IL34285A - 3-thiadiazolylthio-or tetrazolyl-thio cephalosporins and process for preparing the same - Google Patents
3-thiadiazolylthio-or tetrazolyl-thio cephalosporins and process for preparing the sameInfo
- Publication number
- IL34285A IL34285A IL34285A IL3428570A IL34285A IL 34285 A IL34285 A IL 34285A IL 34285 A IL34285 A IL 34285A IL 3428570 A IL3428570 A IL 3428570A IL 34285 A IL34285 A IL 34285A
- Authority
- IL
- Israel
- Prior art keywords
- methyl
- formula
- cephem
- compound
- acid
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims description 7
- 229940124587 cephalosporin Drugs 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims 3
- 150000001875 compounds Chemical class 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 20
- -1 trifluorbmethyl Chemical group 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000000047 product Substances 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical group [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 8
- 150000002431 hydrogen Chemical group 0.000 claims description 7
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Chemical group 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 238000006073 displacement reaction Methods 0.000 claims description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 5
- PUWQVDWJJCSTLK-SSDOTTSWSA-N (2R)-2-hydroxy-2-phenylacetyl chloride Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)Cl PUWQVDWJJCSTLK-SSDOTTSWSA-N 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 150000003573 thiols Chemical class 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- DGSFZGQIUBBSDK-UHFFFAOYSA-N 2,3-dihydrothiadiazole-5-thiol Chemical compound C1(=CNNS1)S DGSFZGQIUBBSDK-UHFFFAOYSA-N 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 2
- 239000001632 sodium acetate Substances 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 4
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 claims 4
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 claims 2
- ZGUNAGUHMKGQNY-SSDOTTSWSA-N D-alpha-phenylglycine Chemical compound OC(=O)[C@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-SSDOTTSWSA-N 0.000 claims 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims 2
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 claims 1
- 239000012467 final product Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 239000007787 solid Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 5
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 150000001780 cephalosporins Chemical class 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229960002449 glycine Drugs 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 3
- 125000004149 thio group Chemical group *S* 0.000 description 3
- DQLYTFPAEVJTFM-UHFFFAOYSA-N 2-azaniumyl-2-(3-hydroxyphenyl)acetate Chemical compound OC(=O)C(N)C1=CC=CC(O)=C1 DQLYTFPAEVJTFM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229960004275 glycolic acid Drugs 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 150000003536 tetrazoles Chemical group 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- BWSFWXSSALIZAU-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-hydroxyacetic acid Chemical compound OC(=O)C(O)C1=CC=C(Cl)C=C1 BWSFWXSSALIZAU-UHFFFAOYSA-N 0.000 description 1
- ITECRQOOEQWFPE-UHFFFAOYSA-N 2-hydroxy-2-(4-methoxyphenyl)acetic acid Chemical compound COC1=CC=C(C(O)C(O)=O)C=C1 ITECRQOOEQWFPE-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JLAMDELLBBZOOX-UHFFFAOYSA-N 3h-1,3,4-thiadiazole-2-thione Chemical compound SC1=NN=CS1 JLAMDELLBBZOOX-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- KZXIQMSWVSTGQX-UHFFFAOYSA-N SC1=CN=NS1 Chemical compound SC1=CN=NS1 KZXIQMSWVSTGQX-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- SDQUDWYMWXUWPV-UHFFFAOYSA-N m-Hydroxyphenylglycine Natural products OC(=O)CNC1=CC=CC(O)=C1 SDQUDWYMWXUWPV-UHFFFAOYSA-N 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US817556A US3641021A (en) | 1969-04-18 | 1969-04-18 | 3 7-(ring-substituted) cephalosporin compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34285A0 IL34285A0 (en) | 1970-06-17 |
| IL34285A true IL34285A (en) | 1973-10-25 |
Family
ID=25223346
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34285A IL34285A (en) | 1969-04-18 | 1970-04-09 | 3-thiadiazolylthio-or tetrazolyl-thio cephalosporins and process for preparing the same |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3641021A (pt) |
| JP (3) | JPS4945880B1 (pt) |
| BR (1) | BR6915448D0 (pt) |
| CH (1) | CH540293A (pt) |
| CS (2) | CS185600B2 (pt) |
| CY (1) | CY775A (pt) |
| DE (1) | DE2018600C3 (pt) |
| DK (1) | DK132119C (pt) |
| ES (1) | ES378765A1 (pt) |
| FI (1) | FI51201C (pt) |
| FR (1) | FR2042346B1 (pt) |
| GB (1) | GB1283811A (pt) |
| IL (1) | IL34285A (pt) |
| LU (1) | LU60751A1 (pt) |
| MY (1) | MY7500031A (pt) |
| NL (1) | NL165170C (pt) |
| NO (2) | NO138807C (pt) |
| OA (1) | OA03254A (pt) |
| PH (1) | PH11309A (pt) |
| PL (1) | PL80605B1 (pt) |
| SE (2) | SE377127B (pt) |
| SU (1) | SU378014A3 (pt) |
| YU (1) | YU36528B (pt) |
| ZA (1) | ZA702290B (pt) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3932465A (en) * | 1970-07-08 | 1976-01-13 | Ciba-Geigy Corporation | 3-R-methyl-7-amino-ceph-em-4-carboxylic acid compounds |
| JPS4948559B1 (pt) * | 1970-11-10 | 1974-12-21 | ||
| US3855213A (en) * | 1971-02-18 | 1974-12-17 | Smith Kline French Lab | 3-heterocyclic thiomethyl-cephalosporins |
| US3987041A (en) * | 1970-12-17 | 1976-10-19 | Smithkline Corporation | P-hydroxymethylphenylacetamidocephalosporins |
| US3867380A (en) * | 1971-02-18 | 1975-02-18 | Smithkline Corp | 3-Heterocyclic thiomethylcephalosporins |
| AU463529B2 (en) * | 1971-01-18 | 1975-07-31 | Bristol-Myers Company | Cephalosporin derivatives and process fob the preparation thereof |
| IE36221B1 (en) * | 1971-04-21 | 1976-09-15 | Ciba Geigy Ag | Acylamino compounds and a process for their manufacture |
| US3757014A (en) * | 1971-05-07 | 1973-09-04 | Bristol Myers Co | Ts 1,3,4 - oxadiazol-2-yl)thiomethyl)-3-cephem-4-carboxylic acid and sal7-(d-(alpha-amino-alpha-pheyle-acetamido)) - 3-(s-(5-hydroxymethyl - |
| GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
| US3903278A (en) * | 1971-11-04 | 1975-09-02 | Smithkline Corp | Method of combating enterobacter infections |
| CA1076560A (en) * | 1972-06-14 | 1980-04-29 | Smith Kline And French Canada Ltd. | 3-heterocyclic thiomethylcephalosporins |
| US3968226A (en) * | 1972-06-14 | 1976-07-06 | Smithkline Corporation | 3-Heterocyclic thiomethylcephalosporins as antibacterial agents |
| CA999574A (en) * | 1972-06-14 | 1976-11-09 | Smith Kline And French Canada Ltd. | 7-hydroxyhalophenylacetamido-3-h heterocyclicthiomethyl cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3855212A (en) * | 1972-08-04 | 1974-12-17 | Squibb & Sons Inc | Cyanomethylth ioacetylcephalosporins |
| US3957768A (en) * | 1972-11-14 | 1976-05-18 | Smithkline Corporation | 3-heterocyclicthiomethylcephalosporins |
| GB1438872A (en) * | 1972-11-17 | 1976-06-09 | Fujisawa Pharmaceutical Co | 7-beta-aminoacylamino-3-substituted-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| YU36970B (en) * | 1973-02-23 | 1984-08-31 | Lilly Co Eli | Process for obtaining 7-(amino)-acylamido-3-halocephalosporins |
| AR207752A1 (es) * | 1973-03-30 | 1976-10-29 | Fujisawa Pharmaceutical Co | Procedimiento para obtener acidos 7-amino-sustituido-3-tiometilsustituido-3-cefem-4-carboxilicos |
| US4007173A (en) * | 1973-05-07 | 1977-02-08 | Smithkline Corporation | α-amino-α-(ureidophenyl)acetamidocephalosporins |
| AR205537A1 (es) * | 1973-05-10 | 1976-05-14 | Fujisawa Pharmaceutical Co | Procedimiento para la preparacion de derivados de acido 7-substituido fenilglicinamido - 3 - substituido - 3 - cefem - 4 - carboxilicos |
| US3962230A (en) * | 1973-05-11 | 1976-06-08 | Smithkline & French Laboratories, Inc. | P-hydroxymethylphenylacetamidocephalosporins |
| US3879385A (en) * | 1973-05-16 | 1975-04-22 | American Home Prod | 3-(Alpha-trifluoromethylarylacetamido)-1,4-cyclo(1,-carboxyl)alkylenethio)-azetidin-2-one derivatives |
| US4000133A (en) * | 1973-06-06 | 1976-12-28 | Fujisawa Pharmaceutical Co., Ltd. | Substituted 7-styryl-carbonyloxy-acetamido cephalosporanic |
| US3957985A (en) * | 1973-07-05 | 1976-05-18 | Smithkline Corporation | Mandelamidocephalosporins with improved properties |
| US3884914A (en) * | 1973-07-05 | 1975-05-20 | Smithkline Corp | Mandelamidocephalosporins with improved properties |
| US4022895A (en) * | 1973-08-01 | 1977-05-10 | Smithkline Corporation | Substituted phenylglycylcephalosporins |
| US3883520A (en) * | 1973-08-17 | 1975-05-13 | Smithkline Corp | Substituted mercaptoacetamidocephalosporins |
| US3957984A (en) * | 1973-08-17 | 1976-05-18 | Smithkline Corporation | Substituted mercaptoacetamidocephalosporins |
| CH617703A5 (en) * | 1973-12-21 | 1980-06-13 | Glaxo Operations Ltd | Process for the preparation of the syn-isomer or of a mixture of syn- and anti-isomers of novel antibiotically active 7 beta -acylamino-ceph-3-em-4-carboxylic acids |
| DE2407715C2 (de) * | 1974-02-18 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | Cephalosporine, Verfahren zu ihrer Herstellung sowie Arzneimittel |
| US4205166A (en) * | 1974-02-20 | 1980-05-27 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted-3-aminoalkyl-, acylaminoalkyl-, or hydroxyalkyl-substituted heterocyclic thiomethyl-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| US3928592A (en) * | 1974-02-22 | 1975-12-23 | Lilly Co Eli | Antibiotic pharmaceutical compositions |
| JPS5729475B2 (pt) * | 1974-04-11 | 1982-06-23 | ||
| US3956292A (en) * | 1974-04-01 | 1976-05-11 | Eli Lilly And Company | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS |
| US3925368A (en) * | 1974-04-01 | 1975-12-09 | Lilly Co Eli | Acylureido substituted cephalosporins |
| US3985747A (en) * | 1974-05-24 | 1976-10-12 | Bristol-Myers Company | Crystalline sesquihydrate of 7-[D-α-amino-α-(p-hydroxyphenyl)acetamido]-3-(1,2,3-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid |
| GB1476981A (en) * | 1974-06-05 | 1977-06-16 | Bristol Myers Co | Substituted penicillanic acids |
| US3928334A (en) * | 1974-06-06 | 1975-12-23 | Bristol Myers Co | Process for the production of cefamandole |
| JPS612674B2 (pt) * | 1974-06-20 | 1986-01-27 | Meiji Seika Co | |
| US3928337A (en) * | 1974-08-07 | 1975-12-23 | Bristol Myers Co | Process for the production of cefamandole |
| CA1074784A (en) * | 1974-09-06 | 1980-04-01 | Sumitomo Chemical Company | N-ACYLAMINO-.alpha.-ARYLACETAMIDO CEPHALOSPORINS |
| US4088815A (en) * | 1974-09-20 | 1978-05-09 | E. R. Squibb & Sons, Inc. | 3-Heterothio-7-ureido cephalosporins |
| BE833640A (fr) * | 1974-09-20 | 1976-03-19 | Nouvelles cephalosporines et leur preparation | |
| US4018759A (en) * | 1974-12-03 | 1977-04-19 | Smithkline Corporation | 3-Heterocyclicthiomethylcephalosporins |
| US3992377A (en) * | 1974-12-13 | 1976-11-16 | Eli Lilly And Company | 3-Thio-substituted cephalosporin antibiotics |
| SE432254B (sv) * | 1975-02-04 | 1984-03-26 | Fujisawa Pharmaceutical Co | Analogiforfarande for framstellning av 3-substituerade 7-(alfa,alfa-disubstituerade acetamido)-3-cefem-4-karboxylsyror |
| JPS51115493A (en) * | 1975-03-18 | 1976-10-12 | Smithkline Corp | Novel cephalosporine compound |
| US4006138A (en) * | 1975-04-11 | 1977-02-01 | Eli Lilly And Company | Crystalline form of sodium O-formylcefamandole |
| US4107440A (en) * | 1975-12-15 | 1978-08-15 | Smithkline Corporation | Intermediates for preparing substituted phenylglycylcephalosporins |
| US4054738A (en) * | 1975-12-22 | 1977-10-18 | Eli Lilly And Company | Sodium cefamandole crystalline forms |
| US4127716A (en) * | 1976-03-08 | 1978-11-28 | E. R. Squibb & Sons, Inc. | 3-heterothiomethyl ureido cephalosporins |
| US4035361A (en) * | 1976-03-17 | 1977-07-12 | Eli Lilly And Company | Bis-trimethylsilyl cefamandole and process therefor |
| US4063019A (en) | 1976-03-30 | 1977-12-13 | E. R. Squibb & Sons, Inc. | [[[(2,4-Dioxo-1-imidazolidinyl)amino]carbonyl]amino]-acetylcephalosporin derivatives |
| US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| US4112228A (en) * | 1976-07-13 | 1978-09-05 | Bristol-Myers Company | 7-(D-α-Hydroxy-2-arylacetamido)-3-(2-carboxyalkyl-2,3-dihydro-s-triazolo-[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids and derivatives |
| JPS5321191A (en) * | 1976-08-10 | 1978-02-27 | Shionogi & Co Ltd | 7-arylmalonamidocephem derivatives |
| US4144391A (en) * | 1977-03-07 | 1979-03-13 | Eli Lilly And Company | Cephalosporin displacement reaction |
| AT366696B (de) * | 1977-03-07 | 1982-04-26 | Lilly Co Eli | Verfahren zur herstellung von 3-(thiomethyl)cephalosporinen |
| US4115644A (en) * | 1977-09-19 | 1978-09-19 | Eli Lilly And Company | Process for preparing pure cefamandole from alkali metal and ammonium salts thereof |
| AR223653A1 (es) * | 1977-09-27 | 1981-09-15 | Toyama Chemical Co Ltd | Procedimiento de preparacion del acido 7-(d(-)-alpha-(4-etil-2,3-dioxo-1-piperazinocarboxamido)-alpha-(4-hidroxifenil)acetamido)-3-(5-(1-metil-1,2,3,4-tetrazolil)tiometil)-delta3-cefem-4-carboxilico y su producto de adicion con n,n-dimetilacetamida |
| US4168376A (en) * | 1978-06-05 | 1979-09-18 | Eli Lilly And Company | Process for crystalline sodium cefamandole |
| US4223135A (en) * | 1979-03-19 | 1980-09-16 | Bristol-Myers Company | Production of cephalosporins |
| US4316017A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| US4316016A (en) * | 1979-03-19 | 1982-02-16 | Bristol-Myers Company | Cephalosporin intermediates |
| JPS55139387A (en) * | 1979-04-19 | 1980-10-31 | Yamanouchi Pharmaceut Co Ltd | Novel synthetic method of 7-amino-3-heterocyclic thiomethyl-delta3-carboxylic acids |
| DE3173499D1 (en) * | 1980-09-02 | 1986-02-27 | Asahi Chemical Ind | Novel thioesters and process for the preparation of the same |
| JPS5988490A (ja) * | 1982-11-10 | 1984-05-22 | Kyoto Yakuhin Kogyo Kk | セフアロスポリン誘導体 |
| US4737492A (en) * | 1986-12-31 | 1988-04-12 | Alcon Laboratories, Inc. | Sparingly soluble salts of cefamandole, and ophthalmic compositions containing same |
| JPH0354585U (pt) * | 1989-09-29 | 1991-05-27 | ||
| US5318781A (en) * | 1993-04-06 | 1994-06-07 | Hoffmann-La Roche Inc. | Absorption enhancement of antibiotics |
| FR2876379B1 (fr) * | 2004-10-08 | 2008-09-05 | Isochem Sa | Procede de polymerisation des o-carboxy anhydrides |
| WO2013057196A1 (en) | 2011-10-20 | 2013-04-25 | Dsm Sinochem Pharmaceuticals Netherlands B.V. | Process for the preparation of cefamandole nafate |
| WO2013057197A1 (en) | 2011-10-20 | 2013-04-25 | Dsm Sinochem Pharmaceuticals Netherlands B.V. | Process for the formylation of cefamandole |
| CN104193767B (zh) * | 2014-08-07 | 2016-07-06 | 杭州长典医药科技有限公司 | 一种头孢孟多酯钠超细粉体制剂及其制备方法 |
-
1969
- 1969-04-18 US US817556A patent/US3641021A/en not_active Expired - Lifetime
- 1969-12-19 BR BR215448/69A patent/BR6915448D0/pt unknown
-
1970
- 1970-04-07 ZA ZA702290A patent/ZA702290B/xx unknown
- 1970-04-09 IL IL34285A patent/IL34285A/en unknown
- 1970-04-16 YU YU00996/70A patent/YU36528B/xx unknown
- 1970-04-16 SE SE7005262A patent/SE377127B/xx unknown
- 1970-04-16 OA OA53902A patent/OA03254A/xx unknown
- 1970-04-16 NL NL7005519.A patent/NL165170C/xx not_active IP Right Cessation
- 1970-04-17 FI FI701073A patent/FI51201C/fi active
- 1970-04-17 LU LU60751D patent/LU60751A1/xx unknown
- 1970-04-17 DK DK194570A patent/DK132119C/da not_active IP Right Cessation
- 1970-04-17 PL PL1970140112A patent/PL80605B1/pl unknown
- 1970-04-17 ES ES378765A patent/ES378765A1/es not_active Expired
- 1970-04-17 CS CS7700000098A patent/CS185600B2/cs unknown
- 1970-04-17 FR FR7014065A patent/FR2042346B1/fr not_active Expired
- 1970-04-17 GB GB08471/70A patent/GB1283811A/en not_active Expired
- 1970-04-17 DE DE2018600A patent/DE2018600C3/de not_active Expired
- 1970-04-17 NO NO701471A patent/NO138807C/no unknown
- 1970-04-17 CH CH577970A patent/CH540293A/de not_active IP Right Cessation
- 1970-04-17 SU SU1427782A patent/SU378014A3/ru active
- 1970-04-17 CS CS7000002637A patent/CS185558B2/cs unknown
- 1970-04-17 CY CY775*UA patent/CY775A/xx unknown
- 1970-04-18 JP JP45033392A patent/JPS4945880B1/ja active Pending
-
1973
- 1973-02-19 SE SE7302268A patent/SE405251B/xx unknown
- 1973-08-03 JP JP48087421A patent/JPS5231356B1/ja active Pending
-
1975
- 1975-01-31 JP JP1328275A patent/JPS5537997B1/ja active Pending
- 1975-11-24 PH PH17793A patent/PH11309A/en unknown
- 1975-12-30 MY MY31/75A patent/MY7500031A/xx unknown
-
1978
- 1978-04-14 NO NO781312A patent/NO781312L/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL34285A (en) | 3-thiadiazolylthio-or tetrazolyl-thio cephalosporins and process for preparing the same | |
| KR840000866B1 (ko) | 세팔로스포린 용매화물의 제조방법 | |
| SU1105116A3 (ru) | Способ получени производных 3-замещенных тиометилцефалоспоринов или их этиловых или дифенилметиловых эфиров или их солей | |
| US3932393A (en) | 3-Methylenecephalosporins and process for production thereof | |
| US3925368A (en) | Acylureido substituted cephalosporins | |
| US4147863A (en) | 7-D-(-)-mandelamido-3-(1-methyl-1H-tetrazol-5-yl)vinyl-3-cephem-4-carboxylic acid | |
| JPS6360992A (ja) | ３−置換７−アミノチアゾリルアセトアミドセフアロスポラン酸の新規なオキシム誘導体 | |
| US3897424A (en) | Process for 7-{62 -amino-7-{60 -methoxy-cephalosporanic acid esters and related compounds | |
| JP3547141B2 (ja) | 精製方法 | |
| GB2178032A (en) | Cephalosporanic acid derivatives | |
| US4558123A (en) | 3-Exomethylene cephalosporins | |
| US3644347A (en) | 3-aminomethyl cephalosporin compounds | |
| KR870000327B1 (ko) | 결정성 7-(r)-아미노-3-(1-피리디늄메틸)-세프-3-엠-4-카복실레이트 일염산염 일수화물의 제조방법 | |
| JPH0134227B2 (pt) | ||
| US3928333A (en) | Process for the preparation of 3 cephalosporin esters | |
| US4959495A (en) | Process for the preparation of intermediates used to produce aminothiazoloximino cephalosporins | |
| US4115646A (en) | Process for preparing 7-aminocephalosporanic acid derivatives | |
| US4008228A (en) | Process for preparing 3-methyl-3-cephem antibiotics | |
| KR870000526B1 (ko) | 아제티디논 설핀산의 제조방법 | |
| EP0115820B1 (en) | Cephalosporin derivatives and process for their preparation | |
| EP0186586A2 (en) | Cephem compounds and the production thereof | |
| KR830001970B1 (ko) | 세파로스포린 유도체의 제조방법 | |
| JPS6034957A (ja) | ２−置換メチレン−２−（２−アミノチアゾ−ル−４−イル）酢酸誘導体及びその製造方法 | |
| SU543353A3 (ru) | Способ получени производных 7-монохлорацетамидо-3-дезацетоксицефалоспорановой кислоты | |
| US5066799A (en) | Intermediates for the preparation of aminothiazoloximino cephalosporins |