IE58236B1 - Process for preparing 2-hydrazino-1, 3-diazacycloalk-2-ene hydrohalides - Google Patents
Process for preparing 2-hydrazino-1, 3-diazacycloalk-2-ene hydrohalidesInfo
- Publication number
- IE58236B1 IE58236B1 IE57985A IE57985A IE58236B1 IE 58236 B1 IE58236 B1 IE 58236B1 IE 57985 A IE57985 A IE 57985A IE 57985 A IE57985 A IE 57985A IE 58236 B1 IE58236 B1 IE 58236B1
- Authority
- IE
- Ireland
- Prior art keywords
- sub
- hydrogen
- ene
- sup
- formula
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 10
- 238000000034 method Methods 0.000 claims abstract description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 19
- -1 ammonium halide Chemical class 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims abstract description 15
- 239000000203 mixture Substances 0.000 claims abstract description 14
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims abstract description 13
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims abstract description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 10
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 9
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 6
- 150000004820 halides Chemical class 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 238000010992 reflux Methods 0.000 claims abstract description 6
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims abstract description 5
- 125000005233 alkylalcohol group Chemical group 0.000 claims abstract description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims abstract description 4
- 239000012433 hydrogen halide Substances 0.000 claims abstract description 4
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 45
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical group [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 16
- 229940044613 1-propanol Drugs 0.000 claims description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- 235000019270 ammonium chloride Nutrition 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical group [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical group 0.000 claims 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 238000001914 filtration Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- DJZWNSRUEJSEEB-UHFFFAOYSA-N n-(4,5-dihydro-1h-imidazol-2-yl)nitramide Chemical compound [O-][N+](=O)NC1=NCCN1 DJZWNSRUEJSEEB-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical group [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 2
- 229940107816 ammonium iodide Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- KCCKZVUDDJTOFK-UHFFFAOYSA-N hydrazine;hydrate;hydrochloride Chemical compound O.Cl.NN KCCKZVUDDJTOFK-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- GRHGTRIHFULSAY-UHFFFAOYSA-N 1,4,5,6-tetrahydropyrimidin-2-amine;hydrochloride Chemical compound Cl.NC1=NCCCN1 GRHGTRIHFULSAY-UHFFFAOYSA-N 0.000 description 1
- UBDZFAGVPPMTIT-UHFFFAOYSA-N 2-aminoguanidine;hydron;chloride Chemical compound [Cl-].NC(N)=N[NH3+] UBDZFAGVPPMTIT-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- DIESEUQXOPYZEJ-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-2-ylhydrazine;dihydrochloride Chemical compound Cl.Cl.NNC1=NCCN1 DIESEUQXOPYZEJ-UHFFFAOYSA-N 0.000 description 1
- CUDNMHPROXHRNR-UHFFFAOYSA-N 4,5-dihydroimidazol-1-ylhydrazine Chemical compound NNN1CCN=C1 CUDNMHPROXHRNR-UHFFFAOYSA-N 0.000 description 1
- KHKOZPUHPXIUAZ-UHFFFAOYSA-N CCCC=CC.Cl Chemical compound CCCC=CC.Cl KHKOZPUHPXIUAZ-UHFFFAOYSA-N 0.000 description 1
- IDVCQTWMDBQBFA-UHFFFAOYSA-N O.NN.Cl.Cl Chemical compound O.NN.Cl.Cl IDVCQTWMDBQBFA-UHFFFAOYSA-N 0.000 description 1
- CLTDXZXMHNPEFM-UHFFFAOYSA-N O.NN.I Chemical compound O.NN.I CLTDXZXMHNPEFM-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- SBRUFOSORMQHES-UHFFFAOYSA-N anthracene-9,10-dialdehyde Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=C(C=O)C2=C1 SBRUFOSORMQHES-UHFFFAOYSA-N 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 231100000357 carcinogen Toxicity 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960000789 guanidine hydrochloride Drugs 0.000 description 1
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
- LIAWOTKNAVAKCX-UHFFFAOYSA-N hydrazine;dihydrochloride Chemical compound Cl.Cl.NN LIAWOTKNAVAKCX-UHFFFAOYSA-N 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- OFQXYHOKKFJNHE-UHFFFAOYSA-N n-(5-methyl-4,5-dihydro-1h-imidazol-2-yl)nitramide Chemical compound CC1CNC(N[N+]([O-])=O)=N1 OFQXYHOKKFJNHE-UHFFFAOYSA-N 0.000 description 1
- FGBCHRJGTFUKJT-UHFFFAOYSA-N n-(5-propyl-1,4,5,6-tetrahydropyrimidin-2-yl)nitramide Chemical compound CCCC1CNC(N[N+]([O-])=O)=NC1 FGBCHRJGTFUKJT-UHFFFAOYSA-N 0.000 description 1
- 229960005335 propanol Drugs 0.000 description 1
- 150000003583 thiosemicarbazides Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D245/00—Heterocyclic compounds containing rings of more than seven members having two nitrogen atoms as the only ring hetero atoms
- C07D245/02—Heterocyclic compounds containing rings of more than seven members having two nitrogen atoms as the only ring hetero atoms not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/52—Nitrogen atoms not forming part of a nitro radical with hetero atoms directly attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D239/08—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms directly attached in position 2
- C07D239/12—Nitrogen atoms not forming part of a nitro radical
- C07D239/18—Nitrogen atoms not forming part of a nitro radical with hetero atoms attached to said nitrogen atoms, except nitro radicals, e.g. hydrazine radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/04—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/587,414 US4574155A (en) | 1984-03-08 | 1984-03-08 | Process for preparing 2-hydrazino-1,3-diazacycloalk-2-ene hydrohalides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE850579L IE850579L (en) | 1985-09-08 |
| IE58236B1 true IE58236B1 (en) | 1993-08-11 |
Family
ID=24349708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE57985A IE58236B1 (en) | 1984-03-08 | 1985-03-07 | Process for preparing 2-hydrazino-1, 3-diazacycloalk-2-ene hydrohalides |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4574155A (https=) |
| EP (1) | EP0158020B1 (https=) |
| JP (1) | JPS60204768A (https=) |
| KR (1) | KR920002265B1 (https=) |
| AT (1) | ATE34571T1 (https=) |
| AU (1) | AU578935B2 (https=) |
| DD (1) | DD231786A5 (https=) |
| DE (1) | DE3507579A1 (https=) |
| DK (1) | DK166321C (https=) |
| ES (1) | ES8606857A1 (https=) |
| FI (1) | FI86300C (https=) |
| GR (1) | GR850562B (https=) |
| HK (1) | HK107290A (https=) |
| IE (1) | IE58236B1 (https=) |
| IL (1) | IL74431A (https=) |
| NO (1) | NO170882C (https=) |
| NZ (1) | NZ211278A (https=) |
| PT (1) | PT80049B (https=) |
| ZA (1) | ZA851731B (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5852009A (en) * | 1984-03-19 | 1998-12-22 | The Rockefeller University | Compositions, including pharmaceutical compositions, for inhibiting the advanced glycosylation of proteins, and therapeutic methods based thereon |
| US4983604A (en) * | 1987-11-13 | 1991-01-08 | The Rockefeller University | Inhibitors of nonenzymatic cross-linking |
| US5258381A (en) * | 1984-03-19 | 1993-11-02 | The Rockefeller University | 2-substituted-2-imidazolines |
| US5612332A (en) * | 1984-03-19 | 1997-03-18 | Alteon Inc. | Di- and triaminoguanidines, and methods of use |
| JPH0784461B2 (ja) * | 1986-12-19 | 1995-09-13 | 日本バイエルアグロケム株式会社 | 殺虫性ニトロイミノ又はシアノイミノ化合物 |
| US5850840A (en) * | 1995-11-15 | 1998-12-22 | Alteon Inc. | Methods for measurement and treatment predicated on the presence of advanced glycosylation endproducts in tobacco and its combustion byproducts |
| US6110968A (en) * | 1995-12-26 | 2000-08-29 | The Picower Institute For Medical Research | Methods for treatment predicated on the presence of advanced glycosylation endproducts in tobacco and its combustion byproducts |
| US5877217A (en) * | 1995-12-26 | 1999-03-02 | Alteon Inc. | N-acylaminoalkyl-hydrazinecarboximidamides |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2525927A (en) * | 1947-09-26 | 1950-10-17 | Honorary Advisory Council | 2-nitramino delta 2-1, 3 diazacycloalkenes |
| FR1380402A (fr) * | 1959-07-30 | 1964-12-04 | Inst Chibret S A | Perfectionnements apportés à la préparation d'imidazolines substituées en position 2 |
| BE792606A (fr) * | 1972-01-06 | 1973-03-30 | Ferlux | Nouveaux semicarbazides et thiosemicarbazides et leur preparation |
| JPS5222101B2 (https=) * | 1973-05-09 | 1977-06-15 | ||
| US3931152A (en) * | 1974-01-29 | 1976-01-06 | American Cyanamid Company | 2-(1,3-Diazacycloalkenyl)-2-hydrazones of substituted chalcones |
| US4258181A (en) * | 1978-09-05 | 1981-03-24 | American Cyanamid Company | Substituted 9,10-anthracenebishydrazones |
| US4262122A (en) * | 1980-02-19 | 1981-04-14 | American Cyanamid Company | Preparation of 5,5-dimethyl-2-hydrazino-1,4,5,6-tetrahydro-pyrimidine hydrohalide |
-
1984
- 1984-03-08 US US06/587,414 patent/US4574155A/en not_active Expired - Lifetime
-
1985
- 1985-02-05 AT AT85101161T patent/ATE34571T1/de active
- 1985-02-05 EP EP85101161A patent/EP0158020B1/en not_active Expired
- 1985-02-24 IL IL74431A patent/IL74431A/xx unknown
- 1985-03-01 NZ NZ211278A patent/NZ211278A/xx unknown
- 1985-03-04 DE DE19853507579 patent/DE3507579A1/de not_active Withdrawn
- 1985-03-05 PT PT80049A patent/PT80049B/pt not_active IP Right Cessation
- 1985-03-05 GR GR850562A patent/GR850562B/el unknown
- 1985-03-05 JP JP60042021A patent/JPS60204768A/ja active Granted
- 1985-03-06 DD DD85273820A patent/DD231786A5/de not_active IP Right Cessation
- 1985-03-07 NO NO850907A patent/NO170882C/no unknown
- 1985-03-07 FI FI850911A patent/FI86300C/fi not_active IP Right Cessation
- 1985-03-07 DK DK105385A patent/DK166321C/da not_active IP Right Cessation
- 1985-03-07 IE IE57985A patent/IE58236B1/en not_active IP Right Cessation
- 1985-03-07 ZA ZA851731A patent/ZA851731B/xx unknown
- 1985-03-07 KR KR1019850001451A patent/KR920002265B1/ko not_active Expired
- 1985-03-07 ES ES541036A patent/ES8606857A1/es not_active Expired
- 1985-03-07 AU AU39634/85A patent/AU578935B2/en not_active Ceased
-
1990
- 1990-12-18 HK HK1072/90A patent/HK107290A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO170882C (no) | 1992-12-23 |
| DK166321B (da) | 1993-04-05 |
| DK105385A (da) | 1985-09-09 |
| FI86300B (fi) | 1992-04-30 |
| DK105385D0 (da) | 1985-03-07 |
| EP0158020B1 (en) | 1988-05-25 |
| ES541036A0 (es) | 1986-05-16 |
| IL74431A0 (en) | 1985-05-31 |
| AU3963485A (en) | 1985-09-12 |
| KR920002265B1 (ko) | 1992-03-20 |
| EP0158020A1 (en) | 1985-10-16 |
| IE850579L (en) | 1985-09-08 |
| US4574155A (en) | 1986-03-04 |
| IL74431A (en) | 1990-01-18 |
| JPH0563470B2 (https=) | 1993-09-10 |
| PT80049B (pt) | 1987-06-17 |
| FI850911A0 (fi) | 1985-03-07 |
| FI850911L (fi) | 1985-09-09 |
| DE3507579A1 (de) | 1985-09-12 |
| AU578935B2 (en) | 1988-11-10 |
| HK107290A (en) | 1990-12-28 |
| ATE34571T1 (de) | 1988-06-15 |
| NZ211278A (en) | 1988-10-28 |
| NO850907L (no) | 1985-09-09 |
| PT80049A (en) | 1985-04-01 |
| ZA851731B (en) | 1985-11-27 |
| ES8606857A1 (es) | 1986-05-16 |
| DD231786A5 (de) | 1986-01-08 |
| FI86300C (fi) | 1992-08-10 |
| KR850006190A (ko) | 1985-10-02 |
| JPS60204768A (ja) | 1985-10-16 |
| NO170882B (no) | 1992-09-14 |
| GR850562B (https=) | 1985-07-03 |
| DK166321C (da) | 1993-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0158020B1 (en) | Process for preparing 2-hydrazino-1,3-diazacycoalk-2-ene hydrohalides | |
| US3922161A (en) | Novel herbicidal compositions | |
| US3857692A (en) | 1,2-dimethyl-3,5-diphenylpyrazolium salts and 3,5-dibromo-4-hydroxybenzonitrile herbicidal compositions | |
| US4925944A (en) | Process for the preparation of o-carboxypyridyl- and o-carboxyquinolylimidazolinones | |
| JPH0354099B2 (https=) | ||
| US4443629A (en) | Preparation of hydrazidines | |
| US4892956A (en) | 5-cyano-4,5-dihydro-3,4-dicarboxypyrazole derivatives | |
| CA1119179A (en) | Process for preparing n-tritylimidazole compounds | |
| US4456769A (en) | Preparation of hydrazidines | |
| US4833141A (en) | 4-[4-[[2-(halophenyl)-2-[1H-tr:azol(or diazol)-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-piperazine-1-carbimic acids having antimycotic activity | |
| US3758474A (en) | Hyl-7-hydroxy pyrimidines process for the production of-2-aryl-3-imino s triazolo n4,3-ae-5-meprocess for the production of-2-aryl-3-imino s triazolo (4,3-a)-5-met | |
| US4924001A (en) | Process for preparing 5-cyano-4, 5-dihydro-3,4-dicarboxypyrazole derivatives | |
| HU226886B1 (en) | Novel process for preparing fluconazole monohydrate | |
| US5110945A (en) | 1-azoniabicyclo[3.3.0]oct-1(5)-ene salt derivatives and process for the preparation of the same | |
| HU198179B (en) | Process for producing n-methyl-1-alkylthio-2-nitroethenamine derivatives | |
| JPH0528708B2 (https=) | ||
| US3855293A (en) | Novel amine compounds | |
| KR830002349B1 (ko) | 4-(5)-하이드록시메틸 5(4)-저급알킬이미다졸류의 제조방법 | |
| KR830000634B1 (ko) | N-트리틸 이미다졸 화합물을 제조하는 방법 | |
| HU191095B (en) | Process for the production of 3,5 diamino-1,2,4-triazole-derivatives | |
| JPS636069B2 (https=) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |