IL28768A - Process for the preparation of nitroimidazole carbamates - Google Patents
Process for the preparation of nitroimidazole carbamatesInfo
- Publication number
- IL28768A IL28768A IL28768A IL2876867A IL28768A IL 28768 A IL28768 A IL 28768A IL 28768 A IL28768 A IL 28768A IL 2876867 A IL2876867 A IL 2876867A IL 28768 A IL28768 A IL 28768A
- Authority
- IL
- Israel
- Prior art keywords
- methyl
- carbamate
- nitroimidazole
- imidazole
- hydroxymethyl
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- CGRNNEJYAQQCOQ-UHFFFAOYSA-N carbamic acid;2-nitro-1h-imidazole Chemical class NC(O)=O.[O-][N+](=O)C1=NC=CN1 CGRNNEJYAQQCOQ-UHFFFAOYSA-N 0.000 title 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 37
- 238000000034 method Methods 0.000 claims description 20
- -1 carbamate ester Chemical class 0.000 claims description 16
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 8
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical group CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 7
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 claims description 6
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical group COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000001118 alkylidene group Chemical group 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- JSAQDPJIVQMBAY-UHFFFAOYSA-N (1-methyl-5-nitroimidazol-2-yl)methanol Chemical group CN1C(CO)=NC=C1[N+]([O-])=O JSAQDPJIVQMBAY-UHFFFAOYSA-N 0.000 claims 1
- KLQMSCYASYAWMG-UHFFFAOYSA-N 1-(1-methyl-5-nitroimidazol-2-yl)ethanol Chemical group CC(O)C1=NC=C([N+]([O-])=O)N1C KLQMSCYASYAWMG-UHFFFAOYSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- YZEUHQHUFTYLPH-UHFFFAOYSA-N 2-nitroimidazole Chemical compound [O-][N+](=O)C1=NC=CN1 YZEUHQHUFTYLPH-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KDJVUTSOHYQCDQ-UHFFFAOYSA-N carbamic acid;1h-imidazole Chemical class NC([O-])=O.[NH2+]1C=CN=C1 KDJVUTSOHYQCDQ-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000005809 transesterification reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- PNOXNTGLSKTMQO-UHFFFAOYSA-L diacetyloxytin Chemical compound CC(=O)O[Sn]OC(C)=O PNOXNTGLSKTMQO-UHFFFAOYSA-L 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- LQRUPWUPINJLMU-UHFFFAOYSA-N dioctyl(oxo)tin Chemical compound CCCCCCCC[Sn](=O)CCCCCCCC LQRUPWUPINJLMU-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 2
- VKNJBTMMRCVSOH-UHFFFAOYSA-N 1-methyl-4-nitroimidazole-2-carbaldehyde Chemical compound CN1C=C([N+]([O-])=O)N=C1C=O VKNJBTMMRCVSOH-UHFFFAOYSA-N 0.000 description 1
- OFGDSGVGRWPQJQ-UHFFFAOYSA-N 1h-imidazol-1-ium;acetate Chemical compound CC(O)=O.C1=CNC=N1 OFGDSGVGRWPQJQ-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- FFYTTYVSDVWNMY-UHFFFAOYSA-N 2-Methyl-5-nitroimidazole Chemical compound CC1=NC=C([N+]([O-])=O)N1 FFYTTYVSDVWNMY-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GEPNZFMLBLNJDW-UHFFFAOYSA-N C(N)(O)=O.[N+](=O)([O-])C1=CN=CN1 Chemical class C(N)(O)=O.[N+](=O)([O-])C1=CN=CN1 GEPNZFMLBLNJDW-UHFFFAOYSA-N 0.000 description 1
- 241000948219 Histomonas Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 208000005448 Trichomonas Infections Diseases 0.000 description 1
- 206010044620 Trichomoniasis Diseases 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 1
- WNVQCJNZEDLILP-UHFFFAOYSA-N dimethyl(oxo)tin Chemical compound C[Sn](C)=O WNVQCJNZEDLILP-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 244000000040 protozoan parasite Species 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- KEAYESYHFKHZAL-BJUDXGSMSA-N sodium-22 Chemical compound [22Na] KEAYESYHFKHZAL-BJUDXGSMSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/94—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by oxygen or sulfur atoms, attached to other ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US58982666A | 1966-10-27 | 1966-10-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28768A true IL28768A (en) | 1971-06-23 |
Family
ID=24359707
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28768A IL28768A (en) | 1966-10-27 | 1967-10-16 | Process for the preparation of nitroimidazole carbamates |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3459764A (forum.php) |
| AT (1) | AT285623B (forum.php) |
| BE (1) | BE705674A (forum.php) |
| CH (1) | CH490388A (forum.php) |
| DE (1) | DE1695500C3 (forum.php) |
| DK (1) | DK116060B (forum.php) |
| FI (1) | FI48084C (forum.php) |
| GB (1) | GB1179750A (forum.php) |
| GR (1) | GR34475B (forum.php) |
| IL (1) | IL28768A (forum.php) |
| NL (1) | NL6713876A (forum.php) |
| NO (1) | NO123571B (forum.php) |
| SE (1) | SE337593B (forum.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2054504B1 (forum.php) * | 1969-07-18 | 1973-06-08 | Rhone Poulenc Sa | |
| US3626069A (en) * | 1970-12-30 | 1971-12-07 | Merck & Co Inc | Growth promotion |
| DE2101111A1 (de) * | 1971-01-12 | 1972-08-03 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Imidazoly 1-ketoxim-carbamate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Insektizide |
| CN102584588A (zh) * | 2012-02-07 | 2012-07-18 | 广东轻工职业技术学院 | 一种催化酯交换反应制备肉桂酸正戊酯的方法 |
| CN102584587B (zh) * | 2012-02-07 | 2015-03-11 | 广东轻工职业技术学院 | 一种催化酯交换反应制备肉桂酸正丁酯的方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2689866A (en) * | 1951-05-03 | 1954-09-21 | Abbott Lab | Alpha-phenyl propyl allophanate and process of preparing same |
-
1966
- 1966-10-27 US US589826A patent/US3459764A/en not_active Expired - Lifetime
-
1967
- 1967-10-12 NL NL6713876A patent/NL6713876A/xx unknown
- 1967-10-16 IL IL28768A patent/IL28768A/en unknown
- 1967-10-16 NO NO170138A patent/NO123571B/no unknown
- 1967-10-17 GR GR670134475A patent/GR34475B/el unknown
- 1967-10-17 FI FI672781A patent/FI48084C/fi active
- 1967-10-17 SE SE14197/67A patent/SE337593B/xx unknown
- 1967-10-18 CH CH1453267A patent/CH490388A/de not_active IP Right Cessation
- 1967-10-23 GB GB48101/67A patent/GB1179750A/en not_active Expired
- 1967-10-25 AT AT968267A patent/AT285623B/de not_active IP Right Cessation
- 1967-10-26 DK DK533267AA patent/DK116060B/da not_active IP Right Cessation
- 1967-10-26 BE BE705674D patent/BE705674A/xx unknown
- 1967-10-26 DE DE1695500A patent/DE1695500C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NO123571B (forum.php) | 1971-12-13 |
| BE705674A (forum.php) | 1968-04-26 |
| DK116060B (da) | 1969-12-08 |
| GB1179750A (en) | 1970-01-28 |
| SE337593B (forum.php) | 1971-08-16 |
| AT285623B (de) | 1970-11-10 |
| DE1695500C3 (de) | 1978-09-14 |
| US3459764A (en) | 1969-08-05 |
| FI48084B (forum.php) | 1974-02-28 |
| GR34475B (el) | 1968-05-14 |
| DE1695500A1 (de) | 1971-04-15 |
| FI48084C (fi) | 1974-06-10 |
| DE1695500B2 (de) | 1978-01-19 |
| CH490388A (de) | 1970-05-15 |
| NL6713876A (forum.php) | 1968-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO170138B (no) | Framgangsmaate og apparat for kapping og avgrading av roer | |
| EP0000533B1 (de) | N-Substituierte 9,10-Dihydrolysergsäureester sowie ein Verfahren zu deren Herstellung | |
| SU691089A3 (ru) | Способ получени карбонилзамещенных 1-сульфонилбензимидазолов | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| US2921961A (en) | Unsaturated ethers of 2-acyl-4-aminophenols | |
| IL28768A (en) | Process for the preparation of nitroimidazole carbamates | |
| US3652579A (en) | 1-methyl-2-substituted 5-nitroimidazoles | |
| US3341548A (en) | Nitroimidazoles and their preparation | |
| US2740781A (en) | 3, 26-dihydroxy-16, 22-imino-5-cholestenes, 3, 26-dihydroxy-16, 22-imino-5, 16, 20(22)-cholestatrienes and derivatives thereof | |
| US3450710A (en) | Process for the preparation of nitroimidazole carbamates | |
| US4560764A (en) | Synthesis of an imidazolyl isothiourea | |
| US3290328A (en) | 2-hydroxymethyl-5-nitroimidazoles and process | |
| US4468518A (en) | Imidazole guanidine compounds and method of making same | |
| US2926167A (en) | Process of esterifying ib-hydroxy | |
| US3390150A (en) | Process for the preparation of 1-(beta-hydroxyethyl)-5-nitroimidazole-2-carboxylic acid gamma-lactone | |
| DE1965980B2 (de) | 2-(23-Dioxopiperazino)-benzophenone und Verfahren zu ihrer Herstellung | |
| US2701250A (en) | Process of producing indole-3-acetic acids | |
| US3644392A (en) | 1-substituted-5-nitroimidazole-2-carboximidates | |
| US2430006A (en) | 4-methyl-5-imidazolone-(2)-caproic acid and esters thereof | |
| US4520201A (en) | Synthesis of cimetidine and analogs thereof | |
| DE1695188C3 (de) | Verfahren zur Herstellung von l-Alkyl^-chlor^-dihydro-S-phenyl-IH-1,4-benzodiazepinen | |
| SU150791A1 (ru) | Способ получени производных фенотиазина | |
| DE1643014C3 (de) | Verfahren zur Herstellung von Cardenoliden | |
| US2519720A (en) | Synthesis of thiolactones | |
| US4249018A (en) | Synthesis of citric acid or citrates |