IL106918A - Electrically balanced connector assembly - Google Patents
Electrically balanced connector assemblyInfo
- Publication number
- IL106918A IL106918A IL10691893A IL10691893A IL106918A IL 106918 A IL106918 A IL 106918A IL 10691893 A IL10691893 A IL 10691893A IL 10691893 A IL10691893 A IL 10691893A IL 106918 A IL106918 A IL 106918A
- Authority
- IL
- Israel
- Prior art keywords
- circuit board
- disposed
- layers
- modular jack
- dielectric material
- Prior art date
Links
- 230000005484 gravity Effects 0.000 claims abstract description 5
- 239000003989 dielectric material Substances 0.000 claims description 10
- 239000004020 conductor Substances 0.000 claims description 4
- 238000009413 insulation Methods 0.000 claims 1
- 230000000149 penetrating effect Effects 0.000 claims 1
- 230000005540 biological transmission Effects 0.000 description 21
- 239000000047 product Substances 0.000 description 13
- 230000008901 benefit Effects 0.000 description 10
- 239000003990 capacitor Substances 0.000 description 10
- 238000009434 installation Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 7
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 230000001419 dependent effect Effects 0.000 description 5
- 238000013461 design Methods 0.000 description 5
- 238000005476 soldering Methods 0.000 description 5
- 238000013459 approach Methods 0.000 description 3
- 238000004891 communication Methods 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000003780 insertion Methods 0.000 description 3
- 230000037431 insertion Effects 0.000 description 3
- 230000000712 assembly Effects 0.000 description 2
- 238000000429 assembly Methods 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BEZZFPOZAYTVHN-UHFFFAOYSA-N oxfendazole Chemical compound C=1C=C2NC(NC(=O)OC)=NC2=CC=1S(=O)C1=CC=CC=C1 BEZZFPOZAYTVHN-UHFFFAOYSA-N 0.000 description 2
- 229910000679 solder Inorganic materials 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B6/00—Light guides; Structural details of arrangements comprising light guides and other optical elements, e.g. couplings
- G02B6/24—Coupling light guides
- G02B6/36—Mechanical coupling means
- G02B6/38—Mechanical coupling means having fibre to fibre mating means
- G02B6/3807—Dismountable connectors, i.e. comprising plugs
- G02B6/3897—Connectors fixed to housings, casing, frames or circuit boards
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01R—ELECTRICALLY-CONDUCTIVE CONNECTIONS; STRUCTURAL ASSOCIATIONS OF A PLURALITY OF MUTUALLY-INSULATED ELECTRICAL CONNECTING ELEMENTS; COUPLING DEVICES; CURRENT COLLECTORS
- H01R13/00—Details of coupling devices of the kinds covered by groups H01R12/70 or H01R24/00 - H01R33/00
- H01R13/646—Details of coupling devices of the kinds covered by groups H01R12/70 or H01R24/00 - H01R33/00 specially adapted for high-frequency, e.g. structures providing an impedance match or phase match
- H01R13/6461—Means for preventing cross-talk
- H01R13/6464—Means for preventing cross-talk by adding capacitive elements
- H01R13/6466—Means for preventing cross-talk by adding capacitive elements on substrates, e.g. printed circuit boards [PCB]
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K1/00—Printed circuits
- H05K1/02—Details
- H05K1/0213—Electrical arrangements not otherwise provided for
- H05K1/0216—Reduction of cross-talk, noise or electromagnetic interference
- H05K1/0228—Compensation of cross-talk by a mutually correlated lay-out of printed circuit traces, e.g. for compensation of cross-talk in mounted connectors
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01R—ELECTRICALLY-CONDUCTIVE CONNECTIONS; STRUCTURAL ASSOCIATIONS OF A PLURALITY OF MUTUALLY-INSULATED ELECTRICAL CONNECTING ELEMENTS; COUPLING DEVICES; CURRENT COLLECTORS
- H01R24/00—Two-part coupling devices, or either of their cooperating parts, characterised by their overall structure
- H01R24/60—Contacts spaced along planar side wall transverse to longitudinal axis of engagement
- H01R24/62—Sliding engagements with one side only, e.g. modular jack coupling devices
- H01R24/64—Sliding engagements with one side only, e.g. modular jack coupling devices for high frequency, e.g. RJ 45
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K1/00—Printed circuits
- H05K1/02—Details
- H05K1/11—Printed elements for providing electric connections to or between printed circuits
- H05K1/115—Via connections; Lands around holes or via connections
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K1/00—Printed circuits
- H05K1/16—Printed circuits incorporating printed electric components, e.g. printed resistor, capacitor, inductor
- H05K1/162—Printed circuits incorporating printed electric components, e.g. printed resistor, capacitor, inductor incorporating printed capacitors
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K2201/00—Indexing scheme relating to printed circuits covered by H05K1/00
- H05K2201/10—Details of components or other objects attached to or integrated in a printed circuit board
- H05K2201/10007—Types of components
- H05K2201/10189—Non-printed connector
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S439/00—Electrical connectors
- Y10S439/941—Crosstalk suppression
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Details Of Connecting Devices For Male And Female Coupling (AREA)
- Coupling Device And Connection With Printed Circuit (AREA)
- Connector Housings Or Holding Contact Members (AREA)
- Structure Of Telephone Exchanges (AREA)
- Multi-Conductor Connections (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/993,480 US5295869A (en) | 1992-12-18 | 1992-12-18 | Electrically balanced connector assembly |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL106918A0 IL106918A0 (en) | 1993-12-28 |
| IL106918A true IL106918A (en) | 1996-11-14 |
Family
ID=25539603
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL10691893A IL106918A (en) | 1992-12-18 | 1993-09-06 | Electrically balanced connector assembly |
Country Status (10)
| Country | Link |
|---|---|
| US (4) | US5295869A (es) |
| EP (2) | EP0901198A3 (es) |
| JP (1) | JPH06283227A (es) |
| AT (1) | ATE176362T1 (es) |
| AU (2) | AU667974B2 (es) |
| DE (1) | DE69323286T2 (es) |
| ES (1) | ES2129488T3 (es) |
| IL (1) | IL106918A (es) |
| MX (2) | MX9306626A (es) |
| TW (1) | TW243563B (es) |
Families Citing this family (164)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5414393A (en) * | 1992-08-20 | 1995-05-09 | Hubbell Incorporated | Telecommunication connector with feedback |
| US5432484A (en) * | 1992-08-20 | 1995-07-11 | Hubbell Incorporated | Connector for communication systems with cancelled crosstalk |
| DE4242987A1 (de) * | 1992-12-18 | 1994-06-23 | Braun Ag | Glaskanne zum Aufbewahren eines Brühgetränkes |
| TW218060B (en) * | 1992-12-23 | 1993-12-21 | Panduit Corp | Communication connector with capacitor label |
| DE4342517C1 (de) * | 1993-12-09 | 1995-05-04 | Krone Ag | Anschlußeinheit für Telekommunikations- und Datenleitungen |
| US5639266A (en) * | 1994-01-11 | 1997-06-17 | Stewart Connector Systems, Inc. | High frequency electrical connector |
| EP0692884B1 (en) * | 1994-07-14 | 2002-03-20 | Molex Incorporated | Modular connector with reduced crosstalk |
| US5518423A (en) * | 1994-07-19 | 1996-05-21 | The Siemon Company | Shielded connector assembly |
| DE9412794U1 (de) * | 1994-08-09 | 1995-09-07 | Krone Ag, 14167 Berlin | Leiterplatte für Steckverbinder |
| USD366025S (en) | 1994-08-10 | 1996-01-09 | The Siemon Company | Panel yoke |
| AU676752B2 (en) * | 1994-09-06 | 1997-03-20 | Krone Gmbh | Printed circuit board for connectors |
| EP0709930A3 (en) * | 1994-10-28 | 1997-09-10 | Whitaker Corp | Capacitive line coupling to reduce crosstalk |
| US5676566A (en) * | 1994-11-04 | 1997-10-14 | The Siemon Company | Multimedia outlet |
| US5807139A (en) * | 1994-11-04 | 1998-09-15 | The Siemon Company | Surface mount multimedia outlet |
| US5488201A (en) * | 1994-12-16 | 1996-01-30 | Dan-Chief Enterprise Co., Ltd. | Low crosstalk electrical signal transmission medium |
| US5605466A (en) * | 1995-01-12 | 1997-02-25 | New Vector Products, Inc. | Wall outlet adapter having sawtooth profile |
| FR2729510B1 (fr) * | 1995-01-13 | 1997-04-04 | Arnould App Electr | Dispositif de raccordement electrique, en particulier pour reseau de telecommunication |
| US5645449A (en) * | 1995-02-21 | 1997-07-08 | The Whitaker Corporation | Low profile mixed media information outlet |
| US5618185A (en) * | 1995-03-15 | 1997-04-08 | Hubbell Incorporated | Crosstalk noise reduction connector for telecommunication system |
| US5620335C1 (en) * | 1995-03-17 | 2001-02-06 | Siemon Co | Boot with icon holder |
| US5735714A (en) * | 1995-04-06 | 1998-04-07 | Ortronics Inc. | Information management outlet module and assembly providing protection to exposed cabling |
| US5556305A (en) * | 1995-04-07 | 1996-09-17 | Yazaki Corporation | Fuse lockout mechanism |
| CA2178681C (en) * | 1995-06-15 | 2001-01-16 | Attilio Joseph Rainal | Low-crosstalk modular electrical connector assembly |
| US5599206A (en) * | 1995-08-04 | 1997-02-04 | The Whitaker Corporation | Modular jack subassembly for use in a network outlet |
| US5651690A (en) * | 1995-08-30 | 1997-07-29 | Hubbell Incorporated | Electrical connector adapter |
| US5769647A (en) * | 1995-11-22 | 1998-06-23 | The Siemon Company | Modular outlet employing a door assembly |
| US5791943A (en) * | 1995-11-22 | 1998-08-11 | The Siemon Company | Reduced crosstalk modular outlet |
| US5685742A (en) * | 1995-11-28 | 1997-11-11 | Molex Incorporated | Electrical connector |
| CN1049313C (zh) * | 1995-12-06 | 2000-02-09 | 登骐企业股份有限公司 | 低串音电信号传送媒体 |
| JP3802070B2 (ja) * | 1996-02-29 | 2006-07-26 | ザ ウィタカー コーポレーション | クロストーク減少のための非抵抗エネルギ結合 |
| US5635769A (en) * | 1996-04-02 | 1997-06-03 | Magnadyne Corporation | Adaptable interface device for control of vehicle accessory systems using a plug-in resistor assembly |
| US5735708A (en) * | 1996-04-03 | 1998-04-07 | Lucent Technologies Inc. | Apparatus and method for displaying information at a wall face plate |
| US5755821A (en) * | 1996-05-28 | 1998-05-26 | D-Link Corporation | Device for preventing the erroneous connection of signal lines to a computer network hub |
| US5700167A (en) * | 1996-09-06 | 1997-12-23 | Lucent Technologies | Connector cross-talk compensation |
| US5944535A (en) * | 1997-02-04 | 1999-08-31 | Hubbell Incorporated | Interface panel system for networks |
| US5931703A (en) * | 1997-02-04 | 1999-08-03 | Hubbell Incorporated | Low crosstalk noise connector for telecommunication systems |
| US5797764A (en) * | 1997-02-12 | 1998-08-25 | Homaco, Inc. | Low return loss and low crosstalk telecommunications electric circuit |
| DE19712630C1 (de) * | 1997-03-26 | 1998-04-30 | Metz Albert Blumberger Tel | Anschlußdose für abgeschirmte Kabel |
| US7110227B2 (en) | 1997-04-08 | 2006-09-19 | X2Y Attenuators, Llc | Universial energy conditioning interposer with circuit architecture |
| US6603646B2 (en) | 1997-04-08 | 2003-08-05 | X2Y Attenuators, Llc | Multi-functional energy conditioner |
| US7042703B2 (en) | 2000-03-22 | 2006-05-09 | X2Y Attenuators, Llc | Energy conditioning structure |
| US6650525B2 (en) | 1997-04-08 | 2003-11-18 | X2Y Attenuators, Llc | Component carrier |
| US6995983B1 (en) | 1997-04-08 | 2006-02-07 | X2Y Attenuators, Llc | Component carrier |
| US7301748B2 (en) | 1997-04-08 | 2007-11-27 | Anthony Anthony A | Universal energy conditioning interposer with circuit architecture |
| US6606011B2 (en) | 1998-04-07 | 2003-08-12 | X2Y Attenuators, Llc | Energy conditioning circuit assembly |
| US7274549B2 (en) | 2000-12-15 | 2007-09-25 | X2Y Attenuators, Llc | Energy pathway arrangements for energy conditioning |
| US20030161086A1 (en) | 2000-07-18 | 2003-08-28 | X2Y Attenuators, Llc | Paired multi-layered dielectric independent passive component architecture resulting in differential and common mode filtering with surge protection in one integrated package |
| US9054094B2 (en) | 1997-04-08 | 2015-06-09 | X2Y Attenuators, Llc | Energy conditioning circuit arrangement for integrated circuit |
| US7336468B2 (en) | 1997-04-08 | 2008-02-26 | X2Y Attenuators, Llc | Arrangement for energy conditioning |
| US7110235B2 (en) | 1997-04-08 | 2006-09-19 | Xzy Altenuators, Llc | Arrangement for energy conditioning |
| US7336467B2 (en) | 2000-10-17 | 2008-02-26 | X2Y Attenuators, Llc | Energy pathway arrangement |
| US7106570B2 (en) | 1997-04-08 | 2006-09-12 | Xzy Altenuators, Llc | Pathway arrangement |
| US7321485B2 (en) | 1997-04-08 | 2008-01-22 | X2Y Attenuators, Llc | Arrangement for energy conditioning |
| US6018448A (en) | 1997-04-08 | 2000-01-25 | X2Y Attenuators, L.L.C. | Paired multi-layered dielectric independent passive component architecture resulting in differential and common mode filtering with surge protection in one integrated package |
| US6509807B1 (en) * | 1997-04-08 | 2003-01-21 | X2Y Attenuators, Llc | Energy conditioning circuit assembly |
| US6894884B2 (en) | 1997-04-08 | 2005-05-17 | Xzy Attenuators, Llc | Offset pathway arrangements for energy conditioning |
| US5897395A (en) * | 1997-05-30 | 1999-04-27 | Lucent Technologies Inc. | Multi-position jack frame |
| US5924896A (en) * | 1997-08-01 | 1999-07-20 | Lucent Technologies Inc. | High frequency communication jack |
| US5967801A (en) * | 1997-11-26 | 1999-10-19 | The Whitaker Corporation | Modular plug having compensating insert |
| WO1999048171A1 (en) * | 1998-03-20 | 1999-09-23 | Leviton Manufacturing Co., Inc. | Modular network adapter |
| US6171152B1 (en) | 1998-04-01 | 2001-01-09 | Regal Electronics, Inc. | Standard footprint and form factor RJ-45 connector with integrated signal conditioning for high speed networks |
| US5971813A (en) * | 1998-04-01 | 1999-10-26 | Regal Electronics, Inc. | RJ-45 modular connector with microwave-transmission-line integrated signal conditioning for high speed networks |
| US7427816B2 (en) | 1998-04-07 | 2008-09-23 | X2Y Attenuators, Llc | Component carrier |
| EP1070389B1 (en) | 1998-04-07 | 2007-12-05 | X2Y Attenuators, L.L.C. | Component carrier |
| US6089892A (en) | 1998-04-27 | 2000-07-18 | Haworth, Inc. | Telecommunications cabling arrangement |
| EP1084522A4 (en) | 1998-06-02 | 2003-12-03 | Bel Fuse Ltd | ELECTRIC CONNECTOR DEVICE FOR HIGH FREQUENCIES, FOR EXAMPLE MULTIPLE CONNECTORS AT MULTI-LEVELS |
| FR2780823B1 (fr) * | 1998-07-03 | 2000-09-22 | Financ Parka | Dispositif pour le montage d'une prise femelle, notamment d'un connecteur de telecommunication, sur un support |
| USD441637S1 (en) | 1998-07-10 | 2001-05-08 | Btr Blumberger Telefon- Und Relaisbau Albert Metz | Wall outlet |
| USRE38519E1 (en) * | 1998-08-24 | 2004-05-18 | Panduit Corp. | Low crosstalk modular communication connector |
| US6371793B1 (en) | 1998-08-24 | 2002-04-16 | Panduit Corp. | Low crosstalk modular communication connector |
| AU2403500A (en) * | 1999-01-15 | 2000-08-01 | Adc Telecommunications, Incorporated | Telecommunications jack assembly |
| US6334792B1 (en) | 1999-01-15 | 2002-01-01 | Adc Telecommunications, Inc. | Connector including reduced crosstalk spring insert |
| US6293707B1 (en) | 1999-02-19 | 2001-09-25 | Lucent Technologies Inc. | Patch panel with pivoting bracket assembly |
| USD425022S (en) * | 1999-03-30 | 2000-05-16 | Dieter Jaag | Data jack for surface mounting assembly |
| US6200160B1 (en) | 1999-04-26 | 2001-03-13 | Avaya Technologies Corp. | Protective console unit for electrical or optical connectors |
| USD425778S (en) * | 1999-06-11 | 2000-05-30 | Lucent Technologies Inc. | Protective console unit for electrical or optical connectors |
| US6089923A (en) | 1999-08-20 | 2000-07-18 | Adc Telecommunications, Inc. | Jack including crosstalk compensation for printed circuit board |
| AUPQ609900A0 (en) * | 2000-03-08 | 2000-03-30 | Krone (Australia) Technique Pty Limited | Compensation device for an electrical connector |
| JP4149633B2 (ja) * | 2000-03-21 | 2008-09-10 | 矢崎総業株式会社 | ケースとコネクタの組付構造 |
| USD449584S1 (en) | 2000-04-10 | 2001-10-23 | Thomas & Betts International, Inc. | Wall plate for directional couplers |
| US7113383B2 (en) | 2000-04-28 | 2006-09-26 | X2Y Attenuators, Llc | Predetermined symmetrically balanced amalgam with complementary paired portions comprising shielding electrodes and shielded electrodes and other predetermined element portions for symmetrically balanced and complementary energy portion conditioning |
| USD443252S1 (en) | 2000-06-02 | 2001-06-05 | Corning Cable Systems Llc | Wall mount housing |
| US6486746B1 (en) * | 2000-06-30 | 2002-11-26 | Intel Corporation | Termination circuit for decoupling unused wires on a network device's unshielded twisted pair (UTP) cable |
| US6506077B2 (en) | 2000-07-21 | 2003-01-14 | The Siemon Company | Shielded telecommunications connector |
| US6346010B1 (en) | 2000-08-10 | 2002-02-12 | The Wiremold Company | Modular connector |
| JP2004507198A (ja) | 2000-08-15 | 2004-03-04 | エクストゥーワイ、アテニュエイタズ、エル、エル、シー | 回路のエネルギーを調整するための電極装置 |
| US6616005B1 (en) * | 2000-08-28 | 2003-09-09 | Hubbell Incorporated | Modular faceplate assembly for an electrical box |
| US6433272B1 (en) | 2000-09-19 | 2002-08-13 | Storage Technology Corporation | Crosstalk reduction in constrained wiring assemblies |
| US6961303B1 (en) | 2000-09-21 | 2005-11-01 | Serconet Ltd. | Telephone communication system and method over local area network wiring |
| US7193831B2 (en) | 2000-10-17 | 2007-03-20 | X2Y Attenuators, Llc | Energy pathway arrangement |
| WO2002033798A1 (en) | 2000-10-17 | 2002-04-25 | X2Y Attenuators, Llc | Amalgam of shielding and shielded energy pathways and other elements for single or multiple circuitries with common reference node |
| US6543940B2 (en) * | 2001-04-05 | 2003-04-08 | Max Chu | Fiber converter faceplate outlet |
| US6729899B2 (en) * | 2001-05-02 | 2004-05-04 | Ortronics, Inc. | Balance high density 110 IDC terminal block |
| US6593530B2 (en) | 2001-07-26 | 2003-07-15 | Torrence L. Hunt | Electrical switch identification plate with replaceable insert members |
| IL145103A (en) * | 2001-08-23 | 2010-05-17 | Rit Techn Ltd | High data rate interconnecting device |
| US6736670B2 (en) * | 2001-11-16 | 2004-05-18 | Adc Telecommunications, Inc. | Angled RJ to RJ patch panel |
| US6483715B1 (en) | 2001-11-21 | 2002-11-19 | Surtec Industries Inc. | Circuit board coupled with jacks |
| US6744329B2 (en) * | 2001-12-14 | 2004-06-01 | Yazaki North America, Inc. | Cross talk compensation circuit |
| US7110653B2 (en) * | 2001-12-20 | 2006-09-19 | Alcatel Canada Inc. | Optical network unit |
| US6718674B2 (en) * | 2002-03-21 | 2004-04-13 | Panduit Corp. | Apparatus and system for identification labeling |
| US6896547B2 (en) * | 2002-08-09 | 2005-05-24 | Panduit Corp. | Multimedia outlet box |
| DE10242143A1 (de) * | 2002-09-04 | 2004-03-25 | Telegärtner Karl Gärtner GmbH | Elektrische Steckbuchse |
| US6814624B2 (en) * | 2002-11-22 | 2004-11-09 | Adc Telecommunications, Inc. | Telecommunications jack assembly |
| US7052328B2 (en) * | 2002-11-27 | 2006-05-30 | Panduit Corp. | Electronic connector and method of performing electronic connection |
| US7180718B2 (en) | 2003-01-31 | 2007-02-20 | X2Y Attenuators, Llc | Shielded energy conditioner |
| US6974911B2 (en) * | 2003-05-09 | 2005-12-13 | Electec Limited | Modular wiring system |
| US7440252B2 (en) | 2003-05-29 | 2008-10-21 | X2Y Attenuators, Llc | Connector related structures including an energy conditioner |
| US6908334B2 (en) * | 2003-07-02 | 2005-06-21 | Pei-Chin Huang | Interlining panel structure for multiple socket |
| EP1649572A4 (en) | 2003-07-21 | 2012-06-27 | X2Y Attenuators Llc | FILTER ASSEMBLY |
| US20050099243A1 (en) * | 2003-11-11 | 2005-05-12 | Ching-Wen Weng | Transmission line structure on base board |
| CN1890854A (zh) | 2003-12-22 | 2007-01-03 | X2Y艾泰钮埃特有限责任公司 | 内屏蔽式能量调节装置 |
| US7232340B2 (en) * | 2004-02-20 | 2007-06-19 | Adc Incorporated | Methods and systems for minimizing alien crosstalk between connectors |
| US10680385B2 (en) | 2004-02-20 | 2020-06-09 | Commscope Technologies Llc | Methods and systems for compensating for alien crosstalk between connectors |
| US20050221678A1 (en) | 2004-02-20 | 2005-10-06 | Hammond Bernard Jr | Methods and systems for compensating for alien crosstalk between connectors |
| US7187766B2 (en) * | 2004-02-20 | 2007-03-06 | Adc Incorporated | Methods and systems for compensating for alien crosstalk between connectors |
| US7153168B2 (en) * | 2004-04-06 | 2006-12-26 | Panduit Corp. | Electrical connector with improved crosstalk compensation |
| CA2464834A1 (en) * | 2004-04-19 | 2005-10-19 | Nordx/Cdt Inc. | Connector |
| US7052288B1 (en) * | 2004-11-12 | 2006-05-30 | Fci Americas Technology, Inc. | Two piece mid-plane |
| GB2439861A (en) | 2005-03-01 | 2008-01-09 | X2Y Attenuators Llc | Internally overlapped conditioners |
| US7817397B2 (en) | 2005-03-01 | 2010-10-19 | X2Y Attenuators, Llc | Energy conditioner with tied through electrodes |
| US7586728B2 (en) | 2005-03-14 | 2009-09-08 | X2Y Attenuators, Llc | Conditioner with coplanar conductors |
| DE102005038795B4 (de) * | 2005-08-17 | 2007-08-30 | Adc Gmbh | Anschlusselement mit einem Gehäuse für Telekommunikations- und/oder Datenkabel |
| US20070134986A1 (en) * | 2005-12-13 | 2007-06-14 | Texas Instruments Incorporated | Active enclosure for use in power over ethernet powered device |
| US7294024B2 (en) * | 2006-01-06 | 2007-11-13 | Adc Telecommunications, Inc. | Methods and systems for minimizing alien crosstalk between connectors |
| US7183487B1 (en) | 2006-01-31 | 2007-02-27 | Panduit Corp. | Stainless steel faceplates with labels |
| EP1987569A1 (en) * | 2006-02-13 | 2008-11-05 | Panduit Corp. | Connector with crosstalk compensation |
| US7488206B2 (en) * | 2006-02-14 | 2009-02-10 | Panduit Corp. | Method and apparatus for patch panel patch cord documentation and revision |
| US8026777B2 (en) | 2006-03-07 | 2011-09-27 | X2Y Attenuators, Llc | Energy conditioner structures |
| US7381098B2 (en) | 2006-04-11 | 2008-06-03 | Adc Telecommunications, Inc. | Telecommunications jack with crosstalk multi-zone crosstalk compensation and method for designing |
| US7429178B2 (en) * | 2006-09-12 | 2008-09-30 | Samtec, Inc. | Modular jack with removable contact array |
| FR2906939B1 (fr) * | 2006-10-09 | 2009-01-23 | Legrand France | Dispositif de raccordement pour reseau local |
| US7874878B2 (en) * | 2007-03-20 | 2011-01-25 | Panduit Corp. | Plug/jack system having PCB with lattice network |
| EP2137794B1 (en) * | 2007-03-29 | 2018-03-07 | The Siemon Company | Modular connector with reduced termination variability and improved performance |
| US7841909B2 (en) | 2008-02-12 | 2010-11-30 | Adc Gmbh | Multistage capacitive far end crosstalk compensation arrangement |
| US20090221179A1 (en) * | 2008-02-28 | 2009-09-03 | Arnel Berton Citurs | Tamper resistant faceplate system |
| US7927153B2 (en) * | 2008-08-13 | 2011-04-19 | Panduit Corp. | Communications connector with multi-stage compensation |
| KR101604629B1 (ko) * | 2008-08-20 | 2016-03-18 | 팬듀트 코포레이션 | 다단계 보상을 갖는 고속 커넥터 |
| US8202128B2 (en) * | 2008-11-25 | 2012-06-19 | Adc Gmbh | Telecommunications jack with adjustable crosstalk compensation |
| DE102008064535A1 (de) | 2008-12-19 | 2010-06-24 | Telegärtner Karl Gärtner GmbH | Elektrischer Verbindungsstecker |
| EP2209172A1 (en) * | 2009-01-15 | 2010-07-21 | 3M Innovative Properties Company | Telecommunications Jack with a Multilayer PCB |
| US7896692B2 (en) * | 2009-05-15 | 2011-03-01 | Leviton Manufacturing Co., Inc. | Method of improving isolation between circuits on a printed circuit board |
| GB0914025D0 (en) | 2009-08-11 | 2009-09-16 | 3M Innovative Properties Co | Telecommunications connector |
| US7850492B1 (en) | 2009-11-03 | 2010-12-14 | Panduit Corp. | Communication connector with improved crosstalk compensation |
| US8993887B2 (en) * | 2009-11-09 | 2015-03-31 | L-Com, Inc. | Right angle twisted pair connector |
| EP2487761B1 (en) | 2011-02-10 | 2013-07-31 | 3M Innovative Properties Company | Telecommunications connector |
| JP2013093345A (ja) * | 2011-10-24 | 2013-05-16 | Hitachi Ltd | 光モジュールおよび多層基板 |
| CN102509972B (zh) * | 2011-11-04 | 2014-11-05 | 浙江一舟电子科技股份有限公司 | 一种超六类网络信息接口电路结构 |
| MX2014006082A (es) | 2011-11-23 | 2014-06-23 | Panduit Corp | Red de compensacion que utiliza una red de compensacion ortogonal. |
| US9136647B2 (en) | 2012-06-01 | 2015-09-15 | Panduit Corp. | Communication connector with crosstalk compensation |
| DE202013102862U1 (de) * | 2013-01-25 | 2014-10-13 | Weidmüller Interface GmbH & Co. KG | Elektrische Anschlussdose, insbesondere für einen Schaltschrank |
| TWM462978U (zh) * | 2013-01-31 | 2013-10-01 | nai-qian Zhang | 可擴充晶片的連接器 |
| US9246463B2 (en) | 2013-03-07 | 2016-01-26 | Panduit Corp. | Compensation networks and communication connectors using said compensation networks |
| US9257792B2 (en) | 2013-03-14 | 2016-02-09 | Panduit Corp. | Connectors and systems having improved crosstalk performance |
| US9246274B2 (en) | 2013-03-15 | 2016-01-26 | Panduit Corp. | Communication connectors having crosstalk compensation networks |
| US20140317978A1 (en) * | 2013-04-29 | 2014-10-30 | Kyung Tae Kim | Electric Wiring Device Marking System |
| US9716924B2 (en) | 2013-10-21 | 2017-07-25 | Centurylink Intellectual Property Llc | Omedia panel |
| DE102014104446A1 (de) | 2014-03-28 | 2015-10-01 | Telegärtner Karl Gärtner GmbH | Elektrischer Steckverbinder |
| DE102014104449A1 (de) | 2014-03-28 | 2015-10-01 | Telegärtner Karl Gärtner GmbH | Elektrischer Steckverbinder |
| US9325117B1 (en) * | 2014-10-30 | 2016-04-26 | Hsing Chau Industrial Co., Ltd. | Pin structure of modular jack |
| US10151890B2 (en) * | 2015-03-18 | 2018-12-11 | Leviton Manufacturing Co., Inc. | Data communication port insert configurable with indicia to customize data communication station labeling and identification |
| US9985359B2 (en) * | 2016-03-11 | 2018-05-29 | The Siemon Company | Field terminable telecommunications connector |
| US9722380B1 (en) * | 2016-07-22 | 2017-08-01 | Rockwell Automation Technologies, Inc. | Network distribution adapter for a motor control center |
| US9912102B1 (en) * | 2016-11-29 | 2018-03-06 | Leviton Manufacturing Co., Inc. | Limited power outlet with changeable protective bezel |
| US11031738B1 (en) * | 2020-01-03 | 2021-06-08 | Jyh Eng Technology Co., Ltd. | Multiple socket panel device with anti-crosstalk shielding structure |
Family Cites Families (157)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US212330A (en) * | 1879-02-18 | Improvement in ore-concentrators | ||
| US240631A (en) * | 1881-04-26 | abbott | ||
| US179997A (en) * | 1876-07-18 | Improvement in horseshoe-machines | ||
| US276605A (en) * | 1883-05-01 | Bark-conveyer | ||
| US306716A (en) * | 1884-10-21 | William scotbubn buist | ||
| US179996A (en) * | 1876-07-18 | Improvement in cotton-planting attachments for harrows | ||
| US269426A (en) * | 1882-12-19 | Motor for churns | ||
| US300739A (en) * | 1884-06-17 | savage | ||
| US333656A (en) * | 1886-01-05 | Feank w | ||
| US298826A (en) * | 1884-05-20 | Willaed a | ||
| US248096A (en) * | 1881-10-11 | Steam-engine | ||
| US233729A (en) * | 1880-10-26 | Support for carriage-tops | ||
| US969409A (en) * | 1909-07-21 | 1910-09-06 | Frank J Russell | High-voltage receptacle and plug. |
| US1278339A (en) * | 1915-08-06 | 1918-09-10 | Crouse Hinds Co | Plug-socket and fuse box. |
| US1627206A (en) * | 1925-07-06 | 1927-05-03 | Siemens Ag | Telephone system |
| US1799188A (en) * | 1928-10-26 | 1931-04-07 | American Telephone & Telegraph | Cross-talk reduction |
| US1922138A (en) * | 1931-12-17 | 1933-08-15 | American Telephone & Telegraph | System for transposition of conductor sets in cables |
| US1995454A (en) * | 1933-10-12 | 1935-03-26 | American Telephone & Telegraph | Apparatus and method for remedying cross talk |
| DE678914C (de) * | 1937-10-29 | 1939-07-25 | Siemens Schuckertwerke Akt Ges | Gekapselte elektrische Steckvorrichtung |
| US2244937A (en) * | 1939-11-27 | 1941-06-10 | Kenneth A Brainard | Electrical outlet |
| US2427349A (en) * | 1944-11-16 | 1947-09-16 | Earl S Boynton | Electrical receptacle |
| US2667543A (en) * | 1950-05-26 | 1954-01-26 | Automatic Telephone & Elect | Electric ribbon cable |
| US3191098A (en) * | 1960-05-26 | 1965-06-22 | Lockheed Aircraft Corp | Structurally integrated capacitor assembly |
| US3496555A (en) * | 1965-08-27 | 1970-02-17 | Burroughs Corp | Magnetic memory apparatus |
| US3343041A (en) * | 1966-08-08 | 1967-09-19 | Hubbell Inc Harvey | Electrical power center |
| US3579046A (en) * | 1969-05-02 | 1971-05-18 | Jordan Controls Inc | Electrical housing assembly having a plurality of chambers with adjacent circuit board elements |
| US3634806A (en) * | 1969-10-31 | 1972-01-11 | Thomas & Betts Corp | Matched impedance connector |
| FR2067825A5 (es) | 1969-11-18 | 1971-08-20 | Telic | |
| US3591834A (en) * | 1969-12-22 | 1971-07-06 | Ibm | Circuit board connecting means |
| US3646246A (en) * | 1970-05-22 | 1972-02-29 | Honeywell Inf Systems | Circuit board and method of making |
| GB1297227A (es) * | 1970-09-05 | 1972-11-22 | ||
| US3641472A (en) * | 1970-09-14 | 1972-02-08 | Unicorn Ind Inc | Exterior power supply connection for recreation vehicles |
| US3662117A (en) * | 1970-12-03 | 1972-05-09 | Northern Electric Co | Crosstalk minimization in multi-wire networks |
| NL160111C (nl) * | 1972-04-27 | 1979-09-17 | Philips Nv | Schakelnetwerk voorzien van een prentplaat. |
| US3761842A (en) * | 1972-06-01 | 1973-09-25 | Bell Telephone Labor Inc | Twisted pair flat conductor cable with means to equalize impedance and propagation velocity |
| US3757028A (en) * | 1972-09-18 | 1973-09-04 | J Schlessel | Terference printed board and similar transmission line structure for reducing in |
| FR2212740B1 (es) | 1972-12-28 | 1977-02-25 | Honeywell Bull | |
| US4049227A (en) * | 1973-08-30 | 1977-09-20 | Gte Automatic Electric Laboratories Incorporated | Mounting arrangement for electrical components and electrical component cases adapted to be used therewith |
| US3892925A (en) * | 1974-06-03 | 1975-07-01 | Ibm | Electric signal exchange switching arrangement |
| US4027937A (en) * | 1975-01-20 | 1977-06-07 | Norden Alexander | Electrical terminal blocks |
| USD248096S (en) | 1976-03-31 | 1978-06-06 | Bunker Ramo Corporation | Connector panel |
| US4053719A (en) * | 1976-10-27 | 1977-10-11 | Northern Telecom Limited | Connector blocks for telecommunications lines |
| US4144509A (en) * | 1977-01-12 | 1979-03-13 | Bunker Ramo Corporation | Filter connector |
| DE2811713C2 (de) | 1978-03-17 | 1985-10-10 | Siemens AG, 1000 Berlin und 8000 München | Gedruckte Schaltung, insbesondere Folienverdrahtung |
| US4241974A (en) * | 1979-05-02 | 1980-12-30 | Western Electric Company, Inc. | Multi-outlet adapter for modular telephone cords |
| GB2060266B (en) | 1979-10-05 | 1984-05-31 | Borrill P L | Multilayer printed circuit board |
| US4367908A (en) * | 1980-06-05 | 1983-01-11 | Akzona Incorporated | Electrical connector coupling |
| JPS5784149A (en) | 1980-11-14 | 1982-05-26 | Hitachi Ltd | Semiconductor integrated circuit device |
| USD269426S (en) | 1981-01-12 | 1983-06-21 | Pyle Larry J | Electric power distribution unit or similar article |
| US4413469A (en) * | 1981-03-23 | 1983-11-08 | Allied Corporation | Method of making low crosstalk ribbon cable |
| US4418239A (en) * | 1981-08-24 | 1983-11-29 | Oak Industries Inc. | Flexible connector with interconnection between conductive traces |
| US4489419A (en) * | 1981-10-29 | 1984-12-18 | An Wang | Data communication system |
| USD276605S (en) | 1982-07-19 | 1984-12-04 | Porta Systems Corp. | Telephone attenuation block or similar article |
| US4636918A (en) * | 1982-07-30 | 1987-01-13 | Rogers Corporation | Decoupled integrated circuit package |
| US4791391A (en) * | 1983-03-30 | 1988-12-13 | E. I. Du Pont De Nemours And Company | Planar filter connector having thick film capacitors |
| US4682129A (en) * | 1983-03-30 | 1987-07-21 | E. I. Du Pont De Nemours And Company | Thick film planar filter connector having separate ground plane shield |
| DE3326800A1 (de) | 1983-07-26 | 1985-02-14 | ANT Nachrichtentechnik GmbH, 7150 Backnang | Leiterplatte |
| US4950840A (en) * | 1983-08-08 | 1990-08-21 | Zetena Maurice F | Wall recess cable connector permitting simplified innerconnection and limiting protruding cables |
| US4643509A (en) * | 1984-06-15 | 1987-02-17 | Amp Incorporated | Grounding clip for filtered electrical connector |
| US4600256A (en) * | 1984-12-31 | 1986-07-15 | Motorola, Inc. | Condensed profile electrical connector |
| US4689441A (en) * | 1985-04-05 | 1987-08-25 | International Business Machines Corporation | Routing method and pattern for reducing cross talk noise problems on printed interconnection boards |
| US4668041A (en) * | 1985-04-19 | 1987-05-26 | Intel Corporation | Low noise test contacts for pin grid array |
| USD298826S (en) | 1985-09-25 | 1988-12-06 | Matsushita Electric Works, Ltd. | Connector for coaxial cable |
| US4726790A (en) * | 1985-10-04 | 1988-02-23 | Hadjis George C | Multi-pin electrical connector including anti-resonant planar capacitors |
| CA1245335A (en) * | 1985-10-09 | 1988-11-22 | Thomas G. Volk | High density connector for main frames in telephone systems |
| US4690479A (en) * | 1985-10-10 | 1987-09-01 | Amp Incorporated | Filtered electrical header assembly |
| US4714440A (en) * | 1985-10-28 | 1987-12-22 | American Telephone And Telegraph Company, At&T Technologies, Inc. | Universal adapter and methods of and apparatus for making same |
| USD300739S (en) | 1985-12-17 | 1989-04-18 | Hirose Electric Co., Ltd. | Electrical connectors |
| US4657323A (en) * | 1986-01-27 | 1987-04-14 | Itt Corporation | D-subminature filter connector |
| US4678251A (en) * | 1986-02-10 | 1987-07-07 | Installation Technology, Inc. | Modular installation system for data cable interfacing |
| US4676576A (en) * | 1986-02-19 | 1987-06-30 | Burndy Corporation | Communications connector |
| US4641900A (en) * | 1986-02-20 | 1987-02-10 | Telnetix, Inc. | Telephone distribution apparatus |
| US4669802A (en) * | 1986-03-26 | 1987-06-02 | Amp Incorporated | Outlet for optical fiber connectors |
| US4747020A (en) * | 1986-05-16 | 1988-05-24 | Adc Telecommunications, Inc. | Wire distribution apparatus |
| US4726776A (en) * | 1986-06-10 | 1988-02-23 | Amp Incorporated | Socket for zig-zag inline package |
| US4756695A (en) * | 1986-06-13 | 1988-07-12 | Amp Incorporated | Local area network interface |
| US4717358A (en) * | 1986-07-31 | 1988-01-05 | Amp Incorporated | Cover plates for power distribution system |
| US4813071A (en) * | 1986-08-13 | 1989-03-14 | Porta Systems Corp. | Laminar type telephone connector block |
| US4695115A (en) * | 1986-08-29 | 1987-09-22 | Corcom, Inc. | Telephone connector with bypass capacitor |
| US4831497A (en) * | 1986-09-11 | 1989-05-16 | General Electric Company | Reduction of cross talk in interconnecting conductors |
| US4725249A (en) * | 1986-09-22 | 1988-02-16 | American Telephone & Telegraph Company | Connector assembly |
| US4731031A (en) * | 1986-10-15 | 1988-03-15 | E. I. Du Pont De Nemours And Company | Transmission cable connector having a contoured shell |
| US4953206A (en) * | 1986-11-17 | 1990-08-28 | At&T Bell Laboratories | Methods of and apparatus for providing substantially error-free transmitted data |
| US4824383A (en) * | 1986-11-18 | 1989-04-25 | E. I. Du Pont De Nemours And Company | Terminator and corresponding receptacle for multiple electrical conductors |
| GB8703048D0 (en) * | 1987-02-11 | 1987-03-18 | Smiths Industries Plc | Filter arrangements |
| DE3704497A1 (de) | 1987-02-13 | 1988-08-25 | Aristo Graphic Systeme | Verfahren zur herstellung eines digitalisiertabletts |
| DE3704498A1 (de) | 1987-02-13 | 1988-08-25 | Aristo Graphic Systeme | Verfahren zur herstellung eines digitalisiertabletts |
| EP0279405B1 (de) * | 1987-02-18 | 1993-11-03 | Siemens Aktiengesellschaft | Steckverbinder |
| JPS63234657A (ja) * | 1987-03-24 | 1988-09-29 | Toshiba Corp | 信号伝送方式 |
| US4767338A (en) * | 1987-04-20 | 1988-08-30 | Dennis Melburn W | Printed circuit board telephone interface |
| US4898156A (en) * | 1987-05-18 | 1990-02-06 | Mitek Surgical Products, Inc. | Suture anchor |
| USD306716S (en) | 1987-07-07 | 1990-03-20 | Raychem Corporation | Terminal block |
| NL8701661A (nl) * | 1987-07-14 | 1989-02-01 | Du Pont Nederland | Filtereenheid voor connectoren. |
| US4878847A (en) * | 1987-07-29 | 1989-11-07 | Rutledge Engineering (Aust.) Pty. Ltd. | Patchfield system |
| US4875205A (en) * | 1987-08-13 | 1989-10-17 | Hewlett-Packard Company | Crosstalk reduction in unshielded twisted-pair lines |
| US4875875A (en) * | 1987-09-28 | 1989-10-24 | Brintec Corporation | Field terminable modular connector |
| US4785265A (en) * | 1987-10-01 | 1988-11-15 | The Babcock & Wilcox Company | Enhanced automatic line build out |
| US4873600A (en) * | 1987-10-05 | 1989-10-10 | Unicorn Electrical Products | Utility pedestal |
| US4958262A (en) * | 1988-02-12 | 1990-09-18 | Michigan Bell Telephone Company | Apparatus and method for facilitating double blocking at a distributing frame in a telephone central office |
| US4871624A (en) * | 1988-02-22 | 1989-10-03 | Toshiba Kikai Kabushiki Kaisha | Magnetic scale and method of manufacturing the same |
| JPH0828925B2 (ja) * | 1988-03-11 | 1996-03-21 | 株式会社日立製作所 | ガス絶縁開閉装置 |
| US4853659A (en) * | 1988-03-17 | 1989-08-01 | Amp Incorporated | Planar pi-network filter assembly having capacitors formed on opposing surfaces of an inductive member |
| JPH01281687A (ja) * | 1988-03-18 | 1989-11-13 | Matsushita Electric Works Ltd | 防水コンセント |
| US4874904A (en) * | 1988-04-14 | 1989-10-17 | Brintec Corporation | Fiber optic faceplate assembly |
| US4912552A (en) * | 1988-04-19 | 1990-03-27 | Control Data Corporation | Distributed monitoring system |
| US4869682A (en) * | 1988-06-08 | 1989-09-26 | Northern Telecom Limited | Electrical bridging link for connecting terminals within a terminal device |
| US4865564A (en) * | 1988-06-10 | 1989-09-12 | American Telephone And Telegraph Company | Wall mounted connecting block |
| US4820192A (en) * | 1988-06-10 | 1989-04-11 | American Telephone And Telegraph Company | Connecting block construction |
| US4799901A (en) * | 1988-06-30 | 1989-01-24 | Pirc Douglas J | Adapter having transient suppression protection |
| US4850887A (en) * | 1988-07-07 | 1989-07-25 | Minnesota Mining And Manufacturing Company | Electrical connector |
| US4878848A (en) * | 1988-07-14 | 1989-11-07 | Independent Technologies, Inc. | 110 Block adapter |
| US5149277A (en) * | 1988-07-18 | 1992-09-22 | Lemaster Dolan M | Connectivity management system |
| US4932892A (en) * | 1988-09-28 | 1990-06-12 | Stewart Connector Systems, Inc. | High density connector for end terminating and/or daisy chaining flat cable and cable-connector assembly |
| US4871316A (en) * | 1988-10-17 | 1989-10-03 | Microelectronics And Computer Technology Corporation | Printed wire connector |
| US4912452A (en) * | 1988-12-08 | 1990-03-27 | Northern Telecom Limited | ISDN quick connect terminating resistor |
| US4939624A (en) * | 1988-12-14 | 1990-07-03 | Cray Research, Inc. | Interconnected multiple circuit module |
| US5032991A (en) * | 1988-12-14 | 1991-07-16 | At&T Ball Laboratories | Method for routing conductive paths |
| US4883432A (en) * | 1988-12-28 | 1989-11-28 | The Siemon Company | Modular jack yoke |
| US4909757A (en) * | 1989-01-27 | 1990-03-20 | The Siemon Company | Modular jack patch block |
| US4905275A (en) * | 1989-02-06 | 1990-02-27 | Porta Systems Corp. | Laminar type telephone protector block and interconnectable modular elements therefor |
| JPH033289A (ja) * | 1989-05-30 | 1991-01-09 | Gurafuiko:Kk | ツイスト・プリント配線 |
| GB2233157B (en) | 1989-06-13 | 1992-10-21 | British Aerospace | Printed circuit board |
| GB8915060D0 (en) * | 1989-06-30 | 1989-08-23 | Smiths Industries Plc | Electrical assemblies |
| US4930200A (en) * | 1989-07-28 | 1990-06-05 | Thomas & Betts Corporation | Method of making an electrical filter connector |
| US4992061A (en) * | 1989-07-28 | 1991-02-12 | Thomas & Betts Corporation | Electrical filter connector |
| US4929196A (en) * | 1989-08-01 | 1990-05-29 | Molex Incorporated | Insert molded filter connector |
| US5029270A (en) * | 1989-08-16 | 1991-07-02 | Chinon Kabushiki Kaisha | Housing case for electromechanical equipment |
| US5046968A (en) * | 1989-09-28 | 1991-09-10 | Tri-Star Incorporated | Electrical connector contact having an electrical component disposed in a central internal cavity |
| US4975078A (en) * | 1989-12-15 | 1990-12-04 | Panduit Corp. | Modular telephone connector |
| US5086271A (en) | 1990-01-12 | 1992-02-04 | Reliability Incorporated | Driver system and distributed transmission line network for driving devices under test |
| US5106325A (en) * | 1990-01-19 | 1992-04-21 | Leviton Manufacturing Co. Inc. | Modular higher density communications coupling system |
| US5069641A (en) * | 1990-02-03 | 1991-12-03 | Murata Manufacturing Co., Ltd. | Modular jack |
| US4986779A (en) * | 1990-02-06 | 1991-01-22 | Amp Incorporated | Local area network interface |
| USD333656S (en) | 1990-03-15 | 1993-03-02 | Siemens Aktiengesellschaft | Wall-mounted, multi-switch control unit for a programmable building system |
| US5153988A (en) * | 1990-03-26 | 1992-10-13 | Raychem Corporation | Method of making modular telecommunications terminal block |
| US5091826A (en) * | 1990-03-27 | 1992-02-25 | At&T Bell Laboratories | Printed wiring board connector |
| US5093879A (en) * | 1990-06-22 | 1992-03-03 | International Business Machines Corporation | Electro-optical connectors |
| US5124506A (en) * | 1990-07-09 | 1992-06-23 | Amp Incorporated | Face plate with seal and cover |
| US5145413A (en) * | 1990-07-24 | 1992-09-08 | Yazaki Corporation | Noise suppressing connector |
| US5068631A (en) * | 1990-08-09 | 1991-11-26 | At&T Bell Laboratories | Sub power plane to provide EMC filtering for VLSI devices |
| US5041018A (en) * | 1990-08-20 | 1991-08-20 | At&T Bell Laboratories | Electrical connector receptacle |
| US5177782A (en) * | 1990-08-30 | 1993-01-05 | Minnesota Mining And Manufacturing Company | Modular protected entrance terminal |
| US5178554A (en) * | 1990-10-26 | 1993-01-12 | The Siemon Company | Modular jack patching device |
| US5074801A (en) * | 1990-10-26 | 1991-12-24 | The Siemon Company | Modular jack patching device |
| US5139442A (en) * | 1990-12-03 | 1992-08-18 | Murata Manufacturing Co., Ltd. | Modular jack |
| US5061209A (en) * | 1991-03-13 | 1991-10-29 | Hubbell Incorporated | Wall plate jack and contact therefor |
| US5082457A (en) * | 1991-03-29 | 1992-01-21 | Cummins Electronics Company, Inc. | Filter electrical connector |
| US5145401A (en) * | 1991-05-28 | 1992-09-08 | Superior Modular Products, Inc. | Electrical connector having improved spring contacts |
| US5125852A (en) * | 1991-07-15 | 1992-06-30 | Superior Modular Products, Inc. | Universal electrical connector jack |
| US5228869A (en) * | 1991-11-20 | 1993-07-20 | The Siemon Company | Panel yoke and snap locking mounting scheme for securing wire connectors |
| US5205762A (en) | 1991-12-06 | 1993-04-27 | Porta Systems Corp. | High frequency patch cord data connector |
| US5186647A (en) * | 1992-02-24 | 1993-02-16 | At&T Bell Laboratories | High frequency electrical connector |
| US5299956B1 (en) | 1992-03-23 | 1995-10-24 | Superior Modular Prod Inc | Low cross talk electrical connector system |
| US5192230A (en) * | 1992-05-18 | 1993-03-09 | Amp Incorporated | Vertical mount connector |
| US5238427A (en) * | 1992-09-01 | 1993-08-24 | Molex Incorporated | Panel mountable electrical connector |
| US5244417A (en) * | 1992-12-30 | 1993-09-14 | Perretta Frederick A | Backshell interface system |
| US5269708A (en) | 1993-03-03 | 1993-12-14 | Adc Telecommunications, Inc. | Patch panel for high speed twisted pair |
-
1992
- 1992-12-18 US US07/993,480 patent/US5295869A/en not_active Expired - Lifetime
-
1993
- 1993-09-06 IL IL10691893A patent/IL106918A/en not_active IP Right Cessation
- 1993-09-14 US US08/121,167 patent/US5362254A/en not_active Expired - Lifetime
- 1993-09-24 US US08/127,240 patent/US5435752A/en not_active Expired - Fee Related
- 1993-10-25 MX MX9306626A patent/MX9306626A/es not_active IP Right Cessation
- 1993-10-26 TW TW082108973A patent/TW243563B/zh active
- 1993-11-02 AU AU50419/93A patent/AU667974B2/en not_active Ceased
- 1993-12-04 EP EP98112328A patent/EP0901198A3/en active Pending
- 1993-12-04 AT AT93119576T patent/ATE176362T1/de not_active IP Right Cessation
- 1993-12-04 DE DE69323286T patent/DE69323286T2/de not_active Expired - Fee Related
- 1993-12-04 ES ES93119576T patent/ES2129488T3/es not_active Expired - Lifetime
- 1993-12-04 EP EP93119576A patent/EP0602484B1/en not_active Expired - Lifetime
- 1993-12-17 JP JP5318760A patent/JPH06283227A/ja not_active Withdrawn
-
1994
- 1994-05-13 US US08/242,113 patent/US5474474A/en not_active Expired - Lifetime
-
1995
- 1995-11-16 AU AU37897/95A patent/AU681316B2/en not_active Ceased
-
1999
- 1999-01-05 MX MXPA99000349A patent/MXPA99000349A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU5041993A (en) | 1994-06-30 |
| AU3789795A (en) | 1996-01-11 |
| US5435752A (en) | 1995-07-25 |
| IL106918A0 (en) | 1993-12-28 |
| DE69323286D1 (de) | 1999-03-11 |
| EP0901198A2 (en) | 1999-03-10 |
| JPH06283227A (ja) | 1994-10-07 |
| MXPA99000349A (es) | 2004-09-06 |
| AU681316B2 (en) | 1997-08-21 |
| EP0602484A2 (en) | 1994-06-22 |
| EP0602484A3 (en) | 1995-09-06 |
| ES2129488T3 (es) | 1999-06-16 |
| DE69323286T2 (de) | 1999-08-19 |
| ATE176362T1 (de) | 1999-02-15 |
| US5295869A (en) | 1994-03-22 |
| MX9306626A (es) | 1994-06-30 |
| AU667974B2 (en) | 1996-04-18 |
| US5474474A (en) | 1995-12-12 |
| US5362254A (en) | 1994-11-08 |
| EP0602484B1 (en) | 1999-01-27 |
| TW243563B (es) | 1995-03-21 |
| EP0901198A3 (en) | 2002-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5435752A (en) | Electrically balanced connector assembly | |
| US5459643A (en) | Electrically enhanced wiring block with break test capability | |
| EP0843907B1 (en) | Reduced crosstalk modular outlet | |
| US5791943A (en) | Reduced crosstalk modular outlet | |
| US5586914A (en) | Electrical connector and an associated method for compensating for crosstalk between a plurality of conductors | |
| CN1640155B (zh) | 电信接线板 | |
| US7711093B2 (en) | Telecommunications test plugs having tuned near end crosstalk | |
| US5944535A (en) | Interface panel system for networks | |
| US6729901B2 (en) | Wire guide sled hardware for communication plug | |
| US6592395B2 (en) | In-line cable connector assembly | |
| US6428362B1 (en) | Jack including crosstalk compensation for printed circuit board | |
| US6113400A (en) | Modular plug having compensating insert | |
| US7503810B1 (en) | Board edge termination back-end connection assemblies and communications jacks including such assemblies | |
| US6371794B1 (en) | Telecommunications plug and adapter | |
| WO2003044902A1 (en) | Angled rj to rj patch panel | |
| EP1021853A1 (en) | High frequency bi-level offset multi-port jack | |
| WO2010098957A1 (en) | Communications patching devices that include integrated electronic static discharge circuits and related methods | |
| EP0993081B1 (en) | Modular connector with capacitive plates | |
| CN109861040B (zh) | Rj45插头 | |
| KR100452490B1 (ko) | Adsl용 스플리터 장치 및 배선방법 | |
| WO1994008365A2 (en) | Wiring connection system including crosstalk compensating connector | |
| US20030017751A1 (en) | Quick connect/disconnect terminal block |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| RH1 | Patent not in force |