IL55156A - N-phenylcarbamoyloxy phenylcarbamic acid derivatives,process for the preparation thereof and herbicidal compositions containing them - Google Patents
N-phenylcarbamoyloxy phenylcarbamic acid derivatives,process for the preparation thereof and herbicidal compositions containing themInfo
- Publication number
- IL55156A IL55156A IL55156A IL5515678A IL55156A IL 55156 A IL55156 A IL 55156A IL 55156 A IL55156 A IL 55156A IL 5515678 A IL5515678 A IL 5515678A IL 55156 A IL55156 A IL 55156A
- Authority
- IL
- Israel
- Prior art keywords
- phenylcarbamoyloxy
- preparation
- compositions containing
- acid derivatives
- herbicidal compositions
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- DZRXGBUOJVVACR-UHFFFAOYSA-N phenyl(phenylcarbamoyloxy)carbamic acid Chemical class C=1C=CC=CC=1N(C(=O)O)OC(=O)NC1=CC=CC=C1 DZRXGBUOJVVACR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/22—O-Aryl or S-Aryl esters thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772732848 DE2732848A1 (de) | 1977-07-18 | 1977-07-18 | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL55156A0 IL55156A0 (en) | 1978-09-29 |
| IL55156A true IL55156A (en) | 1982-11-30 |
Family
ID=6014434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL55156A IL55156A (en) | 1977-07-18 | 1978-07-17 | N-phenylcarbamoyloxy phenylcarbamic acid derivatives,process for the preparation thereof and herbicidal compositions containing them |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4441915A (cs) |
| JP (1) | JPS5422340A (cs) |
| AU (1) | AU519399B2 (cs) |
| BE (1) | BE869074A (cs) |
| CA (1) | CA1103268A (cs) |
| CH (1) | CH637372A5 (cs) |
| CS (1) | CS197327B2 (cs) |
| DD (1) | DD137822A5 (cs) |
| DE (1) | DE2732848A1 (cs) |
| DK (1) | DK320778A (cs) |
| ES (1) | ES471736A1 (cs) |
| FR (1) | FR2398053A1 (cs) |
| GB (1) | GB2002356B (cs) |
| GR (1) | GR73026B (cs) |
| HU (1) | HU180531B (cs) |
| IE (1) | IE47234B1 (cs) |
| IL (1) | IL55156A (cs) |
| IT (1) | IT1097530B (cs) |
| LU (1) | LU79980A1 (cs) |
| NL (1) | NL7807482A (cs) |
| PL (1) | PL111138B1 (cs) |
| PT (1) | PT68309A (cs) |
| SU (2) | SU717990A3 (cs) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE50640B1 (en) * | 1980-04-28 | 1986-05-28 | Stauffer Chemical Co | Synergistic herbicidal compositions and use thereof |
| GR78909B (cs) * | 1982-08-13 | 1984-10-02 | Sipcam Spa | |
| US6150328A (en) * | 1986-07-01 | 2000-11-21 | Genetics Institute, Inc. | BMP products |
| US20080139474A1 (en) * | 1991-11-04 | 2008-06-12 | David Israel | Recombinant bone morphogenetic protein heterodimers, compositions and methods of use |
| EP0612348B1 (en) | 1991-11-04 | 2003-04-23 | Genetics Institute, LLC | Recombinant bone morphogenetic protein heterodimers, compositions and methods of use |
| US6291206B1 (en) * | 1993-09-17 | 2001-09-18 | Genetics Institute, Inc. | BMP receptor proteins |
| EP0733109B9 (en) | 1993-12-07 | 2006-07-05 | Genetics Institute, LLC | Bmp-12, bmp-13 and tendon-inducing compositions thereof |
| US6727224B1 (en) * | 1999-02-01 | 2004-04-27 | Genetics Institute, Llc. | Methods and compositions for healing and repair of articular cartilage |
| US7189392B1 (en) | 1999-10-15 | 2007-03-13 | Genetics Institute, Llc | Injectable carrier formulations of hyaluronic acid derivatives for delivery of osteogenic proteins |
| US20030082233A1 (en) * | 2000-12-01 | 2003-05-01 | Lyons Karen M. | Method and composition for modulating bone growth |
| ATE393573T1 (de) * | 2001-06-01 | 2008-05-15 | Wyeth Corp | Zusammensetzungen für die systemische verabreichung von sequenzen, die für knochenmorphogenese-proteinen kodieren |
| TWI267378B (en) * | 2001-06-08 | 2006-12-01 | Wyeth Corp | Calcium phosphate delivery vehicles for osteoinductive proteins |
| CN1665525A (zh) * | 2002-05-17 | 2005-09-07 | 惠氏公司 | 用于递送骨生成蛋白质的可注入固体透明质酸载体 |
| ATE357244T1 (de) * | 2003-09-12 | 2007-04-15 | Wyeth Corp | Injizierbare feste calciumphosphat-stäbe zur abgabe von osteogenen proteinen |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3133808A (en) * | 1959-03-16 | 1964-05-19 | Monsanto Chemicals | Herbicide composition |
| US3404975A (en) * | 1964-12-18 | 1968-10-08 | Fmc Corp | m-(carbamoyloxy)-carbanilates as herbicides |
| DE1567151C3 (de) * | 1965-04-09 | 1974-02-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel |
| US3551477A (en) * | 1966-07-06 | 1970-12-29 | Basf Ag | Novel biscarbamates |
| US3901936A (en) * | 1966-10-15 | 1975-08-26 | Schering Ag | Process for the preparation of n-carbamoyloxyphenyl carbamates |
| US3865867A (en) * | 1967-06-19 | 1975-02-11 | Monsanto Co | Meta-bifunctional benzenes |
| DE2108975C3 (de) * | 1971-02-16 | 1979-12-20 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
| EG10699A (en) * | 1971-06-23 | 1976-07-31 | Bayer Ag | Novel n.carbamic aryl acid esters method for preparation and their use for controlling plant growth |
| US4022611A (en) * | 1972-06-06 | 1977-05-10 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US3997325A (en) * | 1973-05-24 | 1976-12-14 | American Cyanamid Company | (Alkynyloxy)alkyl and (alkenyloxy)alkyl carbamates and their use as herbicides |
| US3976470A (en) * | 1975-07-23 | 1976-08-24 | Stauffer Chemical Company | Diphenyl ether amides |
-
1977
- 1977-07-18 DE DE19772732848 patent/DE2732848A1/de not_active Withdrawn
-
1978
- 1978-07-03 SU SU782632100A patent/SU717990A3/ru active
- 1978-07-11 NL NL7807482A patent/NL7807482A/xx not_active Application Discontinuation
- 1978-07-12 SU SU782633658A patent/SU858561A3/ru active
- 1978-07-12 CA CA307,243A patent/CA1103268A/en not_active Expired
- 1978-07-14 ES ES471736A patent/ES471736A1/es not_active Expired
- 1978-07-14 LU LU79980A patent/LU79980A1/xx unknown
- 1978-07-14 CH CH766978A patent/CH637372A5/de not_active IP Right Cessation
- 1978-07-14 GR GR56776A patent/GR73026B/el unknown
- 1978-07-14 DD DD78206729A patent/DD137822A5/xx unknown
- 1978-07-15 PL PL1978208435A patent/PL111138B1/pl unknown
- 1978-07-17 GB GB7830049A patent/GB2002356B/en not_active Expired
- 1978-07-17 IL IL55156A patent/IL55156A/xx unknown
- 1978-07-17 FR FR7821127A patent/FR2398053A1/fr active Granted
- 1978-07-17 IT IT25741/78A patent/IT1097530B/it active
- 1978-07-17 IE IE1440/78A patent/IE47234B1/en unknown
- 1978-07-17 HU HU78SCHE652A patent/HU180531B/hu unknown
- 1978-07-17 JP JP8621978A patent/JPS5422340A/ja active Pending
- 1978-07-17 PT PT68309A patent/PT68309A/pt unknown
- 1978-07-18 AU AU38104/78A patent/AU519399B2/en not_active Expired
- 1978-07-18 DK DK320778A patent/DK320778A/da not_active Application Discontinuation
- 1978-07-18 BE BE189340A patent/BE869074A/xx not_active IP Right Cessation
- 1978-07-18 CS CS784789A patent/CS197327B2/cs unknown
-
1981
- 1981-07-15 US US06/283,661 patent/US4441915A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| IT1097530B (it) | 1985-08-31 |
| FR2398053A1 (fr) | 1979-02-16 |
| IT7825741A0 (it) | 1978-07-17 |
| AU3810478A (en) | 1980-01-24 |
| BE869074A (fr) | 1979-01-18 |
| ES471736A1 (es) | 1979-02-01 |
| DK320778A (da) | 1979-01-19 |
| US4441915A (en) | 1984-04-10 |
| CH637372A5 (de) | 1983-07-29 |
| AU519399B2 (en) | 1981-12-03 |
| IL55156A0 (en) | 1978-09-29 |
| FR2398053B1 (cs) | 1982-11-19 |
| PL208435A1 (pl) | 1979-03-26 |
| DE2732848A1 (de) | 1979-02-08 |
| PT68309A (de) | 1978-08-01 |
| GB2002356A (en) | 1979-02-21 |
| JPS5422340A (en) | 1979-02-20 |
| SU858561A3 (ru) | 1981-08-23 |
| CA1103268A (en) | 1981-06-16 |
| NL7807482A (nl) | 1979-01-22 |
| IE47234B1 (en) | 1984-01-25 |
| IE781440L (en) | 1979-01-18 |
| LU79980A1 (cs) | 1978-12-12 |
| HU180531B (en) | 1983-03-28 |
| CS197327B2 (en) | 1980-04-30 |
| SU717990A3 (ru) | 1980-02-25 |
| PL111138B1 (en) | 1980-08-30 |
| GR73026B (cs) | 1984-01-25 |
| GB2002356B (en) | 1982-03-03 |
| DD137822A5 (de) | 1979-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL55089A (en) | 4-(5-trihalomethyl-2-pyridyloxy)phenoxyalkylcarboxylic acid derivatives,their preparation and herbicidal compositions containing them | |
| IL60833A (en) | Substituted n-benzoylanthranilic acid derivatives,their manufacture and herbicidal compositions containing them | |
| IL55156A (en) | N-phenylcarbamoyloxy phenylcarbamic acid derivatives,process for the preparation thereof and herbicidal compositions containing them | |
| PT66150A (en) | Process for the preparation of herbicidal compositions | |
| IL55114A0 (en) | Novel 5-alkylthio-pyrimidine derivatives,their preparation and herbicidal compositions containing them | |
| IL50928A0 (en) | New phenoxy-phenoxy-alkanecarboxylic acid derivatives,their preparation and herbicidal compositions containing them | |
| ZA791240B (en) | Acylated 1-azolyl-2-hydroxy-butane derivatives,processes for their preparation and their use as fungicides | |
| IL63306A0 (en) | Aniline derivatives,process for the preparation thereof and herbicidal compositions containing the same | |
| NZ188500A (en) | Trifluoromethylphenoxy-phenoxy-crotonic acid derivatives and herbicidal compositions | |
| IL56063A (en) | Sulfonanilide compounds,process for preparing them and herbicidal compositions comprising them | |
| ZA786054B (en) | Novel 6-oxy-genated-3,20-dioxo-pregnane-derivatives,process for the preparation thereof,and pharmaceutical compositions containing them | |
| DE2860942D1 (en) | Indanamines, processes for their preparation and compositions containing them | |
| IL55315A0 (en) | New 4-hydroxy-2-benzimidazolinone derivatives,processes for the preparation thereof and pahrmaceutical compositions containing the same | |
| HK93784A (en) | Acil substituted benzimidazole-2-carboxylic acid derivatives,methods for their preparation,and compositions containing them | |
| IL53643A (en) | Phenyl-1,3-dicarbamic acid derivatives,their preparation and herbicidal compositions containing them | |
| DE2860370D1 (en) | Isopenicillins, processes for their preparation, and compositions containing them | |
| IL55427A0 (en) | 2-hydrazonopropionic acid derivatives, processes for the preparation thereof and pharmaceutical compositions containing the same | |
| IL52558A0 (en) | Novel phenoxy-phenoxy-alkanecarboxylic acid derivatives their preparation and herbicidal compositions containing them | |
| IL53685A (en) | N2-arylsulfonyl-l-argininamides and the pharmaceutical salts thereof,process for their preparation and pharmaceutical compositions containing them | |
| DE2860313D1 (en) | Compositions containing aminoalkoxyamines, and processes for their preparation | |
| EG12865A (en) | Trifluoromethylthio-phenyl(di)-thiophosphoric acid esters,processes for their preparation and their use as insecticides or acaricides | |
| PH13851A (en) | Urea derivatives,process for preparing the same,and herbicidal composition containing the same | |
| IL54637A0 (en) | Novel azolyl-alkanecarboxylic acid derivatives, their preparation and their use as fungicides | |
| IL54812A0 (en) | Isoxazolyl-alkyl thiolcarbamates, their preparation and herbicidal compositions containing them | |
| GB2001635B (en) | Diphenyl ether derivatives process for preparing the same and herbicidal compositions containing the same |