JP2007518777A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2007518777A5 JP2007518777A5 JP2006550177A JP2006550177A JP2007518777A5 JP 2007518777 A5 JP2007518777 A5 JP 2007518777A5 JP 2006550177 A JP2006550177 A JP 2006550177A JP 2006550177 A JP2006550177 A JP 2006550177A JP 2007518777 A5 JP2007518777 A5 JP 2007518777A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- alkoxy
- alkanoyl
- butyloxy
- cycloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- -1 methylene, oxy Chemical group 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000004043 oxo group Chemical group O=* 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000002619 bicyclic group Chemical group 0.000 claims description 2
- IBAHLNWTOIHLKE-UHFFFAOYSA-N cyano cyanate Chemical compound N#COC#N IBAHLNWTOIHLKE-UHFFFAOYSA-N 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH952004 | 2004-01-23 | ||
| PCT/EP2005/050273 WO2005070870A2 (en) | 2004-01-23 | 2005-01-21 | Amino alcohol derivatives and their use as renin inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2007518777A JP2007518777A (ja) | 2007-07-12 |
| JP2007518777A5 true JP2007518777A5 (https=) | 2008-03-21 |
Family
ID=34800315
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2006550177A Ceased JP2007518777A (ja) | 2004-01-23 | 2005-01-21 | アミノアルコール誘導体およびレニン阻害剤としてのその使用 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US7767690B2 (https=) |
| EP (1) | EP1711456A2 (https=) |
| JP (1) | JP2007518777A (https=) |
| CN (1) | CN1910136A (https=) |
| AR (1) | AR047445A1 (https=) |
| BR (1) | BRPI0506490A (https=) |
| CA (1) | CA2553836A1 (https=) |
| IL (1) | IL176901A0 (https=) |
| TW (1) | TW200530214A (https=) |
| WO (1) | WO2005070870A2 (https=) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0505969D0 (en) | 2005-03-23 | 2005-04-27 | Novartis Ag | Organic compounds |
| US20070021400A1 (en) | 2005-07-20 | 2007-01-25 | Peter Herold | Amino alcohols as therapeutic compounds |
| BRPI0620736A2 (pt) | 2005-12-30 | 2011-12-20 | Novartis Ag | compostos orgánicos |
| US8158790B2 (en) | 2006-06-23 | 2012-04-17 | Daiichi Sankyo Company, Limited | Cyclic amine compound |
| SG182223A1 (en) | 2007-06-25 | 2012-07-30 | Novartis Ag | N5-(2-ethoxyethyl)-n3-(2-pyridinyl)-3,5-piperidinedicarboxamide derivatives for use as renin inhibitors |
| WO2009106599A2 (en) * | 2008-02-29 | 2009-09-03 | Novartis Ag | Substituted piperidines as therapeutic compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL294870A1 (https=) * | 1991-06-21 | 1993-02-08 | Hoechst Ag | |
| EP0702004A2 (de) * | 1994-09-15 | 1996-03-20 | Ciba-Geigy Ag | 2,9-Diamino- und 2-amino-8-carbamoyl-4-hydroxy-alkansäureamid-derivative |
| US8168616B1 (en) | 2000-11-17 | 2012-05-01 | Novartis Ag | Combination comprising a renin inhibitor and an angiotensin receptor inhibitor for hypertension |
| BRPI0506491A (pt) * | 2004-01-23 | 2007-02-13 | Speedel Experimenta Ag | compostos orgánicos |
-
2005
- 2005-01-21 EP EP05707823A patent/EP1711456A2/en not_active Withdrawn
- 2005-01-21 BR BRPI0506490-2A patent/BRPI0506490A/pt not_active IP Right Cessation
- 2005-01-21 JP JP2006550177A patent/JP2007518777A/ja not_active Ceased
- 2005-01-21 CA CA002553836A patent/CA2553836A1/en not_active Abandoned
- 2005-01-21 US US10/587,046 patent/US7767690B2/en not_active Expired - Fee Related
- 2005-01-21 CN CNA2005800030576A patent/CN1910136A/zh active Pending
- 2005-01-21 AR ARP050100227A patent/AR047445A1/es unknown
- 2005-01-21 WO PCT/EP2005/050273 patent/WO2005070870A2/en not_active Ceased
- 2005-01-21 TW TW094101796A patent/TW200530214A/zh unknown
-
2006
- 2006-07-17 IL IL176901A patent/IL176901A0/en unknown