JP2002502852A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2002502852A5 JP2002502852A5 JP2000530517A JP2000530517A JP2002502852A5 JP 2002502852 A5 JP2002502852 A5 JP 2002502852A5 JP 2000530517 A JP2000530517 A JP 2000530517A JP 2000530517 A JP2000530517 A JP 2000530517A JP 2002502852 A5 JP2002502852 A5 JP 2002502852A5
- Authority
- JP
- Japan
- Prior art keywords
- thiazol
- methylthiothiophene
- carboxamidine
- acid
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 amino, hydroxy Chemical group 0.000 description 193
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 156
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 134
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 102
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 94
- 150000001875 compounds Chemical class 0.000 description 94
- 125000000217 alkyl group Chemical group 0.000 description 68
- 239000002253 acid Substances 0.000 description 54
- 239000002904 solvent Substances 0.000 description 53
- 239000000243 solution Substances 0.000 description 52
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 47
- 150000001409 amidines Chemical class 0.000 description 46
- 239000000377 silicon dioxide Substances 0.000 description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- 239000000460 chlorine Substances 0.000 description 44
- 238000006243 chemical reaction Methods 0.000 description 43
- 229910052739 hydrogen Inorganic materials 0.000 description 43
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 42
- 230000015572 biosynthetic process Effects 0.000 description 41
- 239000001257 hydrogen Substances 0.000 description 41
- 125000003545 alkoxy group Chemical group 0.000 description 39
- 238000000034 method Methods 0.000 description 37
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 33
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 33
- 125000003118 aryl group Chemical group 0.000 description 33
- 238000003786 synthesis reaction Methods 0.000 description 33
- 125000004093 cyano group Chemical group *C#N 0.000 description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- 150000001412 amines Chemical class 0.000 description 28
- 239000003153 chemical reaction reagent Substances 0.000 description 27
- 239000000203 mixture Substances 0.000 description 27
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 26
- 229910052736 halogen Inorganic materials 0.000 description 26
- 150000002367 halogens Chemical class 0.000 description 26
- 229960005356 urokinase Drugs 0.000 description 26
- 239000002585 base Substances 0.000 description 25
- 229910052757 nitrogen Inorganic materials 0.000 description 24
- 238000005160 1H NMR spectroscopy Methods 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 235000019270 ammonium chloride Nutrition 0.000 description 23
- 239000007787 solid Substances 0.000 description 23
- 150000002148 esters Chemical class 0.000 description 22
- 150000002431 hydrogen Chemical class 0.000 description 22
- 238000001819 mass spectrum Methods 0.000 description 22
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 22
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 19
- 150000001408 amides Chemical class 0.000 description 18
- 210000004027 cell Anatomy 0.000 description 18
- 238000001840 matrix-assisted laser desorption--ionisation time-of-flight mass spectrometry Methods 0.000 description 18
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 18
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 18
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 17
- 125000004414 alkyl thio group Chemical group 0.000 description 17
- 125000005110 aryl thio group Chemical group 0.000 description 17
- 125000004104 aryloxy group Chemical group 0.000 description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 17
- 239000002002 slurry Substances 0.000 description 17
- NZNMSOFKMUBTKW-UHFFFAOYSA-N Cyclohexanecarboxylic acid Natural products OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 16
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical compound OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 description 16
- 239000011521 glass Substances 0.000 description 16
- 125000000623 heterocyclic group Chemical group 0.000 description 16
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 16
- 239000011159 matrix material Substances 0.000 description 16
- 239000000725 suspension Substances 0.000 description 16
- 108010088842 Fibrinolysin Proteins 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 229940012957 plasmin Drugs 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 15
- 229910052717 sulfur Inorganic materials 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- 125000004442 acylamino group Chemical group 0.000 description 14
- 125000000266 alpha-aminoacyl group Chemical group 0.000 description 14
- 125000004663 dialkyl amino group Chemical group 0.000 description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 14
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 13
- 108091005804 Peptidases Proteins 0.000 description 13
- 102000035195 Peptidases Human genes 0.000 description 13
- 239000012043 crude product Substances 0.000 description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 12
- 206010028980 Neoplasm Diseases 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000004682 aminothiocarbonyl group Chemical group NC(=S)* 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 12
- 125000001424 substituent group Chemical group 0.000 description 12
- 239000004365 Protease Substances 0.000 description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 11
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 11
- 125000004657 aryl sulfonyl amino group Chemical group 0.000 description 11
- 230000008878 coupling Effects 0.000 description 11
- 238000010168 coupling process Methods 0.000 description 11
- 238000005859 coupling reaction Methods 0.000 description 11
- 125000006239 protecting group Chemical group 0.000 description 11
- 125000000335 thiazolyl group Chemical group 0.000 description 11
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 10
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 10
- 125000003710 aryl alkyl group Chemical group 0.000 description 10
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 10
- 201000010099 disease Diseases 0.000 description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 239000011593 sulfur Chemical group 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 206010027476 Metastases Diseases 0.000 description 9
- 108090000190 Thrombin Proteins 0.000 description 9
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 9
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 9
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 9
- 125000005202 dialkylaminocarbonyloxy group Chemical group 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 150000002576 ketones Chemical class 0.000 description 9
- 230000009401 metastasis Effects 0.000 description 9
- 229910052763 palladium Inorganic materials 0.000 description 9
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 9
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 8
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 description 8
- 239000002841 Lewis acid Substances 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 206010060862 Prostate cancer Diseases 0.000 description 8
- 208000004403 Prostatic Hyperplasia Diseases 0.000 description 8
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 8
- 201000004681 Psoriasis Diseases 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- 125000003282 alkyl amino group Chemical group 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 8
- 125000005162 aryl oxy carbonyl amino group Chemical group 0.000 description 8
- 125000004181 carboxyalkyl group Chemical group 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- 150000007517 lewis acids Chemical class 0.000 description 8
- 125000002971 oxazolyl group Chemical group 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 230000017854 proteolysis Effects 0.000 description 8
- 239000012453 solvate Substances 0.000 description 8
- 108010074860 Factor Xa Proteins 0.000 description 7
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 7
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 7
- 239000008194 pharmaceutical composition Substances 0.000 description 7
- 125000001544 thienyl group Chemical group 0.000 description 7
- 229960004072 thrombin Drugs 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 6
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 6
- 108090000631 Trypsin Proteins 0.000 description 6
- 102000004142 Trypsin Human genes 0.000 description 6
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 6
- 230000029936 alkylation Effects 0.000 description 6
- 238000005804 alkylation reaction Methods 0.000 description 6
- 239000012131 assay buffer Substances 0.000 description 6
- 210000002469 basement membrane Anatomy 0.000 description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 6
- 125000004671 dialkylaminothiocarbonyl group Chemical group 0.000 description 6
- 210000002744 extracellular matrix Anatomy 0.000 description 6
- 125000001072 heteroaryl group Chemical group 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 125000002883 imidazolyl group Chemical group 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000004076 pyridyl group Chemical group 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000012588 trypsin Substances 0.000 description 6
- 229960001322 trypsin Drugs 0.000 description 6
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- FZRKAZHKEDOPNN-UHFFFAOYSA-N Nitric oxide anion Chemical compound O=[N-] FZRKAZHKEDOPNN-UHFFFAOYSA-N 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 239000002168 alkylating agent Substances 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 201000011510 cancer Diseases 0.000 description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 5
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 5
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 229940088598 enzyme Drugs 0.000 description 5
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 239000002797 plasminogen activator inhibitor Substances 0.000 description 5
- 229920002223 polystyrene Polymers 0.000 description 5
- 208000037803 restenosis Diseases 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 125000000547 substituted alkyl group Chemical group 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 108090000317 Chymotrypsin Proteins 0.000 description 4
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- 102000013566 Plasminogen Human genes 0.000 description 4
- 108010051456 Plasminogen Proteins 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 4
- 230000033115 angiogenesis Effects 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 230000003110 anti-inflammatory effect Effects 0.000 description 4
- 230000003262 anti-osteoporosis Effects 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- 229960002376 chymotrypsin Drugs 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 125000005647 linker group Chemical group 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- KAKQVSNHTBLJCH-UHFFFAOYSA-N trifluoromethanesulfonimidic acid Chemical compound NS(=O)(=O)C(F)(F)F KAKQVSNHTBLJCH-UHFFFAOYSA-N 0.000 description 4
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 3
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 3
- OMMIMDGHTTXEFT-UHFFFAOYSA-N 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(Cl)=CC=2)=C1SC OMMIMDGHTTXEFT-UHFFFAOYSA-N 0.000 description 3
- LKDMKWNDBAVNQZ-UHFFFAOYSA-N 4-[[1-[[1-[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-UHFFFAOYSA-N 0.000 description 3
- TVQSONUSFKVUHY-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]thiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(=CC=2)C=2C=CC=CC=2)=C1SC TVQSONUSFKVUHY-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 125000005914 C6-C14 aryloxy group Chemical group 0.000 description 3
- 108090000617 Cathepsin G Proteins 0.000 description 3
- 102100025975 Cathepsin G Human genes 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- 206010014561 Emphysema Diseases 0.000 description 3
- 108010073385 Fibrin Proteins 0.000 description 3
- 102000009123 Fibrin Human genes 0.000 description 3
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 3
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 3
- 102100033174 Neutrophil elastase Human genes 0.000 description 3
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- 208000017442 Retinal disease Diseases 0.000 description 3
- 206010038923 Retinopathy Diseases 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 3
- 239000003875 Wang resin Substances 0.000 description 3
- NERFNHBZJXXFGY-UHFFFAOYSA-N [4-[(4-methylphenyl)methoxy]phenyl]methanol Chemical compound C1=CC(C)=CC=C1COC1=CC=C(CO)C=C1 NERFNHBZJXXFGY-UHFFFAOYSA-N 0.000 description 3
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 125000004103 aminoalkyl group Chemical group 0.000 description 3
- 125000006598 aminocarbonylamino group Chemical group 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 230000001772 anti-angiogenic effect Effects 0.000 description 3
- 230000002456 anti-arthritic effect Effects 0.000 description 3
- 230000001740 anti-invasion Effects 0.000 description 3
- 230000002001 anti-metastasis Effects 0.000 description 3
- 230000002769 anti-restenotic effect Effects 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 125000001769 aryl amino group Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 3
- 230000004709 cell invasion Effects 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000003433 contraceptive agent Substances 0.000 description 3
- 230000002254 contraceptive effect Effects 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 125000004472 dialkylaminosulfonyl group Chemical group 0.000 description 3
- 125000004986 diarylamino group Chemical group 0.000 description 3
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 3
- 229950003499 fibrin Drugs 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 150000002540 isothiocyanates Chemical class 0.000 description 3
- 125000000842 isoxazolyl group Chemical group 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 210000000440 neutrophil Anatomy 0.000 description 3
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 3
- 239000012038 nucleophile Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 239000002516 radical scavenger Substances 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 206010039073 rheumatoid arthritis Diseases 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 3
- 229910000080 stannane Inorganic materials 0.000 description 3
- 125000003107 substituted aryl group Chemical group 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 125000000565 sulfonamide group Chemical group 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- 150000003557 thiazoles Chemical class 0.000 description 3
- 125000003441 thioacyl group Chemical group 0.000 description 3
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ZJIFDEVVTPEXDL-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) hydrogen carbonate Chemical compound OC(=O)ON1C(=O)CCC1=O ZJIFDEVVTPEXDL-UHFFFAOYSA-N 0.000 description 2
- 125000006624 (C1-C6) alkoxycarbonylamino group Chemical group 0.000 description 2
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 2
- KKHFRAFPESRGGD-UHFFFAOYSA-N 1,3-dimethyl-7-[3-(n-methylanilino)propyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCCN(C)C1=CC=CC=C1 KKHFRAFPESRGGD-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 2
- KBVDUUXRXJTAJC-UHFFFAOYSA-N 2,5-dibromothiophene Chemical compound BrC1=CC=C(Br)S1 KBVDUUXRXJTAJC-UHFFFAOYSA-N 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- HNTSNHYPGXXIFN-UHFFFAOYSA-N 4-[2-(2,3-dichloroanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=C(Cl)C=CC=3)Cl)SC=2)=C1SC HNTSNHYPGXXIFN-UHFFFAOYSA-N 0.000 description 2
- ZUWAYNCFFNVIBJ-UHFFFAOYSA-N 4-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC=CC=3)F)SC=2)=C1SC ZUWAYNCFFNVIBJ-UHFFFAOYSA-N 0.000 description 2
- LIRPGSNQMOFUBQ-UHFFFAOYSA-N 4-[2-(3-chloro-2-methylanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=C(Cl)C=CC=3)C)SC=2)=C1SC LIRPGSNQMOFUBQ-UHFFFAOYSA-N 0.000 description 2
- KSJUFIPSZGIVLF-UHFFFAOYSA-N 4-[2-(4-chloro-2-methylanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC(Cl)=CC=3)C)SC=2)=C1SC KSJUFIPSZGIVLF-UHFFFAOYSA-N 0.000 description 2
- ABEISAYFSWNEFB-UHFFFAOYSA-N 4-[2-(benzhydrylamino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC(C=3C=CC=CC=3)C=3C=CC=CC=3)SC=2)=C1SC ABEISAYFSWNEFB-UHFFFAOYSA-N 0.000 description 2
- FJPXRXLMSZWSFX-UHFFFAOYSA-N 4-[2-[4-(dimethylamino)anilino]-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(=CC=3)N(C)C)SC=2)=C1SC FJPXRXLMSZWSFX-UHFFFAOYSA-N 0.000 description 2
- IQHIAMAAHJGYDK-UHFFFAOYSA-N 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C3OCCOC3=CC=2)=C1SC IQHIAMAAHJGYDK-UHFFFAOYSA-N 0.000 description 2
- WHGZPVSQCGFYBQ-UHFFFAOYSA-N 4-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C(=CC(Cl)=CC=2)Cl)=C1SC WHGZPVSQCGFYBQ-UHFFFAOYSA-N 0.000 description 2
- UIUPZJJWMHBXMW-UHFFFAOYSA-N 4-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.COC1=CC(OC)=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 UIUPZJJWMHBXMW-UHFFFAOYSA-N 0.000 description 2
- KLVFDMVKNCAXRG-UHFFFAOYSA-N 4-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(O)C=CC=2)=C1SC KLVFDMVKNCAXRG-UHFFFAOYSA-N 0.000 description 2
- HFUGBKCICWUZIJ-UHFFFAOYSA-N 4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC=CC(C=2N=C(SC=2)C2=C(SC(=C2)C(N)=N)SC)=C1 HFUGBKCICWUZIJ-UHFFFAOYSA-N 0.000 description 2
- HIPYFVFSCZEZBO-UHFFFAOYSA-N 4-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.COC1=CC=CC(C=2N=C(SC=2)C2=C(SC(=C2)C(N)=N)SC)=C1 HIPYFVFSCZEZBO-UHFFFAOYSA-N 0.000 description 2
- QOIVCSLYFPCXMW-UHFFFAOYSA-N 4-[4-(4-chloro-3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C)C(Cl)=CC=2)=C1SC QOIVCSLYFPCXMW-UHFFFAOYSA-N 0.000 description 2
- XKVUYEYANWFIJX-UHFFFAOYSA-N 5-methyl-1h-pyrazole Chemical compound CC1=CC=NN1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 2
- UZGWXXYKZGJHJY-UHFFFAOYSA-N 5-methylsulfanyl-4-(4-methyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(C)N=2)=C1SC UZGWXXYKZGJHJY-UHFFFAOYSA-N 0.000 description 2
- HZNLMAXGKJQXSL-UHFFFAOYSA-N 5-methylsulfanyl-4-(4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC=CC=2)=C1SC HZNLMAXGKJQXSL-UHFFFAOYSA-N 0.000 description 2
- MAEWIZAYVYLSBL-UHFFFAOYSA-N 5-methylsulfanyl-4-(4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC=CC=2)=C1SC MAEWIZAYVYLSBL-UHFFFAOYSA-N 0.000 description 2
- QJBLOXHRGXCQHF-UHFFFAOYSA-N 5-methylsulfanyl-4-(6-phenylpyridin-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(C=CC=2)C=2C=CC=CC=2)=C1SC QJBLOXHRGXCQHF-UHFFFAOYSA-N 0.000 description 2
- YCMAPLMAEQZHAF-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(2,4,5-trimethylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC(C)=C(C)C=3)C)SC=2)=C1SC YCMAPLMAEQZHAF-UHFFFAOYSA-N 0.000 description 2
- YNLXACABVDXVBV-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(2-propan-2-ylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC=CC=3)C(C)C)SC=2)=C1SC YNLXACABVDXVBV-UHFFFAOYSA-N 0.000 description 2
- WWYYVQSACHTSIU-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(3-phenylpropylamino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NCCCC=3C=CC=CC=3)SC=2)=C1SC WWYYVQSACHTSIU-UHFFFAOYSA-N 0.000 description 2
- WIMAUEHWGLTHAB-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(4-phenylmethoxyanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(OCC=4C=CC=CC=4)=CC=3)SC=2)=C1SC WIMAUEHWGLTHAB-UHFFFAOYSA-N 0.000 description 2
- IHVADESBZZCEJN-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(=CC=2)[N+]([O-])=O)=C1SC IHVADESBZZCEJN-UHFFFAOYSA-N 0.000 description 2
- NPTFSUUZGYDTPV-UHFFFAOYSA-N 5-methylsulfanyl-4-phenylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2C=CC=CC=2)=C1SC NPTFSUUZGYDTPV-UHFFFAOYSA-N 0.000 description 2
- AIGVJMZDTQIJIQ-UHFFFAOYSA-N 5-methylsulfanyl-4-propan-2-ylsulfonylthiophene-2-carboximidamide Chemical compound CSC=1SC(C(N)=N)=CC=1S(=O)(=O)C(C)C AIGVJMZDTQIJIQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 108090000107 Acrosin Proteins 0.000 description 2
- 102100026041 Acrosin Human genes 0.000 description 2
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- 125000006847 BOC protecting group Chemical group 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 208000005623 Carcinogenesis Diseases 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 102000016917 Complement C1 Human genes 0.000 description 2
- 108010028774 Complement C1 Proteins 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 102000012545 EGF-like domains Human genes 0.000 description 2
- 108050002150 EGF-like domains Proteins 0.000 description 2
- 108010014173 Factor X Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 201000005569 Gout Diseases 0.000 description 2
- 101000851058 Homo sapiens Neutrophil elastase Proteins 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 102000001399 Kallikrein Human genes 0.000 description 2
- 108060005987 Kallikrein Proteins 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- AVYVHIKSFXVDBG-UHFFFAOYSA-N N-benzyl-N-hydroxy-2,2-dimethylbutanamide Chemical compound C(C1=CC=CC=C1)N(C(C(CC)(C)C)=O)O AVYVHIKSFXVDBG-UHFFFAOYSA-N 0.000 description 2
- 206010029113 Neovascularisation Diseases 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 108010067372 Pancreatic elastase Proteins 0.000 description 2
- 102000016387 Pancreatic elastase Human genes 0.000 description 2
- 206010033645 Pancreatitis Diseases 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 206010063837 Reperfusion injury Diseases 0.000 description 2
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 2
- 108010022999 Serine Proteases Proteins 0.000 description 2
- 102000012479 Serine Proteases Human genes 0.000 description 2
- 101710181917 Serine proteinase inhibitor 1 Proteins 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- 206010047249 Venous thrombosis Diseases 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 2
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000005195 alkyl amino carbonyloxy group Chemical group 0.000 description 2
- 125000004670 alkyl amino thio carbonyl group Chemical group 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000002399 angioplasty Methods 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 125000005100 aryl amino carbonyl group Chemical group 0.000 description 2
- 125000004421 aryl sulphonamide group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- ACBQROXDOHKANW-UHFFFAOYSA-N bis(4-nitrophenyl) carbonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC(=O)OC1=CC=C([N+]([O-])=O)C=C1 ACBQROXDOHKANW-UHFFFAOYSA-N 0.000 description 2
- 210000000988 bone and bone Anatomy 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- YSHOWEKUVWPFNR-UHFFFAOYSA-N burgess reagent Chemical compound CC[N+](CC)(CC)S(=O)(=O)N=C([O-])OC YSHOWEKUVWPFNR-UHFFFAOYSA-N 0.000 description 2
- 230000036952 cancer formation Effects 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 231100000504 carcinogenesis Toxicity 0.000 description 2
- 230000012292 cell migration Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 229940125844 compound 46 Drugs 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 230000009089 cytolysis Effects 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 230000010005 growth-factor like effect Effects 0.000 description 2
- 150000002357 guanidines Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000005283 haloketone group Chemical group 0.000 description 2
- 230000035876 healing Effects 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 230000009545 invasion Effects 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N lysine Chemical compound NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 150000002690 malonic acid derivatives Chemical class 0.000 description 2
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 2
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- 230000008692 neointimal formation Effects 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- UPRIKOWZTZCDNC-UHFFFAOYSA-N o-methyl 4-(2-bromoacetyl)-5-methylthiophene-2-carbothioate Chemical compound COC(=S)C1=CC(C(=O)CBr)=C(C)S1 UPRIKOWZTZCDNC-UHFFFAOYSA-N 0.000 description 2
- WSDDCFXENOCBKW-UHFFFAOYSA-N o-methyl 4-carbamothioyl-5-methylthiophene-2-carbothioate Chemical compound COC(=S)C1=CC(C(N)=S)=C(C)S1 WSDDCFXENOCBKW-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000005968 oxazolinyl group Chemical group 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000003586 protic polar solvent Substances 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 230000006103 sulfonylation Effects 0.000 description 2
- 238000005694 sulfonylation reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- URAGJMBGNVOIJC-UHFFFAOYSA-N thiophene-2-carboximidamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=CS1 URAGJMBGNVOIJC-UHFFFAOYSA-N 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- 230000007838 tissue remodeling Effects 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 230000002100 tumorsuppressive effect Effects 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 1
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 1
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- KQJTXYQXRHCWKW-PJSBSAQXSA-N (4s)-4-[[(2s,3s)-2-benzamido-3-methylpentanoyl]amino]-5-[[2-[[(2s)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid;hydrochloride Chemical compound Cl.N([C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)C(=O)C1=CC=CC=C1 KQJTXYQXRHCWKW-PJSBSAQXSA-N 0.000 description 1
- DAXJNUBSBFUTRP-RTQNCGMRSA-N (8r,9s,10r,13s,14s)-6-(hydroxymethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-dione Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(CO)C2=C1 DAXJNUBSBFUTRP-RTQNCGMRSA-N 0.000 description 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 description 1
- 125000004760 (C1-C4) alkylsulfonylamino group Chemical group 0.000 description 1
- 125000004845 (C1-C6) alkylsulfonylamino group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- RBZRMBCLZMEYEH-UHFFFAOYSA-N 1h-pyrazol-1-ium-1-carboximidamide;chloride Chemical compound Cl.NC(=N)N1C=CC=N1 RBZRMBCLZMEYEH-UHFFFAOYSA-N 0.000 description 1
- PDQRQJVPEFGVRK-UHFFFAOYSA-N 2,1,3-benzothiadiazole Chemical class C1=CC=CC2=NSN=C21 PDQRQJVPEFGVRK-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- PTHLPYKPCQLAOF-UHFFFAOYSA-N 2,4-difluorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(F)C=C1F PTHLPYKPCQLAOF-UHFFFAOYSA-N 0.000 description 1
- MVPQCQBLTQSRFB-UHFFFAOYSA-N 2-[2-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetic acid Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C(=CC=CC=2)OCC(O)=O)=C1SC MVPQCQBLTQSRFB-UHFFFAOYSA-N 0.000 description 1
- KUJMRNQABKKTCS-UHFFFAOYSA-N 2-[4-[[4-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-2-yl]amino]phenoxy]acetamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(OCC(N)=O)=CC=3)SC=2)=C1SC KUJMRNQABKKTCS-UHFFFAOYSA-N 0.000 description 1
- KGHGZRVXCKCJGX-UHFFFAOYSA-N 2-bromo-1-(4-phenylphenyl)ethanone Chemical compound C1=CC(C(=O)CBr)=CC=C1C1=CC=CC=C1 KGHGZRVXCKCJGX-UHFFFAOYSA-N 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- MWFMGBPGAXYFAR-UHFFFAOYSA-N 2-hydroxy-2-methylpropanenitrile Chemical compound CC(C)(O)C#N MWFMGBPGAXYFAR-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- WZHHYIOUKQNLQM-UHFFFAOYSA-N 3,4,5,6-tetrachlorophthalic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O WZHHYIOUKQNLQM-UHFFFAOYSA-N 0.000 description 1
- YJLVXRPNNDKMMO-UHFFFAOYSA-N 3,4,5,6-tetrafluorophthalic acid Chemical group OC(=O)C1=C(F)C(F)=C(F)C(F)=C1C(O)=O YJLVXRPNNDKMMO-UHFFFAOYSA-N 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- WSYQJNPRQUFCGL-UHFFFAOYSA-N 3-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(Cl)=C1 WSYQJNPRQUFCGL-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- ZRXHLJNBNWVNIM-UHFFFAOYSA-N 3-methyl-1-benzofuran Chemical compound C1=CC=C2C(C)=COC2=C1 ZRXHLJNBNWVNIM-UHFFFAOYSA-N 0.000 description 1
- QPXOEZUECRCZMU-UHFFFAOYSA-N 4-(2-amino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(N)SC=2)=C1SC QPXOEZUECRCZMU-UHFFFAOYSA-N 0.000 description 1
- BOBLTMKWXURBGT-UHFFFAOYSA-N 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC=CC=3)SC=2)=C1SC BOBLTMKWXURBGT-UHFFFAOYSA-N 0.000 description 1
- NPCBXIKUSHWJQE-UHFFFAOYSA-N 4-(4-benzyl-1,3-thiazol-2-yl)-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(CC=3C=CC=CC=3)N=2)=C1SC NPCBXIKUSHWJQE-UHFFFAOYSA-N 0.000 description 1
- GFTDFOYLMGQHFH-UHFFFAOYSA-N 4-(4-cyclohexyl-1,3-thiazol-2-yl)-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C2CCCCC2)=C1SC GFTDFOYLMGQHFH-UHFFFAOYSA-N 0.000 description 1
- HVQOQBTUGXWDDB-UHFFFAOYSA-N 4-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC(C)=C(N=2)C=2C=CC=CC=2)=C1SC HVQOQBTUGXWDDB-UHFFFAOYSA-N 0.000 description 1
- KGIRAOPPKLQWOI-UHFFFAOYSA-N 4-[2-(2,5-dichloroanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC=C(Cl)C=3)Cl)SC=2)=C1SC KGIRAOPPKLQWOI-UHFFFAOYSA-N 0.000 description 1
- XWCRFOTXRYVUDS-UHFFFAOYSA-N 4-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC=C(OC)C(NC=2SC=C(N=2)C2=C(SC(=C2)C(N)=N)SC)=C1 XWCRFOTXRYVUDS-UHFFFAOYSA-N 0.000 description 1
- XVPMAUVOZSXQSE-UHFFFAOYSA-N 4-[2-(2,6-dichloroanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC=CC=3Cl)Cl)SC=2)=C1SC XVPMAUVOZSXQSE-UHFFFAOYSA-N 0.000 description 1
- BBZQWPQSGQXDJT-UHFFFAOYSA-N 4-[2-(2-bromo-4-methylanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC(C)=CC=3)Br)SC=2)=C1SC BBZQWPQSGQXDJT-UHFFFAOYSA-N 0.000 description 1
- AEBZRNXDNPAWQV-UHFFFAOYSA-N 4-[2-(2-bromoanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC=CC=3)Br)SC=2)=C1SC AEBZRNXDNPAWQV-UHFFFAOYSA-N 0.000 description 1
- BXNZUFPOZGUYCZ-UHFFFAOYSA-N 4-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C(=CC=CC=3)Cl)SC=2)=C1SC BXNZUFPOZGUYCZ-UHFFFAOYSA-N 0.000 description 1
- FDRDCAYYXVHESU-UHFFFAOYSA-N 4-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC=CC(NC=2SC=C(N=2)C2=C(SC(=C2)C(N)=N)SC)=C1 FDRDCAYYXVHESU-UHFFFAOYSA-N 0.000 description 1
- LRFAHFBYANUWOO-UHFFFAOYSA-N 4-[2-(4-anilinoanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(NC=4C=CC=CC=4)=CC=3)SC=2)=C1SC LRFAHFBYANUWOO-UHFFFAOYSA-N 0.000 description 1
- MUJFCLDCVTWHPO-UHFFFAOYSA-N 4-[2-(4-benzylanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(CC=4C=CC=CC=4)=CC=3)SC=2)=C1SC MUJFCLDCVTWHPO-UHFFFAOYSA-N 0.000 description 1
- QJRTVZFPEDJWOS-UHFFFAOYSA-N 4-[2-(4-methoxyanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound C1=CC(OC)=CC=C1NC1=NC(C2=C(SC(=C2)C(N)=N)SC)=CS1 QJRTVZFPEDJWOS-UHFFFAOYSA-N 0.000 description 1
- ANLZCROUCBPHBW-UHFFFAOYSA-N 4-[2-(4-methylanilino)-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(C)=CC=3)SC=2)=C1SC ANLZCROUCBPHBW-UHFFFAOYSA-N 0.000 description 1
- YODCXSDDGBHEEN-UHFFFAOYSA-N 4-[2-[(4-methylphenyl)methylamino]-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NCC=3C=CC(C)=CC=3)SC=2)=C1SC YODCXSDDGBHEEN-UHFFFAOYSA-N 0.000 description 1
- CXXUGGXVBJBHDR-UHFFFAOYSA-N 4-[2-[(7-bromo-9h-fluoren-2-yl)amino]-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=C4C(C5=CC=C(Br)C=C5C4)=CC=3)SC=2)=C1SC CXXUGGXVBJBHDR-UHFFFAOYSA-N 0.000 description 1
- GUFHYHFVXWKWLW-UHFFFAOYSA-N 4-[2-[3-(hydroxymethyl)anilino]-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=C(CO)C=CC=3)SC=2)=C1SC GUFHYHFVXWKWLW-UHFFFAOYSA-N 0.000 description 1
- YPPRLGGJPQLBFP-UHFFFAOYSA-N 4-[2-[3-[(3-methylpiperidin-1-yl)methyl]anilino]-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=C(CN4CC(C)CCC4)C=CC=3)SC=2)=C1SC YPPRLGGJPQLBFP-UHFFFAOYSA-N 0.000 description 1
- HCHPQQFILQKXKI-UHFFFAOYSA-N 4-[2-[4-(4-chlorophenoxy)anilino]-1,3-thiazol-4-yl]-5-methylsulfanylthiophene-2-carboximidamide;5-methylsulfanyl-4-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(OC=4C=CC=CC=4)=CC=3)SC=2)=C1SC.S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(OC=4C=CC(Cl)=CC=4)=CC=3)SC=2)=C1SC HCHPQQFILQKXKI-UHFFFAOYSA-N 0.000 description 1
- ONJMNFUCIIFBMG-UHFFFAOYSA-N 4-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C3OCOC3=CC=2)=C1SC ONJMNFUCIIFBMG-UHFFFAOYSA-N 0.000 description 1
- BSWDNLYMXICKFY-UHFFFAOYSA-N 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C3OCCOC3=CC=2)=C1SC BSWDNLYMXICKFY-UHFFFAOYSA-N 0.000 description 1
- OUPJOWDHCXNNFZ-UHFFFAOYSA-N 4-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC(OC)=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 OUPJOWDHCXNNFZ-UHFFFAOYSA-N 0.000 description 1
- AIWKHFBIXRNZBT-UHFFFAOYSA-N 4-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC=C(OC)C(C=2N=C(SC=2)C2=C(SC(=C2)C(N)=N)SC)=C1 AIWKHFBIXRNZBT-UHFFFAOYSA-N 0.000 description 1
- GARVNVZOSLSGOA-UHFFFAOYSA-N 4-[4-(2-chloropyridin-3-yl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C(=NC=CC=2)Cl)=C1SC GARVNVZOSLSGOA-UHFFFAOYSA-N 0.000 description 1
- QGSDCVGMOUWGJT-UHFFFAOYSA-N 4-[4-(2-chloropyridin-4-yl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(Cl)N=CC=2)=C1SC QGSDCVGMOUWGJT-UHFFFAOYSA-N 0.000 description 1
- ABKSWDBOGMATIE-UHFFFAOYSA-N 4-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C(=CC=CC=2)O)=C1SC ABKSWDBOGMATIE-UHFFFAOYSA-N 0.000 description 1
- VPNNTFDQKJOHAQ-UHFFFAOYSA-N 4-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 VPNNTFDQKJOHAQ-UHFFFAOYSA-N 0.000 description 1
- VPZZQUHMLFOQOL-UHFFFAOYSA-N 4-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 VPZZQUHMLFOQOL-UHFFFAOYSA-N 0.000 description 1
- DMRSHSWYVATHJS-UHFFFAOYSA-N 4-[4-(2-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C(=CC=CC=2)C)=C1SC DMRSHSWYVATHJS-UHFFFAOYSA-N 0.000 description 1
- CJSCCQLEHSPLCW-UHFFFAOYSA-N 4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(Cl)C(Cl)=CC=2)=C1SC CJSCCQLEHSPLCW-UHFFFAOYSA-N 0.000 description 1
- OAYNZGLTLILARC-UHFFFAOYSA-N 4-[4-(3,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound COC1=CC(OC)=CC(C=2N=C(SC=2)C2=C(SC(=C2)C(N)=N)SC)=C1 OAYNZGLTLILARC-UHFFFAOYSA-N 0.000 description 1
- BAGRENDRQWTDGR-UHFFFAOYSA-N 4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(Br)C=CC=2)=C1SC BAGRENDRQWTDGR-UHFFFAOYSA-N 0.000 description 1
- DEEYDHWXUFFTRR-UHFFFAOYSA-N 4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(Br)C=CC=2)=C1SC DEEYDHWXUFFTRR-UHFFFAOYSA-N 0.000 description 1
- YLNKTTYNAGXKQW-UHFFFAOYSA-N 4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioic S-acid Chemical compound S1C(C(S)=O)=CC(C=2SC=C(N=2)C=2C=C(Br)C=CC=2)=C1C YLNKTTYNAGXKQW-UHFFFAOYSA-N 0.000 description 1
- HHVBHAXDQFDPSD-UHFFFAOYSA-N 4-[4-(3-hydroxy-4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound C1=C(O)C(OC)=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 HHVBHAXDQFDPSD-UHFFFAOYSA-N 0.000 description 1
- MEKFQRDWXPJRHC-UHFFFAOYSA-N 4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C)C=CC=2)=C1SC MEKFQRDWXPJRHC-UHFFFAOYSA-N 0.000 description 1
- VBUYALKQEZGLBD-UHFFFAOYSA-N 4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C)C=CC=2)=C1SC VBUYALKQEZGLBD-UHFFFAOYSA-N 0.000 description 1
- QCNAOMPLQHHHTO-UHFFFAOYSA-N 4-[4-(4-chloro-3-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C)C(Cl)=CC=2)=C1SC QCNAOMPLQHHHTO-UHFFFAOYSA-N 0.000 description 1
- KIGJPKCRBSBFNE-UHFFFAOYSA-N 4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C(Cl)=CC=2)[N+]([O-])=O)=C1SC KIGJPKCRBSBFNE-UHFFFAOYSA-N 0.000 description 1
- BNQPOJIUDPOJRX-UHFFFAOYSA-N 4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C(Cl)=CC=2)[N+]([O-])=O)=C1SC BNQPOJIUDPOJRX-UHFFFAOYSA-N 0.000 description 1
- UYIJZIKDZYEPJT-UHFFFAOYSA-N 4-[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioic S-acid Chemical compound S1C(C(S)=O)=CC(C=2SC=C(N=2)C=2C=C(C(Cl)=CC=2)[N+]([O-])=O)=C1C UYIJZIKDZYEPJT-UHFFFAOYSA-N 0.000 description 1
- CBAMVLSSMLKIOB-UHFFFAOYSA-N 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methylsulfonylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(Cl)=CC=2)=C1S(=O)(=O)C CBAMVLSSMLKIOB-UHFFFAOYSA-N 0.000 description 1
- ACDXWXNJVVSKDT-UHFFFAOYSA-N 4-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound C1=C(O)C(OC)=CC(C=2N=C(SC=2)C2=C(SC(=C2)C(N)=N)SC)=C1 ACDXWXNJVVSKDT-UHFFFAOYSA-N 0.000 description 1
- FLKQFRKNGNJBNP-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound C1=CC(OC)=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 FLKQFRKNGNJBNP-UHFFFAOYSA-N 0.000 description 1
- ITQQDKUANLIWBF-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C1=CSC(C2=C(SC(=C2)C(N)=N)SC)=N1 ITQQDKUANLIWBF-UHFFFAOYSA-N 0.000 description 1
- YDUJVVABCUXEDL-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioic S-acid Chemical compound C1=CC(OC)=CC=C1C1=CSC(C2=C(SC(=C2)C(S)=O)C)=N1 YDUJVVABCUXEDL-UHFFFAOYSA-N 0.000 description 1
- VLUCTQXBQVXUNP-UHFFFAOYSA-N 4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(C)=CC=2)=C1SC VLUCTQXBQVXUNP-UHFFFAOYSA-N 0.000 description 1
- VPVMUEAKVSMETO-UHFFFAOYSA-N 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1SC VPVMUEAKVSMETO-UHFFFAOYSA-N 0.000 description 1
- LATFQEIISAOFAR-UHFFFAOYSA-N 4-[4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC(C)=C(N=2)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1SC LATFQEIISAOFAR-UHFFFAOYSA-N 0.000 description 1
- OUNVWHFQDMXKLY-UHFFFAOYSA-N 4-[4-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(C=C(F)C=2)C(F)(F)F)=C1SC OUNVWHFQDMXKLY-UHFFFAOYSA-N 0.000 description 1
- HXXGPDMZBWBAQA-UHFFFAOYSA-N 4-[4-[3-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC(C)=C(N=2)C=2C=C(C=C(F)C=2)C(F)(F)F)=C1SC HXXGPDMZBWBAQA-UHFFFAOYSA-N 0.000 description 1
- HHHDJHHNEURCNV-UHFFFAOYSA-N 4-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(Cl)C=C1 HHHDJHHNEURCNV-UHFFFAOYSA-N 0.000 description 1
- SQTJQTLLZVWMHN-UHFFFAOYSA-N 4-ethenylpyridine;hydrobromide Chemical compound [Br-].C=CC1=CC=[NH+]C=C1 SQTJQTLLZVWMHN-UHFFFAOYSA-N 0.000 description 1
- LFLSATHZMYYIAQ-UHFFFAOYSA-N 4-flourobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(F)C=C1 LFLSATHZMYYIAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- KXCQDIWJQBSUJF-UHFFFAOYSA-N 4-phenyl-1,3-thiazole Chemical compound S1C=NC(C=2C=CC=CC=2)=C1 KXCQDIWJQBSUJF-UHFFFAOYSA-N 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- CTDXVKWJDOIDEU-UHFFFAOYSA-N 5-methoxycarbonyl-2-methylthiophene-3-carbothioic s-acid Chemical compound COC(=O)C1=CC(C(S)=O)=C(C)S1 CTDXVKWJDOIDEU-UHFFFAOYSA-N 0.000 description 1
- RMXKAJHQDHWTJX-UHFFFAOYSA-N 5-methyl-4-[2-(3,4,5-trimethoxyanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound COC1=C(OC)C(OC)=CC(NC=2SC=C(N=2)C2=C(SC(=C2)C(N)=N)C)=C1 RMXKAJHQDHWTJX-UHFFFAOYSA-N 0.000 description 1
- BPTSLRVJHZVZJK-UHFFFAOYSA-N 5-methyl-4-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(OC=4C=CC=CC=4)=CC=3)SC=2)=C1C BPTSLRVJHZVZJK-UHFFFAOYSA-N 0.000 description 1
- SWKVUKUMYSNAGI-UHFFFAOYSA-N 5-methyl-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]thiophene-2-carbothioic S-acid Chemical compound S1C(C(S)=O)=CC(C=2SC=C(N=2)C=2C=CC(C)=CC=2)=C1C SWKVUKUMYSNAGI-UHFFFAOYSA-N 0.000 description 1
- GDERVCXRALFKIF-UHFFFAOYSA-N 5-methylsulfanyl-4-(2-phenyl-1,3-thiazol-4-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(SC=2)C=2C=CC=CC=2)=C1SC GDERVCXRALFKIF-UHFFFAOYSA-N 0.000 description 1
- CKYREKXNBZFCFF-UHFFFAOYSA-N 5-methylsulfanyl-4-(4-naphthalen-2-yl-1,3-thiazol-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C3C=CC=CC3=CC=2)=C1SC CKYREKXNBZFCFF-UHFFFAOYSA-N 0.000 description 1
- BMYJQBBNGNWLMS-UHFFFAOYSA-N 5-methylsulfanyl-4-(4-phenyl-1,3-oxazol-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2OC=C(N=2)C=2C=CC=CC=2)=C1SC BMYJQBBNGNWLMS-UHFFFAOYSA-N 0.000 description 1
- ICYPEZDQCNHNTK-UHFFFAOYSA-N 5-methylsulfanyl-4-(5-phenyl-1,3-oxazol-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2OC(=CN=2)C=2C=CC=CC=2)=C1SC ICYPEZDQCNHNTK-UHFFFAOYSA-N 0.000 description 1
- DMUUBSPLUMYPEH-UHFFFAOYSA-N 5-methylsulfanyl-4-(5-phenyl-1h-imidazol-2-yl)thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2NC=C(N=2)C=2C=CC=CC=2)=C1SC DMUUBSPLUMYPEH-UHFFFAOYSA-N 0.000 description 1
- MRQHVGIOSIAEKH-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(2-piperidin-1-ylethylamino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NCCN3CCCCC3)SC=2)=C1SC MRQHVGIOSIAEKH-UHFFFAOYSA-N 0.000 description 1
- OFOUKZPHGSBBIX-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(2-piperidin-2-ylethylamino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NCCC3NCCCC3)SC=2)=C1SC OFOUKZPHGSBBIX-UHFFFAOYSA-N 0.000 description 1
- VCMYKMXIDILKGK-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(3,4,5-trimethoxyanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound COC1=C(OC)C(OC)=CC(NC=2SC=C(N=2)C2=C(SC(=C2)C(N)=N)SC)=C1 VCMYKMXIDILKGK-UHFFFAOYSA-N 0.000 description 1
- VPPXWZPISZIDSK-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(4-phenyldiazenylanilino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=CC(=CC=3)N=NC=3C=CC=CC=3)SC=2)=C1SC VPPXWZPISZIDSK-UHFFFAOYSA-N 0.000 description 1
- NGPPMLWAYIHMPU-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(naphthalen-2-ylamino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=C4C=CC=CC4=CC=3)SC=2)=C1SC NGPPMLWAYIHMPU-UHFFFAOYSA-N 0.000 description 1
- KWASOJPMAQPWNY-UHFFFAOYSA-N 5-methylsulfanyl-4-[2-(quinolin-3-ylamino)-1,3-thiazol-4-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2N=C(NC=3C=C4C=CC=CC4=NC=3)SC=2)=C1SC KWASOJPMAQPWNY-UHFFFAOYSA-N 0.000 description 1
- FXXBRXARHYHTSQ-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2ON=CC=2)=C1SC FXXBRXARHYHTSQ-UHFFFAOYSA-N 0.000 description 1
- LMCNGJXAPBJWFG-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]thiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(=CC=2)[N+]([O-])=O)=C1SC LMCNGJXAPBJWFG-UHFFFAOYSA-N 0.000 description 1
- QJMHWUGFNIOSOL-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]thiophene-2-carboxylic acid Chemical compound S1C(C(O)=O)=CC(C=2SC=C(N=2)C=2C=CC(=CC=2)[N+]([O-])=O)=C1SC QJMHWUGFNIOSOL-UHFFFAOYSA-N 0.000 description 1
- YJSXRDXBOOLGGT-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=CC(=CC=2)C=2C=CC=CC=2)=C1SC YJSXRDXBOOLGGT-UHFFFAOYSA-N 0.000 description 1
- WFUWFCPVIJPOGN-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-(phenoxymethyl)-1,3-thiazol-2-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(COC=3C=CC=CC=3)N=2)=C1SC WFUWFCPVIJPOGN-UHFFFAOYSA-N 0.000 description 1
- XSCYUONGRGZQTF-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]thiophene-2-carboximidamide Chemical compound S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(OC(F)(F)F)C=CC=2)=C1SC XSCYUONGRGZQTF-UHFFFAOYSA-N 0.000 description 1
- QFTWVWVRXMVYPR-UHFFFAOYSA-N 5-methylsulfanyl-4-[4-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]thiophene-2-carboximidamide;hydrochloride Chemical compound Cl.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2C=C(OC(F)(F)F)C=CC=2)=C1SC QFTWVWVRXMVYPR-UHFFFAOYSA-N 0.000 description 1
- BPVUDMPPURTXDX-UHFFFAOYSA-N 5-methylsulfanylthiophene-2-carbonitrile Chemical compound CSC1=CC=C(C#N)S1 BPVUDMPPURTXDX-UHFFFAOYSA-N 0.000 description 1
- AXSQTCBARFBKPH-UHFFFAOYSA-N 5-methylsulfanylthiophene-2-carboximidamide Chemical compound CSC1=CC=C(C(N)=N)S1 AXSQTCBARFBKPH-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010003178 Arterial thrombosis Diseases 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 102000004580 Aspartic Acid Proteases Human genes 0.000 description 1
- 108010017640 Aspartic Acid Proteases Proteins 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- FSDHPEVAFMYGCW-UHFFFAOYSA-O CC(C)(C)OC(NC(NC(OC(C)(C)C)=O)=[S+]C)=O Chemical compound CC(C)(C)OC(NC(NC(OC(C)(C)C)=O)=[S+]C)=O FSDHPEVAFMYGCW-UHFFFAOYSA-O 0.000 description 1
- XLZUDRFBWCGZDJ-UHFFFAOYSA-N CC(SC(C(O)=S)=C1)=C1C1=NC(C(C=CC(OC)=C2)=C2OC)=CS1 Chemical compound CC(SC(C(O)=S)=C1)=C1C1=NC(C(C=CC(OC)=C2)=C2OC)=CS1 XLZUDRFBWCGZDJ-UHFFFAOYSA-N 0.000 description 1
- FLSXJPWWIJIRGI-UHFFFAOYSA-N CSC1=C(C=CS1)C=1SC=C(N1)C1=CC=C(C=C1)C1=CC=CC=C1 Chemical compound CSC1=C(C=CS1)C=1SC=C(N1)C1=CC=C(C=C1)C1=CC=CC=C1 FLSXJPWWIJIRGI-UHFFFAOYSA-N 0.000 description 1
- XNEHWVQANDJHJT-UHFFFAOYSA-N C[Al](C)C.ClC1=CC=C(C=C1)C=1N=C(SC1)C=1C=C(SC1SC)C(=N)N Chemical compound C[Al](C)C.ClC1=CC=C(C=C1)C=1N=C(SC1)C=1C=C(SC1SC)C(=N)N XNEHWVQANDJHJT-UHFFFAOYSA-N 0.000 description 1
- 101100270213 Caenorhabditis elegans arrd-17 gene Proteins 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 108010001857 Cell Surface Receptors Proteins 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 206010053567 Coagulopathies Diseases 0.000 description 1
- 108010067641 Complement C3-C5 Convertases Proteins 0.000 description 1
- 102000016574 Complement C3-C5 Convertases Human genes 0.000 description 1
- 108090000059 Complement factor D Proteins 0.000 description 1
- 102000003706 Complement factor D Human genes 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 206010051055 Deep vein thrombosis Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 108010014258 Elastin Proteins 0.000 description 1
- 102000016942 Elastin Human genes 0.000 description 1
- 102000010911 Enzyme Precursors Human genes 0.000 description 1
- 108010062466 Enzyme Precursors Proteins 0.000 description 1
- 108050001049 Extracellular proteins Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 102000016359 Fibronectins Human genes 0.000 description 1
- 108010067306 Fibronectins Proteins 0.000 description 1
- 206010016654 Fibrosis Diseases 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- 238000006846 Hantzsch Thiazole synthesis reaction Methods 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical group N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- SRBFZHDQGSBBOR-HWQSCIPKSA-N L-arabinopyranose Chemical compound O[C@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-HWQSCIPKSA-N 0.000 description 1
- 108010028275 Leukocyte Elastase Proteins 0.000 description 1
- 241000337544 Limnoriidae Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 108010000684 Matrix Metalloproteinases Proteins 0.000 description 1
- 102000002274 Matrix Metalloproteinases Human genes 0.000 description 1
- 108010006035 Metalloproteases Proteins 0.000 description 1
- 102000005741 Metalloproteases Human genes 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- PGBFYLVIMDQYMS-UHFFFAOYSA-N Methyl thiophene-2-carboxylate Chemical compound COC(=O)C1=CC=CS1 PGBFYLVIMDQYMS-UHFFFAOYSA-N 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- QECVIPBZOPUTRD-UHFFFAOYSA-N N=S(=O)=O Chemical group N=S(=O)=O QECVIPBZOPUTRD-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- XAYHDVLNONNIIE-UHFFFAOYSA-N O-methyl 5-methylthiophene-2-carbothioate Chemical compound CC1=CC=C(S1)C(=S)OC XAYHDVLNONNIIE-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 238000003482 Pinner synthesis reaction Methods 0.000 description 1
- 102000004179 Plasminogen Activator Inhibitor 2 Human genes 0.000 description 1
- 108090000614 Plasminogen Activator Inhibitor 2 Proteins 0.000 description 1
- 102000001938 Plasminogen Activators Human genes 0.000 description 1
- 108010001014 Plasminogen Activators Proteins 0.000 description 1
- 102100039419 Plasminogen activator inhibitor 2 Human genes 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 229940122055 Serine protease inhibitor Drugs 0.000 description 1
- 101710102218 Serine protease inhibitor Proteins 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 108090001109 Thermolysin Proteins 0.000 description 1
- AVRWEULSKHQETA-UHFFFAOYSA-N Thiophene-2 Chemical compound S1C=2CCCCCC=2C(C(=O)OC)=C1NC(=O)C1=C(F)C(F)=C(F)C(F)=C1F AVRWEULSKHQETA-UHFFFAOYSA-N 0.000 description 1
- 229940122388 Thrombin inhibitor Drugs 0.000 description 1
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 1
- 102100033571 Tissue-type plasminogen activator Human genes 0.000 description 1
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- RFUGMORVSDZBLC-UHFFFAOYSA-N [Na].CC(N)=O Chemical compound [Na].CC(N)=O RFUGMORVSDZBLC-UHFFFAOYSA-N 0.000 description 1
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- AZMSATIZTOBUCU-UHFFFAOYSA-N acetic acid;5-methylsulfanyl-4-(4-thiophen-2-yl-1,3-thiazol-2-yl)thiophene-2-carboximidamide Chemical compound CC(O)=O.S1C(C(N)=N)=CC(C=2SC=C(N=2)C=2SC=CC=2)=C1SC AZMSATIZTOBUCU-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 108010027597 alpha-chymotrypsin Proteins 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 description 1
- 229960002576 amiloride Drugs 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 108010031969 benzoyl-Ile-Glu-Gly-Arg-p-nitroanilide Proteins 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- GLZHTZVKRCUQRB-UHFFFAOYSA-N benzyl n-[n-phenylmethoxycarbonyl-n'-(trifluoromethylsulfonyl)carbamimidoyl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(=NS(=O)(=O)C(F)(F)F)NC(=O)OCC1=CC=CC=C1 GLZHTZVKRCUQRB-UHFFFAOYSA-N 0.000 description 1
- NRBUVVTTYMTSKM-UHFFFAOYSA-N benzyl n-[phenylmethoxycarbonylamino(pyrazol-1-yl)methylidene]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(N1N=CC=C1)=NC(=O)OCC1=CC=CC=C1 NRBUVVTTYMTSKM-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 238000002306 biochemical method Methods 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000008827 biological function Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 208000015294 blood coagulation disease Diseases 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-N bromoacetic acid Chemical compound OC(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-N 0.000 description 1
- OVIZSQRQYWEGON-UHFFFAOYSA-N butane-1-sulfonamide Chemical compound CCCCS(N)(=O)=O OVIZSQRQYWEGON-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- XTEOJPUYZWEXFI-UHFFFAOYSA-N butyl n-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate Chemical compound S1C(CC(C)C)=CC(C=2C=CC(CN3C=NC=C3)=CC=2)=C1S(=O)(=O)NC(=O)OCCCC XTEOJPUYZWEXFI-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- VQXINLNPICQTLR-UHFFFAOYSA-N carbonyl diazide Chemical compound [N-]=[N+]=NC(=O)N=[N+]=[N-] VQXINLNPICQTLR-UHFFFAOYSA-N 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KWTSZCJMWHGPOS-UHFFFAOYSA-M chloro(trimethyl)stannane Chemical compound C[Sn](C)(C)Cl KWTSZCJMWHGPOS-UHFFFAOYSA-M 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 101150114624 cnp-1 gene Proteins 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125936 compound 42 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 201000007717 corneal ulcer Diseases 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- OUYYNZDOJHSQBW-UHFFFAOYSA-N cyanomethanimidamide Chemical compound NC(=N)C#N OUYYNZDOJHSQBW-UHFFFAOYSA-N 0.000 description 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000002711 cysteinyl group Chemical group 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229920002549 elastin Polymers 0.000 description 1
- 210000002257 embryonic structure Anatomy 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- YFXCNIVBAVFOBX-UHFFFAOYSA-N ethenylboronic acid Chemical compound OB(O)C=C YFXCNIVBAVFOBX-UHFFFAOYSA-N 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 230000020764 fibrinolysis Effects 0.000 description 1
- 239000003527 fibrinolytic agent Substances 0.000 description 1
- 230000004761 fibrosis Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 210000000224 granular leucocyte Anatomy 0.000 description 1
- 239000008202 granule composition Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 238000011540 hip replacement Methods 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 230000028993 immune response Effects 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000028709 inflammatory response Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000003971 isoxazolinyl group Chemical group 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 210000003292 kidney cell Anatomy 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- JORQDGTZGKHEEO-UHFFFAOYSA-N lithium cyanide Chemical compound [Li+].N#[C-] JORQDGTZGKHEEO-UHFFFAOYSA-N 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- KUHRIIPUCPOQMQ-UHFFFAOYSA-N n,n-diethyl-3-(ethyliminomethylideneamino)propan-1-amine Chemical compound CCN=C=NCCCN(CC)CC KUHRIIPUCPOQMQ-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- ZHCAAFJSYLFLPX-UHFFFAOYSA-N nitrocyclohexatriene Chemical group [O-][N+](=O)C1=CC=C=C[CH]1 ZHCAAFJSYLFLPX-UHFFFAOYSA-N 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- KSUQRAADFLDCHC-UHFFFAOYSA-N o-methyl 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioate Chemical compound S1C(C(=S)OC)=CC(C=2SC=C(N=2)C=2C=C3OCCOC3=CC=2)=C1C KSUQRAADFLDCHC-UHFFFAOYSA-N 0.000 description 1
- UYCBCYMXRDANAV-UHFFFAOYSA-N o-methyl 5-methyl-4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]thiophene-2-carbothioate Chemical compound S1C(C(=S)OC)=CC(C=2SC=C(N=2)C=2C=C(C)C=CC=2)=C1C UYCBCYMXRDANAV-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 230000016087 ovulation Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 description 1
- 125000003145 oxazol-4-yl group Chemical group O1C=NC(=C1)* 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 125000005327 perimidinyl group Chemical group N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Chemical group O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- PSGCRHLFZJRYEA-UHFFFAOYSA-N phosphorus p2o5 Chemical compound P.O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 PSGCRHLFZJRYEA-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 230000007505 plaque formation Effects 0.000 description 1
- 239000002806 plasmin inhibitor Substances 0.000 description 1
- 230000033885 plasminogen activation Effects 0.000 description 1
- 229940127126 plasminogen activator Drugs 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- SJMCLWCCNYAWRQ-UHFFFAOYSA-N propane-2-sulfonamide Chemical compound CC(C)S(N)(=O)=O SJMCLWCCNYAWRQ-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000003085 retinopathic effect Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 230000021595 spermatogenesis Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 239000012609 strong anion exchange resin Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- UJJDEOLXODWCGK-UHFFFAOYSA-N tert-butyl carbonochloridate Chemical compound CC(C)(C)OC(Cl)=O UJJDEOLXODWCGK-UHFFFAOYSA-N 0.000 description 1
- QFNFDHNZVTWZED-UHFFFAOYSA-N tert-butyl n-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate Chemical compound CC(C)(C)OC(=O)NC(=NC(=O)OC(C)(C)C)N1C=CC=N1 QFNFDHNZVTWZED-UHFFFAOYSA-N 0.000 description 1
- GOQZIPJCBUYLIR-UHFFFAOYSA-N tert-butyl n-[n-[(2-methylpropan-2-yl)oxycarbonyl]-n'-(trifluoromethylsulfonyl)carbamimidoyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(=NS(=O)(=O)C(F)(F)F)NC(=O)OC(C)(C)C GOQZIPJCBUYLIR-UHFFFAOYSA-N 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-N tert-butylcarbamic acid Chemical compound CC(C)(C)NC(O)=O XBXCNNQPRYLIDE-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
- 229940071127 thioglycolate Drugs 0.000 description 1
- CWERGRDVMFNCDR-UHFFFAOYSA-M thioglycolate(1-) Chemical compound [O-]C(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-M 0.000 description 1
- QSELGEUCFNFITD-UHFFFAOYSA-N thiophene-2-carboximidamide Chemical compound NC(=N)C1=CC=CS1 QSELGEUCFNFITD-UHFFFAOYSA-N 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 239000003868 thrombin inhibitor Substances 0.000 description 1
- 229960000103 thrombolytic agent Drugs 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- 229960000187 tissue plasminogen activator Drugs 0.000 description 1
- ZWYDDDAMNQQZHD-UHFFFAOYSA-L titanium(ii) chloride Chemical compound [Cl-].[Cl-].[Ti+2] ZWYDDDAMNQQZHD-UHFFFAOYSA-L 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- REDSKZBUUUQMSK-UHFFFAOYSA-N tributyltin Chemical compound CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC REDSKZBUUUQMSK-UHFFFAOYSA-N 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical group COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 1
- 108010065822 urokinase inhibitor Proteins 0.000 description 1
- 102000009816 urokinase plasminogen activator receptor activity proteins Human genes 0.000 description 1
- 108040001269 urokinase plasminogen activator receptor activity proteins Proteins 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 230000007995 vascular wound healing Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- 230000037314 wound repair Effects 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7411098P | 1998-02-09 | 1998-02-09 | |
| US60/074,110 | 1998-02-09 | ||
| PCT/US1999/002784 WO1999040088A1 (en) | 1998-02-09 | 1999-02-09 | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors, in particular as urokinase inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2002502852A JP2002502852A (ja) | 2002-01-29 |
| JP2002502852A5 true JP2002502852A5 (enExample) | 2006-03-23 |
Family
ID=22117801
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000530517A Pending JP2002502852A (ja) | 1998-02-09 | 1999-02-09 | プロテアーゼ阻害剤、特にウロキナーゼ阻害剤としてのヘテロアリールアミジン、メチルアミジンおよびグアニジン |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP1054886B1 (enExample) |
| JP (1) | JP2002502852A (enExample) |
| AT (1) | ATE223408T1 (enExample) |
| AU (1) | AU765072B2 (enExample) |
| CA (1) | CA2321025A1 (enExample) |
| DE (1) | DE69902754T2 (enExample) |
| NZ (1) | NZ506507A (enExample) |
| WO (1) | WO1999040088A1 (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6291514B1 (en) | 1998-02-09 | 2001-09-18 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines, preparation thereof, and use thereof as protease inhibitors |
| EP1150979A1 (en) * | 1999-02-09 | 2001-11-07 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors |
| WO2000047194A2 (en) * | 1999-02-09 | 2000-08-17 | 3-Dimensional Pharmaceuticals, Inc. | METHODS OF TREATING C1s-MEDIATED DISEASES AND CONDITIONS, AND COMPOUNDS AND COMPOSITIONS THEREFOR |
| WO2002057273A1 (en) * | 2001-01-20 | 2002-07-25 | Trigen Limited | Serine protease inhibitors comprising a hydrogen-bond acceptor |
| AU2002242500A1 (en) * | 2001-03-02 | 2002-09-19 | Merck Frosst Canada And Co. | Cathepsin cysteine protease inhibitors |
| ATE399175T1 (de) * | 2002-03-11 | 2008-07-15 | Curacyte Ag | Hemmstoffe der urokinase, ihre herstellung und verwendung |
| US7109354B2 (en) * | 2002-05-28 | 2006-09-19 | 3-Dimensional Pharmaceuticals, Inc. | Thiophene amidines, compositions thereof, and methods of treating complement-mediated diseases and conditions |
| EP1394159A1 (fr) * | 2002-08-13 | 2004-03-03 | Warner-Lambert Company LLC | Nouveaux dérivés de thiophène, leur procédé de préparation et les compositions pharmaceutiques qui les contiennent |
| GB0315111D0 (en) | 2003-06-27 | 2003-07-30 | Cancer Rec Tech Ltd | Substituted 5-membered ring compounds and their use |
| US7482376B2 (en) * | 2003-07-03 | 2009-01-27 | 3-Dimensional Pharmaceuticals, Inc. | Conjugated complement cascade inhibitors |
| EA010017B1 (ru) * | 2003-07-10 | 2008-06-30 | Ачиллион Фармасьютикалз, Инк. | Замещённые арилтиомочевины, применимые в качестве ингибиторов репликации вирусов |
| US7674822B2 (en) | 2004-11-24 | 2010-03-09 | Wyeth | PTP1b inhibitors |
| ES2329286T3 (es) * | 2005-06-24 | 2009-11-24 | Wilex Ag | Uso de inhibidores de uroquinasa para el tratamiento y/o la prevencion de enfermedades neuropatologicas. |
| PT1968973E (pt) * | 2005-12-27 | 2011-12-09 | Hoffmann La Roche | Derivados de aril-isoxazol-4-il-imidazol |
| JPWO2007129745A1 (ja) | 2006-05-09 | 2009-09-17 | 第一三共株式会社 | ヘテロアリールアミド低級カルボン酸誘導体 |
| US7985763B2 (en) | 2007-04-10 | 2011-07-26 | National Health Research Institutes | Hepatitis C virus inhibitors |
| TW200848016A (en) | 2007-06-08 | 2008-12-16 | Nat Health Research Institutes | Thiourea compound and composition of treating hepatitis C virus infection |
| TWI361808B (en) | 2008-01-08 | 2012-04-11 | Nat Health Research Institutes | Imidazolidinone and imidazolidinethione derivatives |
| US8198284B2 (en) | 2008-04-30 | 2012-06-12 | National Health Research Institutes | Treatment of neurodegenerative disorders with thiourea compounds |
| SG176983A1 (en) | 2009-07-08 | 2012-02-28 | Dermira Canada Inc | Tofa analogs useful in treating dermatological disorders or conditions |
| DK3038622T3 (en) * | 2013-08-28 | 2018-07-16 | Medivation Tech Llc | HETEROCYCLIC RELATIONS AND PROCEDURES FOR USE |
| EP3265088A1 (en) | 2015-03-04 | 2018-01-10 | Medivation Technologies LLC | Srebp blockers for use in treating liver fibrosis, elevated cholesterol and insulin resistance |
| WO2016141258A1 (en) | 2015-03-04 | 2016-09-09 | Medivation Technologies, Inc. | Sterol regulatory element-binding proteins (srebps) inhibitors |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4220654A (en) * | 1979-06-04 | 1980-09-02 | Merck & Co., Inc. | Cyclic imidazole cyanoguanidines |
| US5340833A (en) * | 1992-05-01 | 1994-08-23 | Eisai Co., Ltd. | Urokinase inhibitors |
| GB9312761D0 (en) * | 1993-06-21 | 1993-08-04 | Wellcome Found | Amino acid derivatives |
| DE69431194T2 (de) * | 1993-10-21 | 2002-12-12 | G.D. Searle & Co., Chicago | Amidino-derivate nützlich als no synthase-hemmer |
| IL112795A (en) * | 1994-03-04 | 2001-01-28 | Astrazeneca Ab | Peptide derivatives as antithrombic agents their preparation and pharmaceutical compositions containing them |
| US5612353A (en) * | 1995-06-07 | 1997-03-18 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds |
| TW414795B (en) * | 1996-07-01 | 2000-12-11 | Yamanouchi Pharma Co Ltd | A thiophene derivative and the pharmaceutical composition |
| DE19632773A1 (de) * | 1996-08-14 | 1998-02-19 | Basf Ag | Neue Thrombininhibitoren |
| PE121699A1 (es) * | 1997-02-18 | 1999-12-08 | Boehringer Ingelheim Pharma | Heterociclos biciclicos disustituidos como inhibidores de la trombina |
| CN1289341A (zh) * | 1998-01-26 | 2001-03-28 | Basf公司 | 凝血酶抑制剂 |
| EP1049673A1 (de) * | 1998-01-26 | 2000-11-08 | Basf Aktiengesellschaft | Heterocyclische amidine als kallikrein protease inhibitoren |
-
1999
- 1999-02-09 DE DE69902754T patent/DE69902754T2/de not_active Expired - Lifetime
- 1999-02-09 JP JP2000530517A patent/JP2002502852A/ja active Pending
- 1999-02-09 EP EP99906845A patent/EP1054886B1/en not_active Expired - Lifetime
- 1999-02-09 CA CA002321025A patent/CA2321025A1/en not_active Abandoned
- 1999-02-09 AU AU26665/99A patent/AU765072B2/en not_active Ceased
- 1999-02-09 NZ NZ506507A patent/NZ506507A/en unknown
- 1999-02-09 AT AT99906845T patent/ATE223408T1/de not_active IP Right Cessation
- 1999-02-09 WO PCT/US1999/002784 patent/WO1999040088A1/en not_active Ceased
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2002502852A5 (enExample) | ||
| US6562840B1 (en) | Heteroaryl amidines, methylamidines and guanidines, and the use thereof as protease inhibitors | |
| AU765072B2 (en) | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors, in particular as urokinase inhibitors | |
| US6492403B1 (en) | Methods of treating C1s-mediated diseases and conditions and compositions thereof | |
| CA2437587C (en) | Substituted 2-oxo-3-phenyl-5-carbonylaminomethyl-1,3-oxazolines and their use as anticoagulant and antithrombotic agents | |
| EP0946528B1 (en) | OXYGEN OR SULFUR CONTAINING 5-MEMBERED HETEROAROMATICS AS FACTOR Xa INHIBITORS | |
| US6569874B1 (en) | Thiazoles as factor Xa inhibitors | |
| PL200413B1 (pl) | Podstawione oksazolidynony, sposób ich wytwarzania, środki lecznicze je zawierające oraz ich zastosowanie do wytwarzania środków leczniczych i do zapobiegania krzepnięciu krwi ex vivo | |
| JP2003509412A (ja) | Xa因子阻害剤 | |
| EP2128156A1 (en) | Novel oxadiazole derivatives and thiadiazole derivatives having neovascularization inhibiting activity | |
| JP2002536446A (ja) | プロテアーゼ阻害剤としての、ヘテロアリールアミジン類、メチルアミジン類およびグアニジン類 | |
| JP2009507055A (ja) | イミノオキサゾリジン誘導体およびその使用 |