IE72507B1 - Therapeutic amides - Google Patents
Therapeutic amidesInfo
- Publication number
- IE72507B1 IE72507B1 IE922427A IE922427A IE72507B1 IE 72507 B1 IE72507 B1 IE 72507B1 IE 922427 A IE922427 A IE 922427A IE 922427 A IE922427 A IE 922427A IE 72507 B1 IE72507 B1 IE 72507B1
- Authority
- IE
- Ireland
- Prior art keywords
- aromatic
- phenyl
- hydroxy
- mmol
- group
- Prior art date
Links
- 150000001408 amides Chemical class 0.000 title claims abstract description 50
- 230000001225 therapeutic effect Effects 0.000 title description 4
- 150000002148 esters Chemical class 0.000 claims abstract description 31
- 150000003839 salts Chemical class 0.000 claims abstract description 30
- 238000000034 method Methods 0.000 claims abstract description 22
- 238000001727 in vivo Methods 0.000 claims abstract description 19
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 5
- -1 3-cyanophenyl Chemical group 0.000 claims description 130
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 93
- 150000001875 compounds Chemical class 0.000 claims description 87
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 75
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 26
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 18
- 125000001153 fluoro group Chemical group F* 0.000 claims description 17
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 17
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000001072 heteroaryl group Chemical group 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 12
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 11
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 10
- 229910052717 sulfur Chemical group 0.000 claims description 10
- 238000005859 coupling reaction Methods 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 claims description 8
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 8
- 230000008878 coupling Effects 0.000 claims description 8
- 238000010168 coupling process Methods 0.000 claims description 8
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 7
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000005647 linker group Chemical group 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Chemical group 0.000 claims description 6
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 6
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 6
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 claims description 5
- 150000001721 carbon Chemical group 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 claims description 3
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims description 3
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 2
- 150000004791 alkyl magnesium halides Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- LVEDGSIMCSQNNX-UHFFFAOYSA-N n-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1 LVEDGSIMCSQNNX-UHFFFAOYSA-N 0.000 claims description 2
- CRHIAMBJMSSNNM-UHFFFAOYSA-N tetraphenylstannane Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CRHIAMBJMSSNNM-UHFFFAOYSA-N 0.000 claims description 2
- HJLSQMSOURVULD-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(3-hydroxy-4-pyridin-4-ylsulfonylphenyl)-2-methylpropanamide Chemical compound OC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=NC=C1 HJLSQMSOURVULD-UHFFFAOYSA-N 0.000 claims 1
- GVFFQGQURYOONH-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(4-pyridin-4-ylsulfonylphenyl)-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=NC=C1 GVFFQGQURYOONH-UHFFFAOYSA-N 0.000 claims 1
- 241000188250 Idas Species 0.000 claims 1
- 101150057104 MCIDAS gene Proteins 0.000 claims 1
- 125000004799 bromophenyl group Chemical group 0.000 claims 1
- 125000004802 cyanophenyl group Chemical group 0.000 claims 1
- SYDYULNRBNEQFP-UHFFFAOYSA-N n-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-n-methyl-2-(trifluoromethyl)propanamide Chemical compound C1=CC(N(C(=O)C(O)(C(F)(F)F)C(F)(F)F)C)=CC=C1C(=O)C1=CC=CC=C1 SYDYULNRBNEQFP-UHFFFAOYSA-N 0.000 claims 1
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical class C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 claims 1
- 206010046543 Urinary incontinence Diseases 0.000 abstract description 12
- 230000008569 process Effects 0.000 abstract description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 405
- 125000003118 aryl group Chemical group 0.000 description 368
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 264
- 239000000243 solution Substances 0.000 description 237
- 239000007787 solid Substances 0.000 description 232
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 172
- 239000000203 mixture Substances 0.000 description 141
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 140
- 229940073584 methylene chloride Drugs 0.000 description 133
- 238000004458 analytical method Methods 0.000 description 115
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 110
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 109
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 106
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 99
- 239000011541 reaction mixture Substances 0.000 description 95
- 239000002904 solvent Substances 0.000 description 73
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 62
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 51
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 50
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 46
- 238000005481 NMR spectroscopy Methods 0.000 description 40
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 39
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 38
- 239000007864 aqueous solution Substances 0.000 description 35
- 238000003818 flash chromatography Methods 0.000 description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- 229940035423 ethyl ether Drugs 0.000 description 32
- 238000001953 recrystallisation Methods 0.000 description 32
- 235000002639 sodium chloride Nutrition 0.000 description 32
- 210000003932 urinary bladder Anatomy 0.000 description 31
- 238000005160 1H NMR spectroscopy Methods 0.000 description 30
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 30
- 238000010992 reflux Methods 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 229940113088 dimethylacetamide Drugs 0.000 description 26
- 238000003756 stirring Methods 0.000 description 26
- 239000000741 silica gel Substances 0.000 description 25
- 229910002027 silica gel Inorganic materials 0.000 description 25
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 24
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 24
- 239000005457 ice water Substances 0.000 description 24
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 22
- 238000001704 evaporation Methods 0.000 description 21
- 230000008020 evaporation Effects 0.000 description 21
- 238000012360 testing method Methods 0.000 description 19
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 239000000706 filtrate Substances 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- 239000012299 nitrogen atmosphere Substances 0.000 description 15
- 239000012286 potassium permanganate Substances 0.000 description 15
- CTGJACFEVDCYMC-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid Chemical compound OC(=O)C(O)(C)C(F)(F)F CTGJACFEVDCYMC-UHFFFAOYSA-N 0.000 description 14
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 14
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 14
- 239000003480 eluent Substances 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- 239000000463 material Substances 0.000 description 13
- 238000000746 purification Methods 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 239000012153 distilled water Substances 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 11
- 229940045348 brown mixture Drugs 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 235000010265 sodium sulphite Nutrition 0.000 description 11
- 239000012267 brine Substances 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 239000013078 crystal Substances 0.000 description 10
- 238000001035 drying Methods 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- GDYFDXDATVPPDR-UHFFFAOYSA-N 4-(benzenesulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 GDYFDXDATVPPDR-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 238000004587 chromatography analysis Methods 0.000 description 9
- 230000008602 contraction Effects 0.000 description 9
- 239000006260 foam Substances 0.000 description 9
- 239000011780 sodium chloride Substances 0.000 description 9
- 238000001665 trituration Methods 0.000 description 9
- 238000002604 ultrasonography Methods 0.000 description 9
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 8
- 230000008859 change Effects 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 8
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 8
- 150000003457 sulfones Chemical class 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 210000001519 tissue Anatomy 0.000 description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- 239000003610 charcoal Substances 0.000 description 7
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- CMQUGOHGJUTDGZ-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid Chemical compound OC(=O)C(O)(C(F)(F)F)C(F)(F)F CMQUGOHGJUTDGZ-UHFFFAOYSA-N 0.000 description 6
- RPQAROOAFRNNHH-UHFFFAOYSA-N 4-pyridin-4-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=NC=C1 RPQAROOAFRNNHH-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 6
- 239000012965 benzophenone Substances 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- BWLBGMIXKSTLSX-UHFFFAOYSA-N 2-hydroxyisobutyric acid Chemical compound CC(C)(O)C(O)=O BWLBGMIXKSTLSX-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 102000004257 Potassium Channel Human genes 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000004296 chiral HPLC Methods 0.000 description 5
- 229910052744 lithium Inorganic materials 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 229920000137 polyphosphoric acid Polymers 0.000 description 5
- 108020001213 potassium channel Proteins 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- RGINXMPQTJUCOC-UHFFFAOYSA-N (4-aminophenyl)-(3-fluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC(F)=C1 RGINXMPQTJUCOC-UHFFFAOYSA-N 0.000 description 4
- 101150041968 CDC13 gene Proteins 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 4
- 229910052737 gold Inorganic materials 0.000 description 4
- 239000010931 gold Substances 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 238000007912 intraperitoneal administration Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 4
- 239000008247 solid mixture Substances 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 210000002700 urine Anatomy 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- FRGXRXKVVAHXBO-UHFFFAOYSA-N (4-aminophenyl)-(2-fluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=C1F FRGXRXKVVAHXBO-UHFFFAOYSA-N 0.000 description 3
- RBKHNGHPZZZJCI-UHFFFAOYSA-N (4-aminophenyl)-phenylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 RBKHNGHPZZZJCI-UHFFFAOYSA-N 0.000 description 3
- OTRZNQQMXMJNEF-UHFFFAOYSA-N (4-aminophenyl)-pyridin-2-ylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=N1 OTRZNQQMXMJNEF-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- RRPOXOJXECFGDO-UHFFFAOYSA-N 4-(benzenesulfonyl)-3-fluoroaniline Chemical compound FC1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 RRPOXOJXECFGDO-UHFFFAOYSA-N 0.000 description 3
- CJNZHMCUOMOIPB-UHFFFAOYSA-N 4-pyridin-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=N1 CJNZHMCUOMOIPB-UHFFFAOYSA-N 0.000 description 3
- BIGAQSPPHVBONE-UHFFFAOYSA-N 5-amino-2-phenylsulfanylbenzonitrile Chemical compound N#CC1=CC(N)=CC=C1SC1=CC=CC=C1 BIGAQSPPHVBONE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- TVZCRIROJQEVOT-CABCVRRESA-N Cromakalim Chemical compound N1([C@@H]2C3=CC(=CC=C3OC([C@H]2O)(C)C)C#N)CCCC1=O TVZCRIROJQEVOT-CABCVRRESA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 230000003187 abdominal effect Effects 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229950004210 cromakalim Drugs 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000002024 ethyl acetate extract Substances 0.000 description 3
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 230000027939 micturition Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 229940080818 propionamide Drugs 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 210000002460 smooth muscle Anatomy 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- ZLEFKGAGSCJDBB-UHFFFAOYSA-N (4-amino-2-fluorophenyl)-phenylmethanone Chemical compound FC1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 ZLEFKGAGSCJDBB-UHFFFAOYSA-N 0.000 description 2
- SBFAVQPGDJEDCY-UHFFFAOYSA-N (4-nitrophenyl)-pyridin-3-ylmethanone Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CN=C1 SBFAVQPGDJEDCY-UHFFFAOYSA-N 0.000 description 2
- QAPXLUZMMFIIBI-UHFFFAOYSA-N 1,1,3,3-tetrafluoropropan-2-one Chemical compound FC(F)C(=O)C(F)F QAPXLUZMMFIIBI-UHFFFAOYSA-N 0.000 description 2
- 238000004293 19F NMR spectroscopy Methods 0.000 description 2
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 2
- HJSYZAWBXPDYCO-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfanylbenzonitrile Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1C#N HJSYZAWBXPDYCO-UHFFFAOYSA-N 0.000 description 2
- DRZHMCCSGGGUDN-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfanylpyrazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=CN=CC=N1 DRZHMCCSGGGUDN-UHFFFAOYSA-N 0.000 description 2
- MIEGJGVFPKVZQJ-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfonyl-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=NC=CS1 MIEGJGVFPKVZQJ-UHFFFAOYSA-N 0.000 description 2
- BNWSRXYXTUEQIR-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfonylpyridine Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CC=CC=N1 BNWSRXYXTUEQIR-UHFFFAOYSA-N 0.000 description 2
- KJKLHUYKWBQANF-UHFFFAOYSA-N 2-(difluoromethyl)-3,3-difluoro-2-hydroxypropanoic acid Chemical compound OC(=O)C(O)(C(F)F)C(F)F KJKLHUYKWBQANF-UHFFFAOYSA-N 0.000 description 2
- LXVSANCQXSSLPA-UHFFFAOYSA-N 2-Ethyl-2-hydroxy-butyric acid Chemical compound CCC(O)(CC)C(O)=O LXVSANCQXSSLPA-UHFFFAOYSA-N 0.000 description 2
- QXZDGMZJCONOGX-UHFFFAOYSA-N 2-fluoro-4-nitro-1-phenylsulfanylbenzene Chemical compound FC1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1 QXZDGMZJCONOGX-UHFFFAOYSA-N 0.000 description 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 2
- DRYMMXUBDRJPDS-UHFFFAOYSA-N 2-hydroxy-2-methylpropanamide Chemical compound CC(C)(O)C(N)=O DRYMMXUBDRJPDS-UHFFFAOYSA-N 0.000 description 2
- IGCQAJNFEBAMJJ-UHFFFAOYSA-N 3,3-difluoro-2-hydroxy-2-methylpropanoic acid Chemical compound FC(F)C(O)(C)C(O)=O IGCQAJNFEBAMJJ-UHFFFAOYSA-N 0.000 description 2
- FDSYXKNYHZKPHO-UHFFFAOYSA-N 3-(4-nitrophenyl)sulfonylpyridine Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CC=CN=C1 FDSYXKNYHZKPHO-UHFFFAOYSA-N 0.000 description 2
- IGWDEZHXQDTZQV-UHFFFAOYSA-N 3-fluoro-2-methylpropanoic acid Chemical compound FCC(C)C(O)=O IGWDEZHXQDTZQV-UHFFFAOYSA-N 0.000 description 2
- ZMLMBLYLMRDXOJ-UHFFFAOYSA-N 4-(1,3-thiazol-2-ylsulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=NC=CS1 ZMLMBLYLMRDXOJ-UHFFFAOYSA-N 0.000 description 2
- SXOFYPXQBMOPNV-UHFFFAOYSA-N 4-(2-methoxyphenyl)sulfonylaniline Chemical compound COC1=CC=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 SXOFYPXQBMOPNV-UHFFFAOYSA-N 0.000 description 2
- FALWGMKGZCNVKK-UHFFFAOYSA-N 4-(3-methoxyphenyl)sulfonylaniline Chemical compound COC1=CC=CC(S(=O)(=O)C=2C=CC(N)=CC=2)=C1 FALWGMKGZCNVKK-UHFFFAOYSA-N 0.000 description 2
- MUDBXLRIOAWFNX-UHFFFAOYSA-N 4-(3-methylphenyl)sulfonylaniline Chemical compound CC1=CC=CC(S(=O)(=O)C=2C=CC(N)=CC=2)=C1 MUDBXLRIOAWFNX-UHFFFAOYSA-N 0.000 description 2
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 2
- LYHXEBSPXKYZHP-UHFFFAOYSA-N 4-pyrazin-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CN=CC=N1 LYHXEBSPXKYZHP-UHFFFAOYSA-N 0.000 description 2
- DRTZAGWWGHUJOR-UHFFFAOYSA-N 4-pyridin-3-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CN=C1 DRTZAGWWGHUJOR-UHFFFAOYSA-N 0.000 description 2
- GKTKCGAOXFHFTD-UHFFFAOYSA-N 5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-amine Chemical compound S1C(N)=NC=C1S(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 GKTKCGAOXFHFTD-UHFFFAOYSA-N 0.000 description 2
- JTLFPFJOGGQGNZ-UHFFFAOYSA-N 5-(4-nitrophenyl)sulfonyl-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CN=CS1 JTLFPFJOGGQGNZ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 108010081348 HRT1 protein Hairy Proteins 0.000 description 2
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- 206010021639 Incontinence Diseases 0.000 description 2
- 239000012839 Krebs-Henseleit buffer Substances 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 101100109871 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) aro-8 gene Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700157 Rattus norvegicus Species 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 210000000683 abdominal cavity Anatomy 0.000 description 2
- 210000003489 abdominal muscle Anatomy 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- PHZGTCINBMMEFN-UHFFFAOYSA-N benzenethiol;potassium Chemical compound [K].SC1=CC=CC=C1 PHZGTCINBMMEFN-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 210000005068 bladder tissue Anatomy 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 210000001715 carotid artery Anatomy 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 238000004042 decolorization Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001647 drug administration Methods 0.000 description 2
- 238000011067 equilibration Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000002038 ethyl acetate fraction Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910000372 mercury(II) sulfate Inorganic materials 0.000 description 2
- 229940105631 nembutal Drugs 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000036316 preload Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 238000002424 x-ray crystallography Methods 0.000 description 2
- CWGBFIRHYJNILV-UHFFFAOYSA-N (1,4-diphenyl-1,2,4-triazol-4-ium-3-yl)-phenylazanide Chemical compound C=1C=CC=CC=1[N-]C1=NN(C=2C=CC=CC=2)C=[N+]1C1=CC=CC=C1 CWGBFIRHYJNILV-UHFFFAOYSA-N 0.000 description 1
- YCLQTMVHFMKKJV-UHFFFAOYSA-N (4-amino-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 YCLQTMVHFMKKJV-UHFFFAOYSA-N 0.000 description 1
- DJZIJGMEQTTYCK-UHFFFAOYSA-N (4-aminophenyl)-(2,3-difluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC(F)=C1F DJZIJGMEQTTYCK-UHFFFAOYSA-N 0.000 description 1
- ZOIBPLOEXLBYMF-UHFFFAOYSA-N (4-aminophenyl)-(2,5-difluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC(F)=CC=C1F ZOIBPLOEXLBYMF-UHFFFAOYSA-N 0.000 description 1
- WYAKUPXWXWLWDL-UHFFFAOYSA-N (4-aminophenyl)-pyridin-3-ylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CN=C1 WYAKUPXWXWLWDL-UHFFFAOYSA-N 0.000 description 1
- 125000006002 1,1-difluoroethyl group Chemical group 0.000 description 1
- RUBQQRMAWLSCCJ-UHFFFAOYSA-N 1,2-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1 RUBQQRMAWLSCCJ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NTKADLOYTKVXQN-UHFFFAOYSA-N 1-bromo-2-methoxy-4-nitrobenzene Chemical compound COC1=CC([N+]([O-])=O)=CC=C1Br NTKADLOYTKVXQN-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- CPKVUHPKYQGHMW-UHFFFAOYSA-N 1-ethenylpyrrolidin-2-one;molecular iodine Chemical compound II.C=CN1CCCC1=O CPKVUHPKYQGHMW-UHFFFAOYSA-N 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- JJABOWZNFOCHMN-UHFFFAOYSA-N 1-hydroxycyclopentane-1-carboxylic acid Chemical compound OC(=O)C1(O)CCCC1 JJABOWZNFOCHMN-UHFFFAOYSA-N 0.000 description 1
- GQXURJDNDYACGE-UHFFFAOYSA-N 1-hydroxycyclopropane-1-carboxylic acid Chemical compound OC(=O)C1(O)CC1 GQXURJDNDYACGE-UHFFFAOYSA-N 0.000 description 1
- YUAWCHJIODXIFW-UHFFFAOYSA-N 1-methyl-3-(4-nitrophenyl)sulfonylbenzene Chemical compound CC1=CC=CC(S(=O)(=O)C=2C=CC(=CC=2)[N+]([O-])=O)=C1 YUAWCHJIODXIFW-UHFFFAOYSA-N 0.000 description 1
- BVHNGWRPAFKGFP-UHFFFAOYSA-N 1-nitro-4-(4-nitrophenyl)sulfonylbenzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 BVHNGWRPAFKGFP-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- JLZVIWSFUPLSOR-UHFFFAOYSA-N 2,3-difluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1F JLZVIWSFUPLSOR-UHFFFAOYSA-N 0.000 description 1
- IVSRTFGFSPGVAG-UHFFFAOYSA-N 2-(2-methoxyphenyl)-1-[2-(2-methoxyphenyl)-4-nitrophenyl]sulfanyl-4-nitrobenzene Chemical compound COC1=CC=CC=C1C1=CC([N+]([O-])=O)=CC=C1SC1=CC=C([N+]([O-])=O)C=C1C1=CC=CC=C1OC IVSRTFGFSPGVAG-UHFFFAOYSA-N 0.000 description 1
- JZIAXHDTLXCVNV-UHFFFAOYSA-N 2-(2-methoxyphenyl)-1-[2-(2-methoxyphenyl)-4-nitrophenyl]sulfonyl-4-nitrobenzene Chemical compound COC1=CC=CC=C1C1=CC([N+]([O-])=O)=CC=C1S(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1C1=CC=CC=C1OC JZIAXHDTLXCVNV-UHFFFAOYSA-N 0.000 description 1
- PIBPBGMHPUPAMF-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfanyl-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=NC=CS1 PIBPBGMHPUPAMF-UHFFFAOYSA-N 0.000 description 1
- KNXDWZLVOLZISA-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfonylpyrazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CN=CC=N1 KNXDWZLVOLZISA-UHFFFAOYSA-N 0.000 description 1
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 1
- DSCJETUEDFKYGN-UHFFFAOYSA-N 2-Methoxybenzenethiol Chemical compound COC1=CC=CC=C1S DSCJETUEDFKYGN-UHFFFAOYSA-N 0.000 description 1
- AFMPMSCZPVNPEM-UHFFFAOYSA-N 2-bromobenzonitrile Chemical compound BrC1=CC=CC=C1C#N AFMPMSCZPVNPEM-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 1
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 1
- YUDNSUGXEKRHEH-UHFFFAOYSA-N 2-methoxybenzenethiol;potassium Chemical compound [K].COC1=CC=CC=C1S YUDNSUGXEKRHEH-UHFFFAOYSA-N 0.000 description 1
- NGOKGAIFSOUVIU-UHFFFAOYSA-N 2-methyl-4-nitro-1-phenylsulfanylbenzene Chemical compound CC1=CC([N+]([O-])=O)=CC=C1SC1=CC=CC=C1 NGOKGAIFSOUVIU-UHFFFAOYSA-N 0.000 description 1
- QDVJAJNCRWJSIO-UHFFFAOYSA-N 2-methylsulfanyl-4-nitro-1-phenylbenzene Chemical compound CSC1=CC([N+]([O-])=O)=CC=C1C1=CC=CC=C1 QDVJAJNCRWJSIO-UHFFFAOYSA-N 0.000 description 1
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 1
- IDDNGQJMAIRFTN-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(4-pyridin-2-ylsulfonylphenyl)-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=N1 IDDNGQJMAIRFTN-UHFFFAOYSA-N 0.000 description 1
- FTVVTTPQUSNKBN-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-[4-(2-hydroxyphenyl)sulfonylphenyl]-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1O FTVVTTPQUSNKBN-UHFFFAOYSA-N 0.000 description 1
- MXEXHASUJVVTKU-UHFFFAOYSA-N 3,3,3-trifluoro-2-methylpropanamide Chemical compound NC(=O)C(C)C(F)(F)F MXEXHASUJVVTKU-UHFFFAOYSA-N 0.000 description 1
- DQOGDQIDOONUSK-UHFFFAOYSA-N 3,3,3-trifluoro-2-methylpropanoic acid Chemical compound OC(=O)C(C)C(F)(F)F DQOGDQIDOONUSK-UHFFFAOYSA-N 0.000 description 1
- OJBLMXHXUYFFPS-UHFFFAOYSA-N 3,3,3-trifluoro-2-phenylmethoxy-2-(trifluoromethyl)propanoic acid Chemical compound OC(=O)C(C(F)(F)F)(C(F)(F)F)OCC1=CC=CC=C1 OJBLMXHXUYFFPS-UHFFFAOYSA-N 0.000 description 1
- BWSPNJIWXYYHAT-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(2-fluorobenzoyl)phenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1F BWSPNJIWXYYHAT-UHFFFAOYSA-N 0.000 description 1
- ZGRQGEXXUUJWQS-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(4-fluorophenyl)sulfonylphenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=C(F)C=C1 ZGRQGEXXUUJWQS-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- MXNBDFWNYRNIBH-UHFFFAOYSA-N 3-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1 MXNBDFWNYRNIBH-UHFFFAOYSA-N 0.000 description 1
- SCHQWAPTRCCHGR-UHFFFAOYSA-N 3-methoxy-4-pyridin-4-ylsulfonylaniline Chemical compound COC1=CC(N)=CC=C1S(=O)(=O)C1=CC=NC=C1 SCHQWAPTRCCHGR-UHFFFAOYSA-N 0.000 description 1
- RWCINFKAYRVTFF-UHFFFAOYSA-N 4-(1,3-thiazol-5-ylsulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CN=CS1 RWCINFKAYRVTFF-UHFFFAOYSA-N 0.000 description 1
- WVDXEDVIGUVYTA-UHFFFAOYSA-N 4-(2-chlorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1Cl WVDXEDVIGUVYTA-UHFFFAOYSA-N 0.000 description 1
- GGABKJDTKJFOOS-UHFFFAOYSA-N 4-(2-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1F GGABKJDTKJFOOS-UHFFFAOYSA-N 0.000 description 1
- FQMOFUPNDCROBN-UHFFFAOYSA-N 4-(2-methoxy-4-nitrophenyl)sulfanylpyridine Chemical compound COC1=CC([N+]([O-])=O)=CC=C1SC1=CC=NC=C1 FQMOFUPNDCROBN-UHFFFAOYSA-N 0.000 description 1
- TYBWNOXLIDGMGO-UHFFFAOYSA-N 4-(2-methylphenyl)sulfonylaniline Chemical compound CC1=CC=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 TYBWNOXLIDGMGO-UHFFFAOYSA-N 0.000 description 1
- JJKIEHUKBJREET-UHFFFAOYSA-N 4-(3-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC(F)=C1 JJKIEHUKBJREET-UHFFFAOYSA-N 0.000 description 1
- YKLGSFACDTUTPG-UHFFFAOYSA-N 4-(4-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(F)C=C1 YKLGSFACDTUTPG-UHFFFAOYSA-N 0.000 description 1
- IIIBGHFAYVJNTN-UHFFFAOYSA-N 4-(benzenesulfonyl)-3-chloroaniline Chemical compound ClC1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 IIIBGHFAYVJNTN-UHFFFAOYSA-N 0.000 description 1
- ZFBKYGFPUCUYIF-UHFFFAOYSA-N 4-amino-2-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C(Cl)=C1 ZFBKYGFPUCUYIF-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 1
- QTHRNZUSIRIYDI-UHFFFAOYSA-N 4-pyrimidin-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=NC=CC=N1 QTHRNZUSIRIYDI-UHFFFAOYSA-N 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- ABPFQVOLERTHTN-UHFFFAOYSA-N 4-thiophen-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CS1 ABPFQVOLERTHTN-UHFFFAOYSA-N 0.000 description 1
- KUWFTPAQURHOBN-UHFFFAOYSA-N 5-nitro-2-phenylsulfanylbenzonitrile Chemical compound N#CC1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1 KUWFTPAQURHOBN-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- DFGKGUXTPFWHIX-UHFFFAOYSA-N 6-[2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]acetyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)C1=CC2=C(NC(O2)=O)C=C1 DFGKGUXTPFWHIX-UHFFFAOYSA-N 0.000 description 1
- 208000000884 Airway Obstruction Diseases 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 241000972773 Aulopiformes Species 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 206010007559 Cardiac failure congestive Diseases 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920002785 Croscarmellose sodium Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 244000287680 Garcinia dulcis Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 102100030500 Heparin cofactor 2 Human genes 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- 101001082432 Homo sapiens Heparin cofactor 2 Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020853 Hypertonic bladder Diseases 0.000 description 1
- YQEZLKZALYSWHR-UHFFFAOYSA-N Ketamine Chemical compound C=1C=CC=C(Cl)C=1C1(NC)CCCCC1=O YQEZLKZALYSWHR-UHFFFAOYSA-N 0.000 description 1
- 208000000913 Kidney Calculi Diseases 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 201000007224 Myeloproliferative neoplasm Diseases 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010029148 Nephrolithiasis Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BNUHAJGCKIQFGE-UHFFFAOYSA-N Nitroanisol Chemical compound COC1=CC=C([N+]([O-])=O)C=C1 BNUHAJGCKIQFGE-UHFFFAOYSA-N 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 1
- 229940127315 Potassium Channel Openers Drugs 0.000 description 1
- 229920000153 Povidone-iodine Polymers 0.000 description 1
- 208000006399 Premature Obstetric Labor Diseases 0.000 description 1
- 206010036600 Premature labour Diseases 0.000 description 1
- 206010039163 Right ventricular failure Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 206010068168 androgenetic alopecia Diseases 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 210000002376 aorta thoracic Anatomy 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- 210000003443 bladder cell Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009530 blood pressure measurement Methods 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229960001681 croscarmellose sodium Drugs 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000011833 dog model Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- GCFHZZWXZLABBL-UHFFFAOYSA-N ethanol;hexane Chemical compound CCO.CCCCCC GCFHZZWXZLABBL-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- TVZISJTYELEYPI-UHFFFAOYSA-N hypodiphosphoric acid Chemical compound OP(O)(=O)P(O)(O)=O TVZISJTYELEYPI-UHFFFAOYSA-N 0.000 description 1
- 201000001881 impotence Diseases 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 230000036724 intravesical pressure Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 235000000396 iron Nutrition 0.000 description 1
- 208000002551 irritable bowel syndrome Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 229960003299 ketamine Drugs 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- YECIFGHRMFEPJK-UHFFFAOYSA-N lidocaine hydrochloride monohydrate Chemical compound O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C YECIFGHRMFEPJK-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004890 malting Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- JOHGREWJSUDXHI-UHFFFAOYSA-N n-(3-cyano-4-phenylsulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound N#CC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1SC1=CC=CC=C1 JOHGREWJSUDXHI-UHFFFAOYSA-N 0.000 description 1
- DFQCVXOIMDPCJO-UHFFFAOYSA-N n-(4-benzoyl-3-fluorophenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound FC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1 DFQCVXOIMDPCJO-UHFFFAOYSA-N 0.000 description 1
- YWMDWBKCZPJBHU-UHFFFAOYSA-N n-(4-benzoylphenyl)-3,3-difluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)F)C)=CC=C1C(=O)C1=CC=CC=C1 YWMDWBKCZPJBHU-UHFFFAOYSA-N 0.000 description 1
- HSWBBZLWIGINOW-UHFFFAOYSA-N n-(4-cyano-3-phenylsulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound FC(F)(F)C(O)(C)C(=O)NC1=CC=C(C#N)C(SC=2C=CC=CC=2)=C1 HSWBBZLWIGINOW-UHFFFAOYSA-N 0.000 description 1
- BETJELCMYOMLNQ-UHFFFAOYSA-N n-[4-(2,3-difluorobenzoyl)phenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC(F)=C1F BETJELCMYOMLNQ-UHFFFAOYSA-N 0.000 description 1
- FPLQCWXALURBDJ-UHFFFAOYSA-N n-[4-(2-cyanophenyl)sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1C#N FPLQCWXALURBDJ-UHFFFAOYSA-N 0.000 description 1
- PXUHSBKGJFYMON-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-hydroxyphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound OC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 PXUHSBKGJFYMON-UHFFFAOYSA-N 0.000 description 1
- MPEZKUULJKRRBY-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-2-ethyl-2-hydroxybutanamide Chemical compound C1=CC(NC(=O)C(O)(CC)CC)=CC=C1S(=O)(=O)C1=CC=CC=C1 MPEZKUULJKRRBY-UHFFFAOYSA-N 0.000 description 1
- GCGDBHBUWUTMOU-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-2-hydroxy-2-methylbutanamide Chemical compound C1=CC(NC(=O)C(C)(O)CC)=CC=C1S(=O)(=O)C1=CC=CC=C1 GCGDBHBUWUTMOU-UHFFFAOYSA-N 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 238000003305 oral gavage Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- ROVXLNOMZDLGDB-UHFFFAOYSA-M potassium;3-methoxybenzenethiolate Chemical compound [K+].COC1=CC=CC([S-])=C1 ROVXLNOMZDLGDB-UHFFFAOYSA-M 0.000 description 1
- INFNXSSRRJMZAM-UHFFFAOYSA-M potassium;4-nitrobenzenethiolate Chemical compound [K+].[O-][N+](=O)C1=CC=C([S-])C=C1 INFNXSSRRJMZAM-UHFFFAOYSA-M 0.000 description 1
- GFFZAFIBOVCKCQ-UHFFFAOYSA-M potassium;pyridine-4-thiolate Chemical compound [K+].[S-]C1=CC=NC=C1 GFFZAFIBOVCKCQ-UHFFFAOYSA-M 0.000 description 1
- 229960001621 povidone-iodine Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 208000026440 premature labor Diseases 0.000 description 1
- 230000037452 priming Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 230000000246 remedial effect Effects 0.000 description 1
- 235000019515 salmon Nutrition 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000050 smooth muscle relaxant Substances 0.000 description 1
- 229960002668 sodium chloride Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 125000004434 sulfur atom Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- 210000000626 ureter Anatomy 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/38—Heterocyclic compounds having sulfur as a ring hetero atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/16—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/40—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
- C07C317/48—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C317/50—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/38—One sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/18—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Reproductive Health (AREA)
- Endocrinology (AREA)
- Urology & Nephrology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Steroid Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919116069A GB9116069D0 (en) | 1991-07-25 | 1991-07-25 | Therapeutic amides |
| GB929209416A GB9209416D0 (en) | 1992-04-30 | 1992-04-30 | Therapeutic amides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE922427A1 IE922427A1 (en) | 1993-01-27 |
| IE72507B1 true IE72507B1 (en) | 1997-04-23 |
Family
ID=26299285
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE922427A IE72507B1 (en) | 1991-07-25 | 1992-07-24 | Therapeutic amides |
Country Status (24)
| Country | Link |
|---|---|
| US (7) | US5272163A (en:Method) |
| EP (1) | EP0524781B1 (en:Method) |
| JP (1) | JP3192228B2 (en:Method) |
| KR (1) | KR100239077B1 (en:Method) |
| CN (1) | CN1038413C (en:Method) |
| AT (1) | ATE136027T1 (en:Method) |
| AU (1) | AU648423B2 (en:Method) |
| CA (1) | CA2074605A1 (en:Method) |
| CZ (1) | CZ282503B6 (en:Method) |
| DE (1) | DE69209395T2 (en:Method) |
| DK (1) | DK0524781T3 (en:Method) |
| ES (1) | ES2084944T3 (en:Method) |
| FI (1) | FI112940B (en:Method) |
| GB (1) | GB9214120D0 (en:Method) |
| GR (1) | GR3019446T3 (en:Method) |
| HU (2) | HU213605B (en:Method) |
| IE (1) | IE72507B1 (en:Method) |
| IL (1) | IL102626A (en:Method) |
| NO (1) | NO178300C (en:Method) |
| NZ (1) | NZ243686A (en:Method) |
| PL (1) | PL171933B1 (en:Method) |
| SG (1) | SG48002A1 (en:Method) |
| SK (1) | SK280516B6 (en:Method) |
| TW (1) | TW221053B (en:Method) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2080949A1 (en) * | 1991-10-21 | 1993-04-22 | Cyrus John Ohnmacht | Therapeutic agents |
| IL105558A (en) * | 1992-05-18 | 1998-04-05 | Zeneca Ltd | Tertiary carbinols having potassium channel activity, process for their preparation and pharmaceutical compositions containing them |
| GB9305295D0 (en) * | 1993-03-15 | 1993-05-05 | Zeneca Ltd | Therapeutic compounds |
| GB9310095D0 (en) * | 1993-05-17 | 1993-06-30 | Zeneca Ltd | Therapeutic compounds |
| GB9310069D0 (en) * | 1993-05-17 | 1993-06-30 | Zeneca Ltd | Heterocyclic compounds |
| AT402926B (de) * | 1994-12-05 | 1997-09-25 | Hafslund Nycomed Pharma | Heterocyclische amide, verfahren zu ihrer herstellung und verwendung |
| DE19506652A1 (de) * | 1995-02-25 | 1996-08-29 | Nycomed Arzneimittel Gmbh | Heterocyclische Amide, Verfahren zu ihrer Herstellung und ihre Verwendung |
| EP0820288B1 (en) | 1995-03-03 | 2004-02-11 | Endo Pharmaceuticals Inc. | Use of dextromethorphan or dextrorphan for the treatment of urinary incontinence |
| ES2159047T3 (es) * | 1995-10-16 | 2001-09-16 | Kyowa Hakko Kogyo Kk | Compuestos triciclicos. |
| US5756005A (en) * | 1995-11-01 | 1998-05-26 | Rohm And Haas Company | Stabilization of non-halogenated 3-isothiazolones in aggressive systems |
| WO1997032562A1 (fr) * | 1996-03-06 | 1997-09-12 | L'oreal | Utilisation de n-aryl-2-hydroxyalkylamides pour stimuler ou induire la pousse des cheveux et/ou stopper leur chute |
| FR2747039B1 (fr) * | 1996-04-05 | 1998-05-22 | Oreal | Utilisation du n-(3,4-dicyano-phenyl)- 3,3,3-trifluoro- 2-hydroxy-2-methylpropionamide pour stimuler ou induire la pousse des cheveux et/ou stopper leur chute |
| GB9607458D0 (en) * | 1996-04-10 | 1996-06-12 | Zeneca Ltd | Enzymatic process for stereoselective preparation of therapeutic amides |
| DE19614856A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide heterocyclisch anellierte Benzoylisothiazole |
| DE19614858A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide heterocyclisch substituierte Benzoylisothiazole |
| DE19614859A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide Benzoylisothiazole |
| US6171298B1 (en) | 1996-05-03 | 2001-01-09 | Situs Corporation | Intravesical infuser |
| DK0938584T3 (da) | 1996-07-10 | 2008-09-22 | Lonza Ag | Fremgangsmåde til fremstilling af (S)-eller (R)-3,3,3-trifluor-2-hydroxy-2-methylpropionsyre |
| CA2264037A1 (en) * | 1996-09-13 | 1998-03-19 | Merck & Co., Inc. | Thrombin inhibitors |
| BR9808552A (pt) * | 1997-04-15 | 2000-05-23 | Kyowa Hakko Kogyo Kk | Composto tricìclico ou um sal farmaceuticamente aceitável do mesmo, e, composição farmacêutica |
| BR9811828A (pt) * | 1997-08-05 | 2000-08-15 | American Home Prod | Análogos do ácido antranìlico |
| US6127392A (en) * | 1997-08-05 | 2000-10-03 | American Home Products Corporation | Anthranilic acid analogs |
| BR9811845A (pt) * | 1997-08-05 | 2000-08-08 | American Home Prod | Análogos do ácido antranìlico |
| FR2770842B1 (fr) * | 1997-11-13 | 1999-12-17 | Oreal | Nouveaux composes derives de n-aryl 2-hydroxy alkylamides |
| ATE236136T1 (de) * | 1998-01-16 | 2003-04-15 | Hoffmann La Roche | Benzosulfonderivate |
| GB9804648D0 (en) | 1998-03-06 | 1998-04-29 | Zeneca Ltd | Chemical compounds |
| US6183461B1 (en) | 1998-03-11 | 2001-02-06 | Situs Corporation | Method for delivering a medication |
| GB9805520D0 (en) | 1998-03-17 | 1998-05-13 | Zeneca Ltd | Chemical compounds |
| GB9811427D0 (en) | 1998-05-29 | 1998-07-22 | Zeneca Ltd | Chemical compounds |
| US6096770A (en) * | 1998-08-03 | 2000-08-01 | American Home Products Corporation | Anthranilic acid analogs |
| WO2000050623A2 (de) | 1999-02-23 | 2000-08-31 | Lonza Ag | Verfahren zur herstellung von optisch aktiven 3,3,3- trifluormethyl- 2- alkylpropionsäurederivaten |
| DK1394150T3 (da) | 1999-02-24 | 2011-03-21 | Hoffmann La Roche | 4-phenylpyridinderivater og deres anvendelse som NK-1-receptorantagonister |
| US6790978B2 (en) | 1999-03-29 | 2004-09-14 | Novartis Ag | Thyromimetic organic compounds |
| US6599942B1 (en) | 1999-03-29 | 2003-07-29 | Novartis Ag | Thyromimetic organic compounds |
| US7030109B2 (en) | 1999-07-19 | 2006-04-18 | Pharmacia & Upjohn Company | 1,2,3,4,5,6-Hexahydroazepino[4,5-b]indoles containing arylsulfones at the 9-position |
| MY122278A (en) | 1999-07-19 | 2006-04-29 | Upjohn Co | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indoles containing arylsulfones at the 9-position |
| WO2001017956A1 (en) * | 1999-09-04 | 2001-03-15 | Astrazeneca Ab | Substituted n-phenyl 2-hydroxy-2-methyl-3,3,3-trifluoropropanamide derivatives which elevate pyruvate dehydrogenase activity |
| JP2003508509A (ja) | 1999-09-04 | 2003-03-04 | アストラゼネカ アクチボラグ | ピルビン酸デヒドロゲナーゼの阻害剤としてのアミド |
| US6552225B1 (en) | 1999-09-04 | 2003-04-22 | Astrazeneca Ab | Chemical compounds |
| DE10061876A1 (de) * | 2000-12-12 | 2002-06-20 | Aventis Pharma Gmbh | Arylierte Furan- und Thiophencarbonsäureamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie sie enthaltende pharmazeutische Zubereitungen |
| US7765153B2 (en) * | 2003-06-10 | 2010-07-27 | Kagi, Inc. | Method and apparatus for verifying financial account information |
| US7288658B2 (en) | 2003-07-15 | 2007-10-30 | Hoffmann-La Roche Inc. | Process for preparation of pyridine derivatives |
| US7404324B2 (en) * | 2005-08-19 | 2008-07-29 | Honeywell International Inc. | Gunhard shock isolation system |
| SI1928427T1 (sl) | 2005-09-23 | 2010-03-31 | Hoffmann La Roche | Nove formulacije za doziranje |
| US10654809B2 (en) | 2016-06-10 | 2020-05-19 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10441570B2 (en) | 2015-04-21 | 2019-10-15 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) Ligands and methods of use thereof |
| US10865184B2 (en) | 2015-04-21 | 2020-12-15 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10093613B2 (en) | 2015-04-21 | 2018-10-09 | Gtx, Inc. | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10806720B2 (en) | 2015-04-21 | 2020-10-20 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| CN105218418A (zh) * | 2015-10-01 | 2016-01-06 | 宜春学院 | 一种硫醚的制备方法 |
| US11230523B2 (en) | 2016-06-10 | 2022-01-25 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| WO2020051344A1 (en) | 2018-09-05 | 2020-03-12 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (sard) ligands and methods of use thereof |
| CN112007027B (zh) * | 2020-09-14 | 2022-07-15 | 长春金赛药业有限责任公司 | 含酯基芳香丙酰胺类化合物及其代谢产物在制备治疗心衰药物中的应用 |
| EP4571056A1 (de) | 2023-12-13 | 2025-06-18 | MTU Aero Engines AG | Schaufelverstellarm für eine gasturbine, strömungsmaschine mit dem schaufelverstellarm und verfahren zur montage eines schaufelverstellarms für eine strömungsmaschine |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3365485A (en) * | 1963-05-29 | 1968-01-23 | American Home Prod | 2-acetoxyacetamido-5-chlorobenzophenone |
| US3468878A (en) * | 1963-05-29 | 1969-09-23 | American Home Prod | Process for preparing 3 - acyloxy-1,3-dihydro - 5 - aryl-2h-1,4-benzodiazepin-2-ones |
| NL7008627A (en:Method) * | 1969-06-25 | 1970-12-29 | ||
| NL7008629A (en:Method) * | 1969-06-25 | 1970-12-29 | ||
| US3715375A (en) * | 1970-09-17 | 1973-02-06 | Merck & Co Inc | New diphenyl sulfones |
| DE2730174C2 (de) * | 1977-07-04 | 1981-12-10 | Ludwig Merckle Kg Chem. Pharm. Fabrik, 7902 Blaubeuren | Aminobenzoesäurederivate und Arzneimittel enthaltend solche Aminobenzoesäurederivate |
| DE2862100D1 (en) * | 1977-10-12 | 1983-01-05 | Ici Plc | Acylanilides, process for their manufacture and pharmaceutical and veterinary compositions containing them |
| US4191775A (en) * | 1977-12-15 | 1980-03-04 | Imperial Chemical Industries Limited | Amide derivatives |
| JPS55108796A (en) * | 1979-02-14 | 1980-08-21 | Matsushita Electric Industrial Co Ltd | Device for inserting component |
| NZ197008A (en) * | 1980-05-22 | 1984-10-19 | Ici Ltd | Acylanilide derivatives and pharmaceutical compositions |
| AU8961382A (en) * | 1981-11-06 | 1983-05-12 | Imperial Chemical Industries Plc | Amide derivatives |
| ATE28864T1 (de) * | 1982-07-23 | 1987-08-15 | Ici Plc | Amide-derivate. |
| GB8406000D0 (en) * | 1984-03-07 | 1984-04-11 | Ici Plc | Olefine derivatives |
| NO174506B (no) * | 1984-10-30 | 1994-02-07 | Usv Pharma Corp | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser |
| JPS61172843A (ja) * | 1985-01-17 | 1986-08-04 | ユーエスヴイー フアーマシユーテイカル コーポレーシヨン | 過敏症疾患治療剤としてのアリールアルコキシフエニルアリルアルコール類 |
| GB8617652D0 (en) * | 1986-07-18 | 1986-08-28 | Ici Plc | Acylanilide derivatives |
| GB8617653D0 (en) * | 1986-07-18 | 1986-08-28 | Ici Plc | Amide derivatives |
| US4851423A (en) * | 1986-12-10 | 1989-07-25 | Schering Corporation | Pharmaceutically active compounds |
| US5272982A (en) * | 1989-06-01 | 1993-12-28 | Giat Industries | Device for maintaining a projectile relative to the casing of a telescoping ammunition |
| IE64358B1 (en) * | 1989-07-18 | 1995-07-26 | Ici Plc | Diaryl ether heterocycles |
| IE902111A1 (en) * | 1989-07-18 | 1991-06-19 | Ici Plc | Diaryl ether cycloalkanes |
| GB9220570D0 (en) * | 1991-10-21 | 1992-11-11 | Ici Plc | Therapeutic agent |
-
1992
- 1992-07-03 GB GB929214120A patent/GB9214120D0/en active Pending
- 1992-07-17 DE DE69209395T patent/DE69209395T2/de not_active Expired - Fee Related
- 1992-07-17 DK DK92306588.2T patent/DK0524781T3/da active
- 1992-07-17 EP EP92306588A patent/EP0524781B1/en not_active Expired - Lifetime
- 1992-07-17 ES ES92306588T patent/ES2084944T3/es not_active Expired - Lifetime
- 1992-07-17 AT AT92306588T patent/ATE136027T1/de not_active IP Right Cessation
- 1992-07-17 SG SG1996006045A patent/SG48002A1/en unknown
- 1992-07-23 NZ NZ243686A patent/NZ243686A/en unknown
- 1992-07-23 AU AU20476/92A patent/AU648423B2/en not_active Ceased
- 1992-07-23 US US07/918,982 patent/US5272163A/en not_active Expired - Lifetime
- 1992-07-23 IL IL10262692A patent/IL102626A/en not_active IP Right Cessation
- 1992-07-24 NO NO922942A patent/NO178300C/no unknown
- 1992-07-24 PL PL92295405A patent/PL171933B1/pl unknown
- 1992-07-24 CZ CS922342A patent/CZ282503B6/cs not_active IP Right Cessation
- 1992-07-24 FI FI923379A patent/FI112940B/fi active
- 1992-07-24 CA CA002074605A patent/CA2074605A1/en not_active Abandoned
- 1992-07-24 IE IE922427A patent/IE72507B1/en not_active IP Right Cessation
- 1992-07-24 HU HU9202429A patent/HU213605B/hu not_active IP Right Cessation
- 1992-07-24 SK SK2342-92A patent/SK280516B6/sk unknown
- 1992-07-25 CN CN92109759A patent/CN1038413C/zh not_active Expired - Fee Related
- 1992-07-25 KR KR1019920013404A patent/KR100239077B1/ko not_active Expired - Fee Related
- 1992-07-27 JP JP19995492A patent/JP3192228B2/ja not_active Expired - Fee Related
- 1992-08-08 TW TW081106280A patent/TW221053B/zh active
-
1993
- 1993-09-24 US US08/126,350 patent/US5382598A/en not_active Expired - Lifetime
-
1994
- 1994-10-26 US US08/329,188 patent/US5474999A/en not_active Expired - Lifetime
-
1995
- 1995-06-07 US US08/476,007 patent/US5565477A/en not_active Expired - Lifetime
- 1995-06-07 US US08/476,413 patent/US5565465A/en not_active Expired - Lifetime
- 1995-06-07 US US08/476,407 patent/US5567735A/en not_active Expired - Lifetime
- 1995-06-16 HU HU95P/P00228P patent/HU211138A9/hu unknown
-
1996
- 1996-03-28 GR GR960400647T patent/GR3019446T3/el unknown
- 1996-08-23 US US08/701,820 patent/US5684198A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0524781B1 (en) | Therapeutic amides | |
| EP0617010B1 (en) | Therapeutic compounds | |
| TWI409247B (zh) | 4-取代之苯氧基苯基乙酸衍生物 | |
| EP0625516B1 (en) | Benzenesulphonamide derivatives for the treatment of bladder instability | |
| US5484792A (en) | 1,8-(2H,5H)-acridinedione therapeutic agents | |
| RU2074173C1 (ru) | Амиды, способы их получения и фармацевтическая композиция, обладающая свойствами открывателя каналов для клеточного калия | |
| HK1003570B (en) | Therapeutic amides | |
| JPH04173775A (ja) | アニリド誘導体 | |
| HK1014183A (en) | Therapeutic compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |