IL42678A - Assemble a preparation using a dry and non-flammable bleach containing chlorine - Google Patents
Assemble a preparation using a dry and non-flammable bleach containing chlorineInfo
- Publication number
- IL42678A IL42678A IL42678A IL4267873A IL42678A IL 42678 A IL42678 A IL 42678A IL 42678 A IL42678 A IL 42678A IL 4267873 A IL4267873 A IL 4267873A IL 42678 A IL42678 A IL 42678A
- Authority
- IL
- Israel
- Prior art keywords
- sodium
- bleaching
- dihydrate
- disinfecting
- sterilizing
- Prior art date
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 41
- 239000000203 mixture Substances 0.000 claims description 59
- 239000003599 detergent Substances 0.000 claims description 34
- 238000004061 bleaching Methods 0.000 claims description 33
- 150000001875 compounds Chemical class 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 229910052708 sodium Inorganic materials 0.000 claims description 24
- 239000011734 sodium Substances 0.000 claims description 24
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 23
- 150000004683 dihydrates Chemical class 0.000 claims description 22
- 239000000460 chlorine Substances 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- 230000000249 desinfective effect Effects 0.000 claims description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 17
- 230000001954 sterilising effect Effects 0.000 claims description 17
- 239000000945 filler Substances 0.000 claims description 14
- 239000003093 cationic surfactant Substances 0.000 claims description 13
- PYILKOIEIHHYGD-UHFFFAOYSA-M sodium;1,5-dichloro-4,6-dioxo-1,3,5-triazin-2-olate;dihydrate Chemical compound O.O.[Na+].[O-]C1=NC(=O)N(Cl)C(=O)N1Cl PYILKOIEIHHYGD-UHFFFAOYSA-M 0.000 claims description 13
- 238000002156 mixing Methods 0.000 claims description 11
- 239000003945 anionic surfactant Substances 0.000 claims description 8
- 125000000129 anionic group Chemical group 0.000 claims description 6
- 239000002736 nonionic surfactant Substances 0.000 claims description 6
- 238000004851 dishwashing Methods 0.000 claims description 4
- 239000003139 biocide Substances 0.000 claims description 3
- 230000003292 diminished effect Effects 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 238000009991 scouring Methods 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 230000003115 biocidal effect Effects 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims 1
- 239000000463 material Substances 0.000 description 27
- -1 calcium dichloroisocyanurate salts Chemical class 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 19
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- 239000003760 tallow Substances 0.000 description 14
- 235000019832 sodium triphosphate Nutrition 0.000 description 13
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 11
- 229940117927 ethylene oxide Drugs 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 10
- 235000002639 sodium chloride Nutrition 0.000 description 10
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- 235000017550 sodium carbonate Nutrition 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 229960003010 sodium sulfate Drugs 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 239000002671 adjuvant Substances 0.000 description 7
- 239000003240 coconut oil Substances 0.000 description 7
- 235000019864 coconut oil Nutrition 0.000 description 7
- 239000000428 dust Substances 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 230000002209 hydrophobic effect Effects 0.000 description 6
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 5
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 150000004682 monohydrates Chemical class 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 4
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 230000001473 noxious effect Effects 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 229950009390 symclosene Drugs 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- 238000009825 accumulation Methods 0.000 description 3
- 230000035508 accumulation Effects 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 239000010419 fine particle Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 3
- 159000000001 potassium salts Chemical class 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000000271 synthetic detergent Substances 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N 1-nonene Chemical compound CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 239000005708 Sodium hypochlorite Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 229940096386 coconut alcohol Drugs 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000009970 fire resistant effect Effects 0.000 description 2
- 231100001261 hazardous Toxicity 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 2
- IFIDXBCRSWOUSB-UHFFFAOYSA-M potassium;1,5-dichloro-4,6-dioxo-1,3,5-triazin-2-olate Chemical compound [K+].ClN1C(=O)[N-]C(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000003784 tall oil Substances 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical group O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical group O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- SIDULKZCBGMXJL-UHFFFAOYSA-N 1-dimethylphosphoryldodecane Chemical compound CCCCCCCCCCCCP(C)(C)=O SIDULKZCBGMXJL-UHFFFAOYSA-N 0.000 description 1
- HKWJJKHFKKYLHC-UHFFFAOYSA-N 1-dodecoxy-3-methylsulfinylpropan-2-ol Chemical compound CCCCCCCCCCCCOCC(O)CS(C)=O HKWJJKHFKKYLHC-UHFFFAOYSA-N 0.000 description 1
- ZZBBQMYYIZNDJM-UHFFFAOYSA-N 1-ethylsulfinyldodecan-2-ol Chemical compound CCCCCCCCCCC(O)CS(=O)CC ZZBBQMYYIZNDJM-UHFFFAOYSA-N 0.000 description 1
- KELGBPHGJYCRSO-UHFFFAOYSA-N 1-ethylsulfinyldodecane Chemical compound CCCCCCCCCCCCS(=O)CC KELGBPHGJYCRSO-UHFFFAOYSA-N 0.000 description 1
- CJPDBKNETSCHCH-UHFFFAOYSA-N 1-methylsulfinyldodecane Chemical compound CCCCCCCCCCCCS(C)=O CJPDBKNETSCHCH-UHFFFAOYSA-N 0.000 description 1
- KRUABTDBQQLWLS-UHFFFAOYSA-N 1-methylsulfinyltetradecane Chemical compound CCCCCCCCCCCCCCS(C)=O KRUABTDBQQLWLS-UHFFFAOYSA-N 0.000 description 1
- HYTOZULGKGUFII-UHFFFAOYSA-N 1-methylsulfinyltridecan-3-ol Chemical compound CCCCCCCCCCC(O)CCS(C)=O HYTOZULGKGUFII-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- YEJUYZRXQFFYBA-UHFFFAOYSA-N 2-phenyldodecane-1-sulfonic acid Chemical compound CCCCCCCCCCC(CS(O)(=O)=O)C1=CC=CC=C1 YEJUYZRXQFFYBA-UHFFFAOYSA-N 0.000 description 1
- UKSKZKJVARWMOV-UHFFFAOYSA-N 3-phenyldodecane-1-sulfonic acid Chemical compound CCCCCCCCCC(CCS(O)(=O)=O)C1=CC=CC=C1 UKSKZKJVARWMOV-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ADKBCVLVQBCHLY-UHFFFAOYSA-N C(CCCCCCCCCCC)[PH2]=O Chemical compound C(CCCCCCCCCCC)[PH2]=O ADKBCVLVQBCHLY-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- WNTGHAZFHMDMCZ-UHFFFAOYSA-N ClC12NC(NC1(NC(N(C2=O)[N+]#[C-])=O)Cl)=O Chemical compound ClC12NC(NC1(NC(N(C2=O)[N+]#[C-])=O)Cl)=O WNTGHAZFHMDMCZ-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 229920002257 Plurafac® Polymers 0.000 description 1
- 240000004885 Quercus rubra Species 0.000 description 1
- 235000009135 Quercus rubra Nutrition 0.000 description 1
- 229910020169 SiOa Inorganic materials 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- OBNXYXPOQJXTBK-UHFFFAOYSA-L didecyl(dimethyl)azanium dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.CCCCCCCCCC[N+](C)(C)CCCCCCCCCC OBNXYXPOQJXTBK-UHFFFAOYSA-L 0.000 description 1
- 125000006182 dimethyl benzyl group Chemical group 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- LWXVCCOAQYNXNX-UHFFFAOYSA-N lithium hypochlorite Chemical compound [Li+].Cl[O-] LWXVCCOAQYNXNX-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001463 metal phosphate Inorganic materials 0.000 description 1
- ONHFWHCMZAJCFB-UHFFFAOYSA-N myristamine oxide Chemical compound CCCCCCCCCCCCCC[N+](C)(C)[O-] ONHFWHCMZAJCFB-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IBOBFGGLRNWLIL-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine oxide Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)[O-] IBOBFGGLRNWLIL-UHFFFAOYSA-N 0.000 description 1
- RSVIRMFSJVHWJV-UHFFFAOYSA-N n,n-dimethyloctan-1-amine oxide Chemical compound CCCCCCCC[N+](C)(C)[O-] RSVIRMFSJVHWJV-UHFFFAOYSA-N 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 229910001120 nichrome Inorganic materials 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- QEHKBHWEUPXBCW-UHFFFAOYSA-N nitrogen trichloride Chemical compound ClN(Cl)Cl QEHKBHWEUPXBCW-UHFFFAOYSA-N 0.000 description 1
- UKSNONZNPOSKFX-UHFFFAOYSA-N octadecan-9-amine;hydrochloride Chemical compound [Cl-].CCCCCCCCCC([NH3+])CCCCCCCC UKSNONZNPOSKFX-UHFFFAOYSA-N 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 235000013966 potassium salts of fatty acid Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000011012 sanitization Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
- 229940056729 sodium sulfate anhydrous Drugs 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/395—Bleaching agents
- C11D3/3955—Organic bleaching agents
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27788872A | 1972-08-04 | 1972-08-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL42678A0 IL42678A0 (en) | 1973-10-25 |
| IL42678A true IL42678A (en) | 1976-02-29 |
Family
ID=23062809
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL42678A IL42678A (en) | 1972-08-04 | 1973-07-06 | Assemble a preparation using a dry and non-flammable bleach containing chlorine |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3789000A (Direct) |
| JP (1) | JPS5318189B2 (Direct) |
| AR (1) | AR202632A1 (Direct) |
| AU (1) | AU471641B2 (Direct) |
| BE (1) | BE803084A (Direct) |
| BR (1) | BR7305934D0 (Direct) |
| CA (1) | CA1004946A (Direct) |
| CH (1) | CH581696A5 (Direct) |
| DE (1) | DE2339117C3 (Direct) |
| ES (1) | ES417590A1 (Direct) |
| FR (1) | FR2194773B1 (Direct) |
| GB (1) | GB1429987A (Direct) |
| HK (1) | HK17077A (Direct) |
| IL (1) | IL42678A (Direct) |
| IT (1) | IT992836B (Direct) |
| NL (1) | NL7310694A (Direct) |
| NO (1) | NO144150C (Direct) |
| SE (1) | SE415194B (Direct) |
| ZA (1) | ZA734863B (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5428283A (en) * | 1977-08-05 | 1979-03-02 | Kirisan Kasei Kk | Bleaching agent |
| CN121271650A (zh) * | 2024-07-05 | 2026-01-06 | 宝洁公司 | 颗粒状衣物洗涤剂组合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3035056A (en) * | 1962-05-15 | Potassium dichloroisocyanurate | ||
| AT212262B (de) * | 1956-09-25 | 1960-12-12 | Fmc Corp | Aktives Chlor enthaltendes Präparat |
-
1972
- 1972-08-04 US US02778882*7A patent/US3789000A/en not_active Expired - Lifetime
-
1973
- 1973-07-05 CA CA175,744A patent/CA1004946A/en not_active Expired
- 1973-07-06 AU AU57825/73A patent/AU471641B2/en not_active Expired
- 1973-07-06 IL IL42678A patent/IL42678A/en unknown
- 1973-07-17 ZA ZA734863A patent/ZA734863B/xx unknown
- 1973-07-26 FR FR7327423A patent/FR2194773B1/fr not_active Expired
- 1973-07-26 JP JP8367773A patent/JPS5318189B2/ja not_active Expired
- 1973-07-26 AR AR249283A patent/AR202632A1/es active
- 1973-07-27 CH CH1101573A patent/CH581696A5/xx not_active IP Right Cessation
- 1973-07-31 BE BE134122A patent/BE803084A/xx not_active IP Right Cessation
- 1973-08-02 NL NL7310694A patent/NL7310694A/xx unknown
- 1973-08-02 SE SE7310666A patent/SE415194B/sv unknown
- 1973-08-02 DE DE2339117A patent/DE2339117C3/de not_active Expired
- 1973-08-03 IT IT27527/73A patent/IT992836B/it active
- 1973-08-03 NO NO3116/73A patent/NO144150C/no unknown
- 1973-08-03 BR BR5934/73A patent/BR7305934D0/pt unknown
- 1973-08-04 ES ES417590A patent/ES417590A1/es not_active Expired
- 1973-08-06 GB GB3717773A patent/GB1429987A/en not_active Expired
-
1977
- 1977-04-14 HK HK170/77A patent/HK17077A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT992836B (it) | 1975-09-30 |
| DE2339117C3 (de) | 1981-10-08 |
| DE2339117A1 (de) | 1974-02-14 |
| BR7305934D0 (pt) | 1974-05-16 |
| NO144150C (no) | 1981-07-15 |
| CH581696A5 (Direct) | 1976-11-15 |
| JPS49131978A (Direct) | 1974-12-18 |
| NL7310694A (Direct) | 1974-02-06 |
| FR2194773B1 (Direct) | 1977-05-13 |
| ES417590A1 (es) | 1976-08-01 |
| BE803084A (fr) | 1974-01-31 |
| HK17077A (en) | 1977-04-22 |
| AU471641B2 (en) | 1976-04-29 |
| DE2339117B2 (de) | 1980-11-27 |
| NO144150B (no) | 1981-03-23 |
| AR202632A1 (es) | 1975-06-30 |
| IL42678A0 (en) | 1973-10-25 |
| ZA734863B (en) | 1974-06-26 |
| JPS5318189B2 (Direct) | 1978-06-13 |
| CA1004946A (en) | 1977-02-08 |
| US3789000A (en) | 1974-01-29 |
| GB1429987A (en) | 1976-03-31 |
| AU5782573A (en) | 1975-01-09 |
| SE415194B (sv) | 1980-09-15 |
| FR2194773A1 (Direct) | 1974-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USRE24412E (en) | Bleaching | |
| US3816320A (en) | Stable dishwashing compositions containing sodium dichloroisocyanurate dihydrate | |
| CA1092476A (en) | Detergent composition and its use in a dishwashing machine | |
| US6589443B1 (en) | Shaped solid comprising oxidant bleach with encapsulate source of bleach | |
| EP0178893B1 (en) | Solid detergent compositions | |
| AU715688B2 (en) | Composition and apparatus for surface cleaning | |
| AU683523B2 (en) | Thickened alkali metal hypochlorite compositions | |
| US3491028A (en) | Chlorine stable machine dishwashing composition | |
| US20020132746A1 (en) | Toilet bowl cleaner effervescent tablet | |
| IE59145B1 (en) | Cleaning compositions | |
| NO128445B (Direct) | ||
| JP2001508112A (ja) | 固体ブロック機能性物質用の結合剤 | |
| CA2063527A1 (en) | Aqueous liquid automatic dishwashing detergent composition comprising hypochlorite bleach and bleach stabilizer | |
| WO2006047045A2 (en) | Stabilized chlorine bleach in alkaline detergent composition and method of making and using the same | |
| JPH02227498A (ja) | 漂白組成物 | |
| US6397862B1 (en) | Method of cleaning garbage disposals | |
| CA1148058A (en) | Method and composition to inhibit staining of porcelain surfaces by manganese | |
| US4931202A (en) | Detergent pellet composition and process therefor | |
| US4120812A (en) | Polyethylene glycol-stabilized peroxygens | |
| US3494868A (en) | Dishwashing composition and method of using same | |
| US3789000A (en) | Formulating with a non-burning chlorinated dry bleach | |
| US4228025A (en) | Agglomeration process for making granular detergents | |
| US3338836A (en) | Cleansing tablets | |
| CA1104028A (en) | Hard surface cleaning compositions | |
| NZ235491A (en) | Non-aqueous detergent containing a dual bleach system of a hypochlorite source and a bromide compound in an organic carrier liquid |