IL43859A - 5(6)-aryloxy or arylthio benzimidazole-2-carbamates,their preparation and anthelmintic compositions containing them - Google Patents
5(6)-aryloxy or arylthio benzimidazole-2-carbamates,their preparation and anthelmintic compositions containing themInfo
- Publication number
- IL43859A IL43859A IL43859A IL4385973A IL43859A IL 43859 A IL43859 A IL 43859A IL 43859 A IL43859 A IL 43859A IL 4385973 A IL4385973 A IL 4385973A IL 43859 A IL43859 A IL 43859A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- carbomethoxyaminobenzimidazole
- naphth
- yloxy
- benzimidazole
- Prior art date
Links
- 230000000507 anthelmentic effect Effects 0.000 title 1
- 125000005110 aryl thio group Chemical group 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims 23
- 238000000034 method Methods 0.000 claims 6
- 125000001624 naphthyl group Chemical group 0.000 claims 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 5
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 4
- 125000004414 alkyl thio group Chemical group 0.000 claims 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims 4
- 238000006467 substitution reaction Methods 0.000 claims 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims 3
- 150000003839 salts Chemical class 0.000 claims 3
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 244000000013 helminth Species 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 2
- JJMCCZLIAMHGME-UHFFFAOYSA-N n-(2-imidazol-1-yl-2-phenylethyl)-1h-imidazole-5-carboxamide Chemical compound C=1N=CNC=1C(=O)NCC(N1C=NC=C1)C1=CC=CC=C1 JJMCCZLIAMHGME-UHFFFAOYSA-N 0.000 claims 2
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 241000124008 Mammalia Species 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000001555 benzenes Chemical class 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- -1 methylsulfinylphenoxy-2-carbomethoxyaminobenzimidazole Chemical compound 0.000 claims 1
- 231100000252 nontoxic Toxicity 0.000 claims 1
- 230000003000 nontoxic effect Effects 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/38—Isothioureas containing any of the groups, X being a hetero atom, Y being any atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31929972A | 1972-12-29 | 1972-12-29 | |
| US05/417,968 US3965113A (en) | 1972-12-29 | 1973-11-21 | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL43859A0 IL43859A0 (en) | 1974-03-14 |
| IL43859A true IL43859A (en) | 1976-12-31 |
Family
ID=26981950
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL43859A IL43859A (en) | 1972-12-29 | 1973-12-19 | 5(6)-aryloxy or arylthio benzimidazole-2-carbamates,their preparation and anthelmintic compositions containing them |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3965113A (de) |
| JP (1) | JPS4994671A (de) |
| AR (1) | AR214701A1 (de) |
| AT (1) | AT332422B (de) |
| BR (1) | BR7310294D0 (de) |
| CA (1) | CA1023750A (de) |
| DE (1) | DE2363348C3 (de) |
| DK (1) | DK151628C (de) |
| ES (1) | ES421928A1 (de) |
| FR (1) | FR2212149B1 (de) |
| GB (1) | GB1434830A (de) |
| IE (1) | IE40141B1 (de) |
| IL (1) | IL43859A (de) |
| IN (1) | IN138645B (de) |
| NL (1) | NL7317798A (de) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2425704A1 (de) * | 1974-05-28 | 1975-12-18 | Hoechst Ag | Substituierte phenylmercapto-benzimidazole |
| SE443977B (sv) | 1977-05-10 | 1986-03-17 | Chinoin Gyogyszer Es Vegyeszet | Forfarande for framstellning av 5(6)-tio-bensimidazolderivat |
| US4136174A (en) * | 1978-01-18 | 1979-01-23 | E. R. Squibb & Sons, Inc. | Benzimidazolecarbamates and method |
| US4156006A (en) * | 1978-01-09 | 1979-05-22 | E. R. Squibb & Sons, Inc. | Vinyl sulfide derivatives of benzimidazoles |
| GB1600840A (en) | 1978-05-30 | 1981-10-21 | Wellcome Found | Diphenylether derivatives useful as flukicidal agents |
| EP0028455A1 (de) * | 1979-10-12 | 1981-05-13 | Imperial Chemical Industries Plc | 5-Phenylselenobenzimidazolderivate, ihre Herstellung und sie enthaltende anthelminthische oder fasziolizide Zusammensetzungen |
| HU182794B (en) * | 1980-03-19 | 1984-03-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 5-bracket-6-bracket closed-thiocyanato-benzimidazolyl-alkyl-carbamates and salts |
| HU184780B (en) * | 1980-09-17 | 1984-10-29 | Chinoin Gyogyszer Es Vegyeszet | Process for producing thiocyanato-benzimidazoles |
| IL61232A (en) * | 1979-10-19 | 1985-09-29 | Chinoin Gyogyszer Es Vegyeszet | Process for the preparation of 2-amino(or alkoxycarbonylamino)-5(6)-thiocyanato(or thiol)benzimidazole derivatives |
| DE3719783A1 (de) * | 1987-06-13 | 1988-12-22 | Hoechst Ag | Verfahren zur herstellung von 5-phenylsulfinyl-1h-2-(methoxycarbonylamino)- benzimidazol |
| GB9900752D0 (en) * | 1999-01-15 | 1999-03-03 | Angiogene Pharm Ltd | Benzimidazole vascular damaging agents |
| US6593466B1 (en) | 1999-07-07 | 2003-07-15 | Isis Pharmaceuticals, Inc. | Guanidinium functionalized nucleotides and precursors thereof |
| CN112094237B (zh) * | 2020-11-06 | 2023-01-20 | 江苏宝众宝达药业股份有限公司 | 氟苯咪唑的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2933502A (en) * | 1958-02-12 | 1960-04-19 | Du Pont | Benzimidazolone derivatives |
| US2933504A (en) * | 1959-08-10 | 1960-04-19 | Du Pont | Derivatives of polyalkoxycarbonyl imine |
| US3010968A (en) * | 1959-11-25 | 1961-11-28 | Du Pont | Process for manufacture of certain alkyl esters of benzimidazole carbamic acids |
| BE666795A (de) * | 1964-08-04 | 1966-01-13 | ||
| US3401171A (en) * | 1966-03-11 | 1968-09-10 | Smithkline Corp | 2-amidobenzimidazoles |
| US3480642A (en) * | 1967-03-22 | 1969-11-25 | Smithkline Corp | Process for producing 2-carbalkoxyaminobenzimidazoles |
| CH490010A (de) * | 1967-10-26 | 1970-05-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| US3714180A (en) * | 1970-08-12 | 1973-01-30 | Squibb & Sons Inc | Sulfonyl benzimidazoles |
| US3720686A (en) * | 1971-04-01 | 1973-03-13 | Squibb & Sons Inc | Mercaptobenzimidazole derivatives |
| BE793358A (fr) * | 1971-12-27 | 1973-06-27 | Hoechst Ag | Nouveaux derives de 2-carbalcoxy-amino-benzimidazole presentantune activite anthelmintique et leur procede de preparation |
-
1973
- 1973-11-21 US US05/417,968 patent/US3965113A/en not_active Expired - Lifetime
- 1973-12-10 IN IN2693/CAL/73A patent/IN138645B/en unknown
- 1973-12-12 CA CA187,977A patent/CA1023750A/en not_active Expired
- 1973-12-13 GB GB5792373A patent/GB1434830A/en not_active Expired
- 1973-12-17 DK DK685373A patent/DK151628C/da not_active IP Right Cessation
- 1973-12-19 IL IL43859A patent/IL43859A/en unknown
- 1973-12-20 DE DE2363348A patent/DE2363348C3/de not_active Expired
- 1973-12-21 IE IE2323/73A patent/IE40141B1/xx unknown
- 1973-12-21 AT AT1075073A patent/AT332422B/de not_active IP Right Cessation
- 1973-12-26 JP JP49004828A patent/JPS4994671A/ja active Pending
- 1973-12-28 AR AR251777A patent/AR214701A1/es active
- 1973-12-28 BR BR10294/73A patent/BR7310294D0/pt unknown
- 1973-12-28 NL NL7317798A patent/NL7317798A/xx not_active Application Discontinuation
- 1973-12-28 FR FR7346945A patent/FR2212149B1/fr not_active Expired
- 1973-12-29 ES ES421928A patent/ES421928A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1023750A (en) | 1978-01-03 |
| AT332422B (de) | 1976-09-27 |
| US3965113A (en) | 1976-06-22 |
| BR7310294D0 (pt) | 1974-09-24 |
| AU6367573A (en) | 1975-06-19 |
| ATA1075073A (de) | 1976-01-15 |
| DK151628C (da) | 1988-06-27 |
| DE2363348B2 (de) | 1980-08-28 |
| FR2212149B1 (de) | 1977-07-01 |
| DE2363348C3 (de) | 1981-04-30 |
| ES421928A1 (es) | 1976-10-16 |
| GB1434830A (en) | 1976-05-05 |
| FR2212149A1 (de) | 1974-07-26 |
| IL43859A0 (en) | 1974-03-14 |
| NL7317798A (de) | 1974-07-02 |
| DE2363348A1 (de) | 1974-07-18 |
| JPS4994671A (de) | 1974-09-09 |
| DK151628B (da) | 1987-12-21 |
| IE40141L (en) | 1974-06-29 |
| IN138645B (de) | 1976-03-06 |
| AR214701A1 (es) | 1979-07-31 |
| IE40141B1 (en) | 1979-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL43859A (en) | 5(6)-aryloxy or arylthio benzimidazole-2-carbamates,their preparation and anthelmintic compositions containing them | |
| US4096335A (en) | 16-Phenoxy prostaglandin B2 analogs | |
| GB1418354A (en) | Tricyclicicazaindole hypoglycemic agents | |
| GB1468270A (en) | Substituted pyrimidine-thionothiolphosphoric acid esters process for their preparation and their use as insecticides or acaricides | |
| GB1381272A (en) | Cephalosporin compounds | |
| IL48790A (en) | Hydroxy-pyrimidines,their preparation and pharmaceutical compositions containing them | |
| US4057564A (en) | 2A,2B-Dihomo-15-alkyl-PGE2 analogs | |
| GB1396627A (en) | Unsaturated sulphones | |
| GB1427160A (en) | Oxazolidines and oxazolidinones and process for their production | |
| GB1428158A (en) | Phenylpyridazines and the preparation thereof | |
| US3978114A (en) | 8β,12α,15β-17-Phenyl-18,19,20-trinor-PGE2 compounds | |
| US3974193A (en) | 16-Fluoro prostaglandin B2 analogs | |
| US3978110A (en) | 8β,12α,15β-17-Phenyl-18,19,20-trinor-PGF2.sub.βc | |
| US3978112A (en) | 8β,11β,12α-17-Phenyl-PGF2.sub.β compounds | |
| US3978111A (en) | 8β,11β,12α-17-Phenyl-18,19,20-trinor-PGE2 compounds | |
| US3978113A (en) | 8β,11β,12α-17-Phenyl-18,19,20-trinor-PGF2.sub.α | |
| US3975426A (en) | 8β, 11β, 12α-PGF2.sub.β -compounds | |
| US3974190A (en) | 16-Fluoro prostaglandin A1 analogs | |
| US3979435A (en) | 8β,12α-17-Phenyl-18,19,20-trinor-PGF2.sub.α compounds | |
| US3974192A (en) | 16-Fluoro prostaglandin B1 analogs | |
| US3979439A (en) | 8β,12α-17-Phenyl-18,19,20 trinor PGF2.sub.β compounds | |
| US3979438A (en) | 8β,12α-17-Phenyl-18,19,20-trinor-PGE2 compounds | |
| GB1373338A (en) | 2-alkyl-4-3h-pteridinones | |
| US3974189A (en) | 16-Fluoro prostaglandin E2 analogs | |
| US3983165A (en) | 8β,12α,15β-17-Phenyl-18,19,20-trinor-PGF2.sub.αc |