JP2007131848A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2007131848A5 JP2007131848A5 JP2006303296A JP2006303296A JP2007131848A5 JP 2007131848 A5 JP2007131848 A5 JP 2007131848A5 JP 2006303296 A JP2006303296 A JP 2006303296A JP 2006303296 A JP2006303296 A JP 2006303296A JP 2007131848 A5 JP2007131848 A5 JP 2007131848A5
- Authority
- JP
- Japan
- Prior art keywords
- composition according
- composition
- containing compound
- lubricating
- gear
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 claims description 66
- 150000001875 compounds Chemical class 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 230000001050 lubricating effect Effects 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 15
- -1 compound salt Chemical class 0.000 claims description 15
- 229910052698 phosphorus Inorganic materials 0.000 claims description 15
- 239000011574 phosphorus Substances 0.000 claims description 15
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 14
- 229910052717 sulfur Inorganic materials 0.000 claims description 14
- 239000011593 sulfur Substances 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 8
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 229910052796 boron Inorganic materials 0.000 claims description 6
- 239000000446 fuel Substances 0.000 claims description 6
- 239000000314 lubricant Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 239000003607 modifier Substances 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 description 6
- 239000002199 base oil Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 3
- 229920013639 polyalphaolefin Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000005461 organic phosphorous group Chemical group 0.000 description 2
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- 0 *C(*)(C(*)(*)O1)C(*)(*)OP1(O)=S Chemical compound *C(*)(C(*)(*)O1)C(*)(*)OP1(O)=S 0.000 description 1
- OUCGJMIVSYHBEC-UHFFFAOYSA-N 2-ethylhexyl 2-ethylhexanoate Chemical compound CCCCC(CC)COC(=O)C(CC)CCCC OUCGJMIVSYHBEC-UHFFFAOYSA-N 0.000 description 1
- LJKDOMVGKKPJBH-UHFFFAOYSA-N 2-ethylhexyl dihydrogen phosphate Chemical compound CCCCC(CC)COP(O)(O)=O LJKDOMVGKKPJBH-UHFFFAOYSA-N 0.000 description 1
- SZGBSAJQKRIGHR-UHFFFAOYSA-N 3-dihydroxyphosphinothioyloxy-2,2-dimethylpropan-1-ol Chemical compound OCC(C)(C)COP(O)(O)=S SZGBSAJQKRIGHR-UHFFFAOYSA-N 0.000 description 1
- ARKBMHLACAUIQS-UHFFFAOYSA-N 6-methylheptyl 2-ethylhexanoate Chemical compound CCCCC(CC)C(=O)OCCCCCC(C)C ARKBMHLACAUIQS-UHFFFAOYSA-N 0.000 description 1
- QPMMHSBIHVGXNV-UHFFFAOYSA-N 6-methylheptyl 3-methylbutanoate Chemical compound CC(C)CCCCCOC(=O)CC(C)C QPMMHSBIHVGXNV-UHFFFAOYSA-N 0.000 description 1
- LHXGZVIIKDOWLE-UHFFFAOYSA-N 6-methylheptyl heptanoate Chemical compound CCCCCCC(=O)OCCCCCC(C)C LHXGZVIIKDOWLE-UHFFFAOYSA-N 0.000 description 1
- DYDCJEMYLPOPBS-UHFFFAOYSA-N 6-methylheptyl pentanoate Chemical compound CCCCC(=O)OCCCCCC(C)C DYDCJEMYLPOPBS-UHFFFAOYSA-N 0.000 description 1
- DYSQPEDMFPRGFD-UHFFFAOYSA-N 7-methyloctyl 2-ethylhexanoate Chemical compound CCCCC(CC)C(=O)OCCCCCCC(C)C DYSQPEDMFPRGFD-UHFFFAOYSA-N 0.000 description 1
- NYOXXFRUDQXKHS-UHFFFAOYSA-N 7-methyloctyl 3-methylbutanoate Chemical compound CC(C)CCCCCCOC(=O)CC(C)C NYOXXFRUDQXKHS-UHFFFAOYSA-N 0.000 description 1
- HPZLYWRSZQYGCA-UHFFFAOYSA-N 7-methyloctyl heptanoate Chemical compound CCCCCCC(=O)OCCCCCCC(C)C HPZLYWRSZQYGCA-UHFFFAOYSA-N 0.000 description 1
- LTWDCIZPDLSBLA-UHFFFAOYSA-N 7-methyloctyl pentanoate Chemical compound CCCCC(=O)OCCCCCCC(C)C LTWDCIZPDLSBLA-UHFFFAOYSA-N 0.000 description 1
- XAZROQGRFWCMBU-UHFFFAOYSA-N Octyl heptanoate Chemical compound CCCCCCCCOC(=O)CCCCCC XAZROQGRFWCMBU-UHFFFAOYSA-N 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- IZOUGMYSRZLQHB-UHFFFAOYSA-N decyl heptanoate Chemical compound CCCCCCCCCCOC(=O)CCCCCC IZOUGMYSRZLQHB-UHFFFAOYSA-N 0.000 description 1
- CNLMHVUZVNKYJA-UHFFFAOYSA-N decyl pentanoate Chemical compound CCCCCCCCCCOC(=O)CCCC CNLMHVUZVNKYJA-UHFFFAOYSA-N 0.000 description 1
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical class OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- JOVBTVIBOUJCPQ-UHFFFAOYSA-N hydroxy-bis(2-methylpropoxy)-sulfanylidene-$l^{5}-phosphane Chemical compound CC(C)COP(O)(=S)OCC(C)C JOVBTVIBOUJCPQ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- XCQXSYSIKVLBKE-UHFFFAOYSA-N nonyl heptanoate Chemical compound CCCCCCCCCOC(=O)CCCCCC XCQXSYSIKVLBKE-UHFFFAOYSA-N 0.000 description 1
- QACHAKPYKAPHJQ-UHFFFAOYSA-N nonyl pentanoate Chemical compound CCCCCCCCCOC(=O)CCCC QACHAKPYKAPHJQ-UHFFFAOYSA-N 0.000 description 1
- OUYCCOBIJYUMAK-UHFFFAOYSA-N octyl pentanoate Chemical compound CCCCCCCCOC(=O)CCCC OUYCCOBIJYUMAK-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- NVTPMUHPCAUGCB-UHFFFAOYSA-N pentyl dihydrogen phosphate Chemical compound CCCCCOP(O)(O)=O NVTPMUHPCAUGCB-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- ZXRDVSMSMOZCPT-UHFFFAOYSA-N phosphorodithious acid Chemical compound OP(S)S ZXRDVSMSMOZCPT-UHFFFAOYSA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73475705P | 2005-11-09 | 2005-11-09 | |
| US11/417,343 US20070105728A1 (en) | 2005-11-09 | 2006-05-03 | Lubricant composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2007131848A JP2007131848A (ja) | 2007-05-31 |
| JP2007131848A5 true JP2007131848A5 (cg-RX-API-DMAC7.html) | 2007-07-12 |
Family
ID=37671933
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2006303296A Withdrawn JP2007131848A (ja) | 2005-11-09 | 2006-11-08 | 潤滑剤組成物 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US20070105728A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1785476A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2007131848A (cg-RX-API-DMAC7.html) |
| KR (1) | KR100838136B1 (cg-RX-API-DMAC7.html) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20070142248A1 (en) * | 2005-11-09 | 2007-06-21 | Degonla David J | Lubricant composition |
| US20070142237A1 (en) * | 2005-11-09 | 2007-06-21 | Degonia David J | Lubricant composition |
| US20070142660A1 (en) * | 2005-11-09 | 2007-06-21 | Degonia David J | Salt of a sulfur-containing, phosphorus-containing compound, and methods thereof |
| US8299003B2 (en) * | 2005-11-09 | 2012-10-30 | Afton Chemical Corporation | Composition comprising a sulfur-containing, phosphorus-containing compound, and/or its salt, and uses thereof |
| US7906465B2 (en) | 2006-07-14 | 2011-03-15 | Afton Chemical Corp. | Lubricant compositions |
| US7902133B2 (en) | 2006-07-14 | 2011-03-08 | Afton Chemical Corporation | Lubricant composition |
| US7879775B2 (en) | 2006-07-14 | 2011-02-01 | Afton Chemical Corporation | Lubricant compositions |
| US8003584B2 (en) | 2006-07-14 | 2011-08-23 | Afton Chemical Corporation | Lubricant compositions |
| US20080015127A1 (en) * | 2006-07-14 | 2008-01-17 | Loper John T | Boundary friction reducing lubricating composition |
| US8445417B2 (en) * | 2007-12-06 | 2013-05-21 | The Lubrizol Corporation | Lubricating composition containing borated phospholipid |
| FR2936812B1 (fr) * | 2008-10-03 | 2010-10-15 | Total France | Compositions lubrifiantes pour transmissions. |
| US10208269B2 (en) | 2013-12-23 | 2019-02-19 | Exxonmobil Research And Engineering Company | Low viscosity ester lubricant and method for using |
| FR3069864B1 (fr) * | 2017-08-03 | 2019-08-16 | Total Marketing Services | Composition lubrifiante comprenant un diester |
| CN107629850B (zh) * | 2017-10-12 | 2020-06-12 | 广东布雷达科技股份有限公司 | 长寿命抗磨变速箱油及其制备方法 |
| CA3087692A1 (en) * | 2018-01-04 | 2019-07-11 | The Lubrizol Corporation | Boron containing automotive gear oil |
Family Cites Families (70)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2063629A (en) * | 1935-02-19 | 1936-12-08 | Du Pont | Esters of the thio acids of phosphorus |
| US2224695A (en) * | 1938-11-25 | 1940-12-10 | Carl F Prutton | Inhibitor |
| US2284409A (en) * | 1940-03-08 | 1942-05-26 | Pittsburgh Corning Corp | Fitting for tempered glass panels |
| US2284410A (en) * | 1940-08-22 | 1942-05-26 | John F Farmer | Adjustable end slide grille |
| US2447288A (en) * | 1946-03-06 | 1948-08-17 | Gulf Oil Corp | Primary aliphatic amine salts of dialiphatic substituted mono-thiophosphoric acids |
| US2616905A (en) * | 1952-03-13 | 1952-11-04 | Lubrizol Corp | Organic alkaline earth metal complexes and methods of making same |
| US3192162A (en) * | 1955-08-12 | 1965-06-29 | Exxon Research Engineering Co | Cyclo-organo compounds of phosphorus |
| US2945749A (en) * | 1956-04-18 | 1960-07-19 | Socony Mobil Oil Co Inc | Stabilized fuel oil containing tertiary alkyl primary amines |
| DE1248643B (de) * | 1959-03-30 | 1967-08-31 | The Lubrizol Corporation, Cleveland, Ohio (V. St. A.) | Verfahren zur Herstellung von öllöslichen aeylierten Aminen |
| NL124842C (cg-RX-API-DMAC7.html) * | 1959-08-24 | |||
| US3087936A (en) * | 1961-08-18 | 1963-04-30 | Lubrizol Corp | Reaction product of an aliphatic olefinpolymer-succinic acid producing compound with an amine and reacting the resulting product with a boron compound |
| US3184411A (en) * | 1962-09-28 | 1965-05-18 | California Research Corp | Lubricants for reducing corrosion |
| US3281428A (en) * | 1963-04-29 | 1966-10-25 | Lubrizol Corp | Reaction product of certain acylated nitrogen containing intermediates and a boron compound |
| US3338832A (en) * | 1963-04-29 | 1967-08-29 | Lubrizol Corp | Lubricating oil containing reaction product of certain acylated nitrogen containing intermediates and a boron compound |
| US3282955A (en) * | 1963-04-29 | 1966-11-01 | Lubrizol Corp | Reaction products of acylated nitrogen intermediates and a boron compound |
| GB1054276A (cg-RX-API-DMAC7.html) * | 1963-05-17 | |||
| US3513093A (en) * | 1963-06-17 | 1970-05-19 | Lubrizol Corp | Lubricant containing nitrogen-containing and phosphorus-containing succinic derivatives |
| US3533945A (en) * | 1963-11-13 | 1970-10-13 | Lubrizol Corp | Lubricating oil composition |
| US3216936A (en) * | 1964-03-02 | 1965-11-09 | Lubrizol Corp | Process of preparing lubricant additives |
| US3658836A (en) * | 1964-04-16 | 1972-04-25 | Monsanto Co | Hydroxyboroxin-amine salts |
| US3342735A (en) * | 1965-04-23 | 1967-09-19 | Texaco Inc | Alkenyl succinic anhydride-amine-ps reaction product |
| US3344069A (en) * | 1965-07-01 | 1967-09-26 | Lubrizol Corp | Lubricant additive and lubricant containing same |
| US3272746A (en) * | 1965-11-22 | 1966-09-13 | Lubrizol Corp | Lubricating composition containing an acylated nitrogen compound |
| US3511780A (en) * | 1966-02-09 | 1970-05-12 | Exxon Research Engineering Co | Oil-soluble ashless dispersant-detergent-inhibitors |
| US3502607A (en) * | 1966-10-31 | 1970-03-24 | Celanese Corp | Art of making dyeable polyacrylonitrile products |
| US3703536A (en) * | 1967-11-24 | 1972-11-21 | Standard Oil Co | Preparation of oil-soluble boron derivatives of an alkylene polyamine-substituted phenol-formaldehyde addition product |
| US3718663A (en) * | 1967-11-24 | 1973-02-27 | Standard Oil Co | Preparation of oil-soluble boron derivatives of an alkylene polyamine-urea or thiourea-succinic anhydride addition product |
| GB1268561A (en) * | 1969-02-06 | 1972-03-29 | Exxon Research Engineering Co | Lubricating and fuel oil compositions |
| GB1329978A (en) * | 1971-06-17 | 1973-09-12 | Exxon Research Engineering Co | Lubricating oil compositions |
| DE2363388C2 (de) * | 1973-12-20 | 1982-08-19 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dialkylthiophosphaten |
| US4234435A (en) * | 1979-02-23 | 1980-11-18 | The Lubrizol Corporation | Novel carboxylic acid acylating agents, derivatives thereof, concentrate and lubricant compositions containing the same, and processes for their preparation |
| GB2081300A (en) * | 1980-07-29 | 1982-02-17 | Exxon Research Engineering Co | Gear or axle oils |
| US4431552A (en) * | 1982-11-26 | 1984-02-14 | Chevron Research Company | Lubricant composition containing an alkali-metal borate and a mixture of phosphates, monothiophosphates and dithiophosphates in a critical ratio |
| US4455243A (en) * | 1983-02-24 | 1984-06-19 | Chevron Research Company | Succinimide complexes of borated fatty acid esters of glycerol and lubricating oil compositions containing same |
| US4615826A (en) * | 1983-09-22 | 1986-10-07 | Chevron Research Company | Hydrocarbon soluble nitrogen containing dispersant-fluorophosphoric acid adducts |
| US4648980A (en) * | 1983-09-22 | 1987-03-10 | Chevron Research Company | Hydrocarbon soluble nitrogen containing dispersant - fluorophosphoric acid adducts |
| DE3789382T2 (de) * | 1986-06-13 | 1994-10-20 | Lubrizol Corp | Phosphor enthaltendes schmiermittel und funktionelle fluidzubereitungen. |
| US4652387A (en) * | 1986-07-30 | 1987-03-24 | Mobil Oil Corporation | Borated reaction products of succinic compounds as lubricant dispersants and antioxidants |
| US4755311A (en) * | 1986-08-14 | 1988-07-05 | The Lubrizol Corporation | Phosphorus-, sulfur- and boron-containing compositions, and lubricant and functional fluid compositions containing same |
| US4943672A (en) * | 1987-12-18 | 1990-07-24 | Exxon Research And Engineering Company | Process for the hydroisomerization of Fischer-Tropsch wax to produce lubricating oil (OP-3403) |
| US5198133A (en) * | 1988-03-14 | 1993-03-30 | Ethyl Petroleum Additives, Inc. | Modified succinimide or sucinamide dispersants and their production |
| US4900460A (en) * | 1988-08-02 | 1990-02-13 | Mobil Oil Corp. | Sulfurized olefin adducts of dihydrocarbyl phosphates and phosphites and lubricant compositions containing same |
| US4857214A (en) * | 1988-09-16 | 1989-08-15 | Ethylk Petroleum Additives, Inc. | Oil-soluble phosphorus antiwear additives for lubricants |
| US4997968A (en) * | 1989-09-28 | 1991-03-05 | The Lubrizol Corporation | Method of preparing monothiophosphoric acid by sulfurizing a phosphite in the presence of an amide |
| CA2040819A1 (en) * | 1990-05-17 | 1991-11-18 | Stephen Norman | Lubricant compositions |
| EP0463994B1 (de) * | 1990-06-26 | 1995-11-08 | Ciba-Geigy Ag | Dioxaphosphorinanverbindungen als Stabilisatoren für organische Materialien |
| CA2099314A1 (en) * | 1992-07-09 | 1994-01-10 | Ian Macpherson | Friction modification of synthetic gear oils |
| US5358650A (en) * | 1993-04-01 | 1994-10-25 | Ethyl Corporation | Gear oil compositions |
| US6096691A (en) * | 1993-04-09 | 2000-08-01 | Ethyl Corporation | Gear oil additive concentrates and lubricants containing them |
| US5698498A (en) * | 1993-06-28 | 1997-12-16 | The Lubrizol Corporation | Hydroxyalkyl dithiocarbamates, their borated esters and lubricants, functional fluids, greases and aqueous compositions containing the same |
| JPH07150183A (ja) * | 1993-08-20 | 1995-06-13 | Lubrizol Corp:The | 熱安定性が向上し、そしてスリップ性能が限定された潤滑組成物 |
| US20030096713A1 (en) * | 1994-04-19 | 2003-05-22 | Eric R. Schnur | Lubricating compositions with improved oxidation resistance containing a dispersant and an antioxidant |
| US5569644A (en) * | 1995-05-18 | 1996-10-29 | The Lubrizol Corporation | Additive combinations for lubricants and functional fluids |
| DE69632920T3 (de) * | 1995-12-08 | 2011-05-12 | Exxonmobil Research And Engineering Co. | Verfahren zur herstellung von biologisch abbaubare hochleistungs-kohlenwasserstoff-basisöle |
| SG64414A1 (en) * | 1996-01-16 | 1999-04-27 | Lubrizol Corp | Lubricating compositions |
| US5882505A (en) * | 1997-06-03 | 1999-03-16 | Exxon Research And Engineering Company | Conversion of fisher-tropsch waxes to lubricants by countercurrent processing |
| US5968880A (en) * | 1997-10-23 | 1999-10-19 | The Lubrizol Corporation | Lubricating compositions, functional fluids and greases containing thiophosphorus esters or their salts with a oxyalkylene group, and methods of using the same |
| US6013171A (en) * | 1998-02-03 | 2000-01-11 | Exxon Research And Engineering Co. | Catalytic dewaxing with trivalent rare earth metal ion exchanged ferrierite |
| US6180575B1 (en) * | 1998-08-04 | 2001-01-30 | Mobil Oil Corporation | High performance lubricating oils |
| US6103099A (en) * | 1998-09-04 | 2000-08-15 | Exxon Research And Engineering Company | Production of synthetic lubricant and lubricant base stock without dewaxing |
| US6080301A (en) * | 1998-09-04 | 2000-06-27 | Exxonmobil Research And Engineering Company | Premium synthetic lubricant base stock having at least 95% non-cyclic isoparaffins |
| US6165949A (en) * | 1998-09-04 | 2000-12-26 | Exxon Research And Engineering Company | Premium wear resistant lubricant |
| EP1252277B1 (en) * | 1999-12-22 | 2010-05-05 | The Lubrizol Corporation | Lubricants with the combination of a molybdenum compound, a phosphorus compounds and dispersants |
| JP2002285184A (ja) * | 2001-02-20 | 2002-10-03 | Ethyl Corp | ギア清浄用低燐配合 |
| US6528458B1 (en) * | 2002-04-19 | 2003-03-04 | The Lubrizol Corporation | Lubricant for dual clutch transmission |
| US6562765B1 (en) * | 2002-07-11 | 2003-05-13 | Chevron Oronite Company Llc | Oil compositions having improved fuel economy employing synergistic organomolybdenum components and methods for their use |
| US20040192564A1 (en) * | 2003-03-25 | 2004-09-30 | Vasudevan Balasubramaniam | Bimodal gear lubricant formulation |
| CA2538768C (en) * | 2003-09-12 | 2011-04-12 | Renewable Lubricants, Inc. | Vegetable oil lubricant comprising all-hydroprocessed synthetic oils |
| CN1849383B (zh) * | 2003-09-13 | 2010-11-24 | 埃克森美孚化学专利公司 | 用于机动车齿轮的润滑组合物 |
| CA2496100A1 (en) * | 2004-03-10 | 2005-09-10 | Afton Chemical Corporation | Power transmission fluids with enhanced extreme pressure characteristics |
-
2006
- 2006-05-03 US US11/417,343 patent/US20070105728A1/en not_active Abandoned
- 2006-11-08 KR KR1020060109849A patent/KR100838136B1/ko not_active Expired - Fee Related
- 2006-11-08 JP JP2006303296A patent/JP2007131848A/ja not_active Withdrawn
- 2006-11-08 EP EP06023240A patent/EP1785476A1/en not_active Withdrawn