DK129448B - Analogifremgangsmåde til fremstilling af bis-(benzylidenamino)-guanidiner eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af bis-(benzylidenamino)-guanidiner eller syreadditionssalte deraf.Info
- Publication number
- DK129448B DK129448B DK354469AA DK354469A DK129448B DK 129448 B DK129448 B DK 129448B DK 354469A A DK354469A A DK 354469AA DK 354469 A DK354469 A DK 354469A DK 129448 B DK129448 B DK 129448B
- Authority
- DK
- Denmark
- Prior art keywords
- benzylideneamino
- guanidines
- bis
- preparation
- acid addition
- Prior art date
Links
- ZWLXITGRGUNARS-UHFFFAOYSA-N 1,2-bis(benzylideneamino)guanidine Chemical class C=1C=CC=CC=1C=NN=C(N)NN=CC1=CC=CC=C1 ZWLXITGRGUNARS-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
- C07C281/16—Compounds containing any of the groups, e.g. aminoguanidine
- C07C281/18—Compounds containing any of the groups, e.g. aminoguanidine the other nitrogen atom being further doubly-bound to a carbon atom, e.g. guanylhydrazones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US74124768A | 1968-07-01 | 1968-07-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK129448B true DK129448B (da) | 1974-10-14 |
| DK129448C DK129448C (OSRAM) | 1975-03-03 |
Family
ID=24979938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK354469AA DK129448B (da) | 1968-07-01 | 1969-06-30 | Analogifremgangsmåde til fremstilling af bis-(benzylidenamino)-guanidiner eller syreadditionssalte deraf. |
Country Status (21)
| Country | Link |
|---|---|
| JP (2) | JPS5324411B1 (OSRAM) |
| AT (1) | AT297015B (OSRAM) |
| BE (1) | BE735375A (OSRAM) |
| BR (1) | BR6910272D0 (OSRAM) |
| CA (1) | CA927394A (OSRAM) |
| CH (1) | CH562209A5 (OSRAM) |
| CS (1) | CS170139B2 (OSRAM) |
| DE (1) | DE1933112C3 (OSRAM) |
| DK (1) | DK129448B (OSRAM) |
| ES (1) | ES368955A1 (OSRAM) |
| FR (1) | FR2012054B1 (OSRAM) |
| GB (1) | GB1256723A (OSRAM) |
| IE (1) | IE33371B1 (OSRAM) |
| IL (1) | IL32213A (OSRAM) |
| IT (1) | IT1000009B (OSRAM) |
| MY (1) | MY7400237A (OSRAM) |
| NL (1) | NL143559B (OSRAM) |
| PH (1) | PH9607A (OSRAM) |
| PL (2) | PL89014B1 (OSRAM) |
| SE (1) | SE370396B (OSRAM) |
| YU (3) | YU33388B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3624214A (en) * | 1970-03-25 | 1971-11-30 | Dow Chemical Co | Guanidene derivatives for coccidiosis |
| ZA708675B (en) * | 1970-12-28 | 1971-10-27 | American Cyanamid Co | Compositions of substituted guanidines and method of use thereof |
| US3992446A (en) | 1973-07-27 | 1976-11-16 | American Cyanamid Company | Substituted aminochlorobenzylamino guanidine compounds |
| WO2000040549A1 (de) * | 1999-01-06 | 2000-07-13 | Lonza Ag | Verfahren zur herstellung von robenidin bzw. dessen derivate |
| HK1042078B (zh) | 1999-01-06 | 2004-01-30 | Lonza Ag | 生产robenidine或其衍生物的方法 |
| RU2666540C2 (ru) * | 2013-05-01 | 2018-09-11 | Неокули Пти Лтд | Соединения и способы лечения инфекций |
| BR112017004153B1 (pt) * | 2014-09-02 | 2023-03-28 | Neoculi Pty Ltd | Uso de uma quantidade terapeuticamente eficaz de um composto, composição farmacêutica antiprotozoária, uso de um dispositivo médico, composto e composição |
| AU2021258697A1 (en) * | 2020-04-24 | 2022-12-15 | Neoculi Pty Ltd | Methods and compositions for treating fungal infections |
-
1969
- 1969-05-07 CA CA050850A patent/CA927394A/en not_active Expired
- 1969-05-12 IL IL32213A patent/IL32213A/en unknown
- 1969-06-19 SE SE6908793A patent/SE370396B/xx unknown
- 1969-06-19 IE IE641/69A patent/IE33371B1/xx unknown
- 1969-06-23 GB GB1256723D patent/GB1256723A/en not_active Expired
- 1969-06-25 NL NL696909722A patent/NL143559B/xx not_active IP Right Cessation
- 1969-06-27 BR BR210272/69A patent/BR6910272D0/pt unknown
- 1969-06-28 IT IT38304/69A patent/IT1000009B/it active
- 1969-06-30 DE DE1933112A patent/DE1933112C3/de not_active Expired
- 1969-06-30 BE BE735375D patent/BE735375A/xx not_active IP Right Cessation
- 1969-06-30 DK DK354469AA patent/DK129448B/da not_active IP Right Cessation
- 1969-06-30 ES ES368955A patent/ES368955A1/es not_active Expired
- 1969-06-30 FR FR696921970A patent/FR2012054B1/fr not_active Expired
- 1969-06-30 CS CS4622A patent/CS170139B2/cs unknown
- 1969-06-30 PH PH10492*UA patent/PH9607A/en unknown
- 1969-06-30 YU YU01672/69A patent/YU33388B/xx unknown
- 1969-07-01 PL PL1969156043A patent/PL89014B1/pl unknown
- 1969-07-01 AT AT629869A patent/AT297015B/de not_active IP Right Cessation
- 1969-07-01 CH CH1006769A patent/CH562209A5/xx not_active IP Right Cessation
- 1969-07-01 PL PL1969157956A patent/PL89704B1/pl unknown
-
1972
- 1972-05-24 JP JP5156072A patent/JPS5324411B1/ja active Pending
- 1972-05-24 JP JP5156172A patent/JPS5324412B1/ja active Pending
-
1974
- 1974-08-15 YU YU2235/74A patent/YU33445B/xx unknown
- 1974-08-15 YU YU2234/74A patent/YU33444B/xx unknown
- 1974-12-30 MY MY237/74A patent/MY7400237A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL32213A0 (en) | 1969-07-30 |
| MY7400237A (en) | 1974-12-31 |
| IE33371L (en) | 1970-01-01 |
| SE370396B (OSRAM) | 1974-10-14 |
| DK129448C (OSRAM) | 1975-03-03 |
| YU223574A (en) | 1976-08-31 |
| GB1256723A (OSRAM) | 1971-12-15 |
| DE1933112B2 (de) | 1974-09-26 |
| CH562209A5 (OSRAM) | 1975-05-30 |
| JPS5324412B1 (OSRAM) | 1978-07-20 |
| ES368955A1 (es) | 1971-07-16 |
| JPS5324411B1 (OSRAM) | 1978-07-20 |
| BE735375A (OSRAM) | 1969-12-30 |
| YU167269A (en) | 1976-06-30 |
| IE33371B1 (en) | 1974-06-12 |
| DE1933112A1 (de) | 1970-01-08 |
| CA927394A (en) | 1973-05-29 |
| YU33444B (en) | 1977-02-28 |
| BR6910272D0 (pt) | 1973-02-08 |
| NL143559B (nl) | 1974-10-15 |
| DE1933112C3 (de) | 1975-05-15 |
| FR2012054A1 (OSRAM) | 1970-03-13 |
| CS170139B2 (OSRAM) | 1976-08-27 |
| YU223474A (en) | 1976-08-31 |
| YU33445B (en) | 1977-02-28 |
| PH9607A (en) | 1976-01-19 |
| YU33388B (en) | 1976-12-31 |
| PL89014B1 (OSRAM) | 1976-10-30 |
| IT1000009B (it) | 1976-03-30 |
| NL6909722A (OSRAM) | 1970-01-05 |
| AT297015B (de) | 1972-03-10 |
| FR2012054B1 (OSRAM) | 1973-01-12 |
| IL32213A (en) | 1972-12-29 |
| PL89704B1 (OSRAM) | 1976-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK124884B (da) | Analogifremgangsmåde til fremstilling af 2-brom-α-ergokryptin eller syreadditionssalte deraf. | |
| DK134984B (da) | Analogifremgangsmåde til fremstilling af alfa-alkylaminopropiophenoner eller syreadditionssalte heraf. | |
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK131858B (da) | Analogifremgangsmåde til fremstilling af 4-amino-6-arylpyrimidin-forbindelser eller syreadditionssalte deraf. | |
| DK139717B (da) | Analogifremgangsmåde til fremstilling af beta-aryl-2-aminoalkoxystyroler eller syreadditionssalte heraf. | |
| DK135278B (da) | Analogifremgangsmåde til fremstilling af fenoksyisopropanolaminderivater eller syreadditionssalte deraf. | |
| DK136526B (da) | Analogifremgangsmåde til fremstilling af substituerede naphthylalkylaminer eller syreadditionssalte deraf. | |
| DK131721B (da) | Analogifremgangsmåde til fremstilling af adamantanylaminer eller 3,5,7-trimethylhomologe eller syreadditionssalte deraf. | |
| DK129577B (da) | Analogifremgangsmåde til fremstilling af phenacetylguanidiner eller syreadditionssalte deraf. | |
| DK127644B (da) | Analogifremgangsmåde til fremstilling af ergopeptiner eller syreadditionssalte deraf. | |
| DK129448B (da) | Analogifremgangsmåde til fremstilling af bis-(benzylidenamino)-guanidiner eller syreadditionssalte deraf. | |
| DK120155B (da) | Analogifremgangsmåde til fremstilling af aminopropiofenoner eller syreadditionssalte deraf. | |
| DK126327B (da) | Analogifremgangsmåde til fremstilling af derivater af p-aminoalkylbenzensulfonamid eller syreadditionssalte deraf. | |
| DK129994B (da) | Analogifremgangsmåde til fremstilling af 1-trimethoxybenzyl-6,7-dialkanoyl-1,2,3,4-tetrahydroisoquinoliner eller syreadditionssalte deraf. | |
| DK125472B (da) | Analogifremgangsmåde til fremstilling af pyrimidopyridazinderivater eller syreadditionssalte deraf. | |
| DK129454B (da) | Analogifremgangsmåde til fremstilling af ergonorcornin eller syreadditionssalte deraf. | |
| DK127424B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-1-(4,4-diarylbutyl)-4-hydroxypiperidiner eller syreadditionssalte deraf. | |
| DK136151B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede tertiære butanoler eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK131727B (da) | Analogifremgangsmåde til fremstilling af oxazinobenzoxaziner eller syreadditionssalte deraf. | |
| DK134023B (da) | Analogifremgangsmåde til fremstilling af acyloxypiperazinylforbindelser eller syreadditionssalte deraf. | |
| DK121955B (da) | Analogifremgangsmåde til fremstilling af 1,4-substituerede phenylpiperaziner eller syreadditionssalte deraf. | |
| DK124028B (da) | Analogifremgangsmåde til fremstilling af quinolylformiminoethere eller syreadditionssalte deraf. | |
| DK128650B (da) | Analogifremgangsmåde til fremstilling af N-propionyl-ε-aminocapronsyre eller salte heraf. | |
| DK129839B (da) | Analogifremgangsmåde til fremstilling af N-vinylquinoloner eller syreadditionssalte deraf. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |