IL33507A - 4-halophenyl-1-phenoxypropyl-3,6-dihydro-1(2h)-pyridine derivatives,their preparation and pharmaceutical compositions containing them - Google Patents
4-halophenyl-1-phenoxypropyl-3,6-dihydro-1(2h)-pyridine derivatives,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL33507A IL33507A IL33507A IL3350769A IL33507A IL 33507 A IL33507 A IL 33507A IL 33507 A IL33507 A IL 33507A IL 3350769 A IL3350769 A IL 3350769A IL 33507 A IL33507 A IL 33507A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- phenyl
- propoxy
- fluoro
- hydroxy
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 19
- 239000008194 pharmaceutical composition Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 43
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 36
- -1 hydroxymethylene Chemical group 0.000 claims description 34
- 239000000203 mixture Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000008378 aryl ethers Chemical class 0.000 claims description 7
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 239000013543 active substance Substances 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 3
- 230000003285 pharmacodynamic effect Effects 0.000 claims 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 3
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 claims 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 102
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 99
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 87
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 65
- 238000006243 chemical reaction Methods 0.000 description 41
- 238000002844 melting Methods 0.000 description 37
- 230000008018 melting Effects 0.000 description 37
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 229960001413 acetanilide Drugs 0.000 description 31
- 239000000155 melt Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 238000001953 recrystallisation Methods 0.000 description 16
- 238000010992 reflux Methods 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 235000011121 sodium hydroxide Nutrition 0.000 description 12
- 230000001476 alcoholic effect Effects 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 101100139845 Caenorhabditis elegans rac-2 gene Proteins 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- 150000002118 epoxides Chemical class 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 4
- CMYUBMYHBILZFL-UHFFFAOYSA-N N-[2-(oxiran-2-ylmethoxy)phenyl]propanamide Chemical compound O1C(COC2=C(NC(CC)=O)C=CC=C2)C1 CMYUBMYHBILZFL-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000000954 anitussive effect Effects 0.000 description 4
- 230000003266 anti-allergic effect Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- LZAYOZUFUAMFLD-UHFFFAOYSA-N 4-(4-chlorophenyl)-4-hydroxypiperidine Chemical compound C=1C=C(Cl)C=CC=1C1(O)CCNCC1 LZAYOZUFUAMFLD-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229940124584 antitussives Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- MVXXCFMHLWEWHY-UHFFFAOYSA-N 4-(4-fluorophenyl)-1,2,3,6-tetrahydropyridine Chemical compound C1=CC(F)=CC=C1C1=CCNCC1 MVXXCFMHLWEWHY-UHFFFAOYSA-N 0.000 description 2
- QXWRXWPNHLIZBV-UHFFFAOYSA-N 4-(4-fluorophenyl)piperidin-4-ol Chemical compound C=1C=C(F)C=CC=1C1(O)CCNCC1 QXWRXWPNHLIZBV-UHFFFAOYSA-N 0.000 description 2
- KQGBLRILCYSUFE-UHFFFAOYSA-N 4-(oxiran-2-ylmethoxy)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1OCC1OC1 KQGBLRILCYSUFE-UHFFFAOYSA-N 0.000 description 2
- QXSAKPUBHTZHKW-UHFFFAOYSA-N 4-hydroxybenzamide Chemical compound NC(=O)C1=CC=C(O)C=C1 QXSAKPUBHTZHKW-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- TWBPSSLBUVRVTR-UHFFFAOYSA-N N-[4-(oxiran-2-ylmethoxy)phenyl]benzamide Chemical compound O1C(COC2=CC=C(NC(C3=CC=CC=C3)=O)C=C2)C1 TWBPSSLBUVRVTR-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 230000001741 anti-phlogistic effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- RUGBMQVCMWSXJP-UHFFFAOYSA-N n-[3-(oxiran-2-ylmethoxy)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(OCC2OC2)=C1 RUGBMQVCMWSXJP-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000003586 protic polar solvent Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- FPIGOBKNDYAZTP-UHFFFAOYSA-N 1,2-epoxy-3-(4-nitrophenoxy)propane Chemical compound C1=CC([N+](=O)[O-])=CC=C1OCC1OC1 FPIGOBKNDYAZTP-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- RWFFKXYEGHJTLS-UHFFFAOYSA-N 2-(oxiran-2-ylmethoxy)-n-phenylacetamide Chemical compound C=1C=CC=CC=1NC(=O)COCC1CO1 RWFFKXYEGHJTLS-UHFFFAOYSA-N 0.000 description 1
- MIMIAWUVJMSJEJ-UHFFFAOYSA-N 2-(oxiran-2-ylmethoxy)benzamide Chemical compound NC(=O)C1=CC=CC=C1OCC1OC1 MIMIAWUVJMSJEJ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- AFYALJSDFPSAAZ-UHFFFAOYSA-N 4-(4-fluorophenyl)piperidine Chemical compound C1=CC(F)=CC=C1C1CCNCC1 AFYALJSDFPSAAZ-UHFFFAOYSA-N 0.000 description 1
- RMHMYTLAUXIOPR-UHFFFAOYSA-N 4-hydroxy-n-phenylbenzamide Chemical compound C1=CC(O)=CC=C1C(=O)NC1=CC=CC=C1 RMHMYTLAUXIOPR-UHFFFAOYSA-N 0.000 description 1
- RKNSEUIPTUHGHN-UHFFFAOYSA-N 4-phenyl-1,2,3,4-tetrahydropyridine Chemical compound C1=CNCCC1C1=CC=CC=C1 RKNSEUIPTUHGHN-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical group [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000350158 Prioria balsamifera Species 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical class CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005011 alkyl ether group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000002021 butanolic extract Substances 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- FZERHIULMFGESH-UHFFFAOYSA-N methylenecarboxanilide Natural products CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- VIPCILFKUBQRCQ-UHFFFAOYSA-N n-(2-hydroxyphenyl)propanamide Chemical compound CCC(=O)NC1=CC=CC=C1O VIPCILFKUBQRCQ-UHFFFAOYSA-N 0.000 description 1
- SSMYTAQHMUHRSK-UHFFFAOYSA-N n-(4-hydroxyphenyl)propanamide Chemical compound CCC(=O)NC1=CC=C(O)C=C1 SSMYTAQHMUHRSK-UHFFFAOYSA-N 0.000 description 1
- AYEQJLOHMLYKAV-UHFFFAOYSA-N n-(4-sulfanylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S)C=C1 AYEQJLOHMLYKAV-UHFFFAOYSA-N 0.000 description 1
- HGDAFIJKXCFHPG-UHFFFAOYSA-N n-(5-chloro-2-hydroxyphenyl)acetamide Chemical compound CC(=O)NC1=CC(Cl)=CC=C1O HGDAFIJKXCFHPG-UHFFFAOYSA-N 0.000 description 1
- SENIMHNFLVMDJV-UHFFFAOYSA-N n-[2-(oxiran-2-ylmethoxy)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1OCC1OC1 SENIMHNFLVMDJV-UHFFFAOYSA-N 0.000 description 1
- GYQVTCSDOJTHEB-UHFFFAOYSA-N n-[4-(3-bromopropoxy)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(OCCCBr)C=C1 GYQVTCSDOJTHEB-UHFFFAOYSA-N 0.000 description 1
- CSGKNGNFQNCWGL-UHFFFAOYSA-N n-[4-(3-bromopropylsulfanyl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(SCCCBr)C=C1 CSGKNGNFQNCWGL-UHFFFAOYSA-N 0.000 description 1
- VNMUIOBUKDSTAC-UHFFFAOYSA-N n-[4-(3-chloro-2-hydroxypropoxy)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(OCC(O)CCl)C=C1 VNMUIOBUKDSTAC-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000004894 pentylamino group Chemical group C(CCCC)N* 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/34—Compounds containing oxirane rings with hydrocarbon radicals, substituted by sulphur, selenium or tellurium atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Nozzles (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1926868A CH543508A (de) | 1968-12-24 | 1968-12-24 | Verfahren zur Herstellung von aromatischen Äthern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL33507A0 IL33507A0 (en) | 1970-02-19 |
| IL33507A true IL33507A (en) | 1973-11-28 |
Family
ID=4438412
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL33507A IL33507A (en) | 1968-12-24 | 1969-12-09 | 4-halophenyl-1-phenoxypropyl-3,6-dihydro-1(2h)-pyridine derivatives,their preparation and pharmaceutical compositions containing them |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US3674799A (enExample) |
| JP (1) | JPS4931991B1 (enExample) |
| AT (2) | AT295536B (enExample) |
| BE (1) | BE743493A (enExample) |
| BR (1) | BR6915344D0 (enExample) |
| CA (1) | CA969963A (enExample) |
| CH (5) | CH507239A (enExample) |
| DE (1) | DE1964421A1 (enExample) |
| DK (1) | DK133335B (enExample) |
| ES (1) | ES374837A1 (enExample) |
| FI (1) | FI52338C (enExample) |
| FR (1) | FR2027037B1 (enExample) |
| GB (1) | GB1264564A (enExample) |
| IE (2) | IE33890B1 (enExample) |
| IL (1) | IL33507A (enExample) |
| NL (1) | NL6919281A (enExample) |
| NO (1) | NO132196C (enExample) |
| PH (1) | PH9402A (enExample) |
| SE (1) | SE357363B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3960873A (en) * | 1970-05-20 | 1976-06-01 | Sumitomo Chemical Co., Ltd. | 1-Phenylthiopropyl-4-hydroxy-4-phenyl piperidines |
| CH558354A (de) * | 1970-06-17 | 1975-01-31 | Hoffmann La Roche | Verfahren zur herstellung von aromatischen aethern. |
| US3951987A (en) * | 1970-06-19 | 1976-04-20 | Hoffmann-La Roche Inc. | Tetrahydropyridine derivatives |
| US3927006A (en) * | 1970-06-19 | 1975-12-16 | Hoffmann La Roche | Tetrahydropyridine derivatives |
| CH547802A (de) * | 1970-06-19 | 1974-04-11 | Hoffmann La Roche | Verfahren zur herstellung von tetrahydropyridinderivaten. |
| US3879405A (en) * | 1970-06-19 | 1975-04-22 | Hoffmann La Roche | Tetrahydropyridine derivatives |
| SE397088B (sv) * | 1972-06-17 | 1977-10-17 | Sumitomo Chemical Co | Forfarande for framstellning av nya 2-propanolderivat |
| JPS4985074A (enExample) * | 1972-12-22 | 1974-08-15 | ||
| JPS5835195B2 (ja) * | 1974-05-09 | 1983-08-01 | 住友化学工業株式会社 | シンキナフエノキシプロピルアミンユウドウタイノセイホウ |
| US4069221A (en) * | 1975-06-09 | 1978-01-17 | G. D. Searle & Co. | 1-(1-Naphthoxy)-3-(4-substituted-piperidino)-2-propanols |
| DE2632040C2 (de) * | 1976-07-16 | 1983-12-29 | Mengeringhausen, Max, Dipl.-Ing. Dr.-Ing., 8700 Würzburg | Verfahren zur Herstellung einer Verbundbauplatte |
| DE3635350A1 (de) * | 1985-10-17 | 1987-06-25 | Kuepper Geb Kaufmann Inge | Aus platten gebildetes bauelement |
| US5364867A (en) * | 1992-11-30 | 1994-11-15 | Sterling Winthrop Inc. | 4-phenylpiperdine agents for treating cns disorders |
| US5698565A (en) * | 1995-06-09 | 1997-12-16 | Hoffmann-La Roche Inc. | Use of phenoxy-pyridine derivatives |
| PT885004E (pt) * | 1996-03-08 | 2002-08-30 | Hoffmann La Roche | Utilizacao de derivados de 4-fenil-3,6-di-hidro-2h-piridilo como bloqueadores dos subtipos dos receptores nmda |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB856587A (en) * | 1956-04-02 | 1960-12-21 | Sterling Drug Inc | Substituted piperidines |
| US3816434A (en) * | 1966-06-24 | 1974-06-11 | Hoffmann La Roche | 4-(3-(4-phenyl-piperidino)-2-hydroxy-propoxy)-benzophenones |
-
1968
- 1968-12-24 CH CH239671A patent/CH507239A/de not_active IP Right Cessation
- 1968-12-24 CH CH239571A patent/CH506525A/de not_active IP Right Cessation
- 1968-12-24 CH CH239471A patent/CH543509A/de not_active IP Right Cessation
- 1968-12-24 CH CH1926868A patent/CH543508A/de not_active IP Right Cessation
- 1968-12-24 CH CH239771A patent/CH507240A/de not_active IP Right Cessation
-
1969
- 1969-12-04 US US882298A patent/US3674799A/en not_active Expired - Lifetime
- 1969-12-09 IL IL33507A patent/IL33507A/en unknown
- 1969-12-10 CA CA069,470A patent/CA969963A/en not_active Expired
- 1969-12-16 GB GB1264564D patent/GB1264564A/en not_active Expired
- 1969-12-18 PH PH10993*UA patent/PH9402A/en unknown
- 1969-12-19 BR BR215344/69A patent/BR6915344D0/pt unknown
- 1969-12-22 IE IE1695/69A patent/IE33890B1/xx unknown
- 1969-12-22 DK DK680669AA patent/DK133335B/da unknown
- 1969-12-22 BE BE743493D patent/BE743493A/xx unknown
- 1969-12-22 IE IE1694/69A patent/IE33981B1/xx unknown
- 1969-12-22 FI FI693714A patent/FI52338C/fi active
- 1969-12-23 DE DE19691964421 patent/DE1964421A1/de active Pending
- 1969-12-23 NO NO695110A patent/NO132196C/no unknown
- 1969-12-23 ES ES374837A patent/ES374837A1/es not_active Expired
- 1969-12-23 SE SE17877/69A patent/SE357363B/xx unknown
- 1969-12-23 NL NL6919281A patent/NL6919281A/xx not_active Application Discontinuation
- 1969-12-23 AT AT192071A patent/AT295536B/de not_active IP Right Cessation
- 1969-12-23 FR FR6944583A patent/FR2027037B1/fr not_active Expired
- 1969-12-23 AT AT1199369A patent/AT295534B/de not_active IP Right Cessation
- 1969-12-24 JP JP44104209A patent/JPS4931991B1/ja active Pending
-
1973
- 1973-10-03 US US403133A patent/US3859294A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2027037A1 (enExample) | 1970-09-25 |
| BR6915344D0 (pt) | 1973-01-25 |
| FR2027037B1 (enExample) | 1973-12-21 |
| IE33890B1 (en) | 1974-11-27 |
| PH9402A (en) | 1975-11-03 |
| DK133335B (da) | 1976-05-03 |
| BE743493A (enExample) | 1970-06-22 |
| SE357363B (enExample) | 1973-06-25 |
| AT295536B (de) | 1972-01-10 |
| NL6919281A (enExample) | 1970-06-26 |
| CH507239A (de) | 1971-05-15 |
| DE1964421A1 (de) | 1970-07-16 |
| CA969963A (en) | 1975-06-24 |
| ES374837A1 (es) | 1972-02-01 |
| IL33507A0 (en) | 1970-02-19 |
| AT295534B (de) | 1972-01-10 |
| IE33890L (en) | 1970-06-24 |
| CH507240A (de) | 1971-05-15 |
| US3859294A (en) | 1975-01-07 |
| GB1264564A (enExample) | 1972-02-23 |
| CH543509A (de) | 1973-10-31 |
| CH506525A (de) | 1971-04-30 |
| FI52338C (fi) | 1977-08-10 |
| DK133335C (enExample) | 1976-10-04 |
| NO132196B (enExample) | 1975-06-23 |
| IE33981B1 (en) | 1974-12-30 |
| CH543508A (de) | 1973-10-31 |
| US3674799A (en) | 1972-07-04 |
| JPS4931991B1 (enExample) | 1974-08-27 |
| IE33981L (en) | 1970-06-24 |
| FI52338B (enExample) | 1977-05-02 |
| NO132196C (enExample) | 1975-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4289772A (en) | 1-Piperidinophthalazines as cardiac stimulants | |
| US3907810A (en) | 1-Imidazolylalkylene-piperidines | |
| IL33507A (en) | 4-halophenyl-1-phenoxypropyl-3,6-dihydro-1(2h)-pyridine derivatives,their preparation and pharmaceutical compositions containing them | |
| EP0040639B1 (en) | Isoxazole derivatives | |
| US4680296A (en) | Piperidine derivatives and pharmaceutical compositions containing them | |
| US5411972A (en) | Arylamide derivatives for treating hyperlipemia | |
| AU593844B2 (en) | N-substituted diphenylpiperidines | |
| KR900005022B1 (ko) | 1-(아미노알킬)-α, α-디아릴 피롤리딘-, 피페리딘- 및 호모피페리딘-아세트아미드 및 아세토니트릴, 및 이의 제조방법 | |
| NO803453L (no) | Fremgangsmaate ved fremstilling av piperidylbenzimidazolonderivater | |
| CS228106B2 (en) | Production of novel derivatives of 3-/4-phenoxymethylpiperidino/-propanol | |
| CA1086742A (en) | Preparation of 1-substituted-4-aroyl-4-hydroxy and -4- acyloxypiperidines | |
| US4329467A (en) | Phenyl-quinolizidines | |
| US3621027A (en) | 1-aminoalkyl-2,6-diaryl 4,5,6,7 tetrahydro-4-oxindales | |
| US3840529A (en) | 1-(1-(3-substituted-1-propenyl)-4-piperidyl)-2-oxobenzimidazolines | |
| US4442102A (en) | 1,5-Diphenylpyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing same | |
| US4080500A (en) | 4-Tertiary-amino-2,6-diaminopyridine 1-oxides | |
| US3542807A (en) | 1-(omega-benzoylalkyl)-3-substituted pyrrolidines | |
| US4448777A (en) | 1-Phenylindazole-3-one compounds, process and intermediates for their preparation, and pharmaceutical compositions containing same | |
| US3862158A (en) | Piperidine ethers | |
| US5045550A (en) | Substituted tetrahydropyridines as central nervous system agents | |
| NO121212B (enExample) | ||
| US3790583A (en) | Certain (3-(4-phenyl)-1-(2h) 3,6-dihydropyridyl)-propyl(thio)-anilides,sulfonamido anilides,anilines and derivatives thereof | |
| US4232160A (en) | Isoquinoline propionamides exhibiting analgesic properties | |
| US4076821A (en) | 4,4-Diphenylcycloalkylpiperidines and psychotropic compositions thereof | |
| US3758483A (en) | Tetrahydropyridine derivatives |