IL99032A - הכנת 2-אמינו-4-אלקוקסי-s-טריאזינים - Google Patents
הכנת 2-אמינו-4-אלקוקסי-s-טריאזיניםInfo
- Publication number
- IL99032A IL99032A IL9903291A IL9903291A IL99032A IL 99032 A IL99032 A IL 99032A IL 9903291 A IL9903291 A IL 9903291A IL 9903291 A IL9903291 A IL 9903291A IL 99032 A IL99032 A IL 99032A
- Authority
- IL
- Israel
- Prior art keywords
- process according
- formula
- methyl
- phenyl
- solvent
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 14
- 239000002585 base Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- -1 amidine salt Chemical class 0.000 claims description 11
- 238000003756 stirring Methods 0.000 claims description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 8
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 8
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical group CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical group [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 150000005325 alkali earth metal hydroxides Chemical class 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 150000004820 halides Chemical group 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical group OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 claims 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 239000012258 stirred mixture Substances 0.000 claims 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000002002 slurry Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- ZOKYZTUQSVAKHS-UHFFFAOYSA-N dimethoxymethylidenecyanamide Chemical compound COC(OC)=NC#N ZOKYZTUQSVAKHS-UHFFFAOYSA-N 0.000 description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001409 amidines Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- IJIVBPPMCFCMGB-UHFFFAOYSA-N 4-cyclopropyl-6-ethoxy-1,3,5-triazin-2-amine Chemical compound CCOC1=NC(N)=NC(C2CC2)=N1 IJIVBPPMCFCMGB-UHFFFAOYSA-N 0.000 description 2
- CIPMQUDTRNJWHR-UHFFFAOYSA-N 4-cyclopropyl-6-methoxy-1,3,5-triazin-2-amine Chemical compound COC1=NC(N)=NC(C2CC2)=N1 CIPMQUDTRNJWHR-UHFFFAOYSA-N 0.000 description 2
- WBYRNUWFQADAPF-UHFFFAOYSA-N 4-ethoxy-6-methyl-1,3,5-triazin-2-amine Chemical compound CCOC1=NC(C)=NC(N)=N1 WBYRNUWFQADAPF-UHFFFAOYSA-N 0.000 description 2
- RJBSTXIIQYFNPX-UHFFFAOYSA-N 4-methoxy-6-phenyl-1,3,5-triazin-2-amine Chemical compound COC1=NC(N)=NC(C=2C=CC=CC=2)=N1 RJBSTXIIQYFNPX-UHFFFAOYSA-N 0.000 description 2
- XCULMHOQTRDWSI-UHFFFAOYSA-N 4-methoxy-6-propan-2-yl-1,3,5-triazin-2-amine Chemical compound COC1=NC(N)=NC(C(C)C)=N1 XCULMHOQTRDWSI-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- JRYOZJIRAVZGMV-UHFFFAOYSA-N cyclopropanecarboximidamide;hydron;chloride Chemical compound Cl.NC(=N)C1CC1 JRYOZJIRAVZGMV-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 2
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- VWXLCWNPSOUPPE-UHFFFAOYSA-N (1-amino-2-methylpropylidene)azanium;chloride Chemical compound Cl.CC(C)C(N)=N VWXLCWNPSOUPPE-UHFFFAOYSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- NXFQWRWXEYTOTK-UHFFFAOYSA-N 2-methyl-4-amino-6-methoxy-s-triazine Chemical compound COC1=NC(C)=NC(N)=N1 NXFQWRWXEYTOTK-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- RGPZHDMQERLGNN-UHFFFAOYSA-N C(#N)N=C(O)O Chemical compound C(#N)N=C(O)O RGPZHDMQERLGNN-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- BPMGFNCDRVFXEG-UHFFFAOYSA-N methyl 2-methylpropanimidate Chemical compound COC(=N)C(C)C BPMGFNCDRVFXEG-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
- C07D251/18—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom with nitrogen atoms directly attached to the two other ring carbon atoms, e.g. guanamines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/562,161 US5075443A (en) | 1990-08-03 | 1990-08-03 | Preparation of 2-amino-4-alkoxy-s-triazines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL99032A0 IL99032A0 (en) | 1992-07-15 |
| IL99032A true IL99032A (he) | 1996-06-18 |
Family
ID=24245053
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL9903291A IL99032A (he) | 1990-08-03 | 1991-08-01 | הכנת 2-אמינו-4-אלקוקסי-s-טריאזינים |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5075443A (he) |
| EP (1) | EP0470050B1 (he) |
| JP (1) | JP3079221B2 (he) |
| KR (1) | KR920004363A (he) |
| BR (1) | BR9103339A (he) |
| CA (1) | CA2048334C (he) |
| DE (1) | DE59106804D1 (he) |
| IE (1) | IE69364B1 (he) |
| IL (1) | IL99032A (he) |
| ZA (1) | ZA916093B (he) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4335497A1 (de) * | 1993-10-19 | 1995-04-20 | Basf Ag | Verfahren zur Herstellung unsymmetrisch substituierter Triazine |
| DE19523206B4 (de) * | 1995-06-27 | 2005-10-20 | Degussa | Verfahren zur Herstellung von 4,6-disubstituierten 2-Amino-s-triazinen |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3154547A (en) * | 1963-03-05 | 1964-10-27 | American Cyanamid Co | Process for preparing 2-amino-s-triazines |
| IE49355B1 (en) * | 1979-01-26 | 1985-09-18 | Ici Ltd | Process for the manufacture of(n-cyanoimido)-carbonates |
| CA1250574A (en) * | 1984-03-27 | 1989-02-28 | Stefan Weiss | Process for the preparation of 2-amino-s-triazines |
| DE3411202C2 (de) * | 1984-03-27 | 1986-07-10 | Skw Trostberg Ag, 8223 Trostberg | Verfahren zur Herstellung von 2-Amino-s-triazinen |
| US4886881A (en) * | 1989-05-12 | 1989-12-12 | E. I. Du Pont De Nemours And Company | Preparation of 2-amino triazines |
-
1990
- 1990-08-03 US US07/562,161 patent/US5075443A/en not_active Expired - Lifetime
-
1991
- 1991-07-18 KR KR1019910012257A patent/KR920004363A/ko not_active Ceased
- 1991-07-26 DE DE59106804T patent/DE59106804D1/de not_active Expired - Lifetime
- 1991-07-26 EP EP91810603A patent/EP0470050B1/de not_active Expired - Lifetime
- 1991-08-01 CA CA002048334A patent/CA2048334C/en not_active Expired - Lifetime
- 1991-08-01 IL IL9903291A patent/IL99032A/he not_active IP Right Cessation
- 1991-08-02 JP JP03216348A patent/JP3079221B2/ja not_active Expired - Lifetime
- 1991-08-02 IE IE276591A patent/IE69364B1/en not_active IP Right Cessation
- 1991-08-02 BR BR919103339A patent/BR9103339A/pt not_active IP Right Cessation
- 1991-08-02 ZA ZA916093A patent/ZA916093B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA916093B (en) | 1994-09-26 |
| US5075443A (en) | 1991-12-24 |
| IE912765A1 (en) | 1992-02-12 |
| DE59106804D1 (de) | 1995-12-07 |
| KR920004363A (ko) | 1992-03-27 |
| EP0470050A1 (de) | 1992-02-05 |
| JP3079221B2 (ja) | 2000-08-21 |
| IL99032A0 (en) | 1992-07-15 |
| CA2048334A1 (en) | 1992-02-04 |
| CA2048334C (en) | 2001-09-25 |
| BR9103339A (pt) | 1992-05-05 |
| IE69364B1 (en) | 1996-09-04 |
| EP0470050B1 (de) | 1995-11-02 |
| JPH04244069A (ja) | 1992-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR0122856B1 (ko) | 피리딜 메틸아민류 | |
| SK281055B6 (sk) | Spôsob výroby fenoxypyrimidínových zlúčenín | |
| EP0205879B1 (en) | Process for the preparation of herbicidal 2-(4,4-disubstituted 5-oxo-2-imidazolin-2-yl)benzoic, nicotinic and quinoline-3-carboxylic acids, esters and salts | |
| SK285993B6 (sk) | Spôsob výroby derivátov pyrimidínu substituovaných aminoskupinou a ich medziprodukty | |
| US4650892A (en) | Process for the preparation of herbicidal sulfonamides | |
| CA2048334C (en) | Preparation of 2-amino-4-alkoxy-s-triazines | |
| AU705409B2 (en) | Process for making dihydropyrimidinones | |
| RU2103262C1 (ru) | Способ получения 2-замещенных 5-хлоримидазол-4-карбальдегидов | |
| US5910602A (en) | Method for preparing 3-amino substituted crotonates | |
| FI111543B (fi) | Menetelmä epäsymmetrisesti substituoitujen triatsiinien valmistamiseksi | |
| HU212611B (en) | Process for the preparation of 2-substituted 4,6-dialkoxy-pyrimidine derivatives | |
| US4225721A (en) | Novel amidoxime derivatives | |
| AU606696B2 (en) | Process for preparing herbicidal and insecticidal ureas and carbamate derivatives | |
| PL171743B1 (pl) | N-5-zabezpieczone2,5-diamino-4,6-dihydroksypirymidyny PL PL PL | |
| EP0819114B1 (en) | An arthropodicidal oxadiazine intermediate | |
| US5777154A (en) | Method for preparing 3-amino substituted crotonates | |
| US5442075A (en) | Process for the production of 2-substituted 5-chlorimidazole-4-carbaldehydes | |
| US5208337A (en) | Process for the preparation of aminopyrimidines | |
| RU2116299C1 (ru) | Способ получения 2-замещенных 5-хлоримидазол-4-карбальдегидов и 2-замещенный 3,5-дигидроимидазолин-4-он | |
| MXPA01000820A (es) | Metodo para producir 2-isocianatopirimidinas disustituidas en las posiciones 4, 6 y para utilizarlas como productos intermediarios en la sintesis de ingredientes activos. | |
| AU705170B2 (en) | Method of preparing sulphonyl ureas with herbicidal properties and N-pyrimidinyl or N-triazinyl carbamates as intermediates in the reaction | |
| RU2021273C1 (ru) | Способ получения 2,6-дизамещенных 2,4,6,8-тетраазабицикло [3,3,0]октан-3,7-дионов | |
| US5723647A (en) | N-(4-bromo-2-fluorobenzyl)carbamates and a process for their preparation | |
| US5973189A (en) | Monoesters of carboxymethylene anthranilic acids and process for preparing the same | |
| SU469689A1 (ru) | Способ получени о-арилкетоксимов |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| HC | Change of name of proprietor(s) | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| EXP | Patent expired |