IL28863A - Pharmaceutical compositions containing homopyrimidazole derivatives,new homopyrimidazole derivatives and processes for the preparation thereof - Google Patents
Pharmaceutical compositions containing homopyrimidazole derivatives,new homopyrimidazole derivatives and processes for the preparation thereofInfo
- Publication number
- IL28863A IL28863A IL28863A IL2886367A IL28863A IL 28863 A IL28863 A IL 28863A IL 28863 A IL28863 A IL 28863A IL 2886367 A IL2886367 A IL 2886367A IL 28863 A IL28863 A IL 28863A
- Authority
- IL
- Israel
- Prior art keywords
- salts
- pharmaceutical compositions
- compounds
- formula
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 31
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 20
- 230000008569 process Effects 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 10
- 150000003839 salts Chemical class 0.000 claims description 62
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 claims description 50
- 150000001875 compounds Chemical class 0.000 claims description 48
- 229960005181 morphine Drugs 0.000 claims description 25
- 230000000202 analgesic effect Effects 0.000 claims description 19
- 239000000243 solution Substances 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 15
- SLZHLQUFNFXTHB-UHFFFAOYSA-M sodium;5-butan-2-yl-5-ethyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione Chemical compound [Na+].CCC(C)C1(CC)C([O-])=NC(=S)NC1=O SLZHLQUFNFXTHB-UHFFFAOYSA-M 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 239000002585 base Substances 0.000 claims description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 8
- 230000001754 anti-pyretic effect Effects 0.000 claims description 8
- 239000002221 antipyretic Substances 0.000 claims description 7
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000001990 intravenous administration Methods 0.000 claims description 6
- 150000001408 amides Chemical class 0.000 claims description 5
- 239000002775 capsule Substances 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- -1 compounds Salts Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 230000009467 reduction Effects 0.000 claims description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 238000002347 injection Methods 0.000 claims description 3
- 239000007924 injection Substances 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 239000007859 condensation product Substances 0.000 claims description 2
- 230000001047 pyretic effect Effects 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 230000002459 sustained effect Effects 0.000 claims description 2
- UBBZKZRMWONRRS-UHFFFAOYSA-N thionyl dichloride hydrochloride Chemical compound Cl.ClS(Cl)=O UBBZKZRMWONRRS-UHFFFAOYSA-N 0.000 claims description 2
- 238000001802 infusion Methods 0.000 claims 3
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 239000000843 powder Substances 0.000 claims 2
- NMIZONYLXCOHEF-UHFFFAOYSA-N 1h-imidazole-2-carboxamide Chemical compound NC(=O)C1=NC=CN1 NMIZONYLXCOHEF-UHFFFAOYSA-N 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 229940035676 analgesics Drugs 0.000 claims 1
- 239000000730 antalgic agent Substances 0.000 claims 1
- 229940125716 antipyretic agent Drugs 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 229940125717 barbiturate Drugs 0.000 claims 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 150000001989 diazonium salts Chemical class 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- UZHSEJADLWPNLE-GRGSLBFTSA-N naloxone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(O)C2=C5[C@@]13CCN4CC=C UZHSEJADLWPNLE-GRGSLBFTSA-N 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 claims 1
- 229940031826 phenolate Drugs 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 150000003222 pyridines Chemical class 0.000 claims 1
- 238000009738 saturating Methods 0.000 claims 1
- 229910021653 sulphate ion Inorganic materials 0.000 claims 1
- 239000000047 product Substances 0.000 description 41
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 230000000694 effects Effects 0.000 description 15
- 241001465754 Metazoa Species 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 230000003389 potentiating effect Effects 0.000 description 11
- 241000700159 Rattus Species 0.000 description 10
- 208000010513 Stupor Diseases 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000012458 free base Substances 0.000 description 9
- 239000003708 ampul Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000000638 stimulation Effects 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 229940079593 drug Drugs 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 210000000936 intestine Anatomy 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 description 4
- 208000036119 Frailty Diseases 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 206010003549 asthenia Diseases 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- 229960005195 morphine hydrochloride Drugs 0.000 description 4
- XELXKCKNPPSFNN-BJWPBXOKSA-N morphine hydrochloride trihydrate Chemical compound O.O.O.Cl.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O XELXKCKNPPSFNN-BJWPBXOKSA-N 0.000 description 4
- 230000036407 pain Effects 0.000 description 4
- 230000008058 pain sensation Effects 0.000 description 4
- 229920000137 polyphosphoric acid Polymers 0.000 description 4
- 230000007958 sleep Effects 0.000 description 4
- GDJWAYOMFZFOTG-UHFFFAOYSA-M sodium;5-cyclohex-2-en-1-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione Chemical compound [Na+].O=C1NC([S-])=NC(=O)C1(CC=C)C1C=CCCC1 GDJWAYOMFZFOTG-UHFFFAOYSA-M 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229960000212 aminophenazone Drugs 0.000 description 3
- 230000036592 analgesia Effects 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- RMEDXOLNCUSCGS-UHFFFAOYSA-N droperidol Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CC=C(N2C(NC3=CC=CC=C32)=O)CC1 RMEDXOLNCUSCGS-UHFFFAOYSA-N 0.000 description 3
- 229940093499 ethyl acetate Drugs 0.000 description 3
- 235000019439 ethyl acetate Nutrition 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 230000002045 lasting effect Effects 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 230000029058 respiratory gaseous exchange Effects 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- RVBUGGBMJDPOST-UHFFFAOYSA-N 2-thiobarbituric acid Chemical compound O=C1CC(=O)NC(=S)N1 RVBUGGBMJDPOST-UHFFFAOYSA-N 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000000330 anaesthesiologic effect Effects 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 229960002319 barbital Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000000812 cholinergic antagonist Substances 0.000 description 2
- OROGSEYTTFOCAN-DNJOTXNNSA-N codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000003176 neuroleptic agent Substances 0.000 description 2
- 230000000701 neuroleptic effect Effects 0.000 description 2
- CKQVRZJOMJRTOY-UHFFFAOYSA-N octadecanoic acid;propane-1,2,3-triol Chemical compound OCC(O)CO.CCCCCCCCCCCCCCCCCC(O)=O CKQVRZJOMJRTOY-UHFFFAOYSA-N 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 150000004707 phenolate Chemical class 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 230000002048 spasmolytic effect Effects 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000011477 surgical intervention Methods 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 230000002110 toxicologic effect Effects 0.000 description 2
- 231100000027 toxicology Toxicity 0.000 description 2
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 1
- JXQCUCDXLSGQNZ-UHFFFAOYSA-N 3-tert-butyl-2-hydroxy-6-methylbenzoic acid Chemical compound CC1=CC=C(C(C)(C)C)C(O)=C1C(O)=O JXQCUCDXLSGQNZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical group CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- OGDVEMNWJVYAJL-LEPYJNQMSA-N Ethyl morphine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OCC OGDVEMNWJVYAJL-LEPYJNQMSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- OGDVEMNWJVYAJL-UHFFFAOYSA-N Ethylmorphine Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OCC OGDVEMNWJVYAJL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- XMGZWGBXVLJOKE-UHFFFAOYSA-N acetic acid;toluene Chemical compound CC(O)=O.CC1=CC=CC=C1 XMGZWGBXVLJOKE-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960004126 codeine Drugs 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000000881 depressing effect Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000005452 ethyl sulfates Chemical class 0.000 description 1
- 230000006203 ethylation Effects 0.000 description 1
- 238000006200 ethylation reaction Methods 0.000 description 1
- 229960004578 ethylmorphine Drugs 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- OROGSEYTTFOCAN-UHFFFAOYSA-N hydrocodone Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OC OROGSEYTTFOCAN-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical group ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000002350 laparotomy Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- BYTCDABWEGFPLT-UHFFFAOYSA-L potassium;sodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[K+] BYTCDABWEGFPLT-UHFFFAOYSA-L 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003902 salicylic acid esters Chemical class 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000002627 tracheal intubation Methods 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 230000002618 waking effect Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI000670 | 1966-11-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28863A true IL28863A (en) | 1973-07-30 |
Family
ID=10994330
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28863A IL28863A (en) | 1966-11-02 | 1967-10-31 | Pharmaceutical compositions containing homopyrimidazole derivatives,new homopyrimidazole derivatives and processes for the preparation thereof |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US3585198A (enExample) |
| JP (1) | JPS4939278B1 (enExample) |
| AT (5) | AT296996B (enExample) |
| BE (1) | BE705934A (enExample) |
| CH (1) | CH538494A (enExample) |
| CS (1) | CS165991B2 (enExample) |
| DE (2) | DE1795769C3 (enExample) |
| DK (1) | DK134160B (enExample) |
| FR (1) | FR7813M (enExample) |
| GB (1) | GB1209946A (enExample) |
| HK (1) | HK27876A (enExample) |
| IL (1) | IL28863A (enExample) |
| NL (1) | NL6714810A (enExample) |
| SE (3) | SE336134B (enExample) |
| YU (2) | YU35136B (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3907798A (en) * | 1966-06-15 | 1975-09-23 | Sterling Drug Inc | Preparation of 4H-pyrido{8 1,2-a{9 pyrimidin-4-ones from cyclic alkylidene 2-pyridylaminomethylenemalonates |
| BE788601A (fr) * | 1971-09-10 | 1973-03-08 | Takeda Chemical Industries Ltd | Procede de preparation de derives de pyrimidine |
| CA1005056A (en) * | 1971-09-17 | 1977-02-08 | E.R. Squibb And Sons | Manufacture of substituted pyridopyrimidinones |
| HU169230B (enExample) * | 1972-03-29 | 1976-10-28 | ||
| US3960847A (en) * | 1972-04-17 | 1976-06-01 | E. R. Squibb & Sons, Inc. | 9-Substituted-4-oxopyrido(1,2-α)pyrimidine-3-carboxylic acids and derivatives thereof |
| US4013656A (en) * | 1972-06-07 | 1977-03-22 | Dynamit Nobel Aktiengesellschaft | Process for the preparation of pyridylamino-methylenemalonic acid derivatives |
| IL42868A (en) * | 1972-08-03 | 1976-04-30 | Chinoin Gyogyszer Es Vegyeszet | Pharmaceutical compositions having synergistic analgesic activity and containing a 6-azido-morphine derivative and either a 4-oxopyrido (1,2-alpha)-pyrimidine-3-carboxylic acid derivative or a butyrophenone derivative |
| HU166378B (enExample) | 1972-12-19 | 1975-03-28 | ||
| US4027024A (en) | 1972-12-19 | 1977-05-31 | Chinoin Gyogyszer-Es Vegyeszeti Termekek Gyara Rt | Pharmaceutical composition having synergistic analgesic activity |
| US4209622A (en) * | 1973-03-30 | 1980-06-24 | Chinoin Gygyszer es Vegyeszeti Termekek Gyara Rt. | 3-(Ethoxycarbonyl-methyl)-6-methyl-4-oxo-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidine |
| HU168014B (enExample) * | 1973-03-30 | 1976-02-28 | ||
| HU169223B (enExample) * | 1973-12-29 | 1976-10-28 | ||
| US4022897A (en) * | 1974-03-04 | 1977-05-10 | E. R. Squibb & Sons, Inc. | CNS active compounds |
| US3929787A (en) * | 1974-04-22 | 1975-12-30 | Squibb & Sons Inc | 6,7,8,9-Tetrahydro-pyrido(1,2-a)pyrimidin-4-ones |
| US3935197A (en) * | 1975-05-16 | 1976-01-27 | E. R. Squibb & Sons, Inc. | 2-Styryl-4H-pyrido(1,2-a)pyrimidin-4-ones |
| HU173823B (hu) * | 1975-07-25 | 1979-08-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija stabil'nogo lechebnogo preparata dlja oral'noj dozirovki, kotoryj soderzhit proizvodnyj gomopirimidazola |
| JPS5822040B2 (ja) * | 1975-10-13 | 1983-05-06 | わかもと製薬 (株) | ホモピリイミダゾ−ル誘導体の製造法 |
| US4495189A (en) * | 1975-11-27 | 1985-01-22 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara R.T. | Condensed pyrimidines |
| HU173438B (hu) * | 1975-11-27 | 1979-05-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija novykh proizvodnykh 4-okso-1,6,7,8-/tetragidro-4h-pirido/1,2/pirimidina s zaderzhivajuhhejj vozgoranie aktivnot'ju i protivosvertivajuhhem effektom |
| HU174693B (hu) * | 1976-02-12 | 1980-03-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija kondensirovannykh proizvodnykh pirimidina |
| HU174901B (hu) * | 1976-06-25 | 1980-04-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija novykh proizvodnykh pirido/1,2-a/pirimidina |
| FR2358891A1 (fr) * | 1976-07-22 | 1978-02-17 | Yamanouchi Pharma Co Ltd | Composes heterocycliques contenant un azote, utilise comme agents analgesiques et anti-inflammatoires |
| US4122274A (en) * | 1977-05-25 | 1978-10-24 | Bristol-Myers Company | 3-Tetrazolo-5,6,7,8-substituted-pyrido[1,2-a]pyrimidin-4-ones |
| HU178910B (en) * | 1977-08-19 | 1982-07-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 2,3-disubstituted-4-oxo-4h-pyrido/1,2-a/-pyrimidines |
| HU180439B (en) * | 1977-12-29 | 1983-03-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 9-amino-pyrido-square bracket-1,2-a-square bracket closed-pyrimidine derivatives |
| HU178496B (en) * | 1977-12-29 | 1982-05-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 6,7,8,9-tetrahydro-4h-pyrido/1,2-a/pyrimidine derivatives with antiallergic activity |
| US4192944A (en) * | 1978-04-03 | 1980-03-11 | Bristol-Myers Company | Optionally substituted 4-oxo-4H-pyrido[1,2-a]pyrimidine-3-N-(1H-tetrazol-4-yl)carboxamides and their use as antiallergy agents |
| FR2449689A1 (fr) * | 1979-02-20 | 1980-09-19 | Logeais Labor Jacques | Nouveaux derives condenses de pyrrolidine ou de piperidine, leur procede de preparation et leurs applications en therapeutique |
| US4482557A (en) * | 1979-05-11 | 1984-11-13 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | 3-Substituted-2-oxo-tetrahydro-pyrrol[1,2-a]pyrimidines having digitalis-like activity |
| HU179443B (en) * | 1979-05-11 | 1982-10-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing substituted geminal dihalogeno-derivatives of pyrido-square bracket-1,2-a-square closed-pyrimidines,pyrrolo-square bracket-1,2-a-square bracket closed-pyrimidines and pyrimido-square bracket-1,2,-a-square bracket closed-asepines |
| HU176942B (hu) * | 1979-05-11 | 1981-06-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija 2,3- i 3,4-dvuzamehhjonnykh tetragidro-pirrolo!1,2-a!-pirimidinov |
| HU178452B (en) * | 1979-05-11 | 1982-05-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 9-substituted amino-4-oxo-6,7-dihydro-4h-pyrido/1,2-a/pyrimidine derivatives |
| HU177184B (en) * | 1979-05-11 | 1981-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 2,3- and 3,4-disubstituted-hexahydro-pyrimido-square bracket-1,2-a-square bracket closed-asepines |
| HU186607B (en) * | 1982-03-31 | 1985-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing pharmaceutical composition with synergetic antiinflammatory activity |
| US4476130A (en) * | 1982-09-09 | 1984-10-09 | Riker Laboratories, Inc. | 3-(1H-Tetrazol-5-yl)-4H-pyrimido[2,1-b]benzoxazol-4-one compounds exhibiting anti-allergic activity |
| US4474953A (en) * | 1982-09-09 | 1984-10-02 | Riker Laboratories, Inc. | Process and intermediates for the preparation of 3(1H-tetrazol-5-yl)-4H-pyrido[1,2-a]pyrimidin-4-ones |
| US4507477A (en) * | 1982-09-09 | 1985-03-26 | Riker Laboratories, Inc. | Process for tetrazolyl-pyrimidinone derivatives |
| US4457932A (en) * | 1983-07-22 | 1984-07-03 | Bristol-Myers Company | Anti-ulcer agents |
| CA1283411C (en) * | 1985-09-25 | 1991-04-23 | Masami Doteuchi | 9-(substituted thio)-4h-pyrido[1,2-a]-pyrimidin-4-one derivatives |
| HU201551B (en) * | 1988-02-03 | 1990-11-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 4-oxo-4h-pyrido(1,2-a)pyrimidine-3-carboxylic acid amide derivatives and pharmaceutical compositions comprising same |
| CA2205313C (en) | 1996-05-28 | 2005-01-18 | Tecton Products | Method of manufacture of a plastic component which is insensitive to the elements, and a plastic component so manufactured |
| BR112012005200A2 (pt) * | 2009-09-09 | 2021-02-02 | E.I. Du Pont De Nemours And Company | compostos, mistura herbicida, composições herbicidas e método para controlar o crescimento de vegetação indesejada |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3149112A (en) * | 1964-09-15 | Z-diethylaminoethoxy |
-
1967
- 1967-10-24 DE DE1795769A patent/DE1795769C3/de not_active Expired
- 1967-10-24 AT AT355470A patent/AT296996B/de not_active IP Right Cessation
- 1967-10-24 AT AT1022870A patent/AT299212B/de not_active IP Right Cessation
- 1967-10-24 AT AT355370A patent/AT294107B/de not_active IP Right Cessation
- 1967-10-24 AT AT00408/71A patent/AT302311B/de not_active IP Right Cessation
- 1967-10-24 DE DE1670480A patent/DE1670480C2/de not_active Expired
- 1967-10-24 CH CH1484767A patent/CH538494A/de not_active IP Right Cessation
- 1967-10-24 AT AT958567A patent/AT286990B/de not_active IP Right Cessation
- 1967-10-27 YU YU2095/67A patent/YU35136B/xx unknown
- 1967-10-31 BE BE705934D patent/BE705934A/xx not_active IP Right Cessation
- 1967-10-31 NL NL6714810A patent/NL6714810A/xx unknown
- 1967-10-31 FR FR126462A patent/FR7813M/fr not_active Expired
- 1967-10-31 IL IL28863A patent/IL28863A/en unknown
- 1967-11-01 GB GB49685/67A patent/GB1209946A/en not_active Expired
- 1967-11-01 US US679640A patent/US3585198A/en not_active Expired - Lifetime
- 1967-11-01 DK DK545067AA patent/DK134160B/da not_active IP Right Cessation
- 1967-11-02 SE SE15057/67A patent/SE336134B/xx unknown
- 1967-11-02 SE SE00046/71A patent/SE363333B/xx unknown
- 1967-11-02 CS CS7770A patent/CS165991B2/cs unknown
-
1970
- 1970-05-04 JP JP45037582A patent/JPS4939278B1/ja active Pending
-
1971
- 1971-01-04 SE SE7100047A patent/SE409327B/xx unknown
- 1971-05-28 US US148199A patent/US3696197A/en not_active Expired - Lifetime
-
1973
- 1973-09-21 YU YU2503/73A patent/YU35142B/xx unknown
-
1976
- 1976-05-13 HK HK278/76*UA patent/HK27876A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6714810A (enExample) | 1968-05-03 |
| CS165991B2 (enExample) | 1975-12-22 |
| BE705934A (enExample) | 1968-03-01 |
| SE363333B (enExample) | 1974-01-14 |
| DK134160B (da) | 1976-09-20 |
| DK134160C (enExample) | 1977-02-21 |
| AT286990B (de) | 1971-01-11 |
| YU209567A (en) | 1980-03-15 |
| DE1795769A1 (de) | 1975-04-10 |
| AT296996B (de) | 1972-03-10 |
| US3696197A (en) | 1972-10-03 |
| DE1670480C2 (de) | 1983-06-01 |
| FR7813M (enExample) | 1970-05-20 |
| YU250373A (en) | 1980-03-15 |
| HK27876A (en) | 1976-05-21 |
| DE1795769B2 (de) | 1978-03-09 |
| GB1209946A (en) | 1970-10-21 |
| SE336134B (enExample) | 1971-06-28 |
| CH538494A (de) | 1973-06-30 |
| JPS4939278B1 (enExample) | 1974-10-24 |
| AT294107B (de) | 1971-11-10 |
| AT299212B (de) | 1972-06-12 |
| US3585198A (en) | 1971-06-15 |
| DE1795769C3 (de) | 1978-11-02 |
| AT302311B (de) | 1972-09-15 |
| SE409327B (sv) | 1979-08-13 |
| DE1670480A1 (de) | 1972-05-10 |
| YU35136B (en) | 1980-09-25 |
| YU35142B (en) | 1980-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL28863A (en) | Pharmaceutical compositions containing homopyrimidazole derivatives,new homopyrimidazole derivatives and processes for the preparation thereof | |
| IL29569A (en) | 1,4-dihydropyridine derivatives and their production | |
| US3558775A (en) | Therapeutical composition containing mercapto-benzimidazoles | |
| JPH0313235B2 (enExample) | ||
| JPH059424B2 (enExample) | ||
| Cannon et al. | Congeners of the. alpha. conformer of dopamine derived from octahydrobenz [h] isoquinoline | |
| US4083985A (en) | 6-Oxa-1-aza tricyclo dodecan-5-ones as psychomotor stimulators | |
| IE60267B1 (en) | Centrally-acting muscle relaxants | |
| JPH06511231A (ja) | 2−(ピロリジニル−1−メチル)−ピペリジン誘導体およびκ受容体アゴニストとしてのその使用 | |
| NZ211139A (en) | Isoxazoles and pharmaceutical compositions | |
| Mashkovsky et al. | Relationships between the chemical structure and pharmacological activity in a series of synthetic quinuclidine derivatives | |
| US4638009A (en) | Derivatives of 3-pyrrolidinopropiophenone and a process for preparation thereof | |
| US3973027A (en) | Analgesic method containing Lysine 2-(2-methyl-3-chloro-anilino)-3-nicotinate | |
| US2776993A (en) | 1-paramethoxyphenyl-2-cyclopentylamino-1-propanol compounds | |
| US4139621A (en) | N-(4-substituted-3,5-dichloro-phenyl)-piperazines | |
| US4055664A (en) | Pharmaceutical preparations containing 4-(4-biphenylyl) butylamines and treatment of the animal organism therewith | |
| US3923992A (en) | Analgetic composition and method of use | |
| CS241475B2 (en) | Method of 1,2-bis/(nicotinamido/)-propane preparation | |
| US3636223A (en) | Therapeutic treatment of parkinson's disease | |
| US3632628A (en) | Sulfonamidoalkyl amino acids | |
| US3005818A (en) | 1-phenyl-2, 3-dimethyl-4-morpholino methyl pyrazolone-(5) compounds | |
| US3436458A (en) | Antispasmodic and gastric antisecretory compositions containing rho-phenylphenacyl derivatives of 1-hyoscyamine and d,1-tropylatropine | |
| US3958002A (en) | Medicaments having psychotropic properties (antitussives) | |
| SU1447283A3 (ru) | Способ получени конденсированных производных @ S-триазина | |
| US3056792A (en) | Unsymmetrical 1, 3-diamino-2-propanols |