IL26910A - Derivatives of furyl-methyl esters of cyclopropane carboxylic acid and their use as insecticides - Google Patents
Derivatives of furyl-methyl esters of cyclopropane carboxylic acid and their use as insecticidesInfo
- Publication number
- IL26910A IL26910A IL26910A IL2691066A IL26910A IL 26910 A IL26910 A IL 26910A IL 26910 A IL26910 A IL 26910A IL 2691066 A IL2691066 A IL 2691066A IL 26910 A IL26910 A IL 26910A
- Authority
- IL
- Israel
- Prior art keywords
- group
- acid
- hydrogen atom
- compounds
- furylmethyl
- Prior art date
Links
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 title claims description 6
- 239000002917 insecticide Substances 0.000 title description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 51
- 150000002148 esters Chemical class 0.000 claims description 32
- -1 alkali metal alkoxide Chemical class 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 29
- 239000002253 acid Substances 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 230000000749 insecticidal effect Effects 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 241000238631 Hexapoda Species 0.000 claims description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- VIMXTGUGWLAOFZ-UHFFFAOYSA-N ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CCOC(=O)C1C(C=C(C)C)C1(C)C VIMXTGUGWLAOFZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 238000005809 transesterification reaction Methods 0.000 claims description 4
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- VNTCVNLNEOVBEE-UHFFFAOYSA-N 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride Chemical compound CC(C)=CC1C(C(Cl)=O)C1(C)C VNTCVNLNEOVBEE-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 150000004820 halides Chemical group 0.000 claims description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 150000001722 carbon compounds Chemical class 0.000 claims 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 150000008065 acid anhydrides Chemical class 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 150000002366 halogen compounds Chemical class 0.000 claims 1
- 239000003701 inert diluent Substances 0.000 claims 1
- 125000005270 trialkylamine group Chemical group 0.000 claims 1
- 235000019441 ethanol Nutrition 0.000 description 47
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical class OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 241000250966 Tanacetum cinerariifolium Species 0.000 description 8
- 231100000331 toxic Toxicity 0.000 description 8
- 230000002588 toxic effect Effects 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Substances OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 7
- 229940015367 pyrethrum Drugs 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 230000003078 antioxidant effect Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- ZCVAOQKBXKSDMS-AQYZNVCMSA-N (+)-trans-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-AQYZNVCMSA-N 0.000 description 4
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 description 4
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 4
- 241000255925 Diptera Species 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- 239000005977 Ethylene Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229940024113 allethrin Drugs 0.000 description 4
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 230000032050 esterification Effects 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- 125000000468 ketone group Chemical group 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- 229960005235 piperonyl butoxide Drugs 0.000 description 4
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000001117 sulphuric acid Substances 0.000 description 4
- 235000011149 sulphuric acid Nutrition 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- AFEOKIGLYCQHAZ-UHFFFAOYSA-N (5-benzylfuran-3-yl)methanol Chemical compound OCC1=COC(CC=2C=CC=CC=2)=C1 AFEOKIGLYCQHAZ-UHFFFAOYSA-N 0.000 description 3
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 3
- DKMROQRQHGEIOW-UHFFFAOYSA-N Diethyl succinate Chemical compound CCOC(=O)CCC(=O)OCC DKMROQRQHGEIOW-UHFFFAOYSA-N 0.000 description 3
- 241000257226 Muscidae Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002085 enols Chemical group 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 238000003197 gene knockdown Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 231100001225 mammalian toxicity Toxicity 0.000 description 3
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 229940070846 pyrethrins Drugs 0.000 description 3
- 239000002728 pyrethroid Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- QFMDFTQOJHFVNR-UHFFFAOYSA-N 1-[2,2-dichloro-1-(4-ethylphenyl)ethyl]-4-ethylbenzene Chemical compound C1=CC(CC)=CC=C1C(C(Cl)Cl)C1=CC=C(CC)C=C1 QFMDFTQOJHFVNR-UHFFFAOYSA-N 0.000 description 2
- OPLCSTZDXXUYDU-UHFFFAOYSA-N 2,4-dimethyl-6-tert-butylphenol Chemical compound CC1=CC(C)=C(O)C(C(C)(C)C)=C1 OPLCSTZDXXUYDU-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical class CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 229950011148 cyclopropane Drugs 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- XEMLEMIOCGLVMR-UHFFFAOYSA-N ethyl 5-benzylfuran-3-carboxylate Chemical compound CCOC(=O)C1=COC(CC=2C=CC=CC=2)=C1 XEMLEMIOCGLVMR-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- DGEHQARARXBTFY-UHFFFAOYSA-N methyl 5-benzylfuran-3-carboxylate Chemical compound COC(=O)C1=COC(CC=2C=CC=CC=2)=C1 DGEHQARARXBTFY-UHFFFAOYSA-N 0.000 description 2
- ZKHQSQYLKSSYIP-UHFFFAOYSA-N methyl furan-3-carboxylate Chemical compound COC(=O)C=1C=COC=1 ZKHQSQYLKSSYIP-UHFFFAOYSA-N 0.000 description 2
- 239000012875 nonionic emulsifier Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 2
- 229940048383 pyrethrum extract Drugs 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 150000003443 succinic acid derivatives Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- UIWNHGWOYRFCSF-KTERXBQFSA-N (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound COC(=O)C(\C)=C\[C@@H]1[C@@H](C(O)=O)C1(C)C UIWNHGWOYRFCSF-KTERXBQFSA-N 0.000 description 1
- FMCAFXHLMUOIGG-JTJHWIPRSA-N (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-JTJHWIPRSA-N 0.000 description 1
- XLOPRKKSAJMMEW-SFYZADRCSA-M (R,R)-chrysanthemate Chemical compound CC(C)=C[C@@H]1[C@@H](C([O-])=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-M 0.000 description 1
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical group CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- XNRCGJVOJYKMSA-UHFFFAOYSA-N 5-[bis[2-(2-butoxyethoxy)ethoxy]methyl]-1,3-benzodioxole Chemical compound CCCCOCCOCCOC(OCCOCCOCCCC)C1=CC=C2OCOC2=C1 XNRCGJVOJYKMSA-UHFFFAOYSA-N 0.000 description 1
- GBFQMYZCARWIAY-UHFFFAOYSA-N 5-benzylfuran-3-carboxylic acid Chemical compound OC(=O)C1=COC(CC=2C=CC=CC=2)=C1 GBFQMYZCARWIAY-UHFFFAOYSA-N 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000003512 Claisen condensation reaction Methods 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 102000020897 Formins Human genes 0.000 description 1
- 108091022623 Formins Proteins 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 241001608568 Phaedon Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 235000017372 Piretro di Dalmazia Nutrition 0.000 description 1
- UIWNHGWOYRFCSF-UHFFFAOYSA-N Pyrethric acid Natural products COC(=O)C(C)=CC1C(C(O)=O)C1(C)C UIWNHGWOYRFCSF-UHFFFAOYSA-N 0.000 description 1
- VMORCWYWLVLMDG-YZGWKJHDSA-N Pyrethrin-II Natural products CC(=O)OC(=C[C@@H]1[C@H](C(=O)O[C@H]2CC(=O)C(=C2C)CC=CC=C)C1(C)C)C VMORCWYWLVLMDG-YZGWKJHDSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 125000005741 alkyl alkenyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- TZIHFWKZFHZASV-UHFFFAOYSA-N anhydrous methyl formate Natural products COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- PWXMEBZOKUPCST-UHFFFAOYSA-N methyl 5-(chloromethyl)furan-2-carboxylate Chemical compound COC(=O)C1=CC=C(CCl)O1 PWXMEBZOKUPCST-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- ROVGZAWFACYCSP-VUMXUWRFSA-N pyrethrin I Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-VUMXUWRFSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/84—Unsaturated compounds containing keto groups containing six membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/30—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Catching Or Destruction (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB52406/65A GB1168797A (en) | 1965-12-09 | 1965-12-09 | Cyclopropane Carboxylic Acid Derivatives and their use as Insecticides |
| GB3778866A GB1168798A (en) | 1965-12-09 | 1965-12-09 | Furan Derivatives and a Process for Their Preparation. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26910A true IL26910A (en) | 1971-06-23 |
Family
ID=26263575
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26910A IL26910A (en) | 1965-12-09 | 1966-11-21 | Derivatives of furyl-methyl esters of cyclopropane carboxylic acid and their use as insecticides |
| IL30842A IL30842A (en) | 1965-12-09 | 1966-11-21 | Furan derivatives and process for their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30842A IL30842A (en) | 1965-12-09 | 1966-11-21 | Furan derivatives and process for their preparation |
Country Status (15)
| Country | Link |
|---|---|
| US (3) | US3466304A (enFirst) |
| AT (3) | AT285590B (enFirst) |
| BE (1) | BE690984A (enFirst) |
| CA (1) | CA1030152A (enFirst) |
| CH (3) | CH513587A (enFirst) |
| DE (3) | DE1543804A1 (enFirst) |
| DK (3) | DK128607B (enFirst) |
| ES (1) | ES334365A1 (enFirst) |
| FR (1) | FR1503260A (enFirst) |
| GB (1) | GB1168797A (enFirst) |
| IL (2) | IL26910A (enFirst) |
| NL (3) | NL6617119A (enFirst) |
| NO (1) | NO118155B (enFirst) |
| OA (1) | OA02187A (enFirst) |
| SE (3) | SE353719B (enFirst) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3968238A (en) * | 1966-06-28 | 1976-07-06 | Dainippon Jochugiku Kabushiki Kaisha | 5-Acetyl furfurylester of chrysanthemumic acid |
| US3992526A (en) * | 1966-06-28 | 1976-11-16 | Dainippon Jochugiku Kabushiki Kaisha | 5-Ethoxymethyl furfuryl ester of chrysanthemumic acid and its use as an insecticide |
| US3932470A (en) * | 1966-06-28 | 1976-01-13 | Dainippon Jochugiku Kabushiki Kaisha | Substituted furfurylesters of chrysantheumumic acid |
| US3982013A (en) * | 1966-06-28 | 1976-09-21 | Dainippon Jochugiku Kabushiki Kaisha | 5-Phenylvinylfurfurylester of chrysanthemumic acid |
| US3832467A (en) * | 1967-08-11 | 1974-08-27 | Sumitomo Chemical Co | Insecticidal chrysanthemate compositions and their method of use |
| US3669989A (en) * | 1968-06-13 | 1972-06-13 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| DE2005489C3 (de) * | 1969-02-07 | 1982-04-15 | Roussel-Uclaf, 75007 Paris | cis-3,3-Dimethyl-2S-(2'-R↓1↓-2'-R↓2↓-vinyl)-cyclopropan-1R-carbonsäure-5"-benzyl-3"-furylmethylester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende insektizide Mittel |
| US3857858A (en) * | 1969-04-08 | 1974-12-31 | Sumitomo Chemical Co | Cyclopropane carboxylic acid esters |
| FR2045177A5 (enFirst) * | 1969-06-13 | 1971-02-26 | Roussel Uclaf | |
| FR2077677B1 (enFirst) * | 1970-02-04 | 1973-05-25 | Roussel Uclaf | |
| US3835220A (en) * | 1970-03-19 | 1974-09-10 | Sumitomo Chemical Co | Insecticidal composition comprising vinylcyclopropanecarboxylates |
| US3716560A (en) * | 1970-03-26 | 1973-02-13 | Sumitomo Chemical Co | 4,5-tetramethylene furfuryl and 4,5-tetramethylene-3-furylmethyl chrysanthemates |
| JPS4821487B1 (enFirst) * | 1970-08-04 | 1973-06-29 | ||
| US3755368A (en) * | 1971-03-01 | 1973-08-28 | Penick S & Co | Formylation of carboxylic compounds with carbon monoxide |
| US3873716A (en) * | 1971-03-01 | 1975-03-25 | Procter & Gamble | Insecticidal esters of chrysanthemic acid and alcohols related to 3-hydroxymethylbenzofuran |
| US4622337A (en) * | 1972-05-25 | 1986-11-11 | National Research Development Corporation | 2,2-dimethyl-3-(2-halovinyl)cyclopropane carboxlic acid ester pesticides |
| GB1410080A (en) * | 1972-12-21 | 1975-10-15 | Nat Res Dev | Oxime derivatives of 2,2-dimethyl-3-formyl cyclopropane carboxylic acid and their use as insecticides |
| US3994882A (en) * | 1974-07-22 | 1976-11-30 | Kabushiki Kaisha Ueno Seiyaku Oyo Kenkyujo | Nitrofuran derivatives, process for the preparation thereof and compositions containing same as active ingredient |
| FI53971C (fi) * | 1974-08-15 | 1978-09-11 | Kemira Oy | Foerfarande foer framstaellning av estrar av furfuryalkohol eller dess derivat med laegre alifatiska karbonsyror |
| US4220591A (en) * | 1975-11-26 | 1980-09-02 | Commonwealth Scientific And Industrial Research Organization | Insecticidal esters |
| FR2341307A1 (fr) * | 1976-02-19 | 1977-09-16 | Roussel Uclaf | Pyrethrinoides a titre de medicaments et compositions pharmaceutiques les renfermant |
| LU75478A1 (enFirst) | 1976-07-28 | 1978-02-08 | ||
| FR2364884A1 (fr) * | 1976-09-21 | 1978-04-14 | Roussel Uclaf | Nouveaux esters d'acides cyclopropane, carboxyliques comportant un substituant polyhalogene, procedes de preparation et compositions insecticides les renfermant |
| SE446527B (sv) * | 1976-09-21 | 1986-09-22 | Roussel Uclaf | Nya cyklopropankarboxylsyraestrar med en polyhalogenerad substituent, sett for framstellning derav samt anvendning derav i pesticidkompositioner |
| US4234582A (en) * | 1978-05-10 | 1980-11-18 | Chugai Seiyaku Kabushiki Kaisha | Trialkyl isocyanates used as pesticides |
| FR2426673A1 (fr) * | 1978-05-25 | 1979-12-21 | Nat Res Dev | Pesticides du type pyrethrine |
| US4356023A (en) * | 1980-06-30 | 1982-10-26 | Shell Oil Company | Certain herbicidal tetrahydrofurans |
| US4676977A (en) * | 1982-06-28 | 1987-06-30 | Roussel Uclaf | Stabilized pesticidal emulsions |
| US4677117A (en) * | 1982-06-28 | 1987-06-30 | Roussel Uclaf | Stabilized pesticidal compositions |
| US4477679A (en) * | 1983-03-01 | 1984-10-16 | Cpc International Inc. | Production of alkyl-5-substituted-3-furoate compounds |
| DE3546371A1 (de) * | 1985-12-31 | 1987-07-02 | Basf Ag | Pyrethroide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen sowie vorprodukte fuer die herstellung der pyrethroide |
| DE10007411A1 (de) | 2000-02-18 | 2001-08-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| AR029677A1 (es) | 2000-06-29 | 2003-07-10 | Bayer Ag | Combinaciones de compuestos activos con propiedades insecticidas y acaricidas |
| DE102004001271A1 (de) | 2004-01-08 | 2005-08-04 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| ES2387927T3 (es) | 2004-12-17 | 2012-10-04 | Devgen Nv | Composiciones nematicidas |
| JP5066843B2 (ja) * | 2006-06-15 | 2012-11-07 | 住友化学株式会社 | エステル化合物及びその有害生物防除用途 |
| DE102006046688B3 (de) * | 2006-09-29 | 2008-01-24 | Siemens Ag | Kälteanlage mit einem warmen und einem kalten Verbindungselement und einem mit den Verbindungselementen verbundenen Wärmerohr |
| DE102007045953B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| KR101647706B1 (ko) | 2009-03-25 | 2016-08-11 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 살충 및 살비성을 지니는 활성 성분 배합물 |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
| CN103058897A (zh) * | 2012-12-27 | 2013-04-24 | 苏州大学 | 一种手性β-羟基磺酰胺的制备方法 |
| DE102014107739B4 (de) | 2014-06-02 | 2023-12-07 | Jacques Tchouangueu | Moskitonetz mit Insektenfalle |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2470349A (en) * | 1945-05-29 | 1949-05-17 | California Spray Chemical Corp | Cyclopropyl furyl propenone |
| US2891889A (en) * | 1953-11-20 | 1959-06-23 | Union Carbide Corp | Insecticidal compositions containing cyclethrin |
| US3101296A (en) * | 1959-11-09 | 1963-08-20 | Harvel Res Corp | Synergistic insecticidal composition |
| BE635902A (enFirst) * | 1962-08-06 | |||
| BE660565A (enFirst) * | 1963-03-18 |
-
1965
- 1965-12-09 GB GB52406/65A patent/GB1168797A/en not_active Expired
-
1966
- 1966-11-21 IL IL26910A patent/IL26910A/en unknown
- 1966-11-21 IL IL30842A patent/IL30842A/xx unknown
- 1966-11-23 DK DK604566AA patent/DK128607B/da not_active IP Right Cessation
- 1966-11-28 SE SE16271/68A patent/SE353719B/xx unknown
- 1966-11-28 SE SE16272/68A patent/SE353906B/xx unknown
- 1966-11-28 SE SE16259/66A patent/SE325582B/xx unknown
- 1966-12-02 CA CA976,970A patent/CA1030152A/en not_active Expired
- 1966-12-05 FR FR86170A patent/FR1503260A/fr not_active Expired
- 1966-12-05 US US598901A patent/US3466304A/en not_active Expired - Lifetime
- 1966-12-05 US US598923A patent/US3465007A/en not_active Expired - Lifetime
- 1966-12-06 NO NO165885A patent/NO118155B/no unknown
- 1966-12-06 NL NL6617119A patent/NL6617119A/xx unknown
- 1966-12-08 CH CH1748866A patent/CH513587A/fr not_active IP Right Cessation
- 1966-12-08 CH CH1120171A patent/CH524593A/fr not_active IP Right Cessation
- 1966-12-08 DE DE19661543804 patent/DE1543804A1/de active Pending
- 1966-12-08 DE DE19661543805 patent/DE1543805B1/de active Granted
- 1966-12-08 CH CH1654768A patent/CH507931A/fr not_active IP Right Cessation
- 1966-12-08 DE DE1793559A patent/DE1793559C3/de not_active Expired
- 1966-12-09 OA OA52688A patent/OA02187A/xx unknown
- 1966-12-09 BE BE690984D patent/BE690984A/xx not_active IP Right Cessation
- 1966-12-09 ES ES334365A patent/ES334365A1/es not_active Expired
- 1966-12-09 AT AT10130/68A patent/AT285590B/de not_active IP Right Cessation
- 1966-12-09 AT AT05936/68A patent/AT279599B/de not_active IP Right Cessation
- 1966-12-09 AT AT1138366A patent/AT275238B/de active
-
1968
- 1968-10-16 DK DK497368AA patent/DK136035B/da not_active IP Right Cessation
- 1968-10-16 DK DK497468A patent/DK136036C/da not_active IP Right Cessation
-
1969
- 1969-03-14 US US807406A patent/US3542928A/en not_active Expired - Lifetime
- 1969-11-20 NL NL6917481A patent/NL6917481A/xx unknown
- 1969-11-20 NL NL6917482A patent/NL6917482A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT275238B (de) | 1969-10-10 |
| DK128607B (da) | 1974-06-04 |
| DK136036B (da) | 1977-08-01 |
| CA1030152A (en) | 1978-04-25 |
| CH507931A (fr) | 1971-05-31 |
| NL6917482A (enFirst) | 1970-01-26 |
| SE325582B (enFirst) | 1970-07-06 |
| SE353719B (enFirst) | 1973-02-12 |
| AT279599B (de) | 1970-03-10 |
| FR1503260A (fr) | 1967-11-24 |
| ES334365A1 (es) | 1967-10-16 |
| GB1168797A (en) | 1969-10-29 |
| DK136036C (da) | 1977-12-27 |
| CH524593A (fr) | 1972-06-30 |
| SE353906B (enFirst) | 1973-02-19 |
| US3542928A (en) | 1970-11-24 |
| NO118155B (enFirst) | 1969-11-17 |
| DK136035C (enFirst) | 1978-01-09 |
| NL6617119A (enFirst) | 1967-06-12 |
| US3466304A (en) | 1969-09-09 |
| CH513587A (fr) | 1971-10-15 |
| DE1543805B1 (de) | 1972-05-31 |
| DE1793559C3 (de) | 1973-11-15 |
| OA02187A (fr) | 1970-05-05 |
| AT285590B (de) | 1970-11-10 |
| NL6917481A (enFirst) | 1970-01-26 |
| DE1543804A1 (de) | 1970-01-02 |
| DE1793559B2 (de) | 1973-04-12 |
| DK136035B (da) | 1977-08-01 |
| IL30842A (en) | 1971-11-29 |
| BE690984A (enFirst) | 1967-05-16 |
| DE1793559A1 (de) | 1972-03-09 |
| US3465007A (en) | 1969-09-02 |
| DE1543805C2 (enFirst) | 1973-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL26910A (en) | Derivatives of furyl-methyl esters of cyclopropane carboxylic acid and their use as insecticides | |
| JPH0355442B2 (enFirst) | ||
| US3358011A (en) | Pyrethric and chrysanthemic acid esters of 4-(alkenyl, cycloalkenyl or alkadienyl) benzyl alcohol and alkyl substituted 4-(alkenyl, cycloalkenyl or alkadienyl) benzyl alcohol | |
| KR840001341B1 (ko) | 시클로프로판 카복실산 유도체의 제조방법 | |
| DE2547534A1 (de) | Cyclopropancarbonsaeureester | |
| US3766218A (en) | Novel substituted chrysanthemates | |
| JPS6366179A (ja) | トリアゾ−ル基またはイミダゾ−ル基を含有する2,5−ジヒドロフラン誘導体、その製造方法、および該誘導体を含有する殺菌剤 | |
| US3716560A (en) | 4,5-tetramethylene furfuryl and 4,5-tetramethylene-3-furylmethyl chrysanthemates | |
| US3867542A (en) | Certain substituted chrysanthemates as insecticides | |
| US3835220A (en) | Insecticidal composition comprising vinylcyclopropanecarboxylates | |
| DE2437882C3 (de) | Verfahren zur Herstellung von Estern des 3-Phenoxybenzylalkohols | |
| DE2359891A1 (de) | Verfahren zur herstellung von furanonderivaten | |
| CA1045635A (en) | .beta.-PHENOXY OR SUBSTITUTED PHENOXY ETHANOL COMPOUNDS | |
| NO155707B (no) | Sikkerhetsventil. | |
| DE2113124B2 (de) | Cyclopropancarbonsaureester, Ver fahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| US3325515A (en) | Coumarin derivatives and their preparation | |
| US4116998A (en) | Preparation of esters of m-phenoxybenzyl alcohol and its α-cyano and α-ethinyl derivatives with 2,2-dimethylcyclopropanecarboxylic acids | |
| JPH036122B2 (enFirst) | ||
| DE2356702A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure | |
| US3647824A (en) | Substituted furoic acids and esters thereof | |
| US3442913A (en) | 2-(trifluoromethyl)-3-fuoricacid esters and other 2 - fluoromethyl furan derivatives | |
| US2594355A (en) | Production of hydroxylated aliphatic compounds including hydroxylated aliphatic carboxylic acids and lactones thereof | |
| CA1197856A (en) | Cyclopropane carboxylic aci derivatives | |
| JPS5989638A (ja) | アリ−ルオキシアルキル化合物の製造法 | |
| JPWO1996024573A1 (ja) | 新規カルボン酸エステル誘導体、その製造法、及びこれを含有する殺虫、防虫剤 |