IL32213A - Substituted guanidines - Google Patents
Substituted guanidinesInfo
- Publication number
- IL32213A IL32213A IL32213A IL3221369A IL32213A IL 32213 A IL32213 A IL 32213A IL 32213 A IL32213 A IL 32213A IL 3221369 A IL3221369 A IL 3221369A IL 32213 A IL32213 A IL 32213A
- Authority
- IL
- Israel
- Prior art keywords
- guanidine
- bis
- compound
- hydrochloride
- ethanol
- Prior art date
Links
- 150000002357 guanidines Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 13
- 241001465754 Metazoa Species 0.000 claims description 10
- 229960000789 guanidine hydrochloride Drugs 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 208000003495 Coccidiosis Diseases 0.000 claims description 5
- 206010023076 Isosporiasis Diseases 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 208000015181 infectious disease Diseases 0.000 claims description 2
- 208000010362 Protozoan Infections Diseases 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 71
- 239000000243 solution Substances 0.000 description 28
- 238000002360 preparation method Methods 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 18
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 17
- -1 1,3-bis ( -cyanobenzylideneamino)guanidine nitrate Chemical compound 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 11
- 229960004198 guanidine Drugs 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 9
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 241000287828 Gallus gallus Species 0.000 description 8
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- BVGPZRCQJJMXBI-UHFFFAOYSA-N 1,2-diaminoguanidine;nitric acid Chemical compound O[N+]([O-])=O.NN\C(N)=N/N BVGPZRCQJJMXBI-UHFFFAOYSA-N 0.000 description 5
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 description 5
- 229910017604 nitric acid Inorganic materials 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 4
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 235000013330 chicken meat Nutrition 0.000 description 4
- 235000005822 corn Nutrition 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 229940050176 methyl chloride Drugs 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- SCIZLHIMZCLSND-UHFFFAOYSA-N diamino(carbamimidoyl)azanium;chloride Chemical compound Cl.NN(N)C(N)=N SCIZLHIMZCLSND-UHFFFAOYSA-N 0.000 description 3
- 235000005911 diet Nutrition 0.000 description 3
- 230000037213 diet Effects 0.000 description 3
- 150000007857 hydrazones Chemical class 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 238000011081 inoculation Methods 0.000 description 3
- 235000012054 meals Nutrition 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 210000003250 oocyst Anatomy 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 2
- LTWIBTYLSRDGHP-UHFFFAOYSA-N 1,2-bis[(4-chlorophenyl)methylideneamino]guanidine;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1C=NNC(=N)NN=CC1=CC=C(Cl)C=C1 LTWIBTYLSRDGHP-UHFFFAOYSA-N 0.000 description 2
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 2
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 2
- 241000271566 Aves Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 241000223924 Eimeria Species 0.000 description 2
- 241000223932 Eimeria tenella Species 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 208000021017 Weight Gain Diseases 0.000 description 2
- ADSXHTNGGZYNKA-UHFFFAOYSA-N [(e)-[amino(methylsulfanyl)methylidene]amino]azanium;chloride Chemical compound Cl.CSC(=N)NN ADSXHTNGGZYNKA-UHFFFAOYSA-N 0.000 description 2
- 230000001165 anti-coccidial effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- VQNVZLDDLJBKNS-UHFFFAOYSA-N carbamimidoylazanium;bromide Chemical compound Br.NC(N)=N VQNVZLDDLJBKNS-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000003224 coccidiostatic agent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- XIWZUMMBBRRJGP-UHFFFAOYSA-N ethyl n'-aminocarbamimidothioate;hydroiodide Chemical compound I.CCSC(=N)NN XIWZUMMBBRRJGP-UHFFFAOYSA-N 0.000 description 2
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- WQUPOMUBXOPGSN-UHFFFAOYSA-N methyl n'-aminocarbamimidothioate Chemical compound CSC(N)=NN WQUPOMUBXOPGSN-UHFFFAOYSA-N 0.000 description 2
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 2
- 244000144977 poultry Species 0.000 description 2
- 235000013594 poultry meat Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- OQXROOQXEFQTPM-UHFFFAOYSA-N propyl n'-aminocarbamimidothioate;hydrobromide Chemical compound Br.CCCSC(=N)NN OQXROOQXEFQTPM-UHFFFAOYSA-N 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 235000012424 soybean oil Nutrition 0.000 description 2
- 239000003549 soybean oil Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000004584 weight gain Effects 0.000 description 2
- 235000019786 weight gain Nutrition 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- LJABNWZBAGZTEQ-UHFFFAOYSA-N 1,2-bis[(4-bromophenyl)methylideneamino]guanidine;nitric acid Chemical compound O[N+]([O-])=O.C=1C=C(Br)C=CC=1C=NN=C(N)NN=CC1=CC=C(Br)C=C1 LJABNWZBAGZTEQ-UHFFFAOYSA-N 0.000 description 1
- CGDZXOHAXDLFIW-UHFFFAOYSA-N 1,2-diamino-1-methylguanidine;hydrobromide Chemical compound Br.CN(N)C(=N)NN CGDZXOHAXDLFIW-UHFFFAOYSA-N 0.000 description 1
- HAZRIBSLCUYMQP-UHFFFAOYSA-N 1,2-diaminoguanidine;hydron;chloride Chemical compound Cl.NN\C(N)=N/N HAZRIBSLCUYMQP-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical class CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- UYZKWRHTYCCDMP-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylideneamino]guanidine Chemical compound NC(N)=NN=CC1=CC=C(Cl)C=C1 UYZKWRHTYCCDMP-UHFFFAOYSA-N 0.000 description 1
- PZOZWNDIDLORJG-UHFFFAOYSA-N 2-amino-1-[(4-chlorophenyl)methylideneamino]guanidine Chemical compound NNC(=N)NN=CC1=CC=C(Cl)C=C1 PZOZWNDIDLORJG-UHFFFAOYSA-N 0.000 description 1
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 1
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical group FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 1
- NIEBHDXUIJSHSL-UHFFFAOYSA-N 4-iodobenzaldehyde Chemical group IC1=CC=C(C=O)C=C1 NIEBHDXUIJSHSL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 208000026803 Animal Parasitic disease Diseases 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000273930 Brevoortia tyrannus Species 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- 235000019743 Choline chloride Nutrition 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- 241000224483 Coccidia Species 0.000 description 1
- AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- FVIGODVHAVLZOO-UHFFFAOYSA-N Dixanthogen Chemical compound CCOC(=S)SSC(=S)OCC FVIGODVHAVLZOO-UHFFFAOYSA-N 0.000 description 1
- 241000223931 Eimeria acervulina Species 0.000 description 1
- 241000499566 Eimeria brunetti Species 0.000 description 1
- 241000223934 Eimeria maxima Species 0.000 description 1
- 241000530449 Eimeria mivati Species 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- 241000219823 Medicago Species 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- 206010037075 Protozoal infections Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- QYSXJUFSXHHAJI-XFEUOLMDSA-N Vitamin D3 Natural products C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C/C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-XFEUOLMDSA-N 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 235000019742 Vitamins premix Nutrition 0.000 description 1
- 206010047897 Weight gain poor Diseases 0.000 description 1
- FABQYDLGFZXBIK-VZUCSPMQSA-N [(e)-(4-chlorophenyl)methylideneamino]thiourea Chemical compound NC(=S)N\N=C\C1=CC=C(Cl)C=C1 FABQYDLGFZXBIK-VZUCSPMQSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 229940124536 anticoccidial agent Drugs 0.000 description 1
- 239000003430 antimalarial agent Substances 0.000 description 1
- 239000003904 antiprotozoal agent Substances 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- XKLVLDXNZDIDKQ-UHFFFAOYSA-N butylhydrazine Chemical compound CCCCNN XKLVLDXNZDIDKQ-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- UUDRLGYROXTISK-UHFFFAOYSA-N carbamimidoylazanium;iodide Chemical compound I.NC(N)=N UUDRLGYROXTISK-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 1
- 229960003178 choline chloride Drugs 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000020940 control diet Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical class COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 231100000676 disease causative agent Toxicity 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- JIMBSYFWVPLTMK-UHFFFAOYSA-N ethyl n'-[(4-cyanophenyl)methylideneamino]carbamimidothioate;hydroiodide Chemical compound I.CCSC(=N)NN=CC1=CC=C(C#N)C=C1 JIMBSYFWVPLTMK-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 235000019152 folic acid Nutrition 0.000 description 1
- 239000011724 folic acid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- 244000144993 groups of animals Species 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical class CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940080839 methionine 500 mg Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 238000003359 percent control normalization Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000019192 riboflavin Nutrition 0.000 description 1
- 229960002477 riboflavin Drugs 0.000 description 1
- 239000002151 riboflavin Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 235000000891 standard diet Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- QYSXJUFSXHHAJI-YRZJJWOYSA-N vitamin D3 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C\C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-YRZJJWOYSA-N 0.000 description 1
- 235000005282 vitamin D3 Nutrition 0.000 description 1
- 239000011647 vitamin D3 Substances 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- 229940021056 vitamin d3 Drugs 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
- C07C281/16—Compounds containing any of the groups, e.g. aminoguanidine
- C07C281/18—Compounds containing any of the groups, e.g. aminoguanidine the other nitrogen atom being further doubly-bound to a carbon atom, e.g. guanylhydrazones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US74124768A | 1968-07-01 | 1968-07-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL32213A0 IL32213A0 (en) | 1969-07-30 |
| IL32213A true IL32213A (en) | 1972-12-29 |
Family
ID=24979938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL32213A IL32213A (en) | 1968-07-01 | 1969-05-12 | Substituted guanidines |
Country Status (21)
| Country | Link |
|---|---|
| JP (2) | JPS5324411B1 (OSRAM) |
| AT (1) | AT297015B (OSRAM) |
| BE (1) | BE735375A (OSRAM) |
| BR (1) | BR6910272D0 (OSRAM) |
| CA (1) | CA927394A (OSRAM) |
| CH (1) | CH562209A5 (OSRAM) |
| CS (1) | CS170139B2 (OSRAM) |
| DE (1) | DE1933112C3 (OSRAM) |
| DK (1) | DK129448B (OSRAM) |
| ES (1) | ES368955A1 (OSRAM) |
| FR (1) | FR2012054B1 (OSRAM) |
| GB (1) | GB1256723A (OSRAM) |
| IE (1) | IE33371B1 (OSRAM) |
| IL (1) | IL32213A (OSRAM) |
| IT (1) | IT1000009B (OSRAM) |
| MY (1) | MY7400237A (OSRAM) |
| NL (1) | NL143559B (OSRAM) |
| PH (1) | PH9607A (OSRAM) |
| PL (2) | PL89014B1 (OSRAM) |
| SE (1) | SE370396B (OSRAM) |
| YU (3) | YU33388B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3624214A (en) * | 1970-03-25 | 1971-11-30 | Dow Chemical Co | Guanidene derivatives for coccidiosis |
| ZA708675B (en) * | 1970-12-28 | 1971-10-27 | American Cyanamid Co | Compositions of substituted guanidines and method of use thereof |
| US3992446A (en) | 1973-07-27 | 1976-11-16 | American Cyanamid Company | Substituted aminochlorobenzylamino guanidine compounds |
| WO2000040549A1 (de) * | 1999-01-06 | 2000-07-13 | Lonza Ag | Verfahren zur herstellung von robenidin bzw. dessen derivate |
| HK1042078B (zh) | 1999-01-06 | 2004-01-30 | Lonza Ag | 生产robenidine或其衍生物的方法 |
| RU2666540C2 (ru) * | 2013-05-01 | 2018-09-11 | Неокули Пти Лтд | Соединения и способы лечения инфекций |
| BR112017004153B1 (pt) * | 2014-09-02 | 2023-03-28 | Neoculi Pty Ltd | Uso de uma quantidade terapeuticamente eficaz de um composto, composição farmacêutica antiprotozoária, uso de um dispositivo médico, composto e composição |
| AU2021258697A1 (en) * | 2020-04-24 | 2022-12-15 | Neoculi Pty Ltd | Methods and compositions for treating fungal infections |
-
1969
- 1969-05-07 CA CA050850A patent/CA927394A/en not_active Expired
- 1969-05-12 IL IL32213A patent/IL32213A/en unknown
- 1969-06-19 SE SE6908793A patent/SE370396B/xx unknown
- 1969-06-19 IE IE641/69A patent/IE33371B1/xx unknown
- 1969-06-23 GB GB1256723D patent/GB1256723A/en not_active Expired
- 1969-06-25 NL NL696909722A patent/NL143559B/xx not_active IP Right Cessation
- 1969-06-27 BR BR210272/69A patent/BR6910272D0/pt unknown
- 1969-06-28 IT IT38304/69A patent/IT1000009B/it active
- 1969-06-30 DE DE1933112A patent/DE1933112C3/de not_active Expired
- 1969-06-30 BE BE735375D patent/BE735375A/xx not_active IP Right Cessation
- 1969-06-30 DK DK354469AA patent/DK129448B/da not_active IP Right Cessation
- 1969-06-30 ES ES368955A patent/ES368955A1/es not_active Expired
- 1969-06-30 FR FR696921970A patent/FR2012054B1/fr not_active Expired
- 1969-06-30 CS CS4622A patent/CS170139B2/cs unknown
- 1969-06-30 PH PH10492*UA patent/PH9607A/en unknown
- 1969-06-30 YU YU01672/69A patent/YU33388B/xx unknown
- 1969-07-01 PL PL1969156043A patent/PL89014B1/pl unknown
- 1969-07-01 AT AT629869A patent/AT297015B/de not_active IP Right Cessation
- 1969-07-01 CH CH1006769A patent/CH562209A5/xx not_active IP Right Cessation
- 1969-07-01 PL PL1969157956A patent/PL89704B1/pl unknown
-
1972
- 1972-05-24 JP JP5156072A patent/JPS5324411B1/ja active Pending
- 1972-05-24 JP JP5156172A patent/JPS5324412B1/ja active Pending
-
1974
- 1974-08-15 YU YU2235/74A patent/YU33445B/xx unknown
- 1974-08-15 YU YU2234/74A patent/YU33444B/xx unknown
- 1974-12-30 MY MY237/74A patent/MY7400237A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL32213A0 (en) | 1969-07-30 |
| MY7400237A (en) | 1974-12-31 |
| IE33371L (en) | 1970-01-01 |
| SE370396B (OSRAM) | 1974-10-14 |
| DK129448C (OSRAM) | 1975-03-03 |
| YU223574A (en) | 1976-08-31 |
| GB1256723A (OSRAM) | 1971-12-15 |
| DK129448B (da) | 1974-10-14 |
| DE1933112B2 (de) | 1974-09-26 |
| CH562209A5 (OSRAM) | 1975-05-30 |
| JPS5324412B1 (OSRAM) | 1978-07-20 |
| ES368955A1 (es) | 1971-07-16 |
| JPS5324411B1 (OSRAM) | 1978-07-20 |
| BE735375A (OSRAM) | 1969-12-30 |
| YU167269A (en) | 1976-06-30 |
| IE33371B1 (en) | 1974-06-12 |
| DE1933112A1 (de) | 1970-01-08 |
| CA927394A (en) | 1973-05-29 |
| YU33444B (en) | 1977-02-28 |
| BR6910272D0 (pt) | 1973-02-08 |
| NL143559B (nl) | 1974-10-15 |
| DE1933112C3 (de) | 1975-05-15 |
| FR2012054A1 (OSRAM) | 1970-03-13 |
| CS170139B2 (OSRAM) | 1976-08-27 |
| YU223474A (en) | 1976-08-31 |
| YU33445B (en) | 1977-02-28 |
| PH9607A (en) | 1976-01-19 |
| YU33388B (en) | 1976-12-31 |
| PL89014B1 (OSRAM) | 1976-10-30 |
| IT1000009B (it) | 1976-03-30 |
| NL6909722A (OSRAM) | 1970-01-05 |
| AT297015B (de) | 1972-03-10 |
| FR2012054B1 (OSRAM) | 1973-01-12 |
| PL89704B1 (OSRAM) | 1976-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6053024B2 (ja) | 1−(4−フエノキシ−フエニル)−1,3,5−トリアジン誘導体の製造法 | |
| US3228833A (en) | Anticoccidial compositions and methods of using same | |
| US3992446A (en) | Substituted aminochlorobenzylamino guanidine compounds | |
| US3941825A (en) | Substituted aminobenzylideneamino guanidine compounds | |
| IL32213A (en) | Substituted guanidines | |
| US3769432A (en) | Compositions and method of use of substituted guanidines | |
| US3493572A (en) | Process for producing quinoxaline-di-n-oxides | |
| JPS6136516B2 (OSRAM) | ||
| US3901944A (en) | 1,3-bis(substituted benzylideneamino)guanidines | |
| CA1250576A (en) | Quinazolin-4-one-3-acetonyl hydrazone and their use against coccidiosis | |
| US3206358A (en) | Pyridinols employed in animal husbandry | |
| US4151298A (en) | Anthelmintic compositions | |
| US3926935A (en) | Anticoccidial complexes | |
| US4112120A (en) | Methods and compositions for use in animal husbandry | |
| US4311710A (en) | Anticoccidial formulation and method | |
| US3816530A (en) | Novel chemical compounds and processes for preparing same | |
| GB1561624A (en) | Sulphonylhydrazones of 1,4-dioxo- and 4-osoquinoxaline-2carboxaldehvde | |
| US3415838A (en) | Nitrogen-containing derivatives of 2,5-dichloro-3-nitrobenzoic acid | |
| US4073791A (en) | 1-Substitutedphenyl-4(1H)-pyridinone hydrazones | |
| US4015016A (en) | [(2-Alkoxyberzylidine)amino]quanidines and their anticoccidal use | |
| JPS6135985B2 (OSRAM) | ||
| US3075877A (en) | Anticoccidial compositions comprising 5-nitro-2-furaldehyde cyanoacetyl or dichloroacetyl-hydrazone | |
| RU2032670C1 (ru) | S-(1-метилпиридиний-3-метил)-n,n`-диметилтиурония дийодид, проявляющий радиозащитную активность | |
| US3773943A (en) | Alpha,alpha,alpha-trifluoro-6-substituted-5-nitro-m-toluic acid,5'-nitrofurylidene hydrazide compounds as growth promotants | |
| US3856975A (en) | Anticoccidial composition containing guanidine derivatives |