IL43299A - Tetrasubstituted ureas,their preparation and their use as herbicides - Google Patents
Tetrasubstituted ureas,their preparation and their use as herbicidesInfo
- Publication number
- IL43299A IL43299A IL43299A IL4329973A IL43299A IL 43299 A IL43299 A IL 43299A IL 43299 A IL43299 A IL 43299A IL 4329973 A IL4329973 A IL 4329973A IL 43299 A IL43299 A IL 43299A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- formula
- carbon atoms
- process according
- halogen
- Prior art date
Links
- 235000013877 carbamide Nutrition 0.000 title claims 3
- 150000003672 ureas Chemical class 0.000 title claims 3
- 239000004009 herbicide Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims 33
- 238000000034 method Methods 0.000 claims 21
- 125000004432 carbon atom Chemical group C* 0.000 claims 15
- 125000000217 alkyl group Chemical group 0.000 claims 11
- 125000003342 alkenyl group Chemical group 0.000 claims 8
- 229910052736 halogen Inorganic materials 0.000 claims 8
- 150000002367 halogens Chemical class 0.000 claims 8
- 125000003545 alkoxy group Chemical group 0.000 claims 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 5
- 229910052757 nitrogen Inorganic materials 0.000 claims 5
- 229910052760 oxygen Inorganic materials 0.000 claims 5
- 239000001301 oxygen Substances 0.000 claims 5
- 241000196324 Embryophyta Species 0.000 claims 4
- 239000005864 Sulphur Substances 0.000 claims 4
- -1 alkali metal cation Chemical class 0.000 claims 4
- 239000003085 diluting agent Substances 0.000 claims 4
- 125000001188 haloalkyl group Chemical group 0.000 claims 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 4
- 239000002253 acid Substances 0.000 claims 3
- 239000011230 binding agent Substances 0.000 claims 3
- 125000005843 halogen group Chemical group 0.000 claims 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 3
- 125000001424 substituent group Chemical group 0.000 claims 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 2
- 125000000304 alkynyl group Chemical group 0.000 claims 2
- 208000027697 autoimmune lymphoproliferative syndrome due to CTLA4 haploinsuffiency Diseases 0.000 claims 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 2
- 239000002904 solvent Substances 0.000 claims 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims 1
- 150000008041 alkali metal carbonates Chemical class 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical group 0.000 claims 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 1
- 125000005210 alkyl ammonium group Chemical group 0.000 claims 1
- 229910001424 calcium ion Inorganic materials 0.000 claims 1
- 239000004202 carbamide Substances 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 125000005131 dialkylammonium group Chemical group 0.000 claims 1
- 230000002363 herbicidal effect Effects 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 239000011777 magnesium Substances 0.000 claims 1
- 229910001425 magnesium ion Inorganic materials 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 239000003495 polar organic solvent Substances 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 229910052717 sulfur Chemical group 0.000 claims 1
- 239000011593 sulfur Chemical group 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722247310 DE2247310A1 (de) | 1972-09-27 | 1972-09-27 | Tetrasubstituierte harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL43299A0 IL43299A0 (en) | 1973-11-28 |
| IL43299A true IL43299A (en) | 1976-08-31 |
Family
ID=5857489
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL43299A IL43299A (en) | 1972-09-27 | 1973-09-24 | Tetrasubstituted ureas,their preparation and their use as herbicides |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4058392A (fr) |
| JP (2) | JPS49100038A (fr) |
| AT (1) | AT327601B (fr) |
| BE (1) | BE805324A (fr) |
| BR (1) | BR7307492D0 (fr) |
| CA (1) | CA1035356A (fr) |
| CH (1) | CH585510A5 (fr) |
| DD (1) | DD107572A5 (fr) |
| DE (1) | DE2247310A1 (fr) |
| DK (1) | DK133776C (fr) |
| EG (1) | EG11148A (fr) |
| ES (1) | ES419103A1 (fr) |
| FR (1) | FR2200256B1 (fr) |
| GB (1) | GB1394951A (fr) |
| HU (1) | HU167993B (fr) |
| IE (1) | IE38279B1 (fr) |
| IL (1) | IL43299A (fr) |
| IT (1) | IT995506B (fr) |
| LU (1) | LU68494A1 (fr) |
| NL (1) | NL7313134A (fr) |
| PL (1) | PL89432B1 (fr) |
| RO (1) | RO71788A (fr) |
| TR (1) | TR17686A (fr) |
| ZA (1) | ZA737585B (fr) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50160327A (fr) * | 1974-06-19 | 1975-12-25 | ||
| BE868406A (fr) * | 1977-06-28 | 1978-12-27 | Sumitomo Chemical Co | N'-phenyl-n-methyl-urees, leur preparation et leur emploi |
| US4289903A (en) * | 1979-06-25 | 1981-09-15 | American Cyanamid Company | Para-phenylalkoxy phenylurea and thiourea compounds and herbicidal use thereof |
| US4294986A (en) * | 1979-06-25 | 1981-10-13 | American Cyanamid Co. | Novel para-phenylalkoxy phenylurea and thiourea compounds and herbicidal use thereof |
| US4780128A (en) * | 1979-07-18 | 1988-10-25 | Imperial Chemical Industries Plc | Herbicides |
| US4361438A (en) * | 1981-01-21 | 1982-11-30 | Stauffer Chemical Company | Substituted cyclopropyl methoxy phenyl ureas and the herbicidal use thereof |
| AU1395983A (en) * | 1982-05-03 | 1983-11-10 | Uniroyal Inc. | Substituted urea herbicides |
| US4782071A (en) * | 1986-11-03 | 1988-11-01 | Warner-Lambert Company | Tetrasubstituted urea cholinergic agents |
| JP5511693B2 (ja) | 2009-02-03 | 2014-06-04 | クミアイ化学工業株式会社 | 縮合環化した２−ピリドン誘導体及び除草剤 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE633027A (fr) * | 1963-05-30 | |||
| DE1542687A1 (de) * | 1965-06-04 | 1970-07-23 | Basf Ag | Herbizide Mittel |
| FR1482710A (fr) * | 1965-06-12 | 1967-05-26 | Basf Ag | Désherbants |
| DE2005326A1 (de) * | 1970-02-06 | 1971-08-12 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Harnstoffderivate |
| US3860644A (en) * | 1970-07-30 | 1975-01-14 | Velsicol Chemical Corp | Composition of matter |
| DE2101698A1 (de) * | 1971-01-15 | 1972-09-07 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Substituierte m-Trifluormethylphenylharnstoffderivate |
-
1972
- 1972-09-27 DE DE19722247310 patent/DE2247310A1/de active Pending
-
1973
- 1973-08-24 CH CH1221173A patent/CH585510A5/xx not_active IP Right Cessation
- 1973-09-10 US US05/395,794 patent/US4058392A/en not_active Expired - Lifetime
- 1973-09-12 DD DD173426A patent/DD107572A5/xx unknown
- 1973-09-24 IL IL43299A patent/IL43299A/en unknown
- 1973-09-24 NL NL7313134A patent/NL7313134A/xx not_active Application Discontinuation
- 1973-09-25 RO RO7376161A patent/RO71788A/fr unknown
- 1973-09-25 LU LU68494A patent/LU68494A1/xx unknown
- 1973-09-25 IT IT29379/73A patent/IT995506B/it active
- 1973-09-25 PL PL1973165421A patent/PL89432B1/pl unknown
- 1973-09-25 IE IE1711/73A patent/IE38279B1/xx unknown
- 1973-09-25 HU HUBA2982A patent/HU167993B/hu unknown
- 1973-09-26 TR TR17686A patent/TR17686A/xx unknown
- 1973-09-26 EG EG376/73A patent/EG11148A/xx active
- 1973-09-26 BR BR7492/73A patent/BR7307492D0/pt unknown
- 1973-09-26 CA CA181,967A patent/CA1035356A/fr not_active Expired
- 1973-09-26 ZA ZA737585*A patent/ZA737585B/xx unknown
- 1973-09-26 ES ES419103A patent/ES419103A1/es not_active Expired
- 1973-09-26 DK DK527973*A patent/DK133776C/da active
- 1973-09-26 GB GB4502273A patent/GB1394951A/en not_active Expired
- 1973-09-26 BE BE136049A patent/BE805324A/fr unknown
- 1973-09-27 JP JP48108060A patent/JPS49100038A/ja active Pending
- 1973-09-27 JP JP48108061A patent/JPS4969832A/ja active Pending
- 1973-09-27 FR FR7334723A patent/FR2200256B1/fr not_active Expired
- 1973-09-27 AT AT831673A patent/AT327601B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE38279B1 (en) | 1978-02-01 |
| DK133776C (da) | 1976-12-06 |
| DK133776B (da) | 1976-07-19 |
| JPS49100038A (fr) | 1974-09-20 |
| IE38279L (en) | 1974-03-27 |
| HU167993B (fr) | 1976-02-28 |
| BE805324A (fr) | 1974-03-26 |
| IT995506B (it) | 1975-11-20 |
| CH585510A5 (fr) | 1977-03-15 |
| JPS4969832A (fr) | 1974-07-05 |
| RO71788A (fr) | 1981-01-30 |
| ES419103A1 (es) | 1976-07-01 |
| BR7307492D0 (pt) | 1974-08-15 |
| LU68494A1 (fr) | 1973-12-07 |
| GB1394951A (en) | 1975-05-21 |
| DE2247310A1 (de) | 1974-04-04 |
| AU6058073A (en) | 1975-03-27 |
| CA1035356A (fr) | 1978-07-25 |
| US4058392A (en) | 1977-11-15 |
| FR2200256B1 (fr) | 1977-05-27 |
| FR2200256A1 (fr) | 1974-04-19 |
| AT327601B (de) | 1976-02-10 |
| IL43299A0 (en) | 1973-11-28 |
| ATA831673A (de) | 1975-04-15 |
| NL7313134A (fr) | 1974-03-29 |
| PL89432B1 (fr) | 1976-11-30 |
| DD107572A5 (fr) | 1974-08-12 |
| ZA737585B (en) | 1974-08-28 |
| EG11148A (en) | 1977-08-15 |
| TR17686A (tr) | 1975-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0033984A1 (fr) | Composés sulfonyliques, procédé pour leur préparation, ainsi que compositions anti-aphidiennes basées sur ces composés | |
| EP0001647B1 (fr) | Dérivés d'imidazolines et leurs sels, leur préparation, compositions pesticides les contenant et leurs préparation, leurs utilisation comme pesticides | |
| IL43299A (en) | Tetrasubstituted ureas,their preparation and their use as herbicides | |
| US4149872A (en) | N-pyridinyl urea and cyclopropanecarboxamide herbicides | |
| US4116676A (en) | 4-Methylthio-2-trifluoromethylmethane-sulfonanilide and derivatives thereof | |
| GB951651A (en) | Substituted benzonitriles, their preparation and compositions containing them | |
| US3948987A (en) | Substituted methanesulfonanilides | |
| US4606862A (en) | Amides of N-(3-(1-chloro-2-nitroethenylthio)propane) | |
| IL43142A (en) | N-sulphenylated carbamidoximes their preparation and fungicidal and microbicidal compositions containing them | |
| EP0057028B1 (fr) | Fongicides | |
| GB2023603A (en) | Pesticidal imidazolines, and their preparation and use | |
| GB1041011A (en) | Fungicidal compositions and halogenated quinoxalines | |
| US4246283A (en) | Pesticidally active 1-phenyl-1,3,5-triaza-4-sulfa-5-alkylsulfonyl and -phenylsulfonyl-pent-1-en derivatives | |
| IL42864A (en) | Azomethines of 4-amino-5-h-1,2,4-triazin-5-ones their production and their use as herbicides | |
| US4259330A (en) | Nematocidal phosphoramidates | |
| CA1149392A (fr) | Derives heterocycliques d'acide phenoxyalcanoique | |
| US2789114A (en) | Triethylamine salt of nu-(2-pyridyl)-dithiocarbamic acid | |
| GB932951A (en) | Improvements in or relating to guanidines | |
| EP0152131B1 (fr) | Dérivés de carboxamide, leur préparation et leur utilisation comme fongicides | |
| IL41709A (en) | N-aminomethylene thiolphosphoric acid ester amides,their manufacture and their use as insecticides and acaricides | |
| IL45421A (en) | 3-alkanoyl-1,1-dialkyl-3-(5-substituted 1,3,4-thiadiazol-2-yl)ureas,their preparation and herbicidal compositions containing them | |
| IL39719A (en) | N-arylcarbamic acid esters,their preparation and their use as plant-growth regulators | |
| GB1579635A (en) | Sulphenamides and their use in pesticidal compositions | |
| US3409630A (en) | Water-soluble salts of nitrosubstituted 3-pyridols | |
| IT8024168A1 (it) | Fungicidi a base di ossazolidinoni |