CCOCC2)=CC=1)CC1=CC2=C(N)N=CC=C2S1 FHIDFRWHRKREHL-UHFFFAOYSA-N 0.000 description 3
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 3
- 230000014508 negative regulation of coagulation Effects 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 229960001639 penicillamine Drugs 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- 229960002429 proline Drugs 0.000 description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 3
- 229960001153 serine Drugs 0.000 description 3
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 3
- 229960002218 sodium chlorite Drugs 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 125000006850 spacer group Chemical group 0.000 description 3
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- ZUSJOPVAEBYKDF-UHFFFAOYSA-N thieno[2,3-c]pyridin-7-amine Chemical compound NC1=NC=CC2=C1SC=C2 ZUSJOPVAEBYKDF-UHFFFAOYSA-N 0.000 description 3
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 3
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- NFYZVVPQGJBDRO-UHFFFAOYSA-N (1-aminoisoquinolin-7-yl) trifluoromethanesulfonate Chemical compound C1=C(OS(=O)(=O)C(F)(F)F)C=C2C(N)=NC=CC2=C1 NFYZVVPQGJBDRO-UHFFFAOYSA-N 0.000 description 2
- TWFHYROHKYJRCK-LLVKDONJSA-N (2r)-2-(2-methylpropoxycarbonylamino)-2-phenylacetic acid Chemical compound CC(C)COC(=O)N[C@@H](C(O)=O)C1=CC=CC=C1 TWFHYROHKYJRCK-LLVKDONJSA-N 0.000 description 2
- RBYBUHMCHHFGHS-SECBINFHSA-N (2r)-2-(ethoxycarbonylamino)-2-phenylacetic acid Chemical compound CCOC(=O)N[C@@H](C(O)=O)C1=CC=CC=C1 RBYBUHMCHHFGHS-SECBINFHSA-N 0.000 description 2
- SNYFMTKGMHWVGU-LLVKDONJSA-N (2r)-2-(ethoxycarbonylamino)-3-(4-methoxyphenyl)propanoic acid Chemical compound CCOC(=O)N[C@@H](C(O)=O)CC1=CC=C(OC)C=C1 SNYFMTKGMHWVGU-LLVKDONJSA-N 0.000 description 2
- FSCKXSDDVQQISQ-SECBINFHSA-N (2r)-2-(methanesulfonamido)-3-phenylpropanoic acid Chemical compound CS(=O)(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 FSCKXSDDVQQISQ-SECBINFHSA-N 0.000 description 2
- GOJLQSAREKTKPT-MRVPVSSYSA-N (2r)-2-(methoxycarbonylamino)-2-phenylacetic acid Chemical compound COC(=O)N[C@@H](C(O)=O)C1=CC=CC=C1 GOJLQSAREKTKPT-MRVPVSSYSA-N 0.000 description 2
- HDNGVBPPMAZUMI-MRXNPFEDSA-N (2r)-2-acetamido-3-(4-phenylphenyl)propanoic acid Chemical compound C1=CC(C[C@@H](NC(=O)C)C(O)=O)=CC=C1C1=CC=CC=C1 HDNGVBPPMAZUMI-MRXNPFEDSA-N 0.000 description 2
- MSADRQUZKXVYJQ-ZCFIWIBFSA-N (2r)-2-amino-3-methyl-3-propan-2-ylsulfanylbutanoic acid Chemical compound CC(C)SC(C)(C)[C@H](N)C(O)=O MSADRQUZKXVYJQ-ZCFIWIBFSA-N 0.000 description 2
- MGVZQBJQSINRSX-SECBINFHSA-N (2r)-2-cyclohexyl-2-(ethoxycarbonylamino)acetic acid Chemical compound CCOC(=O)N[C@@H](C(O)=O)C1CCCCC1 MGVZQBJQSINRSX-SECBINFHSA-N 0.000 description 2
- HJGZINIAIGNIHH-MRVPVSSYSA-N (2r)-2-cyclohexyl-2-(methoxycarbonylamino)acetic acid Chemical compound COC(=O)N[C@@H](C(O)=O)C1CCCCC1 HJGZINIAIGNIHH-MRVPVSSYSA-N 0.000 description 2
- CUSUMDVSPPALSO-SNVBAGLBSA-N (2r)-2-phenyl-2-(propan-2-yloxycarbonylamino)acetic acid Chemical compound CC(C)OC(=O)N[C@@H](C(O)=O)C1=CC=CC=C1 CUSUMDVSPPALSO-SNVBAGLBSA-N 0.000 description 2
- SLWWWZWJISHVOU-GFCCVEGCSA-N (2r)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound COC1=CC=C(C[C@@H](NC(=O)OC(C)(C)C)C(O)=O)C=C1 SLWWWZWJISHVOU-GFCCVEGCSA-N 0.000 description 2
- AFOQGTYVWYUOME-LSDHHAIUSA-N (2s)-1-[(2r)-2-(2-methylpropoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylic acid Chemical compound O=C([C@H](NC(=O)OCC(C)C)C=1C=CC=CC=1)N1CCC[C@H]1C(O)=O AFOQGTYVWYUOME-LSDHHAIUSA-N 0.000 description 2
- QPKZIBRGEZEILC-QWHCGFSZSA-N (2s)-1-[(2r)-2-(ethoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylic acid Chemical compound O=C([C@H](NC(=O)OCC)C=1C=CC=CC=1)N1CCC[C@H]1C(O)=O QPKZIBRGEZEILC-QWHCGFSZSA-N 0.000 description 2
- OXKUFTWKVLWIBS-CABCVRRESA-N (2s)-1-[(2r)-2-(ethoxycarbonylamino)-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](NC(=O)OCC)C(=O)N1[C@@H](CCC1)C(O)=O)C1=CC=C(OC)C=C1 OXKUFTWKVLWIBS-CABCVRRESA-N 0.000 description 2
- CYMKRVPCUZEVSE-GXTWGEPZSA-N (2s)-1-[(2r)-2-(ethoxycarbonylamino)-3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbutanoyl]pyrrolidine-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)CSC(C)(C)[C@H](NC(=O)OCC)C(=O)N1CCC[C@H]1C(O)=O CYMKRVPCUZEVSE-GXTWGEPZSA-N 0.000 description 2
- JXOXQCUIWXHEMD-NWDGAFQWSA-N (2s)-1-[(2r)-2-(ethoxycarbonylamino)-3-methyl-3-propan-2-ylsulfanylbutanoyl]pyrrolidine-2-carboxylic acid Chemical compound CCOC(=O)N[C@@H](C(C)(C)SC(C)C)C(=O)N1CCC[C@H]1C(O)=O JXOXQCUIWXHEMD-NWDGAFQWSA-N 0.000 description 2
- LCWKJYLQMGUURJ-OLZOCXBDSA-N (2s)-1-[(2r)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](NS(=O)(=O)C)C(=O)N1[C@@H](CCC1)C(O)=O)C1=CC=CC=C1 LCWKJYLQMGUURJ-OLZOCXBDSA-N 0.000 description 2
- ZWTRXMWPIYTIRP-NWDGAFQWSA-N (2s)-1-[(2r)-2-(methoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylic acid Chemical compound O=C([C@H](NC(=O)OC)C=1C=CC=CC=1)N1CCC[C@H]1C(O)=O ZWTRXMWPIYTIRP-NWDGAFQWSA-N 0.000 description 2
- UKWOISDEPIVXRB-KGLIPLIRSA-N (2s)-1-[(2r)-2-acetamido-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](NC(=O)C)C(=O)N1[C@@H](CCC1)C(O)=O)C1=CC=CC=C1 UKWOISDEPIVXRB-KGLIPLIRSA-N 0.000 description 2
- AIUVVHMXKIMTJR-QWHCGFSZSA-N (2s)-1-[(2r)-2-cyclohexyl-2-(ethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylic acid Chemical compound C1([C@@H](NC(=O)OCC)C(=O)N2[C@@H](CCC2)C(O)=O)CCCCC1 AIUVVHMXKIMTJR-QWHCGFSZSA-N 0.000 description 2
- VKCFKRGDPPWEGP-NWDGAFQWSA-N (2s)-1-[(2r)-2-cyclohexyl-2-(methoxycarbonylamino)acetyl]pyrrolidine-2-carboxylic acid Chemical compound C1([C@@H](NC(=O)OC)C(=O)N2[C@@H](CCC2)C(O)=O)CCCCC1 VKCFKRGDPPWEGP-NWDGAFQWSA-N 0.000 description 2
- ZWTRXMWPIYTIRP-RYUDHWBXSA-N (2s)-1-[(2s)-2-(methoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylic acid Chemical compound O=C([C@@H](NC(=O)OC)C=1C=CC=CC=1)N1CCC[C@H]1C(O)=O ZWTRXMWPIYTIRP-RYUDHWBXSA-N 0.000 description 2
- UUCUXNHDRDQXJK-ZDUSSCGKSA-N (2s)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound COC1=CC(C)=C(S(=O)(=O)N[C@@H](CC(=O)OC(C)(C)C)C(O)=O)C(C)=C1C UUCUXNHDRDQXJK-ZDUSSCGKSA-N 0.000 description 2
- DQVDQWQQYAYCJC-HHDUEHQLSA-N (2s)-2-[1-(2-aminopropanoyl)piperidin-4-yl]oxy-3,3-dimethylbutanoic acid;hydrochloride Chemical compound Cl.CC(N)C(=O)N1CCC(O[C@H](C(O)=O)C(C)(C)C)CC1 DQVDQWQQYAYCJC-HHDUEHQLSA-N 0.000 description 2
- HZAWARMUSHZTEL-JANGERMGSA-N (2s)-2-[1-[2-[(1-aminoisoquinoline-6-carbonyl)amino]propanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid Chemical compound C=1C=C2C(N)=NC=CC2=CC=1C(=O)NC(C)C(=O)N1CCC(O[C@H](C(O)=O)C(C)(C)C)CC1 HZAWARMUSHZTEL-JANGERMGSA-N 0.000 description 2
- OWJANEXICRZDJT-FVGYRXGTSA-N (2s)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride Chemical compound Cl.COC1=CC=C(C[C@H](N)C(O)=O)C=C1 OWJANEXICRZDJT-FVGYRXGTSA-N 0.000 description 2
- YYOYGNNKIXHQNU-RPWUZVMVSA-N (2s)-n-[(1-aminoisoquinolin-6-yl)methyl]-1-[(2r)-2-(ethylcarbamoylamino)-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxamide Chemical compound C([C@@H](NC(=O)NCC)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C1=CC=C(OC)C=C1 YYOYGNNKIXHQNU-RPWUZVMVSA-N 0.000 description 2
- WJLBJUYLCLTCNE-MKSHZDIXSA-N (2s)-n-[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride Chemical compound Cl.CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@H](C(=O)NC(CC=1C=C2C=CN=C(N)C2=CC=1)C(=O)N1CCCCC1)CC(=O)N1CCOCC1 WJLBJUYLCLTCNE-MKSHZDIXSA-N 0.000 description 2
- VZXQYACYLGRQJU-IBGZPJMESA-N (3s)-3-(9h-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound C1=CC=C2C(COC(=O)N[C@@H](CC(O)=O)C(=O)OC(C)(C)C)C3=CC=CC=C3C2=C1 VZXQYACYLGRQJU-IBGZPJMESA-N 0.000 description 2
- IADUEWIQBXOCDZ-VKHMYHEASA-N (S)-azetidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCN1 IADUEWIQBXOCDZ-VKHMYHEASA-N 0.000 description 2
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 2
- MSSDTZLYNMFTKN-UHFFFAOYSA-N 1-Piperazinecarboxaldehyde Chemical compound O=CN1CCNCC1 MSSDTZLYNMFTKN-UHFFFAOYSA-N 0.000 description 2
- RXUCSGSFYHUFFS-UHFFFAOYSA-N 1-aminoisoquinolin-7-ol Chemical compound C1=C(O)C=C2C(N)=NC=CC2=C1 RXUCSGSFYHUFFS-UHFFFAOYSA-N 0.000 description 2
- UKTWWIFYTHAJSC-UHFFFAOYSA-N 1-aminoisoquinoline-6-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=C2C(N)=NC=CC2=C1 UKTWWIFYTHAJSC-UHFFFAOYSA-N 0.000 description 2
- FJAGSCMUURUHRP-UHFFFAOYSA-N 1-benzamidoisoquinoline-6-carboxylic acid Chemical compound N=1C=CC2=CC(C(=O)O)=CC=C2C=1NC(=O)C1=CC=CC=C1 FJAGSCMUURUHRP-UHFFFAOYSA-N 0.000 description 2
- SSBMOLGNIQJGPF-UHFFFAOYSA-N 1-chloro-7-methoxyisoquinoline Chemical compound C1=CN=C(Cl)C2=CC(OC)=CC=C21 SSBMOLGNIQJGPF-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- ZZAKLGGGMWORRT-UHFFFAOYSA-N 1-methylsulfonylpiperazine Chemical compound CS(=O)(=O)N1CCNCC1 ZZAKLGGGMWORRT-UHFFFAOYSA-N 0.000 description 2
- CQYBNXGHMBNGCG-UHFFFAOYSA-N 2,3,3a,4,5,6,7,7a-octahydro-1h-indol-1-ium-2-carboxylate Chemical compound C1CCCC2NC(C(=O)O)CC21 CQYBNXGHMBNGCG-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 2
- SXIYEBVAQTUBOQ-UHFFFAOYSA-N 2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1h-isoquinoline-7-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2CN(C(=O)C(F)(F)F)CCC2=C1 SXIYEBVAQTUBOQ-UHFFFAOYSA-N 0.000 description 2
- IIAVARXHHDUECN-UHFFFAOYSA-N 2-(aminomethyl)furo[3,2-c]pyridin-4-amine Chemical compound N1=CC=C2OC(CN)=CC2=C1N IIAVARXHHDUECN-UHFFFAOYSA-N 0.000 description 2
- GRWTXGMSEGMHSP-UHFFFAOYSA-N 2-(benzyliminomethyl)-4-methoxyphenol Chemical compound COC1=CC=C(O)C(C=NCC=2C=CC=CC=2)=C1 GRWTXGMSEGMHSP-UHFFFAOYSA-N 0.000 description 2
- NFQWSKHSARJBQH-UHFFFAOYSA-N 2-[(benzylamino)methyl]-4-methoxyphenol Chemical compound COC1=CC=C(O)C(CNCC=2C=CC=CC=2)=C1 NFQWSKHSARJBQH-UHFFFAOYSA-N 0.000 description 2
- FEIYUDNHQFTSBE-UHFFFAOYSA-N 2-[(benzylamino)methyl]phenol Chemical compound OC1=CC=CC=C1CNCC1=CC=CC=C1 FEIYUDNHQFTSBE-UHFFFAOYSA-N 0.000 description 2
- RYPOXBDLMSZBPT-UHFFFAOYSA-N 2-[3-(cyclohexylmethylsulfonylamino)-6-methyl-2-oxopyridin-1-yl]acetic acid Chemical compound O=C1N(CC(O)=O)C(C)=CC=C1NS(=O)(=O)CC1CCCCC1 RYPOXBDLMSZBPT-UHFFFAOYSA-N 0.000 description 2
- CDPROXZBMHOBTQ-SJORKVTESA-N 2-[[(2r)-3-cyclohexyl-1-[(2s)-2-[3-(diaminomethylideneamino)propylcarbamoyl]piperidin-1-yl]-1-oxopropan-2-yl]amino]acetic acid Chemical compound NC(N)=NCCCNC(=O)[C@@H]1CCCCN1C(=O)[C@H](NCC(O)=O)CC1CCCCC1 CDPROXZBMHOBTQ-SJORKVTESA-N 0.000 description 2
- IFQVEYUAIINTRX-UHFFFAOYSA-N 2-methoxyethoxybenzene Chemical compound COCCOC1=CC=CC=C1 IFQVEYUAIINTRX-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- RSOSKNFBSNZOPW-BJKOFHAPSA-N 2-methylpropyl n-[(1r)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate Chemical compound C1([C@H](C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)NC(=O)OCC(C)C)=CC=CC=C1 RSOSKNFBSNZOPW-BJKOFHAPSA-N 0.000 description 2
- FQKZZFIGDKOXCH-UHFFFAOYSA-N 3,5-dihydro-2h-1,4-benzoxazepine-4-sulfonyl chloride Chemical compound C1N(S(=O)(=O)Cl)CCOC2=CC=CC=C21 FQKZZFIGDKOXCH-UHFFFAOYSA-N 0.000 description 2
- QATVILGNIBYYOI-UHFFFAOYSA-N 3-(1-aminoisoquinolin-6-yl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=C2C(N)=NC=CC2=C1 QATVILGNIBYYOI-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- CNGLDNGVMBDDMY-UHFFFAOYSA-N 4-(1,3-dimethoxypropan-2-yloxy)benzenesulfonyl chloride Chemical compound COCC(COC)OC1=CC=C(S(Cl)(=O)=O)C=C1 CNGLDNGVMBDDMY-UHFFFAOYSA-N 0.000 description 2
- QGHZEYHFQCDRAT-UHFFFAOYSA-N 4-(2-methoxyethoxy)benzenesulfonyl chloride Chemical compound COCCOC1=CC=C(S(Cl)(=O)=O)C=C1 QGHZEYHFQCDRAT-UHFFFAOYSA-N 0.000 description 2
- HSDWYZFEJNYNLU-UHFFFAOYSA-N 4-(oxan-4-yloxymethyl)benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1COC1CCOCC1 HSDWYZFEJNYNLU-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- NSDFTKRKGGXZRE-UHFFFAOYSA-N 4-aminofuro[3,2-c]pyridine-2-carbonitrile Chemical compound NC1=NC=CC2=C1C=C(C#N)O2 NSDFTKRKGGXZRE-UHFFFAOYSA-N 0.000 description 2
- DEYIRCMGXXEBMU-UHFFFAOYSA-N 4-benzyl-5h-1,4-benzoxazepin-3-one Chemical compound O=C1COC2=CC=CC=C2CN1CC1=CC=CC=C1 DEYIRCMGXXEBMU-UHFFFAOYSA-N 0.000 description 2
- JLQMAXUDVOAAEW-UHFFFAOYSA-N 4-benzyl-7-methoxy-5h-1,4-benzoxazepin-3-one Chemical compound C1C2=CC(OC)=CC=C2OCC(=O)N1CC1=CC=CC=C1 JLQMAXUDVOAAEW-UHFFFAOYSA-N 0.000 description 2
- OPFFYLJLHPZSEO-UHFFFAOYSA-N 4-chlorofuro[3,2-c]pyridine Chemical compound ClC1=NC=CC2=C1C=CO2 OPFFYLJLHPZSEO-UHFFFAOYSA-N 0.000 description 2
- DMFJRRMECZFOKR-UHFFFAOYSA-N 4-methoxypiperidine;hydrochloride Chemical compound Cl.COC1CCNCC1 DMFJRRMECZFOKR-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- FZHSPPYCNDYIKD-UHFFFAOYSA-N 5-methoxysalicylaldehyde Chemical compound COC1=CC=C(O)C(C=O)=C1 FZHSPPYCNDYIKD-UHFFFAOYSA-N 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- KABRXLINDSPGDF-UHFFFAOYSA-N 7-bromoisoquinoline Chemical compound C1=CN=CC2=CC(Br)=CC=C21 KABRXLINDSPGDF-UHFFFAOYSA-N 0.000 description 2
- BPSLFSXCUJYFIR-UHFFFAOYSA-N 7-methoxy-1,2,3,4-tetrahydroisoquinoline Chemical compound C1CNCC2=CC(OC)=CC=C21 BPSLFSXCUJYFIR-UHFFFAOYSA-N 0.000 description 2
- GVRIYCPXRDOLRG-UHFFFAOYSA-N 7-methoxy-2,3,4,5-tetrahydro-1,4-benzoxazepine Chemical compound O1CCNCC2=CC(OC)=CC=C21 GVRIYCPXRDOLRG-UHFFFAOYSA-N 0.000 description 2
- ZECWOBKRZDCHLA-UHFFFAOYSA-N 7-methoxy-2-oxidoisoquinolin-2-ium;hydrochloride Chemical compound Cl.C1=C[N+]([O-])=CC2=CC(OC)=CC=C21 ZECWOBKRZDCHLA-UHFFFAOYSA-N 0.000 description 2
- YNWBOVKCLIYOMS-UHFFFAOYSA-N 7-methoxy-3,5-dihydro-2h-1,4-benzoxazepine-4-sulfonyl chloride Chemical compound O1CCN(S(Cl)(=O)=O)CC2=CC(OC)=CC=C21 YNWBOVKCLIYOMS-UHFFFAOYSA-N 0.000 description 2
- ZEXCZHWVXMIOFB-UHFFFAOYSA-N 7-methoxynaphthalene-2-sulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=CC(OC)=CC=C21 ZEXCZHWVXMIOFB-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- MITGKKFYIJJQGL-UHFFFAOYSA-N 9-(4-chlorobenzoyl)-6-methylsulfonyl-2,3-dihydro-1H-carbazol-4-one Chemical compound ClC1=CC=C(C(=O)N2C3=CC=C(C=C3C=3C(CCCC2=3)=O)S(=O)(=O)C)C=C1 MITGKKFYIJJQGL-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- FSGHPKZOVOUWRE-RCPFAERMSA-N Cl.C([C@@H](NCC(=O)OCCC)C(=O)N1[C@@H](CCC1)C(N)=O)C1CCCCC1 Chemical compound Cl.C([C@@H](NCC(=O)OCCC)C(=O)N1[C@@H](CCC1)C(N)=O)C1CCCCC1 FSGHPKZOVOUWRE-RCPFAERMSA-N 0.000 description 2
- UWPISLQLJRDZOS-UHFFFAOYSA-N Cl.Cl.CCC(=O)OC Chemical compound Cl.Cl.CCC(=O)OC UWPISLQLJRDZOS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 102000009123 Fibrin Human genes 0.000 description 2
- 108010073385 Fibrin Proteins 0.000 description 2
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 238000007341 Heck reaction Methods 0.000 description 2
- 101000610640 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp3 Proteins 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 2
- HXEACLLIILLPRG-YFKPBYRVSA-N L-pipecolic acid Chemical compound [O-]C(=O)[C@@H]1CCCC[NH2+]1 HXEACLLIILLPRG-YFKPBYRVSA-N 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 101001110823 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-A Proteins 0.000 description 2
- 101000712176 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-B Proteins 0.000 description 2
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 2
- 229940122055 Serine protease inhibitor Drugs 0.000 description 2
- 101710102218 Serine protease inhibitor Proteins 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 208000006011 Stroke Diseases 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- 102100040374 U4/U6 small nuclear ribonucleoprotein Prp3 Human genes 0.000 description 2
- 206010047249 Venous thrombosis Diseases 0.000 description 2
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 125000002785 azepinyl group Chemical group 0.000 description 2
- IADUEWIQBXOCDZ-UHFFFAOYSA-N azetidine-2-carboxylic acid Chemical compound OC(=O)C1CCN1 IADUEWIQBXOCDZ-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- WMKCVNSTKVWJJA-YADHBBJMSA-N benzyl (2s)-1-[(2r)-2-(ethoxycarbonylamino)-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxylate Chemical compound C([C@@H](NC(=O)OCC)C(=O)N1[C@@H](CCC1)C(=O)OCC=1C=CC=CC=1)C1=CC=C(OC)C=C1 WMKCVNSTKVWJJA-YADHBBJMSA-N 0.000 description 2
- PUDUYVLXVQZSPW-UXHICEINSA-N benzyl (2s)-1-[(2r)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxylate Chemical compound C([C@@H](NS(=O)(=O)C)C(=O)N1[C@@H](CCC1)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 PUDUYVLXVQZSPW-UXHICEINSA-N 0.000 description 2
- RQQBZFMBRZSHHJ-RBUKOAKNSA-N benzyl (2s)-1-[(2r)-2-(methoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate Chemical compound O=C([C@@H]1CCCN1C(=O)[C@H](NC(=O)OC)C=1C=CC=CC=1)OCC1=CC=CC=C1 RQQBZFMBRZSHHJ-RBUKOAKNSA-N 0.000 description 2
- GHWQSLHGLCUFQI-RTWAWAEBSA-N benzyl (2s)-1-[(2r)-2-acetamido-3-phenylpropanoyl]pyrrolidine-2-carboxylate Chemical compound C([C@@H](NC(=O)C)C(=O)N1[C@@H](CCC1)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 GHWQSLHGLCUFQI-RTWAWAEBSA-N 0.000 description 2
- LSYRNODSHDKNPM-FDOHDBATSA-N benzyl (2s)-1-[(2r)-2-amino-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxylate;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C[C@@H](N)C(=O)N1[C@H](C(=O)OCC=2C=CC=CC=2)CCC1 LSYRNODSHDKNPM-FDOHDBATSA-N 0.000 description 2
- IZGSPBJOKULTPG-VQTJNVASSA-N benzyl (2s)-1-[(2r)-2-cyclohexyl-2-(ethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate Chemical compound C1([C@@H](NC(=O)OCC)C(=O)N2[C@@H](CCC2)C(=O)OCC=2C=CC=CC=2)CCCCC1 IZGSPBJOKULTPG-VQTJNVASSA-N 0.000 description 2
- GSPFEMJWWCUJMC-RBUKOAKNSA-N benzyl (2s)-1-[(2r)-2-cyclohexyl-2-(methoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate Chemical compound C1([C@@H](NC(=O)OC)C(=O)N2[C@@H](CCC2)C(=O)OCC=2C=CC=CC=2)CCCCC1 GSPFEMJWWCUJMC-RBUKOAKNSA-N 0.000 description 2
- RQQBZFMBRZSHHJ-OALUTQOASA-N benzyl (2s)-1-[(2s)-2-(methoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate Chemical compound O=C([C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC)C=1C=CC=CC=1)OCC1=CC=CC=C1 RQQBZFMBRZSHHJ-OALUTQOASA-N 0.000 description 2
- VVCLBQFBKZQOAF-NSHDSACASA-N benzyl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OCC1=CC=CC=C1 VVCLBQFBKZQOAF-NSHDSACASA-N 0.000 description 2
- DMVOXQPQNTYEKQ-UHFFFAOYSA-N biphenyl-4-amine Chemical group C1=CC(N)=CC=C1C1=CC=CC=C1 DMVOXQPQNTYEKQ-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 2
- 125000005111 carboxyalkoxy group Chemical group 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 2
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 2
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- ODCCJTMPMUFERV-UHFFFAOYSA-N ditert-butyl carbonate Chemical compound CC(C)(C)OC(=O)OC(C)(C)C ODCCJTMPMUFERV-UHFFFAOYSA-N 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- VOZPZBSGYPGXEE-UHFFFAOYSA-N ethyl 2-(cyclopropylamino)acetate Chemical compound CCOC(=O)CNC1CC1 VOZPZBSGYPGXEE-UHFFFAOYSA-N 0.000 description 2
- UACYFPNMMHNBCP-WUFINQPMSA-N ethyl 2-[[(2r)-1-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate Chemical compound C([C@@H](N(CC(=O)OCC)C(=O)OC(C)(C)C)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C1=CC=C(OC)C=C1 UACYFPNMMHNBCP-WUFINQPMSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- ACZOYDZDQROTEA-FCHUYYIVSA-N ethyl n-[(1r)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]carbamate Chemical compound C1([C@@H](NC(=O)OCC)C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)CCCCC1 ACZOYDZDQROTEA-FCHUYYIVSA-N 0.000 description 2
- FDZNDEWKXXBQMQ-FCHUYYIVSA-N ethyl n-[(1r)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate Chemical compound C1([C@H](C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)NC(=O)OCC)=CC=CC=C1 FDZNDEWKXXBQMQ-FCHUYYIVSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 229950003499 fibrin Drugs 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000000350 glycoloyl group Chemical group O=C([*])C([H])([H])O[H] 0.000 description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004475 heteroaralkyl group Chemical group 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- JXYZHMPRERWTPM-UHFFFAOYSA-N hydron;morpholine;chloride Chemical compound Cl.C1COCCN1 JXYZHMPRERWTPM-UHFFFAOYSA-N 0.000 description 2
- SXWRTZOXMUOJER-UHFFFAOYSA-N hydron;piperidin-4-one;chloride;hydrate Chemical compound O.Cl.O=C1CCNCC1 SXWRTZOXMUOJER-UHFFFAOYSA-N 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 238000010874 in vitro model Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229950003291 inogatran Drugs 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 150000002690 malonic acid derivatives Chemical class 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- FUEWHGCADRCMKC-SNVBAGLBSA-N methyl (2r)-2-(methanesulfonamido)-3-phenylpropanoate Chemical compound COC(=O)[C@H](NS(C)(=O)=O)CC1=CC=CC=C1 FUEWHGCADRCMKC-SNVBAGLBSA-N 0.000 description 2
- SSMIPAVCMDVJPA-JKSUJKDBSA-N methyl (2s)-1-[(2r)-2-(2-methylpropoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate Chemical compound COC(=O)[C@@H]1CCCN1C(=O)[C@H](NC(=O)OCC(C)C)C1=CC=CC=C1 SSMIPAVCMDVJPA-JKSUJKDBSA-N 0.000 description 2
- IWUUHGKEHGVVKO-UONOGXRCSA-N methyl (2s)-1-[(2r)-2-(ethoxycarbonylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate Chemical compound O=C([C@H](NC(=O)OCC)C=1C=CC=CC=1)N1CCC[C@H]1C(=O)OC IWUUHGKEHGVVKO-UONOGXRCSA-N 0.000 description 2
- MUTCAPXLKRYEPR-ITWZMISCSA-N methyl (e,3r,5s)-7-[4-bromo-2,3-bis(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyhept-6-enoate Chemical compound COC(=O)C[C@H](O)C[C@H](O)\C=C\N1C(C(C)C)=C(Br)C(C=2C=CC(F)=CC=2)=C1C1=CC=C(F)C=C1 MUTCAPXLKRYEPR-ITWZMISCSA-N 0.000 description 2
- DWKPPFQULDPWHX-UHFFFAOYSA-N methyl 2-aminopropanoate Chemical compound COC(=O)C(C)N DWKPPFQULDPWHX-UHFFFAOYSA-N 0.000 description 2
- KQSSATDQUYCRGS-UHFFFAOYSA-N methyl glycinate Chemical compound COC(=O)CN KQSSATDQUYCRGS-UHFFFAOYSA-N 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- WZVZLGPJGQFXAL-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-3,5-dihydro-2h-1,4-benzoxazepine-4-sulfonamide Chemical compound C1CC(C)CCN1C(=O)C(NS(=O)(=O)N1CC2=CC=CC=C2OCC1)CC1=CC2=C(N)N=CC=C2S1 WZVZLGPJGQFXAL-UHFFFAOYSA-N 0.000 description 2
- UMDDNXIQXDPVLZ-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-7-methoxy-3,4-dihydro-1h-isoquinoline-2-sulfonamide Chemical compound C1C2=CC(OC)=CC=C2CCN1S(=O)(=O)NC(CC=1SC2=CC=NC(N)=C2C=1)C(=O)N1CCC(C)CC1 UMDDNXIQXDPVLZ-UHFFFAOYSA-N 0.000 description 2
- GORVSSCPWLNWMV-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-7-methoxy-3,5-dihydro-2h-1,4-benzoxazepine-4-sulfonamide Chemical compound C1C2=CC(OC)=CC=C2OCCN1S(=O)(=O)NC(CC=1SC2=CC=NC(N)=C2C=1)C(=O)N1CCC(C)CC1 GORVSSCPWLNWMV-UHFFFAOYSA-N 0.000 description 2
- QKNGLZCELQISTL-UHFFFAOYSA-N n-[6-(aminomethyl)isoquinolin-1-yl]benzamide Chemical compound N=1C=CC2=CC(CN)=CC=C2C=1NC(=O)C1=CC=CC=C1 QKNGLZCELQISTL-UHFFFAOYSA-N 0.000 description 2
- SGRBMPUAUFMWKQ-UHFFFAOYSA-N n-[6-(azidomethyl)isoquinolin-1-yl]benzamide Chemical compound N=1C=CC2=CC(CN=[N+]=[N-])=CC=C2C=1NC(=O)C1=CC=CC=C1 SGRBMPUAUFMWKQ-UHFFFAOYSA-N 0.000 description 2
- WDARRYXMNCOLHS-UHFFFAOYSA-N n-[6-(hydroxymethyl)isoquinolin-1-yl]benzamide Chemical compound N=1C=CC2=CC(CO)=CC=C2C=1NC(=O)C1=CC=CC=C1 WDARRYXMNCOLHS-UHFFFAOYSA-N 0.000 description 2
- 239000006225 natural substrate Substances 0.000 description 2
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 2
- 150000002829 nitrogen Chemical class 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- LMYJGUNNJIDROI-UHFFFAOYSA-N oxan-4-ol Chemical compound OC1CCOCC1 LMYJGUNNJIDROI-UHFFFAOYSA-N 0.000 description 2
- 125000003544 oxime group Chemical group 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 125000005592 polycycloalkyl group Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 2
- HNBOOOLIEKOODM-XZOQPEGZSA-N propan-2-yl n-[(1r)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate Chemical compound C1([C@H](C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)NC(=O)OC(C)C)=CC=CC=C1 HNBOOOLIEKOODM-XZOQPEGZSA-N 0.000 description 2
- FXSZGKYGUFCBQY-UHFFFAOYSA-N propanoic acid;dihydrochloride Chemical compound Cl.Cl.CCC(O)=O FXSZGKYGUFCBQY-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- PRWXGRGLHYDWPS-UHFFFAOYSA-L sodium malonate Chemical compound [Na+].[Na+].[O-]C(=O)CC([O-])=O PRWXGRGLHYDWPS-UHFFFAOYSA-L 0.000 description 2
- PDTZMULNKGUIEJ-UHFFFAOYSA-N tert-butyl 4-methylidenepiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=C)CC1 PDTZMULNKGUIEJ-UHFFFAOYSA-N 0.000 description 2
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- GDQBPBMIAFIRIU-UHFFFAOYSA-N thieno[2,3-c]pyridine Chemical compound C1=NC=C2SC=CC2=C1 GDQBPBMIAFIRIU-UHFFFAOYSA-N 0.000 description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 2
- DZLNHFMRPBPULJ-UHFFFAOYSA-N thioproline Chemical compound OC(=O)C1CSCN1 DZLNHFMRPBPULJ-UHFFFAOYSA-N 0.000 description 2
- 229950001139 timonacic Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000018889 transepithelial transport Effects 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 238000000825 ultraviolet detection Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- FANCTJAFZSYTIS-IQUVVAJASA-N (1r,3s,5z)-5-[(2e)-2-[(1r,3as,7ar)-7a-methyl-1-[(2r)-4-(phenylsulfonimidoyl)butan-2-yl]-2,3,3a,5,6,7-hexahydro-1h-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol Chemical compound C([C@@H](C)[C@@H]1[C@]2(CCCC(/[C@@H]2CC1)=C\C=C\1C([C@@H](O)C[C@H](O)C/1)=C)C)CS(=N)(=O)C1=CC=CC=C1 FANCTJAFZSYTIS-IQUVVAJASA-N 0.000 description 1
- RCIVUMDLBQZEHP-UHFFFAOYSA-N (2-methylpropan-2-yl)oxycarbamic acid Chemical group CC(C)(C)ONC(O)=O RCIVUMDLBQZEHP-UHFFFAOYSA-N 0.000 description 1
- WALTZUYWJFOWQS-VOWNYPQQSA-N (2R)-2-amino-3-phenylpropanoic acid methyl (2R)-2-amino-3-phenylpropanoate hydrochloride Chemical compound N[C@H](CC1=CC=CC=C1)C(=O)O.Cl.COC([C@H](N)CC1=CC=CC=C1)=O WALTZUYWJFOWQS-VOWNYPQQSA-N 0.000 description 1
- UIVKCRRNLHHVIT-SNVBAGLBSA-N (2r)-2-(ethoxycarbonylamino)-3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbutanoic acid Chemical compound CCOC(=O)N[C@H](C(O)=O)C(C)(C)SCC(=O)OC(C)(C)C UIVKCRRNLHHVIT-SNVBAGLBSA-N 0.000 description 1
- RSCVMVPIUNRVBN-MRVPVSSYSA-N (2r)-2-(ethoxycarbonylamino)-3-methyl-3-propan-2-ylsulfanylbutanoic acid Chemical compound CCOC(=O)N[C@H](C(O)=O)C(C)(C)SC(C)C RSCVMVPIUNRVBN-MRVPVSSYSA-N 0.000 description 1
- MOLPRESBNHJCFD-OAHLLOKOSA-N (2r)-2-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoic acid Chemical compound CCOC(=O)CN(C(=O)OC(C)(C)C)[C@@H](C(O)=O)CC1=CC=C(OC)C=C1 MOLPRESBNHJCFD-OAHLLOKOSA-N 0.000 description 1
- HRUASHPCEMXOMR-LLVKDONJSA-N (2r)-2-acetamido-3-(4-methoxyphenyl)propanoic acid Chemical compound COC1=CC=C(C[C@@H](NC(C)=O)C(O)=O)C=C1 HRUASHPCEMXOMR-LLVKDONJSA-N 0.000 description 1
- VMMCMWWHVBILEA-WNXIGWQFSA-N (2r)-2-amino-3-methyl-3-propan-2-ylsulfanylbutanoic acid;(2r)-2-(ethoxycarbonylamino)-3-methyl-3-propan-2-ylsulfanylbutanoic acid Chemical compound CC(C)SC(C)(C)[C@H](N)C(O)=O.CCOC(=O)N[C@H](C(O)=O)C(C)(C)SC(C)C VMMCMWWHVBILEA-WNXIGWQFSA-N 0.000 description 1
- HLWWNISUXKKVJH-WHASPQHYSA-N (2r)-2-amino-3-methyl-3-propan-2-ylsulfanylbutanoic acid;(2r)-3-methyl-2-(propan-2-yloxycarbonylamino)-3-propan-2-ylsulfanylbutanoic acid Chemical compound CC(C)SC(C)(C)[C@H](N)C(O)=O.CC(C)OC(=O)N[C@H](C(O)=O)C(C)(C)SC(C)C HLWWNISUXKKVJH-WHASPQHYSA-N 0.000 description 1
- KIXTZUKAOQYVAR-SECBINFHSA-N (2r)-3-methyl-2-(propan-2-yloxycarbonylamino)-3-propan-2-ylsulfanylbutanoic acid Chemical compound CC(C)OC(=O)N[C@H](C(O)=O)C(C)(C)SC(C)C KIXTZUKAOQYVAR-SECBINFHSA-N 0.000 description 1
- SUTSMIZZLFZJFT-UXHICEINSA-N (2s)-1-[(2r)-2-acetamido-3-(4-phenylphenyl)propanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](NC(=O)C)C(=O)N1[C@@H](CCC1)C(O)=O)C(C=C1)=CC=C1C1=CC=CC=C1 SUTSMIZZLFZJFT-UXHICEINSA-N 0.000 description 1
- NTAIFDACCJLRJY-UONOGXRCSA-N (2s)-1-[(2r)-2-phenyl-2-(propan-2-yloxycarbonylamino)acetyl]pyrrolidine-2-carboxylic acid Chemical compound O=C([C@H](NC(=O)OC(C)C)C=1C=CC=CC=1)N1CCC[C@H]1C(O)=O NTAIFDACCJLRJY-UONOGXRCSA-N 0.000 description 1
- AJFQIDYCYUWWTQ-QWHCGFSZSA-N (2s)-1-[(2r)-3-methyl-2-(propan-2-yloxycarbonylamino)-3-propan-2-ylsulfanylbutanoyl]pyrrolidine-2-carboxylic acid Chemical compound CC(C)OC(=O)N[C@@H](C(C)(C)SC(C)C)C(=O)N1CCC[C@H]1C(O)=O AJFQIDYCYUWWTQ-QWHCGFSZSA-N 0.000 description 1
- ZCTWKMVAFLVLRV-AWEZNQCLSA-N (2s)-2-(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound COC1=CC(C)=C(S(=O)(=O)[C@@H](CC(=O)OC(C)(C)C)C(O)=O)C(C)=C1C ZCTWKMVAFLVLRV-AWEZNQCLSA-N 0.000 description 1
- OSFVXSDOJYCBFP-LBPRGKRZSA-N (2s)-2-(benzylsulfonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound CC(C)(C)OC(=O)C[C@@H](C(O)=O)NS(=O)(=O)CC1=CC=CC=C1 OSFVXSDOJYCBFP-LBPRGKRZSA-N 0.000 description 1
- BVAUMRCGVHUWOZ-ZETCQYMHSA-N (2s)-2-(cyclohexylazaniumyl)propanoate Chemical compound OC(=O)[C@H](C)NC1CCCCC1 BVAUMRCGVHUWOZ-ZETCQYMHSA-N 0.000 description 1
- HBPFWIKVDHYDFG-VIFPVBQESA-N (2s)-2-(cyclooctylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCCCCCC1 HBPFWIKVDHYDFG-VIFPVBQESA-N 0.000 description 1
- MVTHUEOHHHQQKY-QMMMGPOBSA-N (2s)-2-(diaminomethylideneamino)-3-phenylpropanoic acid Chemical class NC(N)=N[C@H](C(O)=O)CC1=CC=CC=C1 MVTHUEOHHHQQKY-QMMMGPOBSA-N 0.000 description 1
- SAUDSWFPPKSVMK-LBPRGKRZSA-N (2s)-2-(n-phenylanilino)propanoic acid Chemical compound C=1C=CC=CC=1N([C@@H](C)C(O)=O)C1=CC=CC=C1 SAUDSWFPPKSVMK-LBPRGKRZSA-N 0.000 description 1
- VXXWXHSSRSUDKR-ZDUSSCGKSA-N (2s)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-methylpentanoic acid Chemical compound COC1=CC(C)=C(S(=O)(=O)N[C@@H](CC(C)C)C(O)=O)C(C)=C1C VXXWXHSSRSUDKR-ZDUSSCGKSA-N 0.000 description 1
- HKHLQQSRPKTCPE-AWEZNQCLSA-N (2s)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-morpholin-4-yl-4-oxobutanoic acid Chemical compound CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@H](C(O)=O)CC(=O)N1CCOCC1 HKHLQQSRPKTCPE-AWEZNQCLSA-N 0.000 description 1
- LPECNWZYFJRVMO-LBPRGKRZSA-N (2s)-2-[(4-methoxyphenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound COC1=CC=C(S(=O)(=O)N[C@@H](CC(=O)OC(C)(C)C)C(O)=O)C=C1 LPECNWZYFJRVMO-LBPRGKRZSA-N 0.000 description 1
- PRNRMEHJCPUTOE-LKVBXIFLSA-N (2s)-2-[1-[2-[(1-aminoisoquinoline-6-carbonyl)amino]propanoyl]piperidin-4-yl]oxybutanoic acid;hydrochloride Chemical compound Cl.C1CC(O[C@@H](CC)C(O)=O)CCN1C(=O)C(C)NC(=O)C1=CC=C(C(N)=NC=C2)C2=C1 PRNRMEHJCPUTOE-LKVBXIFLSA-N 0.000 description 1
- JFCXCBBSUORTNS-YOEHRIQHSA-N (2s)-2-[[(2s)-2-[4-(4-carbamimidoylphenoxy)butanoylamino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CCCOC1=CC=C(C(N)=N)C=C1 JFCXCBBSUORTNS-YOEHRIQHSA-N 0.000 description 1
- WAMWSIDTKSNDCU-ZETCQYMHSA-N (2s)-2-azaniumyl-2-cyclohexylacetate Chemical compound OC(=O)[C@@H](N)C1CCCCC1 WAMWSIDTKSNDCU-ZETCQYMHSA-N 0.000 description 1
- DQSMOLGWAJNYHM-LBPRGKRZSA-N (2s)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)N[C@@H](CO)C(O)=O)=CC=C21 DQSMOLGWAJNYHM-LBPRGKRZSA-N 0.000 description 1
- STAIDNGGAYVAGY-JTQLQIEISA-N (2s)-4-amino-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-oxobutanoic acid Chemical compound COC1=CC(C)=C(S(=O)(=O)N[C@@H](CC(N)=O)C(O)=O)C(C)=C1C STAIDNGGAYVAGY-JTQLQIEISA-N 0.000 description 1
- FFVPHLCJPCMVJC-PQHVFQCZSA-N (2s)-n'-[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]butanediamide;hydrochloride Chemical compound Cl.CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@H](C(N)=O)CC(=O)NC(C(=O)N1CCCCC1)CC1=CC=C(C(N)=NC=C2)C2=C1 FFVPHLCJPCMVJC-PQHVFQCZSA-N 0.000 description 1
- NFRBIYLJWQQNPK-YADHBBJMSA-N (2s)-n-[(1-aminoisoquinolin-6-yl)methyl]-1-[(2r)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide Chemical compound C([C@@H](NS(=O)(=O)C)C(=O)N1[C@@H](CCC1)C(=O)NCC=1C=C2C=CN=C(N)C2=CC=1)C1=CC=CC=C1 NFRBIYLJWQQNPK-YADHBBJMSA-N 0.000 description 1
- VTVCGXFEIUAXIO-BJSSTWLPSA-N (2s)-n-[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-methylpentanamide;hydrochloride Chemical compound Cl.CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@@H](CC(C)C)C(=O)NC(C(=O)N1CCCCC1)CC1=CC=C(C(N)=NC=C2)C2=C1 VTVCGXFEIUAXIO-BJSSTWLPSA-N 0.000 description 1
- FFDZCNMMGLFPRD-LEUNPYLKSA-N (2s)-n-[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride Chemical compound Cl.C=1C=C2C(N)=NC=CC2=CC=1CC(NC(=O)[C@H](CO)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C(=O)N1CCCCC1 FFDZCNMMGLFPRD-LEUNPYLKSA-N 0.000 description 1
- TWYYFYNJOJGNFP-CUXYNZQBSA-N (2s,4r,5s,6s)-2-[(4s,5r)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-2-carbamoyl-4-[[(e,4s,6s)-4,6-dimethyloct-2-enoyl]oxymethyl]-5-hydroxy-1,3-dioxane-4,5,6-tricarboxylic acid Chemical compound O1[C@H](C(O)=O)[C@](C(O)=O)(O)[C@](COC(=O)/C=C/[C@@H](C)C[C@@H](C)CC)(C(O)=O)O[C@]1(C(N)=O)CCC(=C)[C@@H](OC(C)=O)[C@H](C)CC1=CC=CC=C1 TWYYFYNJOJGNFP-CUXYNZQBSA-N 0.000 description 1
- OOKAZRDERJMRCJ-KOUAFAAESA-N (3r)-7-[(1s,2s,4ar,6s,8s)-2,6-dimethyl-8-[(2s)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-hydroxy-5-oxoheptanoic acid Chemical compound C1=C[C@H](C)[C@H](CCC(=O)C[C@@H](O)CC(O)=O)C2[C@@H](OC(=O)[C@@H](C)CC)C[C@@H](C)C[C@@H]21 OOKAZRDERJMRCJ-KOUAFAAESA-N 0.000 description 1
- LDRWTKQWSXGSTM-LBPRGKRZSA-N (3s)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](CC(O)=O)C(=O)OCC1=CC=CC=C1 LDRWTKQWSXGSTM-LBPRGKRZSA-N 0.000 description 1
- FUVARZRJYQYFRM-PQHVFQCZSA-N (3s)-4-[[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-oxobutanoic acid;hydrochloride Chemical compound Cl.CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@@H](CC(O)=O)C(=O)NC(C(=O)N1CCCCC1)CC1=CC=C(C(N)=NC=C2)C2=C1 FUVARZRJYQYFRM-PQHVFQCZSA-N 0.000 description 1
- GOPWHXPXSPIIQZ-FQEVSTJZSA-N (4s)-4-(9h-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid Chemical compound C1=CC=C2C(COC(=O)N[C@@H](CCC(O)=O)C(=O)OC(C)(C)C)C3=CC=CC=C3C2=C1 GOPWHXPXSPIIQZ-FQEVSTJZSA-N 0.000 description 1
- RXNPEQZHMGFNAY-GEALJGNFSA-N (5R)-4-[(1S,6R)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one Chemical compound C[C@@H]1CC(=O)NC2=C1C(=NC=N2)N3CCN([C@H]4[C@@H]3C4)C(=O)[C@H](CNC(C)C)C5=CC=C(C=C5)Cl RXNPEQZHMGFNAY-GEALJGNFSA-N 0.000 description 1
- ULDHMXUKGWMISQ-VIFPVBQESA-N (S)-(+)-Carvone Natural products CC(=C)[C@H]1CC=C(C)C(=O)C1 ULDHMXUKGWMISQ-VIFPVBQESA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- 125000004747 1,1-dimethylethoxycarbonyl group Chemical group CC(C)(OC(=O)*)C 0.000 description 1
- RADQTHXRZJGDQI-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinolin-7-ol Chemical compound C1CNCC2=CC(O)=CC=C21 RADQTHXRZJGDQI-UHFFFAOYSA-N 0.000 description 1
- DKYBVKMIZODYKL-UHFFFAOYSA-N 1,3-diazinane Chemical compound C1CNCNC1 DKYBVKMIZODYKL-UHFFFAOYSA-N 0.000 description 1
- YFJJECIMZMWSDD-UHFFFAOYSA-N 1,3-dimethoxypropan-2-yloxybenzene Chemical compound COCC(COC)OC1=CC=CC=C1 YFJJECIMZMWSDD-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- IBYRUEFAAFGNSD-UHFFFAOYSA-N 1-(trifluoromethylsulfonyl)piperazine Chemical compound FC(F)(F)S(=O)(=O)N1CCNCC1 IBYRUEFAAFGNSD-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 1
- HTTPGMNPPMMMOP-UHFFFAOYSA-N 1-azaniumyl-2,3-dihydroindene-1-carboxylate Chemical compound C1=CC=C2C(N)(C(O)=O)CCC2=C1 HTTPGMNPPMMMOP-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- YLRBJYMANQKEAW-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)benzene Chemical compound BrCC1=CC=C(Br)C=C1 YLRBJYMANQKEAW-UHFFFAOYSA-N 0.000 description 1
- YKYWUHHZZRBGMG-JWTNVVGKSA-N 1-methyl-2-[[(1r,5s)-6-[[5-(trifluoromethyl)pyridin-2-yl]methoxymethyl]-3-azabicyclo[3.1.0]hexan-3-yl]methyl]benzimidazole Chemical compound C1([C@@H]2CN(C[C@@H]21)CC=1N(C2=CC=CC=C2N=1)C)COCC1=CC=C(C(F)(F)F)C=N1 YKYWUHHZZRBGMG-JWTNVVGKSA-N 0.000 description 1
- STNLQJRBZHAGSO-UHFFFAOYSA-N 1-piperidin-4-ylethanone Chemical compound CC(=O)C1CCNCC1 STNLQJRBZHAGSO-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- QIXORTWTAVZFFR-UHFFFAOYSA-N 2,2,2-trifluoro-1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone Chemical compound C1CN(C(=O)C(F)(F)F)CCC2=CC=CC=C21 QIXORTWTAVZFFR-UHFFFAOYSA-N 0.000 description 1
- DWCKEHPVZCSBDP-UHFFFAOYSA-N 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonic acid Chemical compound C1CC(C)(C)OC2=C1C(C)=C(S(O)(=O)=O)C(C)=C2C DWCKEHPVZCSBDP-UHFFFAOYSA-N 0.000 description 1
- UXUOVYKDMGFUDU-UHFFFAOYSA-N 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonyl chloride Chemical compound C1CC(C)(C)OC2=C1C(C)=C(S(Cl)(=O)=O)C(C)=C2C UXUOVYKDMGFUDU-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- OJYUOUSEQICBKV-UHFFFAOYSA-N 2,2-dimethoxyethanamine isoquinolin-7-ol Chemical compound COC(CN)OC.C1=NC=CC2=CC=C(C=C12)O OJYUOUSEQICBKV-UHFFFAOYSA-N 0.000 description 1
- LEWZOBYWGWKNCK-UHFFFAOYSA-N 2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=C2CCCC2=C1 LEWZOBYWGWKNCK-UHFFFAOYSA-N 0.000 description 1
- XYIKTLMPVJQPCE-UHFFFAOYSA-N 2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1h-isoquinoline-6-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C2CN(C(=O)C(F)(F)F)CCC2=C1 XYIKTLMPVJQPCE-UHFFFAOYSA-N 0.000 description 1
- AUCVZEYHEFAWHO-UHFFFAOYSA-N 2-(3-fluorophenyl)ethanamine Chemical compound NCCC1=CC=CC(F)=C1 AUCVZEYHEFAWHO-UHFFFAOYSA-N 0.000 description 1
- DVTYJMQWZHKOTG-UHFFFAOYSA-N 2-(Trifluoroacetyl)-1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CN(C(=O)C(F)(F)F)CCC2=C1 DVTYJMQWZHKOTG-UHFFFAOYSA-N 0.000 description 1
- SUHADPCMGOLNFF-UHFFFAOYSA-N 2-(aminomethyl)thieno[3,2-c]pyridin-4-amine Chemical compound N1=CC=C2SC(CN)=CC2=C1N SUHADPCMGOLNFF-UHFFFAOYSA-N 0.000 description 1
- MTFDMQASMMCFHB-UHFFFAOYSA-N 2-(naphthalen-2-ylsulfonylamino)acetic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)NCC(=O)O)=CC=C21 MTFDMQASMMCFHB-UHFFFAOYSA-N 0.000 description 1
- RBOLJSXAGGHPDN-AZUAARDMSA-N 2-[(3r)-4-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-3-(ethoxycarbonylamino)-2-methyl-4-oxobutan-2-yl]sulfanylacetic acid Chemical compound CCOC(=O)N[C@@H](C(C)(C)SCC(O)=O)C(=O)N1CCC[C@H]1C(=O)NCC1=CC=C(C(N)=NC=C2)C2=C1 RBOLJSXAGGHPDN-AZUAARDMSA-N 0.000 description 1
- LCCTWIWZVNZDJR-UHFFFAOYSA-N 2-[3-(benzylsulfonylamino)-6-methyl-2-oxopyridin-1-yl]acetic acid Chemical compound O=C1N(CC(O)=O)C(C)=CC=C1NS(=O)(=O)CC1=CC=CC=C1 LCCTWIWZVNZDJR-UHFFFAOYSA-N 0.000 description 1
- QGEGSJUSWLLZLH-UHFFFAOYSA-N 2-[4-[4-(4-carbamimidoylphenyl)-1-piperazinyl]-1-piperidinyl]acetic acid Chemical compound C1=CC(C(=N)N)=CC=C1N1CCN(C2CCN(CC(O)=O)CC2)CC1 QGEGSJUSWLLZLH-UHFFFAOYSA-N 0.000 description 1
- BLZYQZYSZYILGD-UHFFFAOYSA-N 2-amino-3-(1-aminoisoquinolin-7-yl)propanoic acid;dihydrochloride Chemical compound Cl.Cl.C1=CN=C(N)C2=CC(CC(N)C(O)=O)=CC=C21 BLZYQZYSZYILGD-UHFFFAOYSA-N 0.000 description 1
- WKNMKGVLOWGGOU-UHFFFAOYSA-N 2-aminoacetamide;hydron;chloride Chemical compound Cl.NCC(N)=O WKNMKGVLOWGGOU-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- PFVCTZZFFXYRSG-UHFFFAOYSA-N 2-iodofuro[3,2-c]pyridin-4-amine Chemical compound NC1=NC=CC2=C1C=C(I)O2 PFVCTZZFFXYRSG-UHFFFAOYSA-N 0.000 description 1
- KOHBEDRJXKOYHL-UHFFFAOYSA-N 2-methoxy-n-methylethanamine Chemical compound CNCCOC KOHBEDRJXKOYHL-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- IEEHKTFVUIVORU-UHFFFAOYSA-N 2-methylpropanedioyl dichloride Chemical compound ClC(=O)C(C)C(Cl)=O IEEHKTFVUIVORU-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- PITHYUDHKJKJNQ-UHFFFAOYSA-N 2-propylpentanoyl chloride Chemical compound CCCC(C(Cl)=O)CCC PITHYUDHKJKJNQ-UHFFFAOYSA-N 0.000 description 1
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 1
- GZLPFEYTAAXJCP-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazole-4-sulfonyl chloride Chemical compound CC1=NOC(C)=C1S(Cl)(=O)=O GZLPFEYTAAXJCP-UHFFFAOYSA-N 0.000 description 1
- BBSLOKZINKEUCR-UHFFFAOYSA-N 3-(4-chlorophenyl)propanoic acid Chemical compound OC(=O)CCC1=CC=C(Cl)C=C1 BBSLOKZINKEUCR-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- YGHXWMFWJXNDRF-UHFFFAOYSA-N 3-[1-(benzylamino)isoquinolin-6-yl]prop-2-enoic acid Chemical compound N=1C=CC2=CC(C=CC(=O)O)=CC=C2C=1NCC1=CC=CC=C1 YGHXWMFWJXNDRF-UHFFFAOYSA-N 0.000 description 1
- UNSHMXUHOHBLIQ-UHFFFAOYSA-N 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione Chemical compound ClC1=C(C=C(C2=CC=CC=C12)N1C(NC(=CC1=O)C(F)(F)F)=O)OC1=C(C=CC=C1)C UNSHMXUHOHBLIQ-UHFFFAOYSA-N 0.000 description 1
- UVFAHDAUVZRVCC-UHFFFAOYSA-N 3-nitrodibenzofuran Chemical compound C1=CC=C2C3=CC=C([N+](=O)[O-])C=C3OC2=C1 UVFAHDAUVZRVCC-UHFFFAOYSA-N 0.000 description 1
- JAICGBJIBWDEIZ-UHFFFAOYSA-N 3-phenylmethoxybenzaldehyde Chemical compound O=CC1=CC=CC(OCC=2C=CC=CC=2)=C1 JAICGBJIBWDEIZ-UHFFFAOYSA-N 0.000 description 1
- FBYMBFPXCCVIRA-UHFFFAOYSA-N 4,6-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(O)=CC=C21 FBYMBFPXCCVIRA-UHFFFAOYSA-N 0.000 description 1
- GXXCPULTFYZSJG-UHFFFAOYSA-N 4,6-dimethoxynaphthalene-2-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C(OC)C2=CC(OC)=CC=C21 GXXCPULTFYZSJG-UHFFFAOYSA-N 0.000 description 1
- PCOCFIOYWNCGBM-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound CC(C)(C)OC(=O)CCC(O)=O PCOCFIOYWNCGBM-UHFFFAOYSA-N 0.000 description 1
- XDCOYBQVEVSNNB-UHFFFAOYSA-N 4-[(7-naphthalen-2-yl-1-benzothiophen-2-yl)methylamino]butanoic acid Chemical compound OC(=O)CCCNCc1cc2cccc(-c3ccc4ccccc4c3)c2s1 XDCOYBQVEVSNNB-UHFFFAOYSA-N 0.000 description 1
- TXEBWPPWSVMYOA-UHFFFAOYSA-N 4-[3-[(1-amino-2-chloroethyl)amino]propyl]-1-[[3-(2-chlorophenyl)phenyl]methyl]-5-hydroxyimidazolidin-2-one Chemical compound NC(CCl)NCCCC1NC(=O)N(Cc2cccc(c2)-c2ccccc2Cl)C1O TXEBWPPWSVMYOA-UHFFFAOYSA-N 0.000 description 1
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 description 1
- GLGZUIQSJYTZNA-UHFFFAOYSA-N 4-benzyl-7-methoxy-3,5-dihydro-2h-1,4-benzoxazepine Chemical compound C1C2=CC(OC)=CC=C2OCCN1CC1=CC=CC=C1 GLGZUIQSJYTZNA-UHFFFAOYSA-N 0.000 description 1
- HUADLMRMSJAWAL-UHFFFAOYSA-N 4-benzyl-7-methoxy-5h-1,4-benzoxazepine Chemical compound C1C2=CC(OC)=CC=C2OC=CN1CC1=CC=CC=C1 HUADLMRMSJAWAL-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 4-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1 ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 0.000 description 1
- VFPFMOXMHVQFNR-UHFFFAOYSA-N 4-chlorothieno[3,2-c]pyridine Chemical compound ClC1=NC=CC2=C1C=CS2 VFPFMOXMHVQFNR-UHFFFAOYSA-N 0.000 description 1
- KWHPWBXOLZTZMJ-UHFFFAOYSA-N 4-ethylpiperidine Chemical compound CCC1CCNCC1 KWHPWBXOLZTZMJ-UHFFFAOYSA-N 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- XGMSENVPQPNOHF-UHFFFAOYSA-N 4-methylidenepiperidine;hydrochloride Chemical compound Cl.C=C1CCNCC1 XGMSENVPQPNOHF-UHFFFAOYSA-N 0.000 description 1
- KWZZJCDZLWFHNU-UHFFFAOYSA-N 4-methylsulfonylpiperazine-1-carbaldehyde Chemical compound CS(=O)(=O)N1CCN(C=O)CC1 KWZZJCDZLWFHNU-UHFFFAOYSA-N 0.000 description 1
- CWWSPVBKLIAQEP-UHFFFAOYSA-N 4-phenoxythieno[3,2-c]pyridine Chemical compound N=1C=CC=2SC=CC=2C=1OC1=CC=CC=C1 CWWSPVBKLIAQEP-UHFFFAOYSA-N 0.000 description 1
- KUZSBKJSGSKPJH-VXGBXAGGSA-N 5-[(9R)-6-[(3R)-3-methylmorpholin-4-yl]-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl]pyrazin-2-amine Chemical compound C[C@@H]1COCCN1c1nc(nc2N3CCOC[C@H]3Cc12)-c1cnc(N)cn1 KUZSBKJSGSKPJH-VXGBXAGGSA-N 0.000 description 1
- YMWFGAHXYQBWJM-UHFFFAOYSA-N 5-bromo-2-oxidoisoquinolin-2-ium;hydrochloride Chemical compound Cl.BrC1=CC=CC2=C[N+]([O-])=CC=C21 YMWFGAHXYQBWJM-UHFFFAOYSA-N 0.000 description 1
- CYJZJGYYTFQQBY-UHFFFAOYSA-N 5-bromoisoquinoline Chemical compound N1=CC=C2C(Br)=CC=CC2=C1 CYJZJGYYTFQQBY-UHFFFAOYSA-N 0.000 description 1
- VOAHGGQULSSGQW-UHFFFAOYSA-N 6-bromo-1-chloroisoquinoline Chemical compound BrC1=CC=C2C(Cl)=NC=CC2=C1 VOAHGGQULSSGQW-UHFFFAOYSA-N 0.000 description 1
- QCVOTMPAZHJRFZ-UHFFFAOYSA-N 6-bromo-1-phenoxyisoquinoline Chemical compound N=1C=CC2=CC(Br)=CC=C2C=1OC1=CC=CC=C1 QCVOTMPAZHJRFZ-UHFFFAOYSA-N 0.000 description 1
- SMVCPVKDUXZZER-UHFFFAOYSA-N 6-bromo-2-oxidoisoquinolin-2-ium;hydrochloride Chemical compound Cl.C1=C(Br)C=CC2=C[N+]([O-])=CC=C21 SMVCPVKDUXZZER-UHFFFAOYSA-N 0.000 description 1
- PZNNAAGLKCNZKE-UHFFFAOYSA-N 6-bromoisoquinolin-1-amine Chemical compound BrC1=CC=C2C(N)=NC=CC2=C1 PZNNAAGLKCNZKE-UHFFFAOYSA-N 0.000 description 1
- ZTEATMVVGQUULZ-UHFFFAOYSA-N 6-bromoisoquinoline Chemical compound C1=NC=CC2=CC(Br)=CC=C21 ZTEATMVVGQUULZ-UHFFFAOYSA-N 0.000 description 1
- FHCKWLXHKAPOBN-UHFFFAOYSA-N 6-bromoquinazolin-4-amine Chemical compound C1=C(Br)C=C2C(N)=NC=NC2=C1 FHCKWLXHKAPOBN-UHFFFAOYSA-N 0.000 description 1
- KMYOLSIBCDCWQQ-UHFFFAOYSA-N 6-chloroquinazolin-4-amine Chemical compound C1=C(Cl)C=C2C(N)=NC=NC2=C1 KMYOLSIBCDCWQQ-UHFFFAOYSA-N 0.000 description 1
- UMSWWSIVPWVJOX-UHFFFAOYSA-N 7-bromo-1-chloroisoquinoline Chemical compound C1=C(Br)C=C2C(Cl)=NC=CC2=C1 UMSWWSIVPWVJOX-UHFFFAOYSA-N 0.000 description 1
- GWLJGOGCTYGETC-UHFFFAOYSA-N 7-bromo-1-phenoxyisoquinoline Chemical compound C12=CC(Br)=CC=C2C=CN=C1OC1=CC=CC=C1 GWLJGOGCTYGETC-UHFFFAOYSA-N 0.000 description 1
- IVJDJKJGWCERIX-UHFFFAOYSA-N 7-bromo-2-oxidoisoquinolin-2-ium;hydrochloride Chemical compound Cl.C1=CC(Br)=CC2=C[N+]([O-])=CC=C21 IVJDJKJGWCERIX-UHFFFAOYSA-N 0.000 description 1
- PLOCDXILPIGHEZ-UHFFFAOYSA-N 7-bromoisoquinolin-1-amine Chemical compound C1=C(Br)C=C2C(N)=NC=CC2=C1 PLOCDXILPIGHEZ-UHFFFAOYSA-N 0.000 description 1
- ZYCLVMJKFGHNKX-UHFFFAOYSA-N 7-chloroquinazolin-4-amine Chemical compound ClC1=CC=C2C(N)=NC=NC2=C1 ZYCLVMJKFGHNKX-UHFFFAOYSA-N 0.000 description 1
- HRHLEPHFARWKKU-UHFFFAOYSA-N 7-chlorothieno[2,3-c]pyridine Chemical compound ClC1=NC=CC2=C1SC=C2 HRHLEPHFARWKKU-UHFFFAOYSA-N 0.000 description 1
- PNNUXNXZDJVGSB-UHFFFAOYSA-N 7-methoxyisoquinoline Chemical compound C1=CN=CC2=CC(OC)=CC=C21 PNNUXNXZDJVGSB-UHFFFAOYSA-N 0.000 description 1
- VODKZJIRRUAGHK-UHFFFAOYSA-N 7-nitrodibenzofuran-2-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2C3=CC=C([N+](=O)[O-])C=C3OC2=C1 VODKZJIRRUAGHK-UHFFFAOYSA-N 0.000 description 1
- LPWKFUVWWQYLOD-UHFFFAOYSA-N 9-(dimethylamino)-3-(4-methylphenyl)pyrido[2,3]thieno[2,4-d]pyrimidin-4-one Chemical compound C1=2C(N(C)C)=CN=CC=2SC(C2=O)=C1N=CN2C1=CC=C(C)C=C1 LPWKFUVWWQYLOD-UHFFFAOYSA-N 0.000 description 1
- 208000031104 Arterial Occlusive disease Diseases 0.000 description 1
- 206010003162 Arterial injury Diseases 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 241000995051 Brenda Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OHVVLDNBJIITHK-UHFFFAOYSA-N C(=O)C1=CC=C2C=CN=C(C2=C1)NC(C1=CC=CC=C1)=O.OCC1=CC=C2C=CN=C(C2=C1)NC(C1=CC=CC=C1)=O Chemical compound C(=O)C1=CC=C2C=CN=C(C2=C1)NC(C1=CC=CC=C1)=O.OCC1=CC=C2C=CN=C(C2=C1)NC(C1=CC=CC=C1)=O OHVVLDNBJIITHK-UHFFFAOYSA-N 0.000 description 1
- DXFVRDOHGCMWNO-FNZWTVRRSA-N C(C)OC(N[C@@](C(C)(C)C(C)C)(C(=O)N1[C@@H](CCC1)C(NCC=1C=C2C=CN=C(C2=CC=1)N)=O)S)=O Chemical compound C(C)OC(N[C@@](C(C)(C)C(C)C)(C(=O)N1[C@@H](CCC1)C(NCC=1C=C2C=CN=C(C2=CC=1)N)=O)S)=O DXFVRDOHGCMWNO-FNZWTVRRSA-N 0.000 description 1
- QCMHGCDOZLWPOT-FMNCTDSISA-N COC1=C(CC[C@@H]2CCC3=C(C2)C=CC(=C3)[C@H]2CC[C@](N)(CO)C2)C=CC=C1 Chemical compound COC1=C(CC[C@@H]2CCC3=C(C2)C=CC(=C3)[C@H]2CC[C@](N)(CO)C2)C=CC=C1 QCMHGCDOZLWPOT-FMNCTDSISA-N 0.000 description 1
- RUMCCZJEXUDNHD-UHFFFAOYSA-N COCCOC1=CC=CC=C1.COCCOC1=CC=C(C=C1)S(=O)(=O)Cl Chemical compound COCCOC1=CC=CC=C1.COCCOC1=CC=C(C=C1)S(=O)(=O)Cl RUMCCZJEXUDNHD-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- JLLMRCGZXROOFI-BDQAORGHSA-N Cl.N1=CC=C2SC(CN3CC[C@@H](C3=O)NS(=O)(=O)C=3C=CC4=CC=C(C=C4C=3)OC)=CC2=C1N Chemical compound Cl.N1=CC=C2SC(CN3CC[C@@H](C3=O)NS(=O)(=O)C=3C=CC4=CC=C(C=C4C=3)OC)=CC2=C1N JLLMRCGZXROOFI-BDQAORGHSA-N 0.000 description 1
- RJKNAYWBENRSQQ-JIDHJSLPSA-N Cl.NN1CC2=CC=C(C=C2C=C1)CN1C([C@H](CC1)NS(=O)(=O)C1=CC2=CC(=CC=C2C=C1)OC)=O Chemical compound Cl.NN1CC2=CC=C(C=C2C=C1)CN1C([C@H](CC1)NS(=O)(=O)C1=CC2=CC(=CC=C2C=C1)OC)=O RJKNAYWBENRSQQ-JIDHJSLPSA-N 0.000 description 1
- XPDXVDYUQZHFPV-UHFFFAOYSA-N Dansyl Chloride Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(Cl)(=O)=O XPDXVDYUQZHFPV-UHFFFAOYSA-N 0.000 description 1
- 206010051055 Deep vein thrombosis Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 208000005189 Embolism Diseases 0.000 description 1
- 206010014513 Embolism arterial Diseases 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 108010048049 Factor IXa Proteins 0.000 description 1
- 108010054265 Factor VIIa Proteins 0.000 description 1
- 108010071241 Factor XIIa Proteins 0.000 description 1
- 108010080805 Factor XIa Proteins 0.000 description 1
- 108010074860 Factor Xa Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- 239000004395 L-leucine Substances 0.000 description 1
- 235000019454 L-leucine Nutrition 0.000 description 1
- VLJNHYLEOZPXFW-BYPYZUCNSA-N L-prolinamide Chemical compound NC(=O)[C@@H]1CCCN1 VLJNHYLEOZPXFW-BYPYZUCNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- HPKJGHVHQWJOOT-ZJOUEHCJSA-N N-[(2S)-3-cyclohexyl-1-oxo-1-({(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl}amino)propan-2-yl]-1H-indole-2-carboxamide Chemical compound C1C(CCCC1)C[C@H](NC(=O)C=1NC2=CC=CC=C2C=1)C(=O)N[C@@H](C[C@H]1C(=O)NCC1)C=O HPKJGHVHQWJOOT-ZJOUEHCJSA-N 0.000 description 1
- CBQJSKKFNMDLON-SNVBAGLBSA-N N-acetyl-D-phenylalanine Chemical compound CC(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 CBQJSKKFNMDLON-SNVBAGLBSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 108010033276 Peptide Fragments Proteins 0.000 description 1
- 102000007079 Peptide Fragments Human genes 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N Picolinic acid Natural products OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 101800004937 Protein C Proteins 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 101800001700 Saposin-D Proteins 0.000 description 1
- 102400000827 Saposin-D Human genes 0.000 description 1
- WBNUCLPUOSXSNJ-ZDUSSCGKSA-N Sibrafiban Chemical compound C1CC(OCC(=O)OCC)CCN1C(=O)[C@H](C)NC(=O)C1=CC=C(C(=N)NO)C=C1 WBNUCLPUOSXSNJ-ZDUSSCGKSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Chemical class 0.000 description 1
- 108090000787 Subtilisin Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- BGABKEVTHIJBIW-MHPPCMCBSA-N [(4r)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride Chemical compound C1C[C@]2(CS(Cl)(=O)=O)C(=O)CC1C2(C)C BGABKEVTHIJBIW-MHPPCMCBSA-N 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- ZMQBBPRAZLACCW-UHFFFAOYSA-N acetic acid;dichloromethane Chemical compound ClCCl.CC(O)=O ZMQBBPRAZLACCW-UHFFFAOYSA-N 0.000 description 1
- WDEMHBVIYZGQCD-KALLACGZSA-N acetic acid;methyl (2s)-2-(butoxycarbonylamino)-3-[[2-[(5r)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate Chemical compound CC(O)=O.O1[C@@H](CC(=O)NC[C@H](NC(=O)OCCCC)C(=O)OC)CC(C=2C=CC(=CC=2)C(N)=N)=N1 WDEMHBVIYZGQCD-KALLACGZSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical class O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- SRVFFFJZQVENJC-IHRRRGAJSA-N aloxistatin Chemical compound CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C SRVFFFJZQVENJC-IHRRRGAJSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical group 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- 230000002429 anti-coagulating effect Effects 0.000 description 1
- 239000004019 antithrombin Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 208000021328 arterial occlusion Diseases 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 150000003936 benzamides Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- JSRIQTDJZJVZEM-LJQANCHMSA-N benzyl (2r)-2-[(2-ethoxy-2-oxoethyl)amino]-3-(4-methoxyphenyl)propanoate Chemical compound C([C@@H](NCC(=O)OCC)C(=O)OCC=1C=CC=CC=1)C1=CC=C(OC)C=C1 JSRIQTDJZJVZEM-LJQANCHMSA-N 0.000 description 1
- IAOMXXRLRFPZIK-PKLMIRHRSA-N benzyl (2r)-2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C[C@@H](N)C(=O)OCC1=CC=CC=C1 IAOMXXRLRFPZIK-PKLMIRHRSA-N 0.000 description 1
- BNEHQWXCXGSHHL-YADHBBJMSA-N benzyl (2s)-1-[(2r)-2-(ethylcarbamoylamino)-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxylate Chemical compound C([C@@H](NC(=O)NCC)C(=O)N1[C@@H](CCC1)C(=O)OCC=1C=CC=CC=1)C1=CC=C(OC)C=C1 BNEHQWXCXGSHHL-YADHBBJMSA-N 0.000 description 1
- NBHDNWFRALZCKV-YADHBBJMSA-N benzyl (2s)-1-[(2r)-2-acetamido-3-(4-methoxyphenyl)propanoyl]pyrrolidine-2-carboxylate Chemical compound C1=CC(OC)=CC=C1C[C@@H](NC(C)=O)C(=O)N1[C@H](C(=O)OCC=2C=CC=CC=2)CCC1 NBHDNWFRALZCKV-YADHBBJMSA-N 0.000 description 1
- ZISBKHLEXJRBJB-SXOMAYOGSA-N benzyl (2s)-1-[(2r)-2-acetamido-3-(4-phenylphenyl)propanoyl]pyrrolidine-2-carboxylate Chemical compound C([C@@H](NC(=O)C)C(=O)N1[C@@H](CCC1)C(=O)OCC=1C=CC=CC=1)C(C=C1)=CC=C1C1=CC=CC=C1 ZISBKHLEXJRBJB-SXOMAYOGSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- SBGUYEPUJPATFD-UHFFFAOYSA-N bromo(tripyrrolidin-1-yl)phosphanium Chemical compound C1CCCN1[P+](N1CCCC1)(Br)N1CCCC1 SBGUYEPUJPATFD-UHFFFAOYSA-N 0.000 description 1
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000005102 carbonylalkoxy group Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000007675 cardiac surgery Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- ULDHMXUKGWMISQ-UHFFFAOYSA-N carvone Natural products CC(=C)C1CC=C(C)C(=O)C1 ULDHMXUKGWMISQ-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000020411 cell activation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940125877 compound 31 Drugs 0.000 description 1
- 229940126209 compound 43b Drugs 0.000 description 1
- 229940126545 compound 53 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- ULCKEERECJMLHP-UHFFFAOYSA-N dibenzofuran-2-sulfonyl chloride Chemical compound C1=CC=C2C3=CC(S(=O)(=O)Cl)=CC=C3OC2=C1 ULCKEERECJMLHP-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- PCDHXOGETAJDEL-GFCCVEGCSA-N ethyl (2r)-2-acetamido-3-(4-bromophenyl)propanoate Chemical compound CCOC(=O)[C@H](NC(C)=O)CC1=CC=C(Br)C=C1 PCDHXOGETAJDEL-GFCCVEGCSA-N 0.000 description 1
- QKFMBILEXSQRPT-GOSISDBHSA-N ethyl (2r)-2-acetamido-3-(4-phenylphenyl)propanoate Chemical compound C1=CC(C[C@H](C(=O)OCC)NC(C)=O)=CC=C1C1=CC=CC=C1 QKFMBILEXSQRPT-GOSISDBHSA-N 0.000 description 1
- ADTGRADJRNVKNG-BJSSTWLPSA-N ethyl (4s)-5-[[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-4-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-5-oxopentanoate;hydrochloride Chemical compound Cl.N([C@@H](CCC(=O)OCC)C(=O)NC(CC=1C=C2C=CN=C(N)C2=CC=1)C(=O)N1CCCCC1)S(=O)(=O)C1=C(C)C=C(OC)C(C)=C1C ADTGRADJRNVKNG-BJSSTWLPSA-N 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- MAFQLJCYFMKEJJ-UHFFFAOYSA-N ethyl 4-aminobutanoate Chemical compound CCOC(=O)CCCN MAFQLJCYFMKEJJ-UHFFFAOYSA-N 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- MUQMCYOQBXGHKJ-UHFFFAOYSA-N ethyl butanoate;hydrochloride Chemical compound Cl.CCCC(=O)OCC MUQMCYOQBXGHKJ-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 229940012414 factor viia Drugs 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- IKZACQMAVUIGPY-HOTGVXAUSA-N fradafiban Chemical compound C1=CC(C(=N)N)=CC=C1C(C=C1)=CC=C1OC[C@H]1NC(=O)[C@H](CC(O)=O)C1 IKZACQMAVUIGPY-HOTGVXAUSA-N 0.000 description 1
- 229950008851 fradafiban Drugs 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- YUYKLYDWZPBBMA-UHFFFAOYSA-N furo[3,2-c]pyridin-4-amine 2-iodofuro[3,2-c]pyridin-4-amine Chemical compound O1C=CC=2C(=NC=CC21)N.IC2=CC=1C(=NC=CC1O2)N YUYKLYDWZPBBMA-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- 230000013632 homeostatic process Effects 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- RKDJBXYFUGOJRU-UHFFFAOYSA-N hydron;7-methoxy-1,2,3,4-tetrahydroisoquinoline;chloride Chemical compound Cl.C1CNCC2=CC(OC)=CC=C21 RKDJBXYFUGOJRU-UHFFFAOYSA-N 0.000 description 1
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 1
- COQRGFWWJBEXRC-UHFFFAOYSA-N hydron;methyl 2-aminoacetate;chloride Chemical compound Cl.COC(=O)CN COQRGFWWJBEXRC-UHFFFAOYSA-N 0.000 description 1
- QSJAHJYXDRUZMY-UHFFFAOYSA-N hydron;thiomorpholine;chloride Chemical compound Cl.C1CSCCN1 QSJAHJYXDRUZMY-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- WCRKBMABEPCYII-UHFFFAOYSA-N isoquinolin-7-ol Chemical compound C1=CN=CC2=CC(O)=CC=C21 WCRKBMABEPCYII-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229960003136 leucine Drugs 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 238000011866 long-term treatment Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 1
- 229940087646 methanolamine Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VSDUZFOSJDMAFZ-SECBINFHSA-N methyl (2r)-2-amino-3-phenylpropanoate Chemical compound COC(=O)[C@H](N)CC1=CC=CC=C1 VSDUZFOSJDMAFZ-SECBINFHSA-N 0.000 description 1
- SWVMLNPDTIFDDY-SBSPUUFOSA-N methyl (2r)-2-amino-3-phenylpropanoate;hydrochloride Chemical compound Cl.COC(=O)[C@H](N)CC1=CC=CC=C1 SWVMLNPDTIFDDY-SBSPUUFOSA-N 0.000 description 1
- MVKLRNIVJQSXOG-DZGCQCFKSA-N methyl (2s)-1-[(2r)-2-(ethoxycarbonylamino)-3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanylbutanoyl]pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)CSC(C)(C)[C@H](NC(=O)OCC)C(=O)N1CCC[C@H]1C(=O)OC MVKLRNIVJQSXOG-DZGCQCFKSA-N 0.000 description 1
- GTBUMCNTOHBWKN-UHFFFAOYSA-N methyl 2-amino-3-(1-aminoisoquinolin-6-yl)propanoate;dihydrochloride Chemical compound Cl.Cl.NC1=NC=CC2=CC(CC(N)C(=O)OC)=CC=C21 GTBUMCNTOHBWKN-UHFFFAOYSA-N 0.000 description 1
- JYDIWLHBSPZYAU-UHFFFAOYSA-N methyl 2-amino-3-(1-aminoisoquinolin-7-yl)propanoate;dihydrochloride Chemical compound Cl.Cl.C1=CN=C(N)C2=CC(CC(N)C(=O)OC)=CC=C21 JYDIWLHBSPZYAU-UHFFFAOYSA-N 0.000 description 1
- NSIVRNNJQWGNOR-UHFFFAOYSA-N methyl 3-(1-aminoisoquinolin-6-yl)-2-(naphthalen-2-ylsulfonylamino)propanoate;hydrochloride Chemical compound Cl.C1=CC=CC2=CC(S(=O)(=O)NC(CC=3C=C4C=CN=C(N)C4=CC=3)C(=O)OC)=CC=C21 NSIVRNNJQWGNOR-UHFFFAOYSA-N 0.000 description 1
- QBPGZMKKPVHXPU-UHFFFAOYSA-N methyl 3-[4-(methylamino)piperidin-1-yl]-3-oxopropanoate Chemical compound CNC1CCN(C(=O)CC(=O)OC)CC1 QBPGZMKKPVHXPU-UHFFFAOYSA-N 0.000 description 1
- VUBSDXCPEPAEID-UHFFFAOYSA-N methyl 3-oxo-3-(4-oxopiperidin-1-yl)propanoate Chemical compound COC(=O)CC(=O)N1CCC(=O)CC1 VUBSDXCPEPAEID-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- UVICIAUWWQPIDT-SFTDATJTSA-N methyl n-[(1s)-2-[(2s)-2-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate Chemical compound C1([C@@H](C(=O)N2[C@@H](CCC2)C(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)NC(=O)OC)=CC=CC=C1 UVICIAUWWQPIDT-SFTDATJTSA-N 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- AUZGVIFNJGOGAB-UHFFFAOYSA-N morpholine;piperazine Chemical compound C1CNCCN1.C1COCCN1 AUZGVIFNJGOGAB-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- SMBBZHGTZJNSRQ-UHFFFAOYSA-N n'-(6,6-dichlorohexyl)methanediimine Chemical compound ClC(Cl)CCCCCN=C=N SMBBZHGTZJNSRQ-UHFFFAOYSA-N 0.000 description 1
- AKQJYGRFXFRUHL-UHFFFAOYSA-N n,n-bis(methylamino)piperazine-1-carboxamide;hydrochloride Chemical compound Cl.CNN(NC)C(=O)N1CCNCC1 AKQJYGRFXFRUHL-UHFFFAOYSA-N 0.000 description 1
- WOAWLWDCEUALHT-UHFFFAOYSA-N n,n-dimethylpiperazine-1-carboxamide;hydrochloride Chemical compound Cl.CN(C)C(=O)N1CCNCC1 WOAWLWDCEUALHT-UHFFFAOYSA-N 0.000 description 1
- YCJZWBZJSYLMPB-UHFFFAOYSA-N n-(2-chloropyrimidin-4-yl)-2,5-dimethyl-1-phenylimidazole-4-carboxamide Chemical compound CC=1N(C=2C=CC=CC=2)C(C)=NC=1C(=O)NC1=CC=NC(Cl)=N1 YCJZWBZJSYLMPB-UHFFFAOYSA-N 0.000 description 1
- KCMIAFQGVQFTEN-UHFFFAOYSA-N n-(6-bromoisoquinolin-1-yl)benzamide Chemical compound N=1C=CC2=CC(Br)=CC=C2C=1NC(=O)C1=CC=CC=C1 KCMIAFQGVQFTEN-UHFFFAOYSA-N 0.000 description 1
- OMPBIXWEKNLNHB-UHFFFAOYSA-N n-(7-bromoisoquinolin-1-yl)benzamide Chemical compound C12=CC(Br)=CC=C2C=CN=C1NC(=O)C1=CC=CC=C1 OMPBIXWEKNLNHB-UHFFFAOYSA-N 0.000 description 1
- NCAAZNNIEHNDBZ-UHFFFAOYSA-N n-[(1-aminoisoquinolin-6-yl)methyl]-2-[3-(benzylsulfonylamino)-6-methyl-2-oxopyridin-1-yl]acetamide;hydrochloride Chemical compound Cl.O=C1N(CC(=O)NCC=2C=C3C=CN=C(N)C3=CC=2)C(C)=CC=C1NS(=O)(=O)CC1=CC=CC=C1 NCAAZNNIEHNDBZ-UHFFFAOYSA-N 0.000 description 1
- SKEAGJWUKCNICJ-LSDHHAIUSA-N n-[(4-fluoro-3-methoxyphenyl)methyl]-6-[2-[[(2s,5r)-5-(hydroxymethyl)-1,4-dioxan-2-yl]methyl]tetrazol-5-yl]-2-methylpyrimidine-4-carboxamide Chemical compound C1=C(F)C(OC)=CC(CNC(=O)C=2N=C(C)N=C(C=2)C2=NN(C[C@@H]3OC[C@@H](CO)OC3)N=N2)=C1 SKEAGJWUKCNICJ-LSDHHAIUSA-N 0.000 description 1
- HKFDGVPAMUIEFH-UHFFFAOYSA-N n-[3-(1-aminoisoquinolin-7-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]-7-methoxynaphthalene-2-sulfonamide;hydrochloride Chemical compound Cl.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)NC(CC=1C=C2C(N)=NC=CC2=CC=1)C(=O)N1CCC(C)CC1 HKFDGVPAMUIEFH-UHFFFAOYSA-N 0.000 description 1
- HLUFIVKKHWLJNP-UHFFFAOYSA-N n-[3-(4-aminothieno[3,2-c]pyridin-2-yl)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]octane-1-sulfonamide Chemical compound C=1C2=C(N)N=CC=C2SC=1CC(NS(=O)(=O)CCCCCCCC)C(=O)N1CCC(C)CC1 HLUFIVKKHWLJNP-UHFFFAOYSA-N 0.000 description 1
- ROWWAAJQGIAMBL-UHFFFAOYSA-N n-furo[3,2-c]pyridin-4-ylbenzamide Chemical compound N=1C=CC=2OC=CC=2C=1NC(=O)C1=CC=CC=C1 ROWWAAJQGIAMBL-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- WIVNTNLDTMNDNO-UHFFFAOYSA-N octane-1-sulfonyl chloride Chemical compound CCCCCCCCS(Cl)(=O)=O WIVNTNLDTMNDNO-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ASOADIZOVZTJSR-UHFFFAOYSA-N opicapone Chemical compound CC1=C(Cl)C(C)=[N+]([O-])C(Cl)=C1C1=NOC(C=2C=C(C(O)=C(O)C=2)[N+]([O-])=O)=N1 ASOADIZOVZTJSR-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- LKZKGRRDUWVNSR-UHFFFAOYSA-N oxazepin-3-one Chemical compound O=C1NOC=CC=C1 LKZKGRRDUWVNSR-UHFFFAOYSA-N 0.000 description 1
- 125000005188 oxoalkyl group Chemical group 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 229960005190 phenylalanine Drugs 0.000 description 1
- 150000002993 phenylalanine derivatives Chemical class 0.000 description 1
- 125000000405 phenylalanyl group Chemical group 0.000 description 1
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 150000003147 proline derivatives Chemical class 0.000 description 1
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 229960000856 protein c Drugs 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 230000003331 prothrombotic effect Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- FNNIAKKPBXJGNJ-UHFFFAOYSA-N pyrazolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCN1 FNNIAKKPBXJGNJ-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 230000009711 regulatory function Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Chemical class 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 210000004895 subcellular structure Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000001839 systemic circulation Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- FDMCEXDXULPJPG-MERQFXBCSA-N tert-butyl (2s)-2-amino-3-phenylpropanoate;hydrochloride Chemical compound Cl.CC(C)(C)OC(=O)[C@@H](N)CC1=CC=CC=C1 FDMCEXDXULPJPG-MERQFXBCSA-N 0.000 description 1
- SHYQASWYIJQAHU-DDXKXVGSSA-N tert-butyl (3s)-4-[[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-3-(benzylsulfonylamino)-4-oxobutanoate;hydrochloride Chemical compound Cl.N([C@@H](CC(=O)OC(C)(C)C)C(=O)NC(CC=1C=C2C=CN=C(N)C2=CC=1)C(=O)N1CCCCC1)S(=O)(=O)CC1=CC=CC=C1 SHYQASWYIJQAHU-DDXKXVGSSA-N 0.000 description 1
- FLDOISOIBLOFFV-BJSSTWLPSA-N tert-butyl (3s)-4-[[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]amino]-3-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-4-oxobutanoate;hydrochloride Chemical compound Cl.CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)NC(C(=O)N1CCCCC1)CC1=CC=C(C(N)=NC=C2)C2=C1 FLDOISOIBLOFFV-BJSSTWLPSA-N 0.000 description 1
- YJJWLKMRFAHKNV-UHFFFAOYSA-N tert-butyl 2-(3-amino-6-methyl-2-oxopyridin-1-yl)acetate Chemical compound CC1=CC=C(N)C(=O)N1CC(=O)OC(C)(C)C YJJWLKMRFAHKNV-UHFFFAOYSA-N 0.000 description 1
- BVTUDVNBQYLPMZ-UHFFFAOYSA-N tert-butyl 4-(dimethylcarbamoyl)piperazine-1-carboxylate Chemical compound CN(C)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 BVTUDVNBQYLPMZ-UHFFFAOYSA-N 0.000 description 1
- PMLKGZDHVIESDK-UHFFFAOYSA-N tert-butyl 4-(trifluoromethylsulfonyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(S(=O)(=O)C(F)(F)F)CC1 PMLKGZDHVIESDK-UHFFFAOYSA-N 0.000 description 1
- WATASAJREKAPOT-UHFFFAOYSA-N tert-butyl 4-methoxypiperidine-1-carboxylate Chemical compound COC1CCN(C(=O)OC(C)(C)C)CC1 WATASAJREKAPOT-UHFFFAOYSA-N 0.000 description 1
- UAKLZIDLURQUIP-UHFFFAOYSA-N tert-butyl n-[3-(1-aminoisoquinolin-6-yl)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamate Chemical compound C=1C=C2C(N)=NC=CC2=CC=1CC(NC(=O)OC(C)(C)C)C(=O)N1CCCCC1 UAKLZIDLURQUIP-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- DYTQGJLVGDSCLF-UHFFFAOYSA-N thieno[2,3-d]pyrimidin-4-amine Chemical compound NC1=NC=NC2=C1C=CS2 DYTQGJLVGDSCLF-UHFFFAOYSA-N 0.000 description 1
- LIVYKAHFQBZQRL-UHFFFAOYSA-N thieno[3,2-c]pyridin-4-amine Chemical compound NC1=NC=CC2=C1C=CS2 LIVYKAHFQBZQRL-UHFFFAOYSA-N 0.000 description 1
- QIZMFTNGJPBSBT-UHFFFAOYSA-N thieno[3,2-d]pyrimidin-4-amine Chemical compound NC1=NC=NC2=C1SC=C2 QIZMFTNGJPBSBT-UHFFFAOYSA-N 0.000 description 1
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 1
- 201000005060 thrombophlebitis Diseases 0.000 description 1
- 230000001732 thrombotic effect Effects 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06008—Dipeptides with the first amino acid being neutral
- C07K5/06017—Dipeptides with the first amino acid being neutral and aliphatic
- C07K5/06026—Dipeptides with the first amino acid being neutral and aliphatic the side chain containing 0 or 1 carbon atom, i.e. Gly or Ala
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06008—Dipeptides with the first amino acid being neutral
- C07K5/06078—Dipeptides with the first amino acid being neutral and aromatic or cycloaliphatic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06104—Dipeptides with the first amino acid being acidic
- C07K5/06113—Asp- or Asn-amino acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06139—Dipeptides with the first amino acid being heterocyclic
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Hematology (AREA)
- Public Health (AREA)
- Diabetes (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP97201227 | 1997-04-24 | ||
| EP97201227.2 | 1997-04-24 | ||
| PCT/EP1998/002455 WO1998047876A1 (en) | 1997-04-24 | 1998-04-21 | Heterocyclic derivatives and their use as antithrombotic agents |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2001523240A JP2001523240A (ja) | 2001-11-20 |
| JP2001523240A5 JP2001523240A5 (enExample) | 2005-12-02 |
| JP4392061B2 true JP4392061B2 (ja) | 2009-12-24 |
Family
ID=8228249
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP54504198A Expired - Fee Related JP4392061B2 (ja) | 1997-04-24 | 1998-04-21 | ヘテロ環誘導体および抗血栓剤としてのその使用 |
Country Status (10)
| Country | Link |
|---|---|
| US (4) | US6194409B1 (enExample) |
| EP (2) | EP1505062A1 (enExample) |
| JP (1) | JP4392061B2 (enExample) |
| AR (1) | AR012588A1 (enExample) |
| AU (1) | AU7648698A (enExample) |
| CA (1) | CA2287558C (enExample) |
| IL (1) | IL123986A (enExample) |
| TW (1) | TWI228123B (enExample) |
| WO (1) | WO1998047876A1 (enExample) |
| ZA (1) | ZA983176B (enExample) |
Families Citing this family (87)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6602864B1 (en) * | 1996-12-13 | 2003-08-05 | Aventis Pharma Deutschland Gmbh | Sulfonic acid or sulfonylamino N-(heteroaralkyl)-azaheterocyclylamide compounds |
| EP1009758B1 (en) * | 1997-08-29 | 2005-06-01 | Tularik Limited | Meta-benzamidine derivatives as serine protease inhibitors |
| AU753675B2 (en) * | 1998-03-19 | 2002-10-24 | Ajinomoto Co., Inc. | Aminoisoquinoline derivatives |
| WO2000009480A1 (en) * | 1998-08-11 | 2000-02-24 | Daiichi Pharmaceutical Co., Ltd. | Novel sulfonyl derivatives |
| ES2209337T3 (es) | 1998-08-14 | 2004-06-16 | Pfizer Inc. | Agentes antitromboticos. |
| TW575567B (en) * | 1998-10-23 | 2004-02-11 | Akzo Nobel Nv | Serine protease inhibitor |
| EP1058549A4 (en) * | 1998-12-23 | 2003-11-12 | Bristol Myers Squibb Pharma Co | FACTOR Xa OR THROMBIN INHIBITORS |
| KR20000047461A (ko) * | 1998-12-29 | 2000-07-25 | 성재갑 | 트롬빈 억제제 |
| US6653316B1 (en) | 1999-05-19 | 2003-11-25 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl pyrimidinones useful for selective inhibition of the coagulation cascade |
| US6750342B1 (en) | 1999-05-19 | 2004-06-15 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl pyrimidinones useful for selective inhibition of the coagulation cascade |
| US6716838B1 (en) | 1999-05-19 | 2004-04-06 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl uracils as anticoagulative agents |
| MXPA01011805A (es) * | 1999-05-19 | 2003-09-04 | Pharmacia Corp | Aril y heteroaril piridonas policiclicas, substituidas utiles para la inhibicion selectiva de la cascada de coagulacion. |
| US7015230B1 (en) | 1999-05-19 | 2006-03-21 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl uracils useful for selective inhibition of the coagulation cascade |
| US6458952B1 (en) | 1999-05-19 | 2002-10-01 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl uracils useful for selective inhibition of the coagulation cascade |
| US6867217B1 (en) | 1999-05-19 | 2005-03-15 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl pyridones useful for selective inhibition of the coagulation cascade |
| US6664255B1 (en) | 1999-05-19 | 2003-12-16 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl pyrazinones useful for selective inhibition of the coagulation cascade |
| WO2000071493A2 (en) * | 1999-05-24 | 2000-11-30 | Cor Therapeutics, Inc. | INHIBITORS OF FACTOR Xa |
| GB9929552D0 (en) * | 1999-12-14 | 2000-02-09 | Proteus Molecular Design | Compounds |
| WO2000076970A2 (en) * | 1999-06-14 | 2000-12-21 | Eli Lilly And Company | Serine protease inhibitors |
| CA2375920A1 (en) * | 1999-06-14 | 2000-12-21 | Eli Lilly And Company | Compounds |
| JP2003519120A (ja) * | 1999-12-27 | 2003-06-17 | オーソーマクニール ファーマシューティカル, インコーポレイテッド | 卵胞刺激ホルモンの拮抗物質としての置換したアミノアルキルアミド誘導体 |
| WO2001068605A1 (en) | 2000-03-13 | 2001-09-20 | Pharmacia Corporation | Polycyclic aryl and heteroaryl substituted benzenes useful for selective inhibition of the coagulation cascade |
| EP1267876A1 (en) | 2000-03-23 | 2003-01-02 | Merck & Co., Inc. | Thrombin inhibitors |
| EP1268428A2 (en) | 2000-04-05 | 2003-01-02 | Pharmacia Corporation | Polycyclic aryl and heteroaryl substituted 4-pyridones useful for selective inhibition of the coagulation cascade |
| US6875791B2 (en) | 2000-04-05 | 2005-04-05 | Pharmacia Corporation | Polycyclic aryl and heteroaryl substituted 4-pyrones useful for selective inhibition of the coagulation cascade |
| EP1274676A2 (en) | 2000-04-17 | 2003-01-15 | Pharmacia Corporation | Polycyclic aryl and heteroaryl substituted 1,4-quinones useful for selective inhibition of the coagulation cascade |
| SI20582A (sl) * | 2000-05-05 | 2001-12-31 | Univerza V Ljubljani | Novi inhibitorji trombina, njihova priprava in uporaba |
| AU2001256733A1 (en) * | 2000-05-16 | 2001-11-26 | Takeda Chemical Industries Ltd. | Melanin-concentrating hormone antagonist |
| WO2001087851A1 (en) * | 2000-05-18 | 2001-11-22 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl pyrimidinones useful for selective inhibition of the coagulation cascade |
| GB0030305D0 (en) | 2000-12-13 | 2001-01-24 | Lilly Co Eli | Compounds |
| US7074934B2 (en) | 2000-06-13 | 2006-07-11 | Tularik Limited | Serine protease inhibitors |
| GB0030304D0 (en) | 2000-12-13 | 2001-01-24 | Lilly Co Eli | Compounds |
| GB0030306D0 (en) | 2000-12-13 | 2001-01-24 | Lilly Co Eli | Compounds |
| GB0030303D0 (en) | 2000-12-13 | 2001-01-24 | Lilly Co Eli | Compounds |
| WO2002004423A1 (en) | 2000-07-12 | 2002-01-17 | Akzo Nobel N.V. | Thrombin inhibitors comprising an aminoisoquinoline group |
| US6906192B2 (en) | 2000-11-07 | 2005-06-14 | Bristol Myers Squibb Company | Processes for the preparation of acid derivatives useful as serine protease inhibitors |
| HUP0400651A2 (hu) | 2000-11-07 | 2004-06-28 | Bristol-Myers Squibb Company | Szerin proteáz inhibitorokként alkalmazható savszármazékok és ezeket tartalmazó gyógyszerkészítmények |
| US7015223B1 (en) | 2000-11-20 | 2006-03-21 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl 1,2,4-triazinones useful for selective inhibition of the coagulation cascade |
| WO2002042272A2 (en) | 2000-11-20 | 2002-05-30 | Pharmacia Corporation | Substituted polycyclic aryl and heteroaryl pyridines useful for selective inhibition of the coagulation cascade |
| US7119094B1 (en) | 2000-11-20 | 2006-10-10 | Warner-Lambert Company | Substituted polycyclic aryl and heteroarpyl pyrazinones useful for selective inhibition of the coagulation cascade |
| GB0114185D0 (en) | 2001-06-12 | 2001-08-01 | Protherics Molecular Design Lt | Compounds |
| JP2004518688A (ja) | 2001-01-30 | 2004-06-24 | ブリストル−マイヤーズ スクイブ カンパニー | ファクターXa阻害剤のスルホンアミドラクタムおよびその方法 |
| GB0114004D0 (en) | 2001-06-08 | 2001-08-01 | Glaxo Group Ltd | Chemical compounds |
| GB0114005D0 (en) | 2001-06-08 | 2001-08-01 | Glaxo Group Ltd | Chemical compounds |
| US6905813B2 (en) * | 2001-08-29 | 2005-06-14 | Chugai Photo Chemical Co., Ltd. | Processing agent for silver halide color photosensitive material and processing method thereof |
| MXPA04003170A (es) | 2001-10-03 | 2004-07-08 | Pharmacia Corp | Compuestos policiclicos, sustituidos, provisto de 5 miembros, utiles para la inhibicion selectiva de la cascada de coagulacion. |
| CA2462305A1 (en) | 2001-10-03 | 2003-04-10 | Michael S. South | 6-membered heterocyclic compounds useful for selective inhibition of the coagulation cascade |
| WO2004072102A2 (en) * | 2003-02-11 | 2004-08-26 | Bristol-Myers Squibb Company | Benzene acetamide compounds useful as serine protease inhibitors |
| US7122559B2 (en) * | 2003-02-11 | 2006-10-17 | Bristol-Myers Squibb Company | Phenylglycine derivatives useful as serine protease inhibitors |
| US20070179155A1 (en) * | 2003-06-20 | 2007-08-02 | Brian Smith | N-phenyl-piperazine derivatives and methods of prophylaxis or treatment of 5ht2c receptor associated diseases |
| US7202363B2 (en) | 2003-07-24 | 2007-04-10 | Abbott Laboratories | Thienopyridine and furopyridine kinase inhibitors |
| JPWO2006064780A1 (ja) * | 2004-12-14 | 2008-06-12 | 塩野義製薬株式会社 | 便秘治療剤 |
| US8193359B2 (en) | 2004-12-24 | 2012-06-05 | Prosidion Limited | G-protein coupled receptor agonists |
| ATE479676T1 (de) * | 2005-01-10 | 2010-09-15 | Bristol Myers Squibb Co | Als antikoagulanzien verwendbare phenylglycinamid-derivate |
| GB0507577D0 (en) | 2005-04-14 | 2005-05-18 | Novartis Ag | Organic compounds |
| DE602006011752D1 (de) * | 2005-06-24 | 2010-03-04 | Bristol Myers Squibb Co | Als antikoagulationsmittel geeignete phenylglycinamid- und pyridylglycinamidderivate |
| TWI389899B (zh) * | 2006-08-08 | 2013-03-21 | Msd Oss Bv | 具口服活性之凝血酶抑制劑 |
| AR063258A1 (es) * | 2006-10-13 | 2009-01-14 | Actelion Pharmaceuticals Ltd | Derivados de 2-aminocarbonil-piridina, una composicion farmaceutica que los contiene y su uso en la preparacion de un medicamento para el tratamiento de trastornos vasculares oclusivos. |
| US8247403B2 (en) | 2007-03-07 | 2012-08-21 | Takeda Pharmaceutical Company Limited | Benzoxazepine derivatives and use thereof |
| WO2008144483A2 (en) * | 2007-05-18 | 2008-11-27 | Armgo Pharma, Inc. | Agents for treating disorders involving modulation of ryanodine receptors |
| EP2138495A1 (en) | 2008-06-26 | 2009-12-30 | sanofi-aventis | Substituted pyrimido[2,1-a]isoquinolin-4-one derivatives |
| EP2138485A1 (en) | 2008-06-26 | 2009-12-30 | sanofi-aventis | Substituted N-Oxide pyrazine derivatives |
| EP2138493A1 (en) | 2008-06-26 | 2009-12-30 | Sanofi-Aventis | Substituted pyrimidone derivatives |
| EP2138492A1 (en) | 2008-06-26 | 2009-12-30 | Sanofi-Aventis | Substituted pyrimidin-4-one derivatives |
| EP2138498A1 (en) | 2008-06-26 | 2009-12-30 | sanofi-aventis | Substituted tricyclic derivatives against neurodegenerative diseases |
| EP2138494A1 (en) | 2008-06-26 | 2009-12-30 | Sanofi-Aventis | Substituted alkyl pyrimidin-4-one derivatives |
| EP2138488A1 (en) | 2008-06-26 | 2009-12-30 | sanofi-aventis | 4-(pyridin-4-yl)-1H-[1,3,5]triazin-2-one derivatives as GSK3-beta inhibitors for the treatment of neurodegenerative diseases |
| CN101684077B (zh) | 2008-09-24 | 2013-01-02 | 浙江九洲药业股份有限公司 | N-酰基联苯丙氨酸的制备方法 |
| CN101774941A (zh) | 2009-01-13 | 2010-07-14 | 浙江九洲药业股份有限公司 | 2-酰基氨基-3-联苯基丙酸的制备及拆分方法 |
| CN101555211B (zh) * | 2009-05-13 | 2012-01-25 | 浙江九洲药业股份有限公司 | 2-酰基氨基-3-联苯基丙酸的化学合成方法 |
| EP2480523B1 (en) * | 2009-09-23 | 2017-03-01 | Zhejiang Jiuzhou Pharmaceutical Co., Ltd. | Process for manufacture of n-acylbphenyl alanine |
| WO2012015949A2 (en) * | 2010-07-29 | 2012-02-02 | Joule Unlimited Technologies, Inc. | Methods and compositions for improving yields of reduced products of photosynthetic microorganisms |
| MY182666A (en) | 2010-11-05 | 2021-01-28 | Senomyx Inc | Compounds useful as modulators of trpm8 |
| EP2606893A1 (en) * | 2011-12-21 | 2013-06-26 | Sanofi | Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application |
| WO2014188211A1 (en) | 2013-05-23 | 2014-11-27 | Kalvista Pharmaceuticals Limited | Heterocyclic derivates |
| ITUB20150417A1 (it) * | 2015-05-08 | 2016-11-08 | Dipharma Francis Srl | Procedimento per la preparazione di composti piperidinici |
| JP6865743B2 (ja) | 2015-10-01 | 2021-04-28 | フィルメニッヒ インコーポレイテッドFirmenich Incorporated | Trpm8の活性調節因子として有用な化合物 |
| GB201805174D0 (en) * | 2018-03-29 | 2018-05-16 | Univ Leeds Innovations Ltd | Compounds |
| GB201807014D0 (en) * | 2018-04-30 | 2018-06-13 | Univ Leeds Innovations Ltd | Factor xlla inhibitors |
| SMT202400527T1 (it) | 2019-07-01 | 2025-01-14 | Tonix Pharma Ltd | Anticorpi anti-cd154 e loro usi |
| CA3147564A1 (en) * | 2019-08-21 | 2021-02-25 | Kalvista Pharmaceuticals Limited | Enzyme inhibitors |
| CN114258392A (zh) * | 2019-08-21 | 2022-03-29 | 卡尔维斯塔制药有限公司 | 酶抑制剂 |
| AR121715A1 (es) * | 2020-04-03 | 2022-06-29 | Biocryst Pharm Inc | Pirrolopirimidinaminas como inhibidores del sistema del complemento |
| CA3207098A1 (en) | 2021-01-06 | 2022-07-14 | Tonix Pharma Limited | Methods of inducing immune tolerance with modified anti-cd154 antibodies |
| WO2024044098A2 (en) * | 2022-08-23 | 2024-02-29 | Alexion Pharmaceuticals, Inc. | Pharmaceutical compounds for the treatment of complement mediated disorders |
| WO2025248134A1 (en) | 2024-05-31 | 2025-12-04 | Tonix Pharma Limited | Treatment methods comprising administration of modified cd154 antibodies |
| CN119954681A (zh) * | 2025-02-05 | 2025-05-09 | 南京工业大学 | 一种小分子光交联剂、制备方法及应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR920703558A (ko) | 1990-11-15 | 1992-12-18 | 원본미기재 | 메타-치환 페닐알라닌 유도체 |
| WO1992016549A1 (de) * | 1991-03-18 | 1992-10-01 | Pentapharm Ag | Para-substituierte phenylalanin-derivate |
| PH31294A (en) * | 1992-02-13 | 1998-07-06 | Thomae Gmbh Dr K | Benzimidazolyl derivatives, pharmaceutical compositions containing these compounds and process for preparing them. |
| DE4332168A1 (de) | 1993-02-22 | 1995-03-23 | Thomae Gmbh Dr K | Cyclische Derivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| GB9322976D0 (en) * | 1993-11-08 | 1994-01-05 | Pfizer Ltd | Therapeutic agents |
| EP0944386B1 (en) * | 1996-12-13 | 2002-09-18 | Aventis Pharmaceuticals Inc. | Sulfonic acid or sulfonylamino n-(heteroaralkyl)-azaheterocyclylamide compounds |
-
1998
- 1998-04-07 IL IL123986A patent/IL123986A/en not_active IP Right Cessation
- 1998-04-08 TW TW087105306A patent/TWI228123B/zh not_active IP Right Cessation
- 1998-04-15 ZA ZA983176A patent/ZA983176B/xx unknown
- 1998-04-21 EP EP04105699A patent/EP1505062A1/en not_active Withdrawn
- 1998-04-21 EP EP98924206A patent/EP0975600A1/en not_active Withdrawn
- 1998-04-21 JP JP54504198A patent/JP4392061B2/ja not_active Expired - Fee Related
- 1998-04-21 AU AU76486/98A patent/AU7648698A/en not_active Abandoned
- 1998-04-21 WO PCT/EP1998/002455 patent/WO1998047876A1/en not_active Ceased
- 1998-04-21 CA CA002287558A patent/CA2287558C/en not_active Expired - Fee Related
- 1998-04-21 US US09/403,327 patent/US6194409B1/en not_active Expired - Lifetime
- 1998-04-22 AR ARP980101846A patent/AR012588A1/es active IP Right Grant
-
2000
- 2000-04-17 US US09/550,954 patent/US6444672B1/en not_active Expired - Lifetime
- 2000-10-04 US US09/679,232 patent/US6432955B1/en not_active Expired - Lifetime
-
2002
- 2002-06-20 US US10/178,441 patent/US6797710B2/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| AU7648698A (en) | 1998-11-13 |
| TWI228123B (en) | 2005-02-21 |
| AR012588A1 (es) | 2000-11-08 |
| US6432955B1 (en) | 2002-08-13 |
| EP0975600A1 (en) | 2000-02-02 |
| US20030130270A1 (en) | 2003-07-10 |
| EP1505062A1 (en) | 2005-02-09 |
| JP2001523240A (ja) | 2001-11-20 |
| IL123986A (en) | 2011-10-31 |
| CA2287558C (en) | 2009-09-08 |
| ZA983176B (en) | 1998-10-21 |
| IL123986A0 (en) | 1998-12-06 |
| CA2287558A1 (en) | 1998-10-29 |
| US6797710B2 (en) | 2004-09-28 |
| WO1998047876A1 (en) | 1998-10-29 |
| US6444672B1 (en) | 2002-09-03 |
| US6194409B1 (en) | 2001-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4392061B2 (ja) | ヘテロ環誘導体および抗血栓剤としてのその使用 | |
| EP0643072B1 (en) | 2-Piperazinone compounds and their use | |
| EP1140918B1 (en) | Thrombin inhibitors | |
| EP0822931B1 (en) | Piperazinones useful as inhibitors of platelet aggregation | |
| WO1996039380A1 (en) | BIS-ARYLSULFONYLAMINOBENZAMIDE DERIVATIVES AND THE USE THEREOF AS FACTOR Xa INHIBITORS | |
| EP0841918B1 (en) | Thrombin inhibitors | |
| EP0858262B1 (en) | Thrombin inhibitors | |
| EP1212300B1 (en) | Azacycloalkanone serine protease inhibitors | |
| US6242600B1 (en) | 2-piperazinone-1-acetic acid derivatives and their use | |
| US6774110B2 (en) | Orally available peptidic thrombin inhibitors | |
| EP0832879A1 (en) | Process for preparing intermediates for thrombin inhibitors | |
| JPH07157472A (ja) | 2−ピペラジノン−1−酢酸誘導体およびその用途 | |
| MXPA01006708A (en) | Thrombin inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20050420 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20050420 |
|
| A711 | Notification of change in applicant |
Free format text: JAPANESE INTERMEDIATE CODE: A711 Effective date: 20070416 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20090106 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20090330 |
|
| A602 | Written permission of extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A602 Effective date: 20090518 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20090702 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20090915 |
|
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20091009 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20121016 Year of fee payment: 3 |
|
| R150 | Certificate of patent or registration of utility model |
Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20121016 Year of fee payment: 3 |
|
| S111 | Request for change of ownership or part of ownership |
Free format text: JAPANESE INTERMEDIATE CODE: R313111 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20121016 Year of fee payment: 3 |
|
| R371 | Transfer withdrawn |
Free format text: JAPANESE INTERMEDIATE CODE: R371 |
|
| S111 | Request for change of ownership or part of ownership |
Free format text: JAPANESE INTERMEDIATE CODE: R313111 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20121016 Year of fee payment: 3 |
|
| R350 | Written notification of registration of transfer |
Free format text: JAPANESE INTERMEDIATE CODE: R350 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20121016 Year of fee payment: 3 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20131016 Year of fee payment: 4 |
|
| S111 | Request for change of ownership or part of ownership |
Free format text: JAPANESE INTERMEDIATE CODE: R313111 |
|
| R350 | Written notification of registration of transfer |
Free format text: JAPANESE INTERMEDIATE CODE: R350 |
|
| LAPS | Cancellation because of no payment of annual fees |