IL22669A - (Alaoxy-low benzamide) -New pyrolidines and piperidines - Google Patents
(Alaoxy-low benzamide) -New pyrolidines and piperidinesInfo
- Publication number
- IL22669A IL22669A IL22669A IL2266964A IL22669A IL 22669 A IL22669 A IL 22669A IL 22669 A IL22669 A IL 22669A IL 2266964 A IL2266964 A IL 2266964A IL 22669 A IL22669 A IL 22669A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- solution
- added
- dissolved
- sodium
- Prior art date
Links
- 150000003053 piperidines Chemical class 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 21
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims 5
- 238000000034 method Methods 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000007787 solid Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- RJWJCQLFAYQGBG-UHFFFAOYSA-L disodium;sulfite;hydrate Chemical compound [OH-].[Na+].[Na+].OS([O-])=O RJWJCQLFAYQGBG-UHFFFAOYSA-L 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- SKIIKRJAQOSWFT-UHFFFAOYSA-N 2-[3-[1-(2,2-difluoroethyl)piperidin-4-yl]oxy-4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound FC(CN1CCC(CC1)OC1=NN(C=C1C=1C=NC(=NC=1)NC1CC2=CC=CC=C2C1)CC(=O)N1CC2=C(CC1)NN=N2)F SKIIKRJAQOSWFT-UHFFFAOYSA-N 0.000 description 1
- QTSWEUQHTHVJLT-UHFFFAOYSA-N 2-sulfamoyloxybenzoic acid Chemical compound NS(=O)(=O)OC1=CC=CC=C1C(O)=O QTSWEUQHTHVJLT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- WCBYBDYERYCDGO-UHFFFAOYSA-K copper sodium chloride sulfate Chemical compound [Cl-].[Na+].S(=O)(=O)([O-])[O-].[Cu+2] WCBYBDYERYCDGO-UHFFFAOYSA-K 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- -1 copper sulfate sodium bromide Chemical compound 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/08—Preparation of nitro compounds by substitution of hydrogen atoms by nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/04—Formation of amino groups in compounds containing carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/36—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids
- C07C303/40—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids by reactions not involving the formation of sulfonamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C315/00—Preparation of sulfones; Preparation of sulfoxides
- C07C315/02—Preparation of sulfones; Preparation of sulfoxides by formation of sulfone or sulfoxide groups by oxidation of sulfides, or by formation of sulfone groups by oxidation of sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/347—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups
- C07C51/363—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quick-Acting Or Multi-Walled Pipe Joints (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US337162A US3342826A (en) | 1964-01-13 | 1964-01-13 | Heterocyclic aminoalkyl benzamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL22669A true IL22669A (en) | 1969-03-27 |
Family
ID=23319376
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL22669A IL22669A (en) | 1964-01-13 | 1964-12-25 | (Alaoxy-low benzamide) -New pyrolidines and piperidines |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3342826A (enFirst) |
| BE (1) | BE658250A (enFirst) |
| BR (1) | BR6566161D0 (enFirst) |
| CH (1) | CH468377A (enFirst) |
| DE (2) | DE1595915C3 (enFirst) |
| DK (1) | DK124402B (enFirst) |
| ES (1) | ES308289A1 (enFirst) |
| FI (1) | FI48273C (enFirst) |
| FR (2) | FR1472025A (enFirst) |
| GB (1) | GB1088531A (enFirst) |
| IL (1) | IL22669A (enFirst) |
| NL (1) | NL6500326A (enFirst) |
| NO (1) | NO119533B (enFirst) |
| OA (1) | OA01859A (enFirst) |
| SE (1) | SE340452B (enFirst) |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3885033A (en) * | 1967-04-03 | 1975-05-20 | Ile De France | Method of anesthetizing a mammal by administration of a substituted 2-arylalkyloxy benzamide |
| US3723416A (en) * | 1967-04-03 | 1973-03-27 | Ile De France | Substituted 2-arylalkyloxy benzamides |
| US3865946A (en) * | 1967-04-03 | 1975-02-11 | Ile De France | Method of anesthetizing a mammal by administration of a substituted 2-arylalkyloxy benzamide |
| US3891671A (en) * | 1968-08-01 | 1975-06-24 | Ile De France | N-(2-pyrrolidyl or piperidyl alkyl)-4-hydroxy benzamides |
| USRE29828E (en) * | 1968-12-23 | 1978-11-07 | A. H. Robins Company, Inc. | 1-Substituted-3-amidopyrrolidines |
| JPS4864066A (enFirst) * | 1971-12-09 | 1973-09-05 | ||
| US4279822A (en) * | 1972-04-03 | 1981-07-21 | A. H. Robins Company, Inc. | N-(1-Substituted-3-pyrrolidinyl)benzamides |
| US3966957A (en) * | 1972-04-03 | 1976-06-29 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| US3963745A (en) * | 1972-04-03 | 1976-06-15 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| CH584688A5 (enFirst) * | 1972-06-23 | 1977-02-15 | Delmar Chem | |
| US3862139A (en) * | 1972-06-23 | 1975-01-21 | Delmar Chem | Heterocyclic benzamide compounds |
| BE793689A (fr) * | 1972-07-19 | 1973-05-02 | Renfag Sa | Procede de preparation d'acides 2-alcoxy-5-alcoysulfonylbenzoique |
| FR2206937B1 (enFirst) * | 1972-11-22 | 1977-01-14 | Ile De France | |
| FR2219156B1 (enFirst) * | 1973-02-28 | 1977-12-30 | Ile De France | |
| FR2219940B1 (enFirst) * | 1973-03-01 | 1976-09-10 | Ile De France | |
| CH605793A5 (fr) * | 1974-03-05 | 1978-10-13 | Soc Et Scient Et Ind | Procédé de préparation de nouveaux N-(1benzylpyrrollidinil 2-alkyl) benzamides substitués |
| GB1507462A (en) * | 1974-03-21 | 1978-04-12 | Gallardo Antonio Sa | N-heterocyclic substituted benzamides methods for their preparation and compositions containing them |
| US4189495A (en) * | 1974-09-17 | 1980-02-19 | Synthelabo | 2-Methoxy-benzamide derivatives |
| US4172143A (en) * | 1974-12-18 | 1979-10-23 | Synthelabo | 2-Methoxy-benzamide derivatives |
| US4158060A (en) * | 1974-12-18 | 1979-06-12 | Synthelabo | 2-Methoxy-benzamide derivatives |
| US4002757A (en) * | 1974-12-26 | 1977-01-11 | A. H. Robins Company, Incorporated | N-(1-substituted-3-pyrrolidinyl)-4-quinolinecarboxamides |
| US4052361A (en) * | 1974-12-30 | 1977-10-04 | American Cyanamid Company | N-(2,2-dimethyl-6,6-di(lower alkyl)-4-piperidinyl)-amides of hindered 3,5-dialkyl-4-hydroxybenzoic acids and use as light stabilizers in polyolefins |
| US4048058A (en) * | 1975-08-13 | 1977-09-13 | Standard Oil Company (Indiana) | Methods to be used in reforming processes employing multi-metallic catalysts |
| US4056535A (en) * | 1975-07-09 | 1977-11-01 | Stanford Research Institute | N-substituted 3-aminopyrrolidines |
| GB1561350A (en) * | 1976-11-05 | 1980-02-20 | May & Baker Ltd | Benzamide derivatives |
| US4163789A (en) * | 1976-02-17 | 1979-08-07 | Anphar, S.A. | Anti-psychotic (cycloalkenylalkylpiperidino) benzamides |
| US4035373A (en) * | 1976-02-23 | 1977-07-12 | The University Of Toledo | Preparation of piperidinyl-alkyl-benzamides |
| US4049821A (en) * | 1976-05-12 | 1977-09-20 | A. H. Robins Company, Inc. | Method of treating allergy |
| US4186135A (en) * | 1976-08-04 | 1980-01-29 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | Substituted 2,3-alkylene bis (oxy) benzamides and derivatives and method of preparation |
| GB1586468A (en) * | 1976-10-29 | 1981-03-18 | Anphar Sa | Piperidine derivatives |
| GB1574418A (en) * | 1976-11-16 | 1980-09-03 | Anphar Sa | Piperidine derivatives |
| NZ186175A (en) * | 1977-01-27 | 1980-03-05 | Shionogi & Co | Meta-sulphonamidobenzamide derivatives |
| DE2730174C2 (de) * | 1977-07-04 | 1981-12-10 | Ludwig Merckle Kg Chem. Pharm. Fabrik, 7902 Blaubeuren | Aminobenzoesäurederivate und Arzneimittel enthaltend solche Aminobenzoesäurederivate |
| US4207327A (en) * | 1977-08-19 | 1980-06-10 | A. H. Robins Company, Inc. | N-(4-Pyrazolidinyl)benzamides and their amino precursors |
| US4143150A (en) * | 1977-08-19 | 1979-03-06 | A. H. Robins Company, Inc. | Derivatives of oxanilic acid |
| FR2415099A1 (fr) * | 1978-01-20 | 1979-08-17 | Ile De France | Nouveaux derives de 4-amino-5-alkylsulfonyl ortho-anisamides, leurs procedes de preparation et leur application comme psychotropes |
| FR2440946A2 (fr) * | 1978-01-20 | 1980-06-06 | Ile De France | Nouveaux benzamides heterocycliques substitues, leurs procedes de preparation et leur application comme modificateurs du comportement |
| SE411118B (sv) * | 1978-03-23 | 1979-12-03 | Astra Laekemedel Ab | Ett forfarande for framstellning av 2,6-dialkoxibensamider med terapentiska egenskaper |
| US4263316A (en) * | 1978-10-11 | 1981-04-21 | Societe D'etudes Scientifiques Et Industrielles De L'ile De France | N-(1-Methyl-2-pyrrolidinylmethyl)-2,3-dimethoxy-5-methylsulfamoyl benzamide and its derivatives, methods of preparing them and their application to the treatment of troubles of the lower part of the body |
| FR2438650A1 (fr) * | 1978-10-11 | 1980-05-09 | Ile De France | N-(1-methyl 2-pyrrolidinyl methyl) 2,3-dimethoxy 5-methylsulfamoyl benzamide et ses derives, leurs methodes de preparation et leur application dans le traitement des troubles du bas appareil urinaire |
| US4210660A (en) * | 1978-12-20 | 1980-07-01 | Yamanouchi Pharmaceutical Co., Ltd. | Benzamide derivatives |
| FR2446274A1 (fr) * | 1979-01-15 | 1980-08-08 | Delalande Sa | Nouveaux derives de salicylamide, leur procede de preparation et leur application en therapeutique |
| FR2447911A1 (fr) * | 1979-02-05 | 1980-08-29 | Synthelabo | Benzamides et leur application en therapeutique |
| FR2489327B1 (fr) * | 1980-08-28 | 1984-05-18 | Ile De France | N (1 allyl 2 pyrrolidinyl methyl) 2 methoxy 4 amino 5 methylsulfa moyl benzamide, son procede de preparation et son application comme medicament |
| SE8101536L (sv) * | 1981-03-11 | 1982-09-12 | Astra Laekemedel Ab | Bensamid-derivat |
| US4470977A (en) * | 1981-06-04 | 1984-09-11 | Adria Laboratories, Inc. | Antiemetic and antipsychotic agents |
| US4962115A (en) * | 1981-10-01 | 1990-10-09 | Janssen Pharmaceutica N.V. | Novel N-(3-hydroxy-4-piperidinyl)benzamide derivatives |
| FR2531083B1 (fr) * | 1982-06-29 | 1986-11-28 | Sandoz Sa | Nouveaux derives de la piperidine, leur preparation et leur utilisation comme medicaments |
| SE8205135D0 (sv) * | 1982-09-09 | 1982-09-09 | Astra Laekemedel Ab | Benzamido-derivatives |
| JPS59186969A (ja) * | 1983-04-08 | 1984-10-23 | Yoshitomi Pharmaceut Ind Ltd | ベンゾフラン−およびベンゾピランカルボキサミド誘導体 |
| WO1985001048A1 (en) * | 1983-08-26 | 1985-03-14 | Sandoz Ag | Aromatic esters or amides of carboxylic acid and sulfonic acid |
| US5175173A (en) * | 1983-12-22 | 1992-12-29 | Sun Jung Hui | Carboxamides useful as antiemetic or antipsychotic agents |
| US4888353A (en) * | 1986-02-28 | 1989-12-19 | Erbamont, Inc. | Carboxamides useful as antiemetic or antipsychotic agents |
| CA1297877C (en) * | 1983-12-22 | 1992-03-24 | Daniel Lednicer | Benzofurancarboxamides useful as antiemetic or antipsychotic agents |
| FR2557110B1 (fr) * | 1983-12-23 | 1989-11-24 | Sandoz Sa | Nouveaux derives d'amines cycliques, leur preparation et leur utilisation comme medicaments |
| FR2556964A1 (fr) * | 1983-12-23 | 1985-06-28 | Ile De France | Nouvelles formes galeniques du sulpiride utilisables par voie orale |
| US5240957A (en) * | 1984-01-31 | 1993-08-31 | Astra Lakemedel Akteibolag | Oxysalicylamido derivatives |
| SE8503054D0 (sv) * | 1985-06-19 | 1985-06-19 | Astra Laekemedel Ab | Catecholcarboxamides |
| FR2584605B1 (fr) * | 1985-07-15 | 1988-06-17 | Ile De France | Application du n-(1-allyl-2-pyrrolidinylmethyl) 2-methoxy 4-amino 5-methylsulfamoyl benzamide dans le traitement de la maladie de parkinson |
| GB8519707D0 (en) | 1985-08-06 | 1985-09-11 | Fordonal Sa | Chemical compounds |
| FR2592042B1 (fr) * | 1985-12-19 | 1988-03-25 | Ile De France | Nouveaux ortho-anisamides, leur procede d'obtention, et leurs applications therapeutiques |
| US4772459A (en) * | 1986-09-09 | 1988-09-20 | Erbamont, Inc. | Method for controlling emesis caused by chemotherapeutic agents and antiemetic agents useful therein |
| JPH0768185B2 (ja) * | 1986-12-23 | 1995-07-26 | セントラル硝子株式会社 | ニトロ置換4―トリフルオロメチル安息香酸の製造方法 |
| GB8708833D0 (en) * | 1987-04-13 | 1987-05-20 | Lilly S A E | Organic compounds |
| US4751236A (en) * | 1987-05-20 | 1988-06-14 | Avihou Mishniot | Method for treating genital herpes |
| DE3782651T2 (de) * | 1987-06-17 | 1993-03-25 | Delagrange Lab | Anwendung von n-(2-(diaethylamino)aethyl)-2-methoxy-4((1-h-4,5-dihydro-2-imidazolyl)amino)-5-chlorobenzamid als anxiolytisches und antipsychotisches mittel. |
| US5154913A (en) * | 1987-11-19 | 1992-10-13 | Vanderbilt University | Radioiodinated benzamines method of their use as radioimaging agents |
| EP0320630A1 (en) * | 1987-11-19 | 1989-06-21 | The Vanderbilt University | Enantiometric iodobenzamides |
| US4952574A (en) * | 1988-09-26 | 1990-08-28 | Riker Laboratories, Inc. | Antiarrhythmic substituted N-(2-piperidylmethyl)benzamides |
| GB8823040D0 (en) * | 1988-09-30 | 1988-11-09 | Lilly Sa | Organic compounds & their use as pharmaceuticals |
| GB8823041D0 (en) * | 1988-09-30 | 1988-11-09 | Lilly Sa | Organic compounds & their use as pharmaceuticals |
| GB8823042D0 (en) * | 1988-09-30 | 1988-11-09 | Lilly Sa | Organic compounds & their use as pharmaceuticals |
| US5254569A (en) * | 1991-01-14 | 1993-10-19 | The Du Pont Merck Pharmaceutical Company | (Amidomethyl)nitrogen heterocyclic analgesics |
| JP3026845B2 (ja) * | 1991-02-20 | 2000-03-27 | 日清製粉株式会社 | ピペリジン誘導体 |
| US5290796A (en) * | 1992-11-20 | 1994-03-01 | Sterling Winthrop Inc. | Substituted 3-piperidinealkanamines and alkanamides and compositions and method of use thereof |
| JP4619655B2 (ja) * | 2001-09-14 | 2011-01-26 | ハイ・ポイント・ファーマスーティカルズ、エルエルシー | 新規アミノアゼチジン、−ピロリジンおよび−ピペリジン誘導体 |
| US6673829B2 (en) | 2001-09-14 | 2004-01-06 | Novo Nordisk A/S | Aminoazetidine,-pyrrolidine and -piperidine derivatives |
| AU2002364553A1 (en) * | 2001-12-28 | 2003-07-15 | Farmaceutsko-Hemijska Industrija "Zdravlje" | A process for synthesis of heterocyclic aminoalkyl benzamides |
| GT200600161A (es) * | 2005-04-22 | 2007-03-14 | Nuevas combinaciones terapeuticas para el tratamiento o la prevencion de los trastornos psicoticos |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2748134A (en) * | 1956-05-29 | Amide-like derivatives of piperidine | ||
| US2691025A (en) * | 1951-03-30 | 1954-10-05 | Sterling Drug Inc | N-(tertiary-aminoalkyl)-2, 4-disubstituted-benzamides and their preparation |
| US2691041A (en) * | 1953-05-21 | 1954-10-05 | Sterling Drug Inc | N-(tertiary-aminoalkyl)-2-substituted-4-nitrobenzamides and their salts |
| GB797476A (en) * | 1955-09-09 | 1958-07-02 | Bristol Lab Inc | Amides of trialkoxybenzoic acids |
| FR36F (fr) * | 1961-07-25 | 1963-08-30 | Ile De France | Médicaments antiémétiques nouveaux. |
| NL281394A (enFirst) * | 1961-07-25 |
-
1964
- 1964-01-13 US US337162A patent/US3342826A/en not_active Expired - Lifetime
- 1964-12-25 IL IL22669A patent/IL22669A/en unknown
-
1965
- 1965-01-04 GB GB284/65A patent/GB1088531A/en not_active Expired
- 1965-01-08 DE DE1595915A patent/DE1595915C3/de not_active Expired
- 1965-01-08 DE DE19651795723 patent/DE1795723A1/de active Pending
- 1965-01-09 FI FI40/65A patent/FI48273C/fi active
- 1965-01-12 FR FR1653A patent/FR1472025A/fr not_active Expired
- 1965-01-12 SE SE00358/65A patent/SE340452B/xx unknown
- 1965-01-12 DK DK14265AA patent/DK124402B/da unknown
- 1965-01-12 NO NO156308A patent/NO119533B/no unknown
- 1965-01-12 ES ES0308289A patent/ES308289A1/es not_active Expired
- 1965-01-12 NL NL6500326A patent/NL6500326A/xx unknown
- 1965-01-12 BR BR166161/65A patent/BR6566161D0/pt unknown
- 1965-01-12 CH CH38665A patent/CH468377A/de unknown
- 1965-01-13 BE BE658250D patent/BE658250A/xx unknown
- 1965-04-01 FR FR11640A patent/FR4879M/fr not_active Expired
- 1965-11-16 OA OA52253A patent/OA01859A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE658250A (enFirst) | 1965-07-13 |
| DE1795723A1 (de) | 1974-08-29 |
| DE1595915C3 (de) | 1980-02-21 |
| FR1472025A (fr) | 1967-03-10 |
| SE340452B (enFirst) | 1971-11-22 |
| DE1595915B2 (de) | 1974-07-11 |
| GB1088531A (en) | 1967-10-25 |
| BR6566161D0 (pt) | 1973-08-02 |
| FI48273C (fi) | 1979-12-14 |
| US3342826A (en) | 1967-09-19 |
| CH468377A (de) | 1969-02-15 |
| ES308289A1 (es) | 1965-06-16 |
| FI48273B (enFirst) | 1974-04-30 |
| OA01859A (fr) | 1970-01-14 |
| FR4879M (enFirst) | 1967-03-06 |
| NL6500326A (enFirst) | 1965-07-14 |
| NO119533B (enFirst) | 1970-06-01 |
| DE1595915A1 (de) | 1970-02-12 |
| DK124402B (da) | 1972-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL22669A (en) | (Alaoxy-low benzamide) -New pyrolidines and piperidines | |
| US4337263A (en) | 1-Aryl-4-γ-arylsulphonyl-3-aminopropoxy-1H-pyrazoles and their use as hypolipemiant and hypocholesterolemiant agents | |
| Sharp et al. | Derivatives of 1, 2, 4-Triazole and of Pyrazole | |
| US2712031A (en) | Monosubstituted salicylaldehyde alkoximes | |
| US5506249A (en) | Isoxazoles | |
| DE2541342A1 (de) | Neue phenoxyalkylcarbonsaeuren und verfahren zur herstellung derselben | |
| US2621162A (en) | J-propargyl-x-quinazolones and acid | |
| US3989746A (en) | Substituted naphthyl anthranilic acids | |
| US4066784A (en) | Tropone derivatives | |
| Reasenberg et al. | Esters of β-Alkylaminoethanols | |
| US4104305A (en) | 1-Aminotricyclo (4.3.1.12,5) undecane and salts thereof | |
| US3510495A (en) | Novel substituted 1-amino-2-pyrrolidinones | |
| US2528940A (en) | Pyrrolidylethyl indole compounds | |
| US4182880A (en) | 1,8-Naphthyridine compounds and process for preparing the same | |
| US2850521A (en) | Nu-(2, 2-dicyanovinyl) imido compounds and their preparation | |
| US2987546A (en) | Acyl-and amino-substituted phenol ethers | |
| US3833648A (en) | Process for preparing acylphenoxyaliphatic acid derivatives | |
| US3246010A (en) | 1, 5-diaryl-2-pyrrole propanols and ethers | |
| US4297503A (en) | Novel benzamide derivative and method of preparing metoclopramide using same | |
| JP3892963B2 (ja) | L−バリンベンジルエステルp−トルエンスルホン酸塩の製造方法 | |
| US3751462A (en) | Process for preparation of substituted fluoromethanesulfonanilides | |
| SU1502564A1 (ru) | Способ получени алкиловых эфиров 4,6-дитиа-5-метиленнонадиен-2,7-диовой кислоты | |
| IL96396A (en) | Process for the preparation of alkylene-bis (2-pyridylamine) compounds | |
| KR800001450B1 (ko) | 1, 3, 5-트리치환 벤젠 유도체의 제조방법 | |
| SU1318593A1 (ru) | Способ получени алкилпроизводных хинолина |