JP2004500308A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2004500308A5 JP2004500308A5 JP2000535620A JP2000535620A JP2004500308A5 JP 2004500308 A5 JP2004500308 A5 JP 2004500308A5 JP 2000535620 A JP2000535620 A JP 2000535620A JP 2000535620 A JP2000535620 A JP 2000535620A JP 2004500308 A5 JP2004500308 A5 JP 2004500308A5
- Authority
- JP
- Japan
- Prior art keywords
- amino
- mmol
- compounds
- ptpases
- ptp
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 description 423
- -1 5-tetrazolyl Chemical group 0.000 description 302
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 288
- 239000000243 solution Substances 0.000 description 166
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 162
- 230000002401 inhibitory effect Effects 0.000 description 161
- 102000002727 Protein Tyrosine Phosphatases Human genes 0.000 description 158
- 108020000494 Protein Tyrosine Phosphatases Proteins 0.000 description 158
- 239000000203 mixture Substances 0.000 description 152
- 239000007787 solid Substances 0.000 description 146
- 239000003112 inhibitor Substances 0.000 description 127
- 238000005160 1H NMR spectroscopy Methods 0.000 description 119
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 118
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 114
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 107
- 229920001469 poly(aryloxy)thionylphosphazene Polymers 0.000 description 107
- 108091006359 Mitochondrial phosphate transporter Proteins 0.000 description 104
- 102100004022 PTPRU Human genes 0.000 description 104
- 125000003431 oxalo group Chemical group 0.000 description 95
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 87
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 84
- 210000004027 cells Anatomy 0.000 description 81
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 81
- 230000000694 effects Effects 0.000 description 79
- 230000000051 modifying Effects 0.000 description 77
- 239000011541 reaction mixture Substances 0.000 description 75
- OKKJLVBELUTLKV-MZCSYVLQSA-N cd3od Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 72
- 239000002904 solvent Substances 0.000 description 71
- 125000003118 aryl group Chemical group 0.000 description 62
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N DMSO-d6 Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 60
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 60
- 125000003636 chemical group Chemical group 0.000 description 59
- HEDRZPFGACZZDS-MICDWDOJSA-N deuterated chloroform Substances [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 59
- DCWXELXMIBXGTH-UHFFFAOYSA-N O(4)-phosphotyrosine Chemical compound OC(=O)C(N)CC1=CC=C(OP(O)(O)=O)C=C1 DCWXELXMIBXGTH-UHFFFAOYSA-N 0.000 description 54
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 54
- 230000027455 binding Effects 0.000 description 52
- 235000018102 proteins Nutrition 0.000 description 49
- 102000004169 proteins and genes Human genes 0.000 description 49
- 108090000623 proteins and genes Proteins 0.000 description 49
- 239000003039 volatile agent Substances 0.000 description 49
- 239000002244 precipitate Substances 0.000 description 47
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 46
- 102100017813 PTPN1 Human genes 0.000 description 41
- 101700050499 PTPN1 Proteins 0.000 description 41
- 125000000217 alkyl group Chemical group 0.000 description 39
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 102100005499 PTPRC Human genes 0.000 description 35
- 101700059076 PTPRC Proteins 0.000 description 35
- 230000019491 signal transduction Effects 0.000 description 35
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 34
- 102000004190 Enzymes Human genes 0.000 description 33
- 108090000790 Enzymes Proteins 0.000 description 33
- 102000014400 SH2 domains Human genes 0.000 description 32
- 108050003452 SH2 domains Proteins 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 32
- 239000012074 organic phase Substances 0.000 description 32
- 239000003921 oil Substances 0.000 description 31
- 235000019198 oils Nutrition 0.000 description 31
- 239000000758 substrate Substances 0.000 description 31
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- 239000012267 brine Substances 0.000 description 30
- 238000000034 method Methods 0.000 description 30
- 201000010099 disease Diseases 0.000 description 29
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 28
- 229940088598 Enzyme Drugs 0.000 description 28
- 239000008079 hexane Substances 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- 239000012472 biological sample Substances 0.000 description 26
- 125000004432 carbon atoms Chemical group C* 0.000 description 25
- 239000011780 sodium chloride Substances 0.000 description 24
- 102100003367 PTPN6 Human genes 0.000 description 23
- 101710033203 PTPN6 Proteins 0.000 description 23
- 238000004166 bioassay Methods 0.000 description 23
- 239000003480 eluent Substances 0.000 description 23
- 239000003446 ligand Substances 0.000 description 23
- 239000008346 aqueous phase Substances 0.000 description 22
- 238000007792 addition Methods 0.000 description 21
- 239000003814 drug Substances 0.000 description 21
- 239000000284 extract Substances 0.000 description 21
- 230000011664 signaling Effects 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 21
- 229910052938 sodium sulfate Inorganic materials 0.000 description 21
- 206010012601 Diabetes mellitus Diseases 0.000 description 20
- 239000007832 Na2SO4 Substances 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 20
- 230000002860 competitive Effects 0.000 description 20
- 239000012299 nitrogen atmosphere Substances 0.000 description 20
- 102000003746 Insulin Receptor Human genes 0.000 description 19
- 108010001127 Insulin Receptor Proteins 0.000 description 19
- UIIMBOGNXHQVGW-UHFFFAOYSA-M buffer Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 19
- 230000003834 intracellular Effects 0.000 description 19
- 102000003886 Glycoproteins Human genes 0.000 description 18
- 108090000288 Glycoproteins Proteins 0.000 description 18
- 201000011510 cancer Diseases 0.000 description 18
- 239000000463 material Substances 0.000 description 18
- 239000000126 substance Substances 0.000 description 18
- 125000003545 alkoxy group Chemical group 0.000 description 17
- 102000004877 Insulin Human genes 0.000 description 16
- 108090001061 Insulin Proteins 0.000 description 16
- 230000003993 interaction Effects 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- 235000002374 tyrosine Nutrition 0.000 description 16
- 239000005711 Benzoic acid Substances 0.000 description 15
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 230000015572 biosynthetic process Effects 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 15
- 230000001965 increased Effects 0.000 description 15
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 15
- 239000011664 nicotinic acid Substances 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 101700075056 Lar Proteins 0.000 description 14
- 102100017818 PTPN11 Human genes 0.000 description 14
- 102100005503 PTPRF Human genes 0.000 description 14
- 101700055577 PTPRF Proteins 0.000 description 14
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 14
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 14
- 108010042209 insulin receptor tyrosine kinase Proteins 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 14
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- VHJLVAABSRFDPM-UHFFFAOYSA-N 1,4-dimercaptobutane-2,3-diol Chemical compound SCC(O)C(O)CS VHJLVAABSRFDPM-UHFFFAOYSA-N 0.000 description 13
- CIFFDBUDZABDNZ-UHFFFAOYSA-N 2-imidazol-1-yl-2-oxoacetic acid Chemical compound OC(=O)C(=O)N1C=CN=C1 CIFFDBUDZABDNZ-UHFFFAOYSA-N 0.000 description 13
- 241000282619 Hylobates lar Species 0.000 description 13
- 101710018405 PTPN11 Proteins 0.000 description 13
- 101710009384 SRC Proteins 0.000 description 13
- 230000001276 controlling effect Effects 0.000 description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 13
- 235000001968 nicotinic acid Nutrition 0.000 description 13
- 101700056560 PTP-1 Proteins 0.000 description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 12
- 125000004122 cyclic group Chemical group 0.000 description 12
- KCXVZYZYPLLWCC-UHFFFAOYSA-N edta Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 12
- 230000014509 gene expression Effects 0.000 description 12
- 230000001105 regulatory Effects 0.000 description 12
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- 230000002194 synthesizing Effects 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229940098773 Bovine Serum Albumin Drugs 0.000 description 11
- 108091003117 Bovine Serum Albumin Proteins 0.000 description 11
- 229920002676 Complementary DNA Polymers 0.000 description 11
- 108010051696 Growth Hormone Proteins 0.000 description 11
- 102000018997 Growth Hormone Human genes 0.000 description 11
- 108010015832 Non-Receptor Type 2 Protein Tyrosine Phosphatase Proteins 0.000 description 11
- 102100009123 PTPN2 Human genes 0.000 description 11
- 230000004913 activation Effects 0.000 description 11
- 239000002299 complementary DNA Substances 0.000 description 11
- 239000000122 growth hormone Substances 0.000 description 11
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 11
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Substances ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 11
- 238000006366 phosphorylation reaction Methods 0.000 description 11
- 230000000865 phosphorylative Effects 0.000 description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 11
- 125000004076 pyridyl group Chemical group 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- 238000010521 absorption reaction Methods 0.000 description 10
- 230000003197 catalytic Effects 0.000 description 10
- GFEYTWVSRDLPLE-UHFFFAOYSA-L dihydrogenvanadate Chemical compound O[V](O)([O-])=O GFEYTWVSRDLPLE-UHFFFAOYSA-L 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 150000002829 nitrogen Chemical group 0.000 description 10
- 230000037361 pathway Effects 0.000 description 10
- 230000035755 proliferation Effects 0.000 description 10
- 229910052717 sulfur Inorganic materials 0.000 description 10
- 239000011593 sulfur Substances 0.000 description 10
- RWSXRVCMGQZWBV-WDSKDSINSA-N Glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 9
- 229960003180 Glutathione Drugs 0.000 description 9
- 229940088597 Hormone Drugs 0.000 description 9
- 241000124008 Mammalia Species 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 230000033228 biological regulation Effects 0.000 description 9
- 239000007853 buffer solution Substances 0.000 description 9
- 230000001413 cellular Effects 0.000 description 9
- 230000000875 corresponding Effects 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- 239000005556 hormone Substances 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 230000000670 limiting Effects 0.000 description 9
- 239000011159 matrix material Substances 0.000 description 9
- 210000000963 osteoblast Anatomy 0.000 description 9
- 230000000790 osteoblast Effects 0.000 description 9
- 239000008194 pharmaceutical composition Substances 0.000 description 9
- 230000004044 response Effects 0.000 description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 9
- 208000001132 Osteoporosis Diseases 0.000 description 8
- 102100009129 PTPN21 Human genes 0.000 description 8
- 101710018421 PTPN21 Proteins 0.000 description 8
- 102100009136 PTPN3 Human genes 0.000 description 8
- 101700083677 PTPN3 Proteins 0.000 description 8
- 210000001744 T-Lymphocytes Anatomy 0.000 description 8
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 230000001808 coupling Effects 0.000 description 8
- 238000010168 coupling process Methods 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- 210000002950 fibroblast Anatomy 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 8
- 230000001404 mediated Effects 0.000 description 8
- 229910052760 oxygen Inorganic materials 0.000 description 8
- 239000001301 oxygen Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 239000007790 solid phase Substances 0.000 description 8
- 230000000638 stimulation Effects 0.000 description 8
- 210000001519 tissues Anatomy 0.000 description 8
- 230000001131 transforming Effects 0.000 description 8
- QBYNNSFEMMNINN-UHFFFAOYSA-N 2-(oxaloamino)benzoic acid Chemical compound OC(=O)C(=O)NC1=CC=CC=C1C(O)=O QBYNNSFEMMNINN-UHFFFAOYSA-N 0.000 description 7
- XZKIHKMTEMTJQX-UHFFFAOYSA-N 4-Nitrophenyl dihydrogen phosphate Chemical compound OP(O)(=O)OC1=CC=C([N+]([O-])=O)C=C1 XZKIHKMTEMTJQX-UHFFFAOYSA-N 0.000 description 7
- 229940112871 Bisphosphonate drugs affecting bone structure and mineralization Drugs 0.000 description 7
- 108010024636 Glutathione Proteins 0.000 description 7
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 7
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 7
- 230000035969 Vmax Effects 0.000 description 7
- 125000003710 aryl alkyl group Chemical group 0.000 description 7
- 239000012131 assay buffer Substances 0.000 description 7
- 235000010233 benzoic acid Nutrition 0.000 description 7
- 150000004663 bisphosphonates Chemical class 0.000 description 7
- 239000000969 carrier Substances 0.000 description 7
- 150000001923 cyclic compounds Chemical class 0.000 description 7
- 238000006209 dephosphorylation reaction Methods 0.000 description 7
- 201000009910 diseases by infectious agent Diseases 0.000 description 7
- 239000003102 growth factor Substances 0.000 description 7
- 230000003394 haemopoietic Effects 0.000 description 7
- 150000002431 hydrogen Chemical class 0.000 description 7
- 229940113083 morpholine Drugs 0.000 description 7
- IMNFDUFMRHMDMM-UHFFFAOYSA-N n-heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 230000003389 potentiating Effects 0.000 description 7
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 6
- YNHIGQDRGKUECZ-UHFFFAOYSA-L Bis(triphenylphosphine)palladium(II) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 6
- 208000008589 Obesity Diseases 0.000 description 6
- 102100017815 PTPN14 Human genes 0.000 description 6
- 101710018410 PTPN14 Proteins 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 230000036462 Unbound Effects 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 125000004104 aryloxy group Chemical group 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- 230000003247 decreasing Effects 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 239000003937 drug carrier Substances 0.000 description 6
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 6
- 108020001507 fusion proteins Proteins 0.000 description 6
- 102000037240 fusion proteins Human genes 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 235000020824 obesity Nutrition 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 230000002285 radioactive Effects 0.000 description 6
- 108091007921 receptor tyrosine kinases Proteins 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- 230000002441 reversible Effects 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 6
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Chemical compound [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 description 6
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 6
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 5
- ZRDVHVJLNSJTOE-UHFFFAOYSA-M 2-cyano-3,3-dimethylbutanoate Chemical compound CC(C)(C)C(C#N)C([O-])=O ZRDVHVJLNSJTOE-UHFFFAOYSA-M 0.000 description 5
- DQBLKSRRWDWNKQ-UHFFFAOYSA-N 3-(Oxalyl-Amino)-Naphthalene-2-Carboxylic Acid Chemical compound C1=CC=C2C=C(C(O)=O)C(NC(=O)C(=O)O)=CC2=C1 DQBLKSRRWDWNKQ-UHFFFAOYSA-N 0.000 description 5
- 206010003816 Autoimmune disease Diseases 0.000 description 5
- 208000002705 Glucose Intolerance Diseases 0.000 description 5
- 102000005720 Glutathione Transferase family Human genes 0.000 description 5
- 108010070675 Glutathione Transferase family Proteins 0.000 description 5
- 206010022489 Insulin resistance Diseases 0.000 description 5
- 101700033896 LCK Proteins 0.000 description 5
- XKJCHHZQLQNZHY-UHFFFAOYSA-N Phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 5
- 102000005157 Somatostatin Human genes 0.000 description 5
- 108010056088 Somatostatin Proteins 0.000 description 5
- 208000010110 Spontaneous Platelet Aggregation Diseases 0.000 description 5
- 241000607734 Yersinia <bacteria> Species 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 5
- 201000005794 allergic hypersensitivity disease Diseases 0.000 description 5
- 235000001014 amino acid Nutrition 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 235000018417 cysteine Nutrition 0.000 description 5
- 230000004064 dysfunction Effects 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 230000001939 inductive effect Effects 0.000 description 5
- 239000006166 lysate Substances 0.000 description 5
- 239000010452 phosphate Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 230000002062 proliferating Effects 0.000 description 5
- 201000004681 psoriasis Diseases 0.000 description 5
- 125000003373 pyrazinyl group Chemical group 0.000 description 5
- 230000028327 secretion Effects 0.000 description 5
- YOQDYZUWIQVZSF-UHFFFAOYSA-N sodium borohydride Substances [BH4-].[Na+] YOQDYZUWIQVZSF-UHFFFAOYSA-N 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- ODGROJYWQXFQOZ-UHFFFAOYSA-N sodium;boron(1-) Chemical compound [B-].[Na+] ODGROJYWQXFQOZ-UHFFFAOYSA-N 0.000 description 5
- NHXLMOGPVYXJNR-ATOGVRKGSA-N somatostatin Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N1)[C@@H](C)O)NC(=O)CNC(=O)[C@H](C)N)C(O)=O)=O)[C@H](O)C)C1=CC=CC=C1 NHXLMOGPVYXJNR-ATOGVRKGSA-N 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 230000001225 therapeutic Effects 0.000 description 5
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 4
- 102000013563 Acid Phosphatase Human genes 0.000 description 4
- 108010051457 Acid Phosphatase Proteins 0.000 description 4
- 206010000565 Acquired immunodeficiency syndrome Diseases 0.000 description 4
- 206010001897 Alzheimer's disease Diseases 0.000 description 4
- 210000001772 Blood Platelets Anatomy 0.000 description 4
- 210000000988 Bone and Bones Anatomy 0.000 description 4
- 208000008581 Brain Disease Diseases 0.000 description 4
- 102000001301 EGF receptors Human genes 0.000 description 4
- 108060006698 EGF receptors Proteins 0.000 description 4
- 210000001650 Focal Adhesions Anatomy 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 206010061598 Immunodeficiency Diseases 0.000 description 4
- 102000004218 Insulin-like growth factor I Human genes 0.000 description 4
- 108090000723 Insulin-like growth factor I Proteins 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 108010032109 Non-Receptor Type 12 Protein Tyrosine Phosphatase Proteins 0.000 description 4
- 229920000272 Oligonucleotide Polymers 0.000 description 4
- 102100017817 PTPN12 Human genes 0.000 description 4
- 108091007517 SFKs Proteins 0.000 description 4
- 102000024741 SFKs Human genes 0.000 description 4
- 229960000553 Somatostatin Drugs 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M Tetra-n-butylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- 108091014342 Zeta family Proteins 0.000 description 4
- 102000030793 Zeta family Human genes 0.000 description 4
- 230000002159 abnormal effect Effects 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 4
- 125000005157 alkyl carboxy group Chemical group 0.000 description 4
- 125000000539 amino acid group Chemical group 0.000 description 4
- 239000000427 antigen Substances 0.000 description 4
- 108091007172 antigens Proteins 0.000 description 4
- 102000038129 antigens Human genes 0.000 description 4
- 125000005110 aryl thio group Chemical group 0.000 description 4
- 238000010256 biochemical assay Methods 0.000 description 4
- 239000007844 bleaching agent Substances 0.000 description 4
- 238000004364 calculation method Methods 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 230000015271 coagulation Effects 0.000 description 4
- 238000005345 coagulation Methods 0.000 description 4
- 239000010779 crude oil Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000001419 dependent Effects 0.000 description 4
- SNQXJPARXFUULZ-UHFFFAOYSA-N dioxolane Chemical compound C1COOC1 SNQXJPARXFUULZ-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000001747 exhibiting Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-M fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000012528 membrane Substances 0.000 description 4
- OHCDSOWRUPEPSV-UHFFFAOYSA-N methyl 2-amino-5-phenylbenzoate Chemical compound C1=C(N)C(C(=O)OC)=CC(C=2C=CC=CC=2)=C1 OHCDSOWRUPEPSV-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000006011 modification reaction Methods 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000003752 polymerase chain reaction Methods 0.000 description 4
- 239000001184 potassium carbonate Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 102000004196 processed proteins & peptides Human genes 0.000 description 4
- 108090000765 processed proteins & peptides Proteins 0.000 description 4
- 102000027656 receptor tyrosine kinases Human genes 0.000 description 4
- 230000002829 reduced Effects 0.000 description 4
- 201000000980 schizophrenia Diseases 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000001544 thienyl group Chemical group 0.000 description 4
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- DGVVWUTYPXICAM-UHFFFAOYSA-N 2-mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 3
- DWLHTIPCWYOEMT-UHFFFAOYSA-N 2H-thiopyran-3-carboxylic acid Chemical compound OC(=O)C1=CC=CSC1 DWLHTIPCWYOEMT-UHFFFAOYSA-N 0.000 description 3
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 3
- 108091014317 Alpha family Proteins 0.000 description 3
- 102000030762 Alpha family Human genes 0.000 description 3
- 239000005695 Ammonium acetate Substances 0.000 description 3
- 230000036715 Apparent Km Effects 0.000 description 3
- 208000006673 Asthma Diseases 0.000 description 3
- 210000003719 B-Lymphocytes Anatomy 0.000 description 3
- 108091014316 Beta family Proteins 0.000 description 3
- 230000036912 Bioavailability Effects 0.000 description 3
- 229960001701 Chloroform Drugs 0.000 description 3
- LSXDOTMGLUJQCM-UHFFFAOYSA-M Copper(I) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N D-Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 101700033006 EGF Proteins 0.000 description 3
- 102100010813 EGF Human genes 0.000 description 3
- 101700013756 ELK4 Proteins 0.000 description 3
- 229940116977 Epidermal Growth Factor Drugs 0.000 description 3
- 102000009465 Growth Factor Receptors Human genes 0.000 description 3
- 108010009202 Growth Factor Receptors Proteins 0.000 description 3
- JKMHFZQWWAIEOD-UHFFFAOYSA-N HEPES Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 3
- 239000007995 HEPES buffer Substances 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 102000038595 IGF Type 1 Receptor Human genes 0.000 description 3
- 108010031794 IGF Type 1 Receptor Proteins 0.000 description 3
- 210000004185 Liver Anatomy 0.000 description 3
- 210000004698 Lymphocytes Anatomy 0.000 description 3
- 101710026141 MIH1 Proteins 0.000 description 3
- 108091014330 Mu family Proteins 0.000 description 3
- 102000030768 Mu family Human genes 0.000 description 3
- 102000007339 Nerve Growth Factor Receptors Human genes 0.000 description 3
- 108010032605 Nerve Growth Factor Receptors Proteins 0.000 description 3
- DCWXELXMIBXGTH-QMMMGPOBSA-N O(4)-phospho-L-tyrosine Chemical group OC(=O)[C@@H](N)CC1=CC=C(OP(O)(O)=O)C=C1 DCWXELXMIBXGTH-QMMMGPOBSA-N 0.000 description 3
- 101710004306 Os04g0364800 Proteins 0.000 description 3
- 102100005492 PTPRH Human genes 0.000 description 3
- 101700014840 PTPRH Proteins 0.000 description 3
- 102000003993 Phosphatidylinositol 3-Kinases Human genes 0.000 description 3
- 108090000430 Phosphatidylinositol 3-Kinases Proteins 0.000 description 3
- 102000008022 Proto-Oncogene Proteins c-met Human genes 0.000 description 3
- 108010089836 Proto-Oncogene Proteins c-met Proteins 0.000 description 3
- 230000037104 Vapp Effects 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 230000000172 allergic Effects 0.000 description 3
- 230000003281 allosteric Effects 0.000 description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 3
- 235000019257 ammonium acetate Nutrition 0.000 description 3
- 229940043376 ammonium acetate Drugs 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 3
- 125000005129 aryl carbonyl group Chemical group 0.000 description 3
- 201000008937 atopic dermatitis Diseases 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 230000035514 bioavailability Effects 0.000 description 3
- 230000010261 cell growth Effects 0.000 description 3
- 230000033077 cellular process Effects 0.000 description 3
- 230000001684 chronic Effects 0.000 description 3
- 125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 3
- 230000001086 cytosolic Effects 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 229940079593 drugs Drugs 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000006911 enzymatic reaction Methods 0.000 description 3
- 239000002024 ethyl acetate extract Substances 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 230000002068 genetic Effects 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- 125000005842 heteroatoms Chemical group 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 3
- 239000003018 immunosuppressive agent Substances 0.000 description 3
- 230000000977 initiatory Effects 0.000 description 3
- 125000000842 isoxazolyl group Chemical group 0.000 description 3
- 230000036963 noncompetitive Effects 0.000 description 3
- 230000011164 ossification Effects 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical group O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 229940002612 prodrugs Drugs 0.000 description 3
- 125000002098 pyridazinyl group Chemical group 0.000 description 3
- 239000003638 reducing agent Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 230000004960 subcellular localization Effects 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 230000001629 suppression Effects 0.000 description 3
- 230000002459 sustained Effects 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000004953 trihalomethyl group Chemical group 0.000 description 3
- VTWKXBJHBHYJBI-SOFGYWHQSA-N (NE)-N-benzylidenehydroxylamine Chemical compound O\N=C\C1=CC=CC=C1 VTWKXBJHBHYJBI-SOFGYWHQSA-N 0.000 description 2
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 2
- RLSFIPSTJNAONT-UHFFFAOYSA-N 1,4,8-trioxaspiro[4.5]decan-7-ylmethyl 4-nitrobenzenesulfonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)OCC1OCCC2(OCCO2)C1 RLSFIPSTJNAONT-UHFFFAOYSA-N 0.000 description 2
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-Lutidine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- KBHVOPHKSRVNIV-UHFFFAOYSA-N 2-(3-nitrophenyl)acetaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(CC=O)=C1 KBHVOPHKSRVNIV-UHFFFAOYSA-N 0.000 description 2
- JMOVKMUNGBVQNJ-UHFFFAOYSA-N 2-(hydroxymethyl)oxan-4-one Chemical compound OCC1CC(=O)CCO1 JMOVKMUNGBVQNJ-UHFFFAOYSA-N 0.000 description 2
- LYKXDWLTTKIKIV-UHFFFAOYSA-N 2-[(4-oxo-2,3-dihydropyran-2-yl)methyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC1CC(=O)C=CO1 LYKXDWLTTKIKIV-UHFFFAOYSA-N 0.000 description 2
- URNVNSGKDHQKPV-UHFFFAOYSA-N 2-[(4-oxooxan-2-yl)methyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CC1CC(=O)CCO1 URNVNSGKDHQKPV-UHFFFAOYSA-N 0.000 description 2
- BKPFVUCQPXAMRL-HSZRJFAPSA-N 2-[2-ethyl-4-[[(2R)-4-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butyl]-3,6-dioxopiperazin-2-yl]methyl]-N-oxaloanilino]benzoic acid Chemical compound N([C@@H](C1=O)CC=2C=C(C(=CC=2)N(C(=O)C(O)=O)C=2C(=CC=CC=2)C(O)=O)CC)C(=O)CN1CCCCOC1=CC=CC(O)=C1C(=O)OC BKPFVUCQPXAMRL-HSZRJFAPSA-N 0.000 description 2
- XNINAOUGJUYOQX-UHFFFAOYSA-M 2-cyanobutanoate Chemical compound CCC(C#N)C([O-])=O XNINAOUGJUYOQX-UHFFFAOYSA-M 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N 289-95-2 Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- DEBZQUFVQZPPLC-UHFFFAOYSA-N 2H-chromene-3-carboxylic acid Chemical compound C1=CC=C2OCC(C(=O)O)=CC2=C1 DEBZQUFVQZPPLC-UHFFFAOYSA-N 0.000 description 2
- LZNNMMKMGKFYLL-UHFFFAOYSA-N 2H-pyran-3-carboxylic acid Chemical compound OC(=O)C1=CC=COC1 LZNNMMKMGKFYLL-UHFFFAOYSA-N 0.000 description 2
- 230000037295 APPARENT VMAX Effects 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229940009100 Aurothiomalate Drugs 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N Benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 210000004369 Blood Anatomy 0.000 description 2
- YSWNPDCTRUKWQG-UHFFFAOYSA-N C1C=CC=C2OC=C3S(C(=O)OCC)C(N)=CC3=C21 Chemical compound C1C=CC=C2OC=C3S(C(=O)OCC)C(N)=CC3=C21 YSWNPDCTRUKWQG-UHFFFAOYSA-N 0.000 description 2
- 101700051654 CDK1 Proteins 0.000 description 2
- OTAFHZMPRISVEM-UHFFFAOYSA-N Chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 2
- 210000004292 Cytoskeleton Anatomy 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N Diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- 241000668709 Dipterocarpus costatus Species 0.000 description 2
- 108091007936 ERK family Proteins 0.000 description 2
- 102000003951 Erythropoietin Human genes 0.000 description 2
- 108090000394 Erythropoietin Proteins 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- 210000002744 Extracellular Matrix Anatomy 0.000 description 2
- 108009000576 Focal Adhesion Proteins 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 206010073071 Hepatocellular carcinoma Diseases 0.000 description 2
- 102100002729 IRS1 Human genes 0.000 description 2
- 101700048020 IRS1 Proteins 0.000 description 2
- 210000000987 Immune System Anatomy 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 108009000068 Insulin Signaling Proteins 0.000 description 2
- YGHRJJRRZDOVPD-UHFFFAOYSA-N Isovaleraldehyde Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- 210000000265 Leukocytes Anatomy 0.000 description 2
- 108091007472 MAP kinase family Proteins 0.000 description 2
- 102000012750 Membrane Glycoproteins Human genes 0.000 description 2
- 108010090054 Membrane Glycoproteins Proteins 0.000 description 2
- 108020004999 Messenger RNA Proteins 0.000 description 2
- 108090000823 Mitogen-Activated Protein Kinases Proteins 0.000 description 2
- 102000004331 Mitogen-Activated Protein Kinases Human genes 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000699660 Mus musculus Species 0.000 description 2
- 210000002027 Muscle, Skeletal Anatomy 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- CPCZUXSHORSJIZ-UHFFFAOYSA-N N-(thiophen-3-ylmethylidene)hydroxylamine Chemical compound ON=CC=1C=CSC=1 CPCZUXSHORSJIZ-UHFFFAOYSA-N 0.000 description 2
- UUCQXTFEHFDTQW-UHFFFAOYSA-N N-benzyl-4-methyl-2-[propan-2-yl(prop-2-enoyl)amino]pentanamide Chemical compound C=CC(=O)N(C(C)C)C(CC(C)C)C(=O)NCC1=CC=CC=C1 UUCQXTFEHFDTQW-UHFFFAOYSA-N 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- 229920001850 Nucleic acid sequence Polymers 0.000 description 2
- 102000016979 Other receptors Human genes 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N P-Toluenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 108091007929 PDGF receptors Proteins 0.000 description 2
- 102100017342 PTPRJ Human genes 0.000 description 2
- 101700020334 PTPRJ Proteins 0.000 description 2
- 102100001938 PTPRN2 Human genes 0.000 description 2
- 101710034323 PTPRN2 Proteins 0.000 description 2
- 208000008443 Pancreatic Carcinoma Diseases 0.000 description 2
- DTBNBXWJWCWCIK-UHFFFAOYSA-N Phosphoenolpyruvic acid Natural products OC(=O)C(=C)OP(O)(O)=O DTBNBXWJWCWCIK-UHFFFAOYSA-N 0.000 description 2
- 108010001441 Phosphopeptides Proteins 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N Phosphoryl chloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 108091000081 Phosphotransferases Proteins 0.000 description 2
- 210000002826 Placenta Anatomy 0.000 description 2
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 2
- 102000015585 Polypyrimidine Tract-Binding Protein Human genes 0.000 description 2
- 108010063723 Polypyrimidine Tract-Binding Protein Proteins 0.000 description 2
- 102000001253 Protein Kinases Human genes 0.000 description 2
- 206010039073 Rheumatoid arthritis Diseases 0.000 description 2
- 101700073994 SYK Proteins 0.000 description 2
- 208000006641 Skin Disease Diseases 0.000 description 2
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M Sodium bisulfate Chemical class [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M Sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M Sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 102000013275 Somatomedins Human genes 0.000 description 2
- 108010026080 Somatomedins Proteins 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N Stearic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 108091008153 T cell receptors Proteins 0.000 description 2
- 102000016266 T-Cell Antigen Receptors Human genes 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N Triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Tris Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 239000003875 Wang resin Substances 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 230000002378 acidificating Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000001154 acute Effects 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000005094 alkyl carbonyl amino alkyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000001028 anti-proliferant Effects 0.000 description 2
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 2
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 2
- 125000005126 aryl alkyl carbonyl amino group Chemical group 0.000 description 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 2
- 125000001769 aryl amino group Chemical group 0.000 description 2
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 2
- 125000004429 atoms Chemical group 0.000 description 2
- XJHSMFDIQHVMCY-UHFFFAOYSA-M aurothiomalic acid Chemical compound OC(=O)CC(S[Au])C(O)=O XJHSMFDIQHVMCY-UHFFFAOYSA-M 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N carbon bisulphide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- 230000024881 catalytic activity Effects 0.000 description 2
- 101700067613 cdk1-b Proteins 0.000 description 2
- 230000020411 cell activation Effects 0.000 description 2
- 230000024245 cell differentiation Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- 230000021615 conjugation Effects 0.000 description 2
- 230000002596 correlated Effects 0.000 description 2
- 230000002950 deficient Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 229940000406 drug candidates Drugs 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000002708 enhancing Effects 0.000 description 2
- 230000002255 enzymatic Effects 0.000 description 2
- 229940105423 erythropoietin Drugs 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- PDXPRWCJESNIIT-UHFFFAOYSA-N ethyl 1H-indole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2NC=CC2=C1 PDXPRWCJESNIIT-UHFFFAOYSA-N 0.000 description 2
- KACZQOKEFKFNDB-UHFFFAOYSA-N ethyl 1H-pyrazole-4-carboxylate Chemical compound CCOC(=O)C=1C=NNC=1 KACZQOKEFKFNDB-UHFFFAOYSA-N 0.000 description 2
- URJOBQJGQMZSTN-UHFFFAOYSA-N ethyl 6-amino-1H-indole-7-carboxylate Chemical compound CCOC(=O)C1=C(N)C=CC2=C1NC=C2 URJOBQJGQMZSTN-UHFFFAOYSA-N 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 150000002344 gold compounds Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 210000002865 immune cell Anatomy 0.000 description 2
- 230000028993 immune response Effects 0.000 description 2
- 230000001861 immunosuppresant Effects 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 230000002427 irreversible Effects 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 210000004962 mammalian cells Anatomy 0.000 description 2
- 230000035800 maturation Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229920002106 messenger RNA Polymers 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- ZOPBNTZZPBLGBC-UHFFFAOYSA-N methyl 2-amino-5-(3-phenyl-1,2-oxazol-5-yl)benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC(C=2ON=C(C=2)C=2C=CC=CC=2)=C1 ZOPBNTZZPBLGBC-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L mgso4 Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000003226 mitogen Substances 0.000 description 2
- 230000002297 mitogenic Effects 0.000 description 2
- 230000011278 mitosis Effects 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 210000000287 oocyte Anatomy 0.000 description 2
- 210000000056 organs Anatomy 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 201000002528 pancreatic cancer Diseases 0.000 description 2
- 230000036961 partial Effects 0.000 description 2
- 230000008506 pathogenesis Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (NE)-N-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000000611 regression analysis Methods 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000002864 sequence alignment Methods 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 230000036962 time dependent Effects 0.000 description 2
- 230000002588 toxic Effects 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- 150000003668 tyrosines Chemical group 0.000 description 2
- 125000005287 vanadyl group Chemical group 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NKCXQMYPWXSLIZ-PSRDDEIFSA-N (2S)-2-[[(2S)-1-[(2S)-5-amino-2-[[2-[[(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]propanoyl]amino]-4-oxobutanoyl]amino]-3-m Chemical compound O=C([C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](N)[C@@H](C)O)[C@@H](C)O)C(C)C)N1CCC[C@H]1C(=O)N[C@@H](CO)C(O)=O NKCXQMYPWXSLIZ-PSRDDEIFSA-N 0.000 description 1
- INQLGDGUTMTJDV-BHDXBOSCSA-N (3S)-3-[[(2R)-2-[3-(naphthalene-2-carbonylamino)-2-oxopyridin-1-yl]-2-phenylacetyl]amino]-4-oxo-5-phenoxypentanoic acid Chemical compound C1([C@H](C(=O)N[C@@H](CC(=O)O)C(=O)COC=2C=CC=CC=2)N2C(C(NC(=O)C=3C=C4C=CC=CC4=CC=3)=CC=C2)=O)=CC=CC=C1 INQLGDGUTMTJDV-BHDXBOSCSA-N 0.000 description 1
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 description 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 1
- XFMQGQAAHOGFQS-UHFFFAOYSA-N 1,1-dioxothian-4-one Chemical compound O=C1CCS(=O)(=O)CC1 XFMQGQAAHOGFQS-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 1
- 125000001607 1,2,3-triazol-1-yl group Chemical group [*]N1N=NC([H])=C1[H] 0.000 description 1
- 125000001359 1,2,3-triazol-4-yl group Chemical group [H]N1N=NC([*])=C1[H] 0.000 description 1
- 125000001305 1,2,4-triazol-3-yl group Chemical group [H]N1N=C([*])N=C1[H] 0.000 description 1
- VGISFWWEOGVMED-UHFFFAOYSA-N 1-(chloromethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CCl)=C1 VGISFWWEOGVMED-UHFFFAOYSA-N 0.000 description 1
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 description 1
- NZAXGZYPZGEVBD-UHFFFAOYSA-N 1-benzoylpiperidin-4-one Chemical compound C=1C=CC=CC=1C(=O)N1CCC(=O)CC1 NZAXGZYPZGEVBD-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- CZSXIGLHRRJGPZ-UHFFFAOYSA-N 1-oxothian-4-one Chemical compound O=C1CCS(=O)CC1 CZSXIGLHRRJGPZ-UHFFFAOYSA-N 0.000 description 1
- ZVUAMUKZHFTJGR-UHFFFAOYSA-N 1-piperazin-1-ylprop-2-en-1-one Chemical compound C=CC(=O)N1CCNCC1 ZVUAMUKZHFTJGR-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1H-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 2,3-dihydrochromen-4-one Chemical compound C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 1
- ZCSOJXHICDKYJO-UHFFFAOYSA-N 2,3-dihydropyran-4-one Chemical compound O=C1CCOC=C1 ZCSOJXHICDKYJO-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- LMRDBJZQDUVCQH-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)acetaldehyde Chemical compound C1=CC=C2C(=O)N(CC=O)C(=O)C2=C1 LMRDBJZQDUVCQH-UHFFFAOYSA-N 0.000 description 1
- WQINSVOOIJDOLJ-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)acetic acid Chemical compound C1=CC=C2C(=O)N(CC(=O)O)C(=O)C2=C1 WQINSVOOIJDOLJ-UHFFFAOYSA-N 0.000 description 1
- GTLLHMGWGZRXEG-UHFFFAOYSA-N 2-(1,4,8-trioxaspiro[4.5]decan-7-ylmethyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound O=C1C(CCCC2)=C2C(=O)N1CC(OCC1)CC21OCCO2 GTLLHMGWGZRXEG-UHFFFAOYSA-N 0.000 description 1
- GEFXJJJQUSEHLV-UHFFFAOYSA-N 2-(2,2-diethoxyethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CC(OCC)OCC)C(=O)C2=C1 GEFXJJJQUSEHLV-UHFFFAOYSA-N 0.000 description 1
- BSMILTTURCQDGJ-UHFFFAOYSA-N 2-(3-hydroxypropyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCO)C(=O)C2=C1 BSMILTTURCQDGJ-UHFFFAOYSA-N 0.000 description 1
- PWZWTSYUZQZFKE-UHFFFAOYSA-N 2-(3-nitrophenyl)ethanol Chemical compound OCCC1=CC=CC([N+]([O-])=O)=C1 PWZWTSYUZQZFKE-UHFFFAOYSA-N 0.000 description 1
- FREKGJOVUQPIKK-UHFFFAOYSA-N 2-(3-nitrophenyl)thiophene Chemical compound [O-][N+](=O)C1=CC=CC(C=2SC=CC=2)=C1 FREKGJOVUQPIKK-UHFFFAOYSA-N 0.000 description 1
- XSGXRYNZNGUGEJ-LTGZKZEYSA-N 2-(4-benzylpiperazin-1-yl)-N'-[(E)-(6-oxo-5-prop-2-enylcyclohexa-2,4-dien-1-ylidene)methyl]acetohydrazide Chemical compound O=C1C(CC=C)=CC=C\C1=C/NNC(=O)CN1CCN(CC=2C=CC=CC=2)CC1 XSGXRYNZNGUGEJ-LTGZKZEYSA-N 0.000 description 1
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 1
- IRQQAWBBQRVPSH-UHFFFAOYSA-N 2-(phenylmethoxymethyl)-2,3-dihydropyran-4-one Chemical compound O1C=CC(=O)CC1COCC1=CC=CC=C1 IRQQAWBBQRVPSH-UHFFFAOYSA-N 0.000 description 1
- XYBYVWNYIOEMOH-UHFFFAOYSA-N 2-[(4-oxooxan-2-yl)methyl]-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound O=C1C(CCCC2)=C2C(=O)N1CC1CC(=O)CCO1 XYBYVWNYIOEMOH-UHFFFAOYSA-N 0.000 description 1
- UHOVOZDEKFBJJQ-UHFFFAOYSA-N 2-amino-5-[[(4-methoxyphenyl)sulfonylamino]methyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)NCC1OCC(SC(N)=C2C(O)=O)=C2C1 UHOVOZDEKFBJJQ-UHFFFAOYSA-N 0.000 description 1
- GOLGILSVWFKZRQ-UHFFFAOYSA-N 2-amino-5-iodobenzoic acid Chemical compound NC1=CC=C(I)C=C1C(O)=O GOLGILSVWFKZRQ-UHFFFAOYSA-N 0.000 description 1
- KPIVDNYJNOPGBE-UHFFFAOYSA-N 2-aminonicotinic acid Chemical compound NC1=NC=CC=C1C(O)=O KPIVDNYJNOPGBE-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- AKLKIGMEFVPQFJ-UHFFFAOYSA-N 2-bromo-2-methoxy-1-phenylethanone Chemical compound COC(Br)C(=O)C1=CC=CC=C1 AKLKIGMEFVPQFJ-UHFFFAOYSA-N 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- NFNOAHXEQXMCGT-UHFFFAOYSA-N 2-phenylmethoxyacetaldehyde Chemical compound O=CCOCC1=CC=CC=C1 NFNOAHXEQXMCGT-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- YGTOWESQZGWBAZ-UHFFFAOYSA-N 3,5,6,8-tetrahydropyrano[2,3]thieno[2,4-d]pyrimidin-4-one Chemical compound C1OCCC2=C1SC1=C2C(=O)NC=N1 YGTOWESQZGWBAZ-UHFFFAOYSA-N 0.000 description 1
- IBSDSIHTMABATG-UHFFFAOYSA-N 3-(1,3-dioxoisoindol-2-yl)propanal Chemical compound C1=CC=C2C(=O)N(CCC=O)C(=O)C2=C1 IBSDSIHTMABATG-UHFFFAOYSA-N 0.000 description 1
- UFOUSHWZVOIJKK-UHFFFAOYSA-N 3-amino-5,6-dichloropyrazine-2-carboxylic acid Chemical compound NC1=NC(Cl)=C(Cl)N=C1C(O)=O UFOUSHWZVOIJKK-UHFFFAOYSA-N 0.000 description 1
- FDXQKOSOGMOQJW-UHFFFAOYSA-N 3-amino-6-chloro-5-(propan-2-ylamino)pyrazine-2-carboxylic acid Chemical compound CC(C)NC1=NC(N)=C(C(O)=O)N=C1Cl FDXQKOSOGMOQJW-UHFFFAOYSA-N 0.000 description 1
- ZAGZIOYVEIDDJA-UHFFFAOYSA-N 3-aminopyrazine-2-carboxylic acid Chemical compound NC1=NC=CN=C1C(O)=O ZAGZIOYVEIDDJA-UHFFFAOYSA-N 0.000 description 1
- FYEQKMAVRYRMBL-UHFFFAOYSA-N 3-aminopyridine-4-carboxylic acid Chemical compound NC1=CN=CC=C1C(O)=O FYEQKMAVRYRMBL-UHFFFAOYSA-N 0.000 description 1
- DHXNZYCXMFBMHE-UHFFFAOYSA-M 3-bromopropanoate Chemical compound [O-]C(=O)CCBr DHXNZYCXMFBMHE-UHFFFAOYSA-M 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
- PHPIMLZTBYCDSX-UHFFFAOYSA-N 3-ethynylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C#C)=C1 PHPIMLZTBYCDSX-UHFFFAOYSA-N 0.000 description 1
- RBIGKSZIQCTIJF-UHFFFAOYSA-N 3-formylthiophene Chemical compound O=CC=1C=CSC=1 RBIGKSZIQCTIJF-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DFOZLRWOCDRNDA-UHFFFAOYSA-N 4,5-dichloroisoindole-1,3-dione Chemical compound ClC1=CC=C2C(=O)NC(=O)C2=C1Cl DFOZLRWOCDRNDA-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- ZNLJNQVUOKMQPW-UHFFFAOYSA-N 5,6-dichloro-2-(1,4,8-trioxaspiro[4.5]decan-7-ylmethyl)isoindole-1,3-dione Chemical compound O=C1C=2C=C(Cl)C(Cl)=CC=2C(=O)N1CC(OCC1)CC21OCCO2 ZNLJNQVUOKMQPW-UHFFFAOYSA-N 0.000 description 1
- FUBBEYNDJLSUDY-UHFFFAOYSA-N 5,6-dichloro-2-[(4-oxooxan-2-yl)methyl]isoindole-1,3-dione Chemical compound O=C1C=2C=C(Cl)C(Cl)=CC=2C(=O)N1CC1CC(=O)CCO1 FUBBEYNDJLSUDY-UHFFFAOYSA-N 0.000 description 1
- HWCXJKLFOSBVLH-UHFFFAOYSA-N 5-amino-2,4-dioxo-1H-pyrimidine-6-carboxylic acid Chemical compound NC1=C(C(O)=O)NC(=O)NC1=O HWCXJKLFOSBVLH-UHFFFAOYSA-N 0.000 description 1
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- ZSMRRZONCYIFNB-UHFFFAOYSA-N 6,11-dihydro-5H-benzo[b][1]benzazepine Chemical compound C1CC2=CC=CC=C2NC2=CC=CC=C12 ZSMRRZONCYIFNB-UHFFFAOYSA-N 0.000 description 1
- ZSIKYWLPTPFHKD-UHFFFAOYSA-N 6,8-dihydro-5H-pyrano[4,5]thieno[1,2-c]pyrimidin-4-ylhydrazine Chemical compound C1OCCC2=C1SC1=C2C(NN)=NC=N1 ZSIKYWLPTPFHKD-UHFFFAOYSA-N 0.000 description 1
- WCLCDQBGCADVSY-UHFFFAOYSA-N 6-ethoxycarbonylpyridine-3-carboxylic acid Chemical compound CCOC(=O)C1=CC=C(C(O)=O)C=N1 WCLCDQBGCADVSY-UHFFFAOYSA-N 0.000 description 1
- VUIGGTBOFZGZHK-UHFFFAOYSA-N 6-phenylmethoxycarbonylpyridine-3-carboxylic acid Chemical compound N1=CC(C(=O)O)=CC=C1C(=O)OCC1=CC=CC=C1 VUIGGTBOFZGZHK-UHFFFAOYSA-N 0.000 description 1
- 101700008728 ACP1 Proteins 0.000 description 1
- 102100006666 ACP1 Human genes 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- 210000000577 Adipose Tissue Anatomy 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 229940062527 Alendronate Drugs 0.000 description 1
- OGSPWJRAVKPPFI-UHFFFAOYSA-N Alendronic Acid Chemical compound NCCCC(O)(P(O)(O)=O)P(O)(O)=O OGSPWJRAVKPPFI-UHFFFAOYSA-N 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- HIMXGTXNXJYFGB-UHFFFAOYSA-N Alloxan Chemical compound O=C1NC(=O)C(=O)C(=O)N1 HIMXGTXNXJYFGB-UHFFFAOYSA-N 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N Anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 206010059512 Apoptosis Diseases 0.000 description 1
- 108010039627 Aprotinin Proteins 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 210000002940 B-Lymphoid Precursor Cells Anatomy 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N Benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- OWMVSZAMULFTJU-UHFFFAOYSA-N Bis-tris methane Chemical compound OCCN(CCO)C(CO)(CO)CO OWMVSZAMULFTJU-UHFFFAOYSA-N 0.000 description 1
- 208000003432 Bone Disease Diseases 0.000 description 1
- 210000004556 Brain Anatomy 0.000 description 1
- 210000000481 Breast Anatomy 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- ISKDXKRMVFRAFL-UHFFFAOYSA-N C(C)OC(=O)C=1C=C2C=CN(C2=CC=1)CN1CCN(CC1)C(CCN1CCOCC1)=O Chemical compound C(C)OC(=O)C=1C=C2C=CN(C2=CC=1)CN1CCN(CC1)C(CCN1CCOCC1)=O ISKDXKRMVFRAFL-UHFFFAOYSA-N 0.000 description 1
- UZBCKBJFEOXJSG-UHFFFAOYSA-N C(C)OC(=O)S1C=CC2=C1COC=1C=CC=CC2=1 Chemical compound C(C)OC(=O)S1C=CC2=C1COC=1C=CC=CC2=1 UZBCKBJFEOXJSG-UHFFFAOYSA-N 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O CC[NH+](CC)CC Chemical class CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- 101710012771 CD247 Proteins 0.000 description 1
- 101700083324 CDC25 Proteins 0.000 description 1
- 101710028721 CMLV104 Proteins 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 108010078791 Carrier Proteins Proteins 0.000 description 1
- 239000005973 Carvone Substances 0.000 description 1
- 210000000170 Cell Membrane Anatomy 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- 210000000349 Chromosomes Anatomy 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 206010010741 Conjunctivitis Diseases 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- MTCFGRXMJLQNBG-UWTATZPHSA-N D-serine Chemical compound OC[C@@H](N)C(O)=O MTCFGRXMJLQNBG-UWTATZPHSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N D-sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 101710022050 DUSP12 Proteins 0.000 description 1
- 102100013023 DUSP2 Human genes 0.000 description 1
- 238000006646 Dess-Martin oxidation reaction Methods 0.000 description 1
- NKLCNNUWBJBICK-UHFFFAOYSA-N Dess–Martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 1
- LCGTWRLJTMHIQZ-UHFFFAOYSA-N Dibenzazepine Chemical compound C1=CC2=CC=CC=C2NC2=CC=CC=C21 LCGTWRLJTMHIQZ-UHFFFAOYSA-N 0.000 description 1
- 102000010778 Dual Specificity Phosphatase 1 Human genes 0.000 description 1
- 108010038537 Dual Specificity Phosphatase 1 Proteins 0.000 description 1
- 102100016662 ERBB2 Human genes 0.000 description 1
- 101700025368 ERBB2 Proteins 0.000 description 1
- 102100015167 EZR Human genes 0.000 description 1
- 208000004232 Enteritis Diseases 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N Ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- XBLVHTDFJBKJLG-UHFFFAOYSA-N Ethyl nicotinate Chemical compound CCOC(=O)C1=CC=CN=C1 XBLVHTDFJBKJLG-UHFFFAOYSA-N 0.000 description 1
- 102100008658 FN1 Human genes 0.000 description 1
- 108010067306 Fibronectins Proteins 0.000 description 1
- QEWYKACRFQMRMB-UHFFFAOYSA-N Fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 1
- 101700032527 GRAP Proteins 0.000 description 1
- 101700046691 GRB2 Proteins 0.000 description 1
- 102100016564 GSX1 Human genes 0.000 description 1
- 101700063805 GSX1 Proteins 0.000 description 1
- BVJSUAQZOZWCKN-UHFFFAOYSA-N Gastrodigenin Chemical compound OCC1=CC=C(O)C=C1 BVJSUAQZOZWCKN-UHFFFAOYSA-N 0.000 description 1
- 210000001035 Gastrointestinal Tract Anatomy 0.000 description 1
- 108009000020 Glucose Homeostasis Proteins 0.000 description 1
- 229940074045 Glyceryl Distearate Drugs 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 101700028224 HCK Proteins 0.000 description 1
- 210000000777 Hematopoietic System Anatomy 0.000 description 1
- 210000003494 Hepatocytes Anatomy 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241001441571 Hiodontidae Species 0.000 description 1
- 101710004181 INTS2 Proteins 0.000 description 1
- 102000016844 Immunoglobulin-like domains Human genes 0.000 description 1
- 108050006430 Immunoglobulin-like domains Proteins 0.000 description 1
- 206010062016 Immunosuppression Diseases 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N Iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 102400000022 Insulin-Like Growth Factor II Human genes 0.000 description 1
- 108090001117 Insulin-Like Growth Factor II Proteins 0.000 description 1
- 102000000588 Interleukin-2 Human genes 0.000 description 1
- 108010002350 Interleukin-2 Proteins 0.000 description 1
- 102000015696 Interleukins Human genes 0.000 description 1
- 108010063738 Interleukins Proteins 0.000 description 1
- 229940047122 Interleukins Drugs 0.000 description 1
- TWBYWOBDOCUKOW-UHFFFAOYSA-N Isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N Isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-Methionine Natural products CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- 125000000415 L-cysteinyl group Chemical group O=C([*])[C@@](N([H])[H])([H])C([H])([H])S[H] 0.000 description 1
- 125000002842 L-seryl group Chemical group O=C([*])[C@](N([H])[H])([H])C([H])([H])O[H] 0.000 description 1
- GUBGYTABKSRVRQ-UUNJERMWSA-N Lactose Natural products O([C@@H]1[C@H](O)[C@H](O)[C@H](O)O[C@@H]1CO)[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](CO)O1 GUBGYTABKSRVRQ-UUNJERMWSA-N 0.000 description 1
- 201000003533 Leber congenital amaurosis Diseases 0.000 description 1
- 210000004072 Lung Anatomy 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 102000021180 Lymphocyte Specific Protein Tyrosine Kinase p56(lck) Human genes 0.000 description 1
- 108010002481 Lymphocyte Specific Protein Tyrosine Kinase p56(lck) Proteins 0.000 description 1
- 101710027015 MIMI_R382 Proteins 0.000 description 1
- 102100015262 MYC Human genes 0.000 description 1
- 208000003393 Mammary Paget's Disease Diseases 0.000 description 1
- 210000000138 Mast Cells Anatomy 0.000 description 1
- 208000010453 Mesenteric Lymphadenitis Diseases 0.000 description 1
- 230000036740 Metabolism Effects 0.000 description 1
- TZIHFWKZFHZASV-UHFFFAOYSA-N Methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 1
- 102000016943 Muramidase Human genes 0.000 description 1
- 108010014251 Muramidase Proteins 0.000 description 1
- 210000003205 Muscles Anatomy 0.000 description 1
- BKEHNGMBGCQOPQ-UHFFFAOYSA-N N,N-diethylethanamine;pyridine-3-carboxylic acid Chemical compound CC[NH+](CC)CC.[O-]C(=O)C1=CC=CN=C1 BKEHNGMBGCQOPQ-UHFFFAOYSA-N 0.000 description 1
- OKDQKPLMQBXTNH-UHFFFAOYSA-N N,N-dimethyl-2H-pyridin-1-amine Chemical compound CN(C)N1CC=CC=C1 OKDQKPLMQBXTNH-UHFFFAOYSA-N 0.000 description 1
- ILBIXZPOMJFOJP-UHFFFAOYSA-N N,N-dimethylprop-2-yn-1-amine Chemical compound CN(C)CC#C ILBIXZPOMJFOJP-UHFFFAOYSA-N 0.000 description 1
- YCWRAEJDUDHAPC-UHFFFAOYSA-N N-(2-methyl-7H-thieno[2,3-c]pyran-3-yl)benzamide Chemical compound CC=1SC=2COC=CC=2C=1NC(=O)C1=CC=CC=C1 YCWRAEJDUDHAPC-UHFFFAOYSA-N 0.000 description 1
- FVYFOJMHVLKKQC-UHFFFAOYSA-N NC1=C(C2=C(COC(C2)CO)S1)C(=O)O Chemical compound NC1=C(C2=C(COC(C2)CO)S1)C(=O)O FVYFOJMHVLKKQC-UHFFFAOYSA-N 0.000 description 1
- 108010032107 Non-Receptor Type 11 Protein Tyrosine Phosphatase Proteins 0.000 description 1
- 210000004967 Non-hematopoietic Stem Cells Anatomy 0.000 description 1
- KBDOSDCBLIGGLX-UHFFFAOYSA-N O1N=C(C=C1)CCCCCCCC Chemical compound O1N=C(C=C1)CCCCCCCC KBDOSDCBLIGGLX-UHFFFAOYSA-N 0.000 description 1
- 108010020361 Oncogene Protein gp140(v-fms) Proteins 0.000 description 1
- 229940054534 Ophthalmic Solution Drugs 0.000 description 1
- 208000010191 Osteitis Deformans Diseases 0.000 description 1
- 108009000065 Osteoblast differentiation Proteins 0.000 description 1
- 210000002997 Osteoclasts Anatomy 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 108009000578 Oxidative Stress Proteins 0.000 description 1
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N PMSF Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 1
- 108060006789 PSMG1 Proteins 0.000 description 1
- 102100017882 PTK2B Human genes 0.000 description 1
- 101700021024 PTPA Proteins 0.000 description 1
- 102100017816 PTPN13 Human genes 0.000 description 1
- 101710018408 PTPN13 Proteins 0.000 description 1
- 102100003364 PTPN4 Human genes 0.000 description 1
- 101710033193 PTPN4 Proteins 0.000 description 1
- 101700017341 PTPRA Proteins 0.000 description 1
- 102100017348 PTPRO Human genes 0.000 description 1
- 101700025670 PTPRO Proteins 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L Palladium(II) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 208000006551 Parasitic Disease Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- 108010088535 Pep-1 peptide Proteins 0.000 description 1
- 108010081690 Pertussis Toxin Proteins 0.000 description 1
- HXITXNWTGFUOAU-UHFFFAOYSA-N Phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 102000010780 Platelet-Derived Growth Factor Human genes 0.000 description 1
- 108010038512 Platelet-Derived Growth Factor Proteins 0.000 description 1
- 210000004623 Platelet-Rich Plasma Anatomy 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 108010093413 Prophet of Pit-1 protein Proteins 0.000 description 1
- 208000008425 Protein Deficiency Diseases 0.000 description 1
- 101710037934 QRSL1 Proteins 0.000 description 1
- 101710028714 RNGTT Proteins 0.000 description 1
- 102100003654 RNGTT Human genes 0.000 description 1
- 206010038389 Renal cancer Diseases 0.000 description 1
- 102000009738 Ribosomal Protein S6 Kinases Human genes 0.000 description 1
- 108010034782 Ribosomal Protein S6 Kinases Proteins 0.000 description 1
- 101710036794 SLC44A1 Proteins 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 102100019388 SOAT1 Human genes 0.000 description 1
- 101700025022 SOAT1 Proteins 0.000 description 1
- 102000001332 SRC Human genes 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920002684 Sepharose Polymers 0.000 description 1
- 206010040914 Skin reaction Diseases 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L Sodium thiosulphate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 102000011096 Somatostatin receptor family Human genes 0.000 description 1
- 108050001286 Somatostatin receptor family Proteins 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-GDQSFJPYSA-N Sucrose Natural products O([C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O1)[C@@]1(CO)[C@H](O)[C@@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-GDQSFJPYSA-N 0.000 description 1
- QYTDEUPAUMOIOP-UHFFFAOYSA-N TEMPO Chemical compound CC1(C)CCCC(C)(C)N1[O] QYTDEUPAUMOIOP-UHFFFAOYSA-N 0.000 description 1
- 210000001550 Testis Anatomy 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N Tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N Trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 210000001635 Urinary Tract Anatomy 0.000 description 1
- 241000700618 Vaccinia virus Species 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 241000607447 Yersinia enterocolitica Species 0.000 description 1
- 241000607477 Yersinia pseudotuberculosis Species 0.000 description 1
- 101700083482 ZAP70 Proteins 0.000 description 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 1
- FBCSDEQVNNRGEQ-DKWTVANSSA-N [P].OC[C@H](N)C(O)=O Chemical compound [P].OC[C@H](N)C(O)=O FBCSDEQVNNRGEQ-DKWTVANSSA-N 0.000 description 1
- 230000001594 aberrant Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 102000035425 adaptor proteins Human genes 0.000 description 1
- 108091005736 adaptor proteins Proteins 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive Effects 0.000 description 1
- 210000001789 adipocyte Anatomy 0.000 description 1
- 238000001261 affinity purification Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000005093 alkyl carbonyl alkyl group Chemical group 0.000 description 1
- 125000004703 alkyl carbonyl aminoalkyl carbonyl group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 238000003277 amino acid sequence analysis Methods 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000692 anti-sense Effects 0.000 description 1
- 108090001123 antibodies Proteins 0.000 description 1
- 102000004965 antibodies Human genes 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 229960004405 aprotinin Drugs 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 201000001320 atherosclerosis Diseases 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 201000009596 autoimmune hypersensitivity disease Diseases 0.000 description 1
- 230000001908 autoinhibitory Effects 0.000 description 1
- 230000035578 autophosphorylation Effects 0.000 description 1
- 125000004321 azepin-2-yl group Chemical group [H]N1C([H])=C([H])C([H])=C([H])C([H])=C1* 0.000 description 1
- 229940095076 benzaldehyde Drugs 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000005841 biaryl group Chemical group 0.000 description 1
- 230000003115 biocidal Effects 0.000 description 1
- 229920001222 biopolymer Polymers 0.000 description 1
- 238000007413 biotinylation Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000037182 bone density Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229930007075 carvone Natural products 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000011712 cell development Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 230000002759 chromosomal Effects 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 229960005188 collagen Drugs 0.000 description 1
- 201000011231 colorectal cancer Diseases 0.000 description 1
- 238000004590 computer program Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 125000006641 cyclooctyl carbonyl group Chemical group 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- ZYBFWPARLOUPMV-UHFFFAOYSA-L dichlorozinc;ethoxyethane Chemical compound [Cl-].[Cl-].[Zn+2].CCOCC ZYBFWPARLOUPMV-UHFFFAOYSA-L 0.000 description 1
- 230000001079 digestive Effects 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical class [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 1
- KUYRYZCGVNGVHL-UHFFFAOYSA-L dipotassium;2H-tetrazole-5-carboxylate Chemical compound [K+].[K+].[O-]C(=O)C=1N=NNN=1.[O-]C(=O)C=1N=NNN=1 KUYRYZCGVNGVHL-UHFFFAOYSA-L 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- VXIHRIQNJCRFQX-UHFFFAOYSA-K disodium aurothiomalate Chemical compound [Na+].[Na+].[O-]C(=O)CC(S[Au])C([O-])=O VXIHRIQNJCRFQX-UHFFFAOYSA-K 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 239000006167 equilibration buffer Substances 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N ethanolamine Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- WZXGOHXFXHUJLR-UHFFFAOYSA-N ethyl 1H-indole-7-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1NC=C2 WZXGOHXFXHUJLR-UHFFFAOYSA-N 0.000 description 1
- BGQURRJUEUPSDT-UHFFFAOYSA-N ethyl 2-(1-benzoylpiperidin-4-ylidene)-2-cyanoacetate Chemical compound C1CC(=C(C#N)C(=O)OCC)CCN1C(=O)C1=CC=CC=C1 BGQURRJUEUPSDT-UHFFFAOYSA-N 0.000 description 1
- RRKGPBYCHQFJEG-UHFFFAOYSA-N ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate Chemical compound C1OCCC2=C1SC(N)=C2C(=O)OCC RRKGPBYCHQFJEG-UHFFFAOYSA-N 0.000 description 1
- HPHZYXVTSBIRAS-UHFFFAOYSA-N ethyl 2-cyano-2-(2,3-dihydrochromen-4-ylidene)acetate Chemical compound C1=CC=C2C(=C(C#N)C(=O)OCC)CCOC2=C1 HPHZYXVTSBIRAS-UHFFFAOYSA-N 0.000 description 1
- PORPDAHFFBNANX-UHFFFAOYSA-N ethyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate Chemical compound C1NCCC2=C1SC=C2C(=O)OCC PORPDAHFFBNANX-UHFFFAOYSA-N 0.000 description 1
- YPXGHKWOJXQLQU-UHFFFAOYSA-N ethyl 5-amino-1H-pyrazole-4-carboxylate Chemical compound CCOC(=O)C=1C=NNC=1N YPXGHKWOJXQLQU-UHFFFAOYSA-N 0.000 description 1
- AYKVDBDWLMMDQY-UHFFFAOYSA-N ethyl 6-amino-1H-indole-5-carboxylate Chemical compound C1=C(N)C(C(=O)OCC)=CC2=C1NC=C2 AYKVDBDWLMMDQY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- JZGZKRJVTIRPOK-UHFFFAOYSA-N ethyl thiophene-2-carboxylate Chemical compound CCOC(=O)C1=CC=CS1 JZGZKRJVTIRPOK-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 108010055671 ezrin Proteins 0.000 description 1
- 230000037320 fibronectin Effects 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000010579 first pass effect Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 230000000762 glandular Effects 0.000 description 1
- 230000014101 glucose homeostasis Effects 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000009200 high fat diet Nutrition 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing Effects 0.000 description 1
- 230000002209 hydrophobic Effects 0.000 description 1
- 230000002218 hypoglycaemic Effects 0.000 description 1
- WUJUYHMGDPTLMG-UHFFFAOYSA-N imidazol-2-ylacetic acid Chemical compound OC(=O)CC1=NC=CN1 WUJUYHMGDPTLMG-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000036737 immune function Effects 0.000 description 1
- 239000002955 immunomodulating agent Substances 0.000 description 1
- 230000002584 immunomodulator Effects 0.000 description 1
- 229940121354 immunomodulators Drugs 0.000 description 1
- 239000003022 immunostimulating agent Substances 0.000 description 1
- 230000001506 immunosuppresive Effects 0.000 description 1
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 1
- 200000000018 inflammatory disease Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000004155 insulin signaling pathway Effects 0.000 description 1
- 230000002608 insulinlike Effects 0.000 description 1
- 230000004068 intracellular signaling Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- RIWNFZUWWRVGEU-UHFFFAOYSA-N isocyanomethylbenzene Chemical compound [C-]#[N+]CC1=CC=CC=C1 RIWNFZUWWRVGEU-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000010807 litter Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 201000005296 lung carcinoma Diseases 0.000 description 1
- 230000002934 lysing Effects 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 235000010335 lysozyme Nutrition 0.000 description 1
- 239000004325 lysozyme Substances 0.000 description 1
- 229960000274 lysozyme Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000035786 metabolism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 1
- KSINVKZRNOJNNW-UHFFFAOYSA-N methyl 2-(2-oxocyclohexyl)acetate Chemical compound COC(=O)CC1CCCCC1=O KSINVKZRNOJNNW-UHFFFAOYSA-N 0.000 description 1
- QVNYNHCNNGKULA-UHFFFAOYSA-N methyl 2-amino-5-bromobenzoate Chemical compound COC(=O)C1=CC(Br)=CC=C1N QVNYNHCNNGKULA-UHFFFAOYSA-N 0.000 description 1
- YIBRKYVKVWTHEM-UHFFFAOYSA-N methyl 3-amino-5-(4-fluorophenyl)thiophene-2-carboxylate Chemical compound NC1=C(C(=O)OC)SC(C=2C=CC(F)=CC=2)=C1 YIBRKYVKVWTHEM-UHFFFAOYSA-N 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- 230000000813 microbial Effects 0.000 description 1
- 230000003278 mimic Effects 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N monochloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 201000009251 multiple myeloma Diseases 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000006225 natural substrate Substances 0.000 description 1
- 230000010807 negative regulation of binding Effects 0.000 description 1
- 230000035407 negative regulation of cell proliferation Effects 0.000 description 1
- 230000005538 negative regulation of osteoblast proliferation Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001613 neoplastic Effects 0.000 description 1
- 230000001537 neural Effects 0.000 description 1
- 210000004255 neuroglia Anatomy 0.000 description 1
- 210000002569 neurons Anatomy 0.000 description 1
- 230000000269 nucleophilic Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000002246 oncogenic Effects 0.000 description 1
- 231100000590 oncogenic Toxicity 0.000 description 1
- 239000002997 ophthalmic solution Substances 0.000 description 1
- 230000003287 optical Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000004072 osteoblast differentiation Effects 0.000 description 1
- 230000002148 osteoclast Effects 0.000 description 1
- 230000001599 osteoclastic Effects 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical class O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 1
- 230000036542 oxidative stress Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 150000002942 palmitic acid derivatives Chemical class 0.000 description 1
- 230000000849 parathyroid Effects 0.000 description 1
- 101710014294 pct1 Proteins 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000004675 pentylcarbonyl group Chemical group C(CCCC)C(=O)* 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 200000000002 platelet activation Diseases 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002250 progressing Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000026731 protein phosphorylation Effects 0.000 description 1
- KYQCOXFCLRTKLS-UHFFFAOYSA-N pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000004941 pyridazin-5-yl group Chemical group N1=NC=CC(=C1)* 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- YPOXGDJGKBXRFP-UHFFFAOYSA-N pyrimidine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC=N1 YPOXGDJGKBXRFP-UHFFFAOYSA-N 0.000 description 1
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Chemical compound OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching Effects 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N rac-1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 201000010174 renal carcinoma Diseases 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000284 resting Effects 0.000 description 1
- 230000000717 retained Effects 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 101710028406 satA Proteins 0.000 description 1
- 238000002821 scintillation proximity assay Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000003530 single readout Methods 0.000 description 1
- 230000035483 skin reaction Effects 0.000 description 1
- 231100000430 skin reaction Toxicity 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229940075581 sodium bromide Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000002198 surface plasmon resonance spectroscopy Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- RBNBDIMXFJYDLQ-UHFFFAOYSA-N thieno[3,2-d]pyrimidine Chemical compound C1=NC=C2SC=CC2=N1 RBNBDIMXFJYDLQ-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- GLQWRXYOTXRDNH-UHFFFAOYSA-N thiophen-2-amine Chemical class NC1=CC=CS1 GLQWRXYOTXRDNH-UHFFFAOYSA-N 0.000 description 1
- DKGYESBFCGKOJC-UHFFFAOYSA-N thiophen-3-amine Chemical class NC=1C=CSC=1 DKGYESBFCGKOJC-UHFFFAOYSA-N 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- YNVOMSDITJMNET-UHFFFAOYSA-N thiophene-3-carboxylic acid Chemical compound OC(=O)C=1C=CSC=1 YNVOMSDITJMNET-UHFFFAOYSA-N 0.000 description 1
- 125000000341 threoninyl group Chemical group [H]OC([H])(C([H])([H])[H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical class CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 230000000699 topical Effects 0.000 description 1
- 231100000224 toxic side effect Toxicity 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000010361 transduction Methods 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 101700034364 treB Proteins 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 230000001960 triggered Effects 0.000 description 1
- QHUNJMXHQHHWQP-UHFFFAOYSA-N trimethylsilyl acetate Chemical compound CC(=O)O[Si](C)(C)C QHUNJMXHQHHWQP-UHFFFAOYSA-N 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- WQEVDHBJGNOKKO-UHFFFAOYSA-K vanadic acid Chemical compound O[V](O)(O)=O WQEVDHBJGNOKKO-UHFFFAOYSA-K 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium(0) Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 230000017613 viral reproduction Effects 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N β-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
Images
Applications Claiming Priority (26)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK34698 | 1998-03-12 | ||
| DK34498 | 1998-03-12 | ||
| DK34598 | 1998-03-12 | ||
| DK35098 | 1998-03-12 | ||
| DK34898 | 1998-03-12 | ||
| DK34398 | 1998-03-12 | ||
| DK34798 | 1998-03-12 | ||
| DK34298 | 1998-03-12 | ||
| DK47698 | 1998-04-03 | ||
| DK47898 | 1998-04-03 | ||
| DK47598 | 1998-04-03 | ||
| DK47498 | 1998-04-03 | ||
| DK47998 | 1998-04-03 | ||
| DK47298 | 1998-04-03 | ||
| DK47398 | 1998-04-03 | ||
| DK48098 | 1998-04-03 | ||
| US8291298P | 1998-04-24 | 1998-04-24 | |
| DK66798 | 1998-05-15 | ||
| US8811598P | 1998-06-05 | 1998-06-05 | |
| DKPA199800940 | 1998-07-15 | ||
| DKPA199800939 | 1998-07-15 | ||
| DKPA199800938 | 1998-07-15 | ||
| DKPA199801385 | 1998-10-28 | ||
| DKPA199801561 | 1998-11-26 | ||
| DKPA199801612 | 1998-12-07 | ||
| PCT/DK1999/000126 WO1999046237A1 (en) | 1998-03-12 | 1999-03-12 | Modulators of protein tyrosine phosphatases |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2004500308A JP2004500308A (ja) | 2004-01-08 |
| JP2004500308A5 true JP2004500308A5 (de) | 2004-12-24 |
Family
ID=27586755
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000535620A Pending JP2004500308A (ja) | 1998-03-12 | 1999-03-12 | プロテインチロシンホスアターゼのモジュレーター |
Country Status (6)
| Country | Link |
|---|---|
| EP (1) | EP1080068A1 (de) |
| JP (1) | JP2004500308A (de) |
| KR (1) | KR20010041811A (de) |
| HU (1) | HUP0102612A2 (de) |
| NO (1) | NO20004526L (de) |
| WO (1) | WO1999046237A1 (de) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6262044B1 (en) | 1998-03-12 | 2001-07-17 | Novo Nordisk A/S | Modulators of protein tyrosine phosphatases (PTPASES) |
| DE19814838C2 (de) | 1998-04-02 | 2001-01-18 | Asta Medica Ag | Indolyl-3-glyoxylsäure-Derivate mit Antitumorwirkung |
| DE19946301A1 (de) | 1998-04-02 | 2001-04-19 | Asta Medica Ag | Indolyl-3-glyoxylsäure-Derivate mit therapeutisch wertvollen Eigenschaften |
| JP2002541214A (ja) * | 1999-04-09 | 2002-12-03 | マックス−プランク−ゲゼルシャフト ツール フェルデルンク デル ヴィッセンシャフテン エー．ファウ． | Ｐｔｐ ｌａｒ関連疾病の治療のための物および方法 |
| WO2001019830A1 (en) * | 1999-09-10 | 2001-03-22 | Novo Nordisk A/S | MODULATORS OF PROTEIN TYROSINE PHOSPHATASES (PTPases) |
| US6410556B1 (en) | 1999-09-10 | 2002-06-25 | Novo Nordisk A/S | Modulators of protein tyrosine phosphateses (PTPases) |
| ATE309250T1 (de) | 1999-09-10 | 2005-11-15 | Novo Nordisk As | Modulatoren der protein tyrosin phosphatase (ptpases) |
| US7115624B1 (en) | 1999-09-10 | 2006-10-03 | Novo Nordisk A/S | Method of inhibiting protein tyrosine phosphatase 1B and/or T-cell protein tyrosine phosphatase 4 and/or other PTPases with an Asp residue at position 48 |
| AU7476800A (en) * | 1999-09-10 | 2001-04-10 | Novo Nordisk A/S | Method of inhibiting protein tyrosine phosphatase 1b and/or t-cell protein tyrosine phosphatase and/or other ptpases with an asp residue at position 48 |
| TWI269654B (en) * | 1999-09-28 | 2007-01-01 | Baxter Healthcare Sa | N-substituted indole-3-glyoxylamide compounds having anti-tumor action |
| BRPI0107715B8 (pt) | 2000-01-21 | 2021-05-25 | Novartis Ag | produto farmacêutico compreendendo um inibidor de dipeptidilpeptidase-iv e metformina, bem como usos do dito produto farmacêutico e do inibidor de dipeptidilpeptidase-iv |
| US6867299B2 (en) | 2000-02-24 | 2005-03-15 | Hoffmann-La Roche Inc. | Oxamide IMPDH inhibitors |
| WO2002002593A2 (en) * | 2000-06-29 | 2002-01-10 | North Shore-Long Island Jewish Health System | Modulators of cellular proliferation and angiogenesis, methods for use and identification thereof |
| WO2002004458A1 (en) * | 2000-07-07 | 2002-01-17 | Novo Nordisk A/S | Modulators of protein tyrosine phosphatases (ptpases) |
| EP1301516B1 (de) * | 2000-07-07 | 2006-03-22 | Novo Nordisk A/S | Modulatoren von protein tyrosin phosphatasen (ptpasen) |
| US6613903B2 (en) | 2000-07-07 | 2003-09-02 | Novo Nordisk A/S | Modulators of protein tyrosine phosphatases (PTPases) |
| DE10038709A1 (de) * | 2000-08-09 | 2002-02-28 | Aventis Pharma Gmbh | Substituierte und unsubstituierte Benzooxathiazole sowie daraus abgeleitete Verbindungen |
| US6972340B2 (en) | 2000-08-29 | 2005-12-06 | Abbott Laboratories | Selective protein tyrosine phosphatatase inhibitors |
| US6627767B2 (en) | 2000-08-29 | 2003-09-30 | Abbott Laboratories | Amino(oxo) acetic acid protein tyrosine phosphatase inhibitors |
| US20020169157A1 (en) * | 2000-08-29 | 2002-11-14 | Gang Liu | Selective protein tyrosine phosphatatase inhibitors |
| US6569853B1 (en) | 2000-11-06 | 2003-05-27 | Combinatorx, Incorporated | Combinations of chlorpromazine and pentamidine for the treatment of neoplastic disorders |
| US20020116729A1 (en) * | 2000-12-06 | 2002-08-22 | Allen Keith D. | Transgenic mice containing NTTP1 phosphatase gene disruptions |
| US20020152493A1 (en) * | 2000-12-06 | 2002-10-17 | Allen Keith D. | Transgenic mice containing PTP36 tyrosine phosphatase gene disruptions |
| US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
| WO2003002569A1 (en) * | 2001-06-29 | 2003-01-09 | Novo Nordisk A/S | Method of inhibiting ptp 1b and/or t-cell ptp and/or other ptpases with an asp residue at position 48 |
| FR2829766A1 (fr) * | 2001-09-14 | 2003-03-21 | Lipha | Derives d'oxamates comportant un heterocycle azote diversement substitue |
| US7521473B2 (en) | 2004-02-25 | 2009-04-21 | Wyeth | Inhibitors of protein tyrosine phosphatase 1B |
| ES2656017T3 (es) | 2004-06-24 | 2018-02-22 | Vertex Pharmaceuticals Incorporated | Moduladores de transportadores del casete de unión a ATP |
| EP2336117A1 (de) | 2005-05-26 | 2011-06-22 | Neuron Systems, Inc | Heterozyklische Verbindungen zur Behandlung retinaler Erkrankungen |
| CN102908351B (zh) | 2005-09-14 | 2014-07-23 | 武田药品工业株式会社 | 用于治疗糖尿病的二肽基肽酶抑制剂 |
| DK3219705T3 (da) | 2005-12-28 | 2020-04-14 | Vertex Pharma | Farmaceutiske sammensætninger af den amorfe form af n-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinolin-3-carboxamid |
| EP3330255B1 (de) | 2009-03-20 | 2020-12-09 | Vertex Pharmaceuticals Incorporated | Verfahren zur herstellung von cftr-regulatoren |
| WO2011041293A1 (en) | 2009-09-30 | 2011-04-07 | Takeda Pharmaceutical Company Limited | Pyrazolo [1, 5-a] pyrimidine derivatives as apoptosis signal-regulating kinase 1 inhibitors |
| RU2641648C1 (ru) * | 2009-12-04 | 2018-01-19 | Суновион Фармасьютикалз, Инк. | Полициклические соединения и способы их применения |
| CA2782015C (en) | 2009-12-11 | 2020-08-25 | Neuron Systems, Inc. | Topical ophthalmic compositions and methods for the treatment of macular degeneration |
| RS53176B (en) | 2010-02-03 | 2014-06-30 | Takeda Pharmaceutical Company Limited | KINASE INHIBITORS 1 REGULATING SIGNALS IN APOPTOSIS |
| AU2013226076B2 (en) | 2012-02-27 | 2017-11-16 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administration thereof |
| SG11201504859YA (en) | 2012-12-20 | 2015-07-30 | Aldeyra Therapeutics Inc | Peri-carbinols |
| SG11201505587YA (en) | 2013-01-23 | 2015-08-28 | Aldeyra Therapeutics Inc | Toxic aldehyde related diseases and treatment |
| WO2014116593A1 (en) | 2013-01-25 | 2014-07-31 | Aldexa Therapeutics, Inc. | Novel traps in the treatment of macular degeneration |
| MY176814A (en) | 2013-08-08 | 2020-08-21 | Galapagos Nv | Compounds and pharmaceutical compositions thereof for the treatment of cystic fibrosis |
| JP6746569B2 (ja) | 2014-10-07 | 2020-08-26 | バーテックス ファーマシューティカルズ インコーポレイテッドＶｅｒｔｅｘ Ｐｈａｒｍａｃｅｕｔｉｃａｌｓ Ｉｎｃｏｒｐｏｒａｔｅｄ | 嚢胞性線維症膜貫通コンダクタンス制御因子のモジュレーターの共結晶 |
| EP4400106A1 (de) | 2015-08-21 | 2024-07-17 | Aldeyra Therapeutics, Inc. | Deuterierte verbindungen und verwendungen davon |
| US11129823B2 (en) | 2016-05-09 | 2021-09-28 | Aldeyra Therapeutics, Inc. | Combination treatment of ocular inflammatory disorders and diseases |
| CN116283877A (zh) | 2016-07-29 | 2023-06-23 | 赛诺维信制药公司 | 化合物、组合物及其用途 |
| KR20190065246A (ko) | 2016-07-29 | 2019-06-11 | 선오비온 파마슈티컬스 인코포레이티드 | 화합물 및 조성물 및 이들의 용도 |
| MX2019009763A (es) | 2017-02-16 | 2019-11-21 | Sunovion Pharmaceuticals Inc | Metodos para tratar esquizofrenia. |
| ES2968462T3 (es) | 2017-03-16 | 2024-05-09 | Aldeyra Therapeutics Inc | Sal polimórfica de 6-cloro-3-amino-2(2-hidroxiprolil) quinolina y usos de la misma |
| SG11202000669VA (en) | 2017-08-02 | 2020-02-27 | Sunovion Pharmaceuticals Inc | Isochroman compounds and uses thereof |
| US11040039B2 (en) | 2017-10-10 | 2021-06-22 | Aldeyra Therapeutics, Inc. | Treatment of inflammatory disorders |
| EP3728407B1 (de) * | 2017-12-19 | 2021-03-24 | Wacker Chemie AG | Verfahren zur herstellung von oxamidoester-gruppen aufweisenden siloxanen |
| WO2019161238A1 (en) | 2018-02-16 | 2019-08-22 | Sunovion Pharmaceuticals Inc. | Salts, crystal forms, and production methods thereof |
| EP3833660A4 (de) | 2018-08-06 | 2022-05-11 | Aldeyra Therapeutics, Inc. | Polymorphe verbindungen und verwendungen davon |
| AU2020236225A1 (en) | 2019-03-14 | 2021-09-16 | Sunovion Pharmaceuticals Inc. | Salts of a isochromanyl compound and crystalline forms, processes for preparing, therapeutic uses, and pharmaceutical compositions thereof |
| JP2022530967A (ja) | 2019-05-02 | 2022-07-05 | アルデイラ セラピューティクス， インコーポレイテッド | 多形化合物およびその使用 |
| US12098132B2 (en) | 2019-05-02 | 2024-09-24 | Aldeyra Therapeutics, Inc. | Process for preparation of aldehyde scavenger and intermediates |
| KR20230003503A (ko) | 2020-04-14 | 2023-01-06 | 선오비온 파마슈티컬스 인코포레이티드 | 신경학적 및 정신의학적 장애의 치료를 위한 (S)-(4,5-디히드로-7H-티에노[2,3-c]피란-7-일)-N-메틸메탄아민 |
| JP2023526016A (ja) | 2020-05-13 | 2023-06-20 | アルデイラ セラピューティクス， インコーポレイテッド | 医薬製剤およびその使用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU6110496A (en) * | 1995-06-07 | 1996-12-30 | Sugen, Inc. | Phosphatase inhibitors |
-
1999
- 1999-03-12 HU HU0102612A patent/HUP0102612A2/hu unknown
- 1999-03-12 WO PCT/DK1999/000126 patent/WO1999046237A1/en not_active Application Discontinuation
- 1999-03-12 KR KR1020007010089A patent/KR20010041811A/ko not_active Application Discontinuation
- 1999-03-12 JP JP2000535620A patent/JP2004500308A/ja active Pending
- 1999-03-12 EP EP99907336A patent/EP1080068A1/de not_active Withdrawn
-
2000
- 2000-09-11 NO NO20004526A patent/NO20004526L/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2004500308A5 (de) | ||
| US6410586B1 (en) | Modulators of protein tyrosine phosphatases (PTPases) | |
| JP2004500308A (ja) | プロテインチロシンホスアターゼのモジュレーター | |
| US7019026B1 (en) | Modulators of Protein Tyrosine Phosphatases (PTPases) | |
| EP1080095B1 (de) | Modulatoren der protein tyrosin phosphatase (ptpases) | |
| EP1214324B1 (de) | Modulatoren der protein tyrosin phosphatase (ptpases) | |
| WO1999046267A1 (en) | Modulators of protein tyrosine phosphatases (ptpases) | |
| US6225329B1 (en) | Modulators of protein tyrosine phosphatases (PTPases) | |
| US6169087B1 (en) | Modulators of protein tyrosine phosphatases (PTPases) | |
| US20020019412A1 (en) | Modulators of protein tyrosine phosphatases (ptpases) | |
| JP2002506073A (ja) | プロテイン・チロシン・ホスファターゼ（ＰＴＰａｓｅｓ）のモジュレーター | |
| US20020002199A1 (en) | Modulators of protein tyrosine phosphatases (ptpases) | |
| WO1999046236A1 (en) | Modulators of protein tyrosine phosphatases (ptpases) | |
| WO2001017516A2 (en) | Method of inhibiting protein tyrosine phosphatase 1b and/or t-cell protein tyrosine phosphatase and/or other ptpases with an asp residue at position 48 | |
| US20050119332A1 (en) | Substituted thiophene compounds as modulators of protein tyrosine phosphatases (PTPases) | |
| US6410556B1 (en) | Modulators of protein tyrosine phosphateses (PTPases) | |
| US7115624B1 (en) | Method of inhibiting protein tyrosine phosphatase 1B and/or T-cell protein tyrosine phosphatase 4 and/or other PTPases with an Asp residue at position 48 | |
| AU2713999A (en) | Modulators of protein tyrosine phosphatases | |
| CZ20003229A3 (cs) | Sloučenina a její použití, farmaceutická kompozice a její použití a způsob úpravy aktivity, izolace, detekce, stanovení množství a funkce proteinových tyrosinfosfatas | |
| MXPA00008921A (es) | Moduladores de las proteinas tirosina fosfatasas. | |
| EP1062199A1 (de) | Modulatoren der protein-tyrosin-phosphatasen (ptphasen) | |
| JP2002506058A (ja) | プロテインチロシンホスファターゼ（ｐｔｐアーゼ）のモジュレーター | |
| CZ20003228A3 (cs) | Modulátory proteinu tyrosin fosfatázy | |
| MXPA00008927A (en) | Modulators of protein tyrosine phosphatases (ptpases) |