IE55020B1 - Impact sensitive high temperature detonator - Google Patents
Impact sensitive high temperature detonatorInfo
- Publication number
- IE55020B1 IE55020B1 IE627/84A IE62784A IE55020B1 IE 55020 B1 IE55020 B1 IE 55020B1 IE 627/84 A IE627/84 A IE 627/84A IE 62784 A IE62784 A IE 62784A IE 55020 B1 IE55020 B1 IE 55020B1
- Authority
- IE
- Ireland
- Prior art keywords
- charge
- casing
- detonator
- detonator according
- primary explosive
- Prior art date
Links
- 238000010304 firing Methods 0.000 claims abstract description 42
- 239000011819 refractory material Substances 0.000 claims abstract description 30
- 150000001540 azides Chemical class 0.000 claims abstract description 27
- 239000003999 initiator Substances 0.000 claims abstract description 26
- 239000002360 explosive Substances 0.000 claims description 82
- 239000000463 material Substances 0.000 claims description 35
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims description 9
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 9
- 229910000838 Al alloy Inorganic materials 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000003129 oil well Substances 0.000 description 8
- YSIBQULRFXITSW-OWOJBTEDSA-N 1,3,5-trinitro-2-[(e)-2-(2,4,6-trinitrophenyl)ethenyl]benzene Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C1\C=C\C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O YSIBQULRFXITSW-OWOJBTEDSA-N 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000004033 plastic Substances 0.000 description 7
- 229920003023 plastic Polymers 0.000 description 7
- 230000000977 initiatory effect Effects 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 238000009527 percussion Methods 0.000 description 6
- 230000004323 axial length Effects 0.000 description 5
- 239000012254 powdered material Substances 0.000 description 4
- 230000001427 coherent effect Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000003082 abrasive agent Substances 0.000 description 2
- 238000002788 crimping Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000005553 drilling Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000005337 ground glass Substances 0.000 description 2
- 239000007769 metal material Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- QBFXQJXHEPIJKW-UHFFFAOYSA-N silver azide Chemical compound [Ag+].[N-]=[N+]=[N-] QBFXQJXHEPIJKW-UHFFFAOYSA-N 0.000 description 2
- JDFUJAMTCCQARF-UHFFFAOYSA-N tatb Chemical compound NC1=C([N+]([O-])=O)C(N)=C([N+]([O-])=O)C(N)=C1[N+]([O-])=O JDFUJAMTCCQARF-UHFFFAOYSA-N 0.000 description 2
- MNUJHDPQSAMAAM-UHFFFAOYSA-N 1,3,7,9-tetranitrobenzotriazolo[2,1-a]benzotriazol-5-ium-6-ide Chemical compound C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=NN(C=3C(=C([N+]([O-])=O)C=C(C=3)[N+](=O)[O-])[N-]3)[N+]3=C21 MNUJHDPQSAMAAM-UHFFFAOYSA-N 0.000 description 1
- FZAZPMLWYUKRAE-UHFFFAOYSA-N 2,4,6-trinitrobenzene-1,3-diamine Chemical compound NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C(N)=C1[N+]([O-])=O FZAZPMLWYUKRAE-UHFFFAOYSA-N 0.000 description 1
- YNCRJDVIFSGCTH-UHFFFAOYSA-N 3,5-dinitro-n-(2,4,6-trinitrophenyl)pyridin-2-amine Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CN=C1NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O YNCRJDVIFSGCTH-UHFFFAOYSA-N 0.000 description 1
- OJZIOUGIUXQKJP-UHFFFAOYSA-N 3-nitro-4-(2,3,4,5,6-pentanitrophenyl)benzene-1,2-diamine Chemical group [O-][N+](=O)C1=C(N)C(N)=CC=C1C1=C([N+]([O-])=O)C([N+]([O-])=O)=C([N+]([O-])=O)C([N+]([O-])=O)=C1[N+]([O-])=O OJZIOUGIUXQKJP-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- -1 Polyethylene terephthalate Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- PDZKZMQQDCHTNF-UHFFFAOYSA-M copper(1+);thiocyanate Chemical compound [Cu+].[S-]C#N PDZKZMQQDCHTNF-UHFFFAOYSA-M 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- WETZJIOEDGMBMA-UHFFFAOYSA-L lead styphnate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([O-])=C1[N+]([O-])=O WETZJIOEDGMBMA-UHFFFAOYSA-L 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- 230000037452 priming Effects 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical compound [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C7/00—Non-electric detonators; Blasting caps; Primers
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/10—Percussion caps
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
- Pressure Welding/Diffusion-Bonding (AREA)
- Portable Nailing Machines And Staplers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/483,134 US4527481A (en) | 1983-04-08 | 1983-04-08 | Impact sensitive high temperature detonator |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE840627L IE840627L (en) | 1984-10-08 |
| IE55020B1 true IE55020B1 (en) | 1990-04-25 |
Family
ID=23918812
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE627/84A IE55020B1 (en) | 1983-04-08 | 1984-03-13 | Impact sensitive high temperature detonator |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4527481A (show.php) |
| EP (1) | EP0122012B1 (show.php) |
| JP (1) | JPS59205600A (show.php) |
| AU (1) | AU571248B2 (show.php) |
| CA (1) | CA1228505A (show.php) |
| DE (1) | DE3474208D1 (show.php) |
| DK (1) | DK181184A (show.php) |
| GB (1) | GB2139740B (show.php) |
| IE (1) | IE55020B1 (show.php) |
| NO (1) | NO158833C (show.php) |
| PT (1) | PT78369B (show.php) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3607350A1 (de) * | 1986-03-06 | 1987-09-24 | Dynamit Nobel Ag | Detonator mit schnell ausloesendem anzuendelement |
| DE3629371A1 (de) * | 1986-04-26 | 1987-10-29 | Dynamit Nobel Ag | Sprengzeitzuender |
| US4939996A (en) * | 1986-09-03 | 1990-07-10 | Coors Porcelain Company | Ceramic munitions projectile |
| US4850278A (en) * | 1986-09-03 | 1989-07-25 | Coors Porcelain Company | Ceramic munitions projectile |
| FR2618140B1 (fr) * | 1987-07-17 | 1990-11-02 | Gruaz Eric | Amorce pour munitions d'arme a feu |
| US5417160A (en) * | 1993-12-01 | 1995-05-23 | Olin Corporation | Lead-free priming mixture for percussion primer |
| US5597974A (en) * | 1996-03-04 | 1997-01-28 | Schlumberger Technology Corporation | Shaped charge for a perforating gun having a main body of explosive including TATB and a sensitive primer |
| WO1999053263A2 (en) * | 1998-01-29 | 1999-10-21 | Halliburton Energy Services, Inc. | Deflagration to detonation choke |
| US6672215B2 (en) * | 2001-10-17 | 2004-01-06 | Textron Systems Corporation | Constant output high-precision microcapillary pyrotechnic initiator |
| US6761116B2 (en) * | 2001-10-17 | 2004-07-13 | Textron Sytems Corporation | Constant output high-precision microcapillary pyrotechnic initiator |
| ITMI20020418A1 (it) * | 2002-03-01 | 2003-09-01 | Fiocchi Munizioni Spa | Miscela innescante per inneschi di cartucce per armi portatili |
| SG11201604474XA (en) * | 2013-11-07 | 2016-07-28 | Saab Ab Publ | Electric detonator and method for producing an electric detonator |
| DE202014000055U1 (de) * | 2014-01-10 | 2014-03-06 | Voere Holding Gmbh | Zündelement zum Zünden von Munition |
| US10126103B2 (en) * | 2014-09-03 | 2018-11-13 | Halliburton Energy Services, Inc. | Perforating systems with insensitive high explosive |
| US10746002B2 (en) | 2014-09-03 | 2020-08-18 | Halliburton Energy Services, Inc. | Perforating systems with insensitive high explosive |
| US11674784B2 (en) | 2016-03-14 | 2023-06-13 | JD Pharma, LLC | Systems and methods for selectively disabling electrical and mechanical devices |
| CA3056146C (en) * | 2016-03-14 | 2022-06-14 | JD Pharma, LLC | Selectively disabled ammunition and remote ammunition disabling system and method of use |
| US10865617B2 (en) | 2016-12-20 | 2020-12-15 | Baker Hughes, A Ge Company, Llc | One-way energy retention device, method and system |
| US10450840B2 (en) | 2016-12-20 | 2019-10-22 | Baker Hughes, A Ge Company, Llc | Multifunctional downhole tools |
| US11015409B2 (en) * | 2017-09-08 | 2021-05-25 | Baker Hughes, A Ge Company, Llc | System for degrading structure using mechanical impact and method |
| US10907429B2 (en) | 2017-10-16 | 2021-02-02 | Baker Hughes, A Ge Company, Llc | Plug formed from a disintegrate on demand (DOD) material |
| DE102019116464A1 (de) * | 2019-06-18 | 2020-12-24 | NEFZER SPECIAL EFFECTS GmbH | Filmeffektzünder und Verfahren zum Herstellen |
| US11650037B2 (en) * | 2021-02-16 | 2023-05-16 | Spectre Materials Sciences, Inc. | Primer for firearms and other munitions |
| WO2025085106A2 (en) | 2023-04-29 | 2025-04-24 | Spectre Primer Technologies, Inc. | Fuzzy interface layer for thermite and primer made from thermite with fuzzy layer |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2868128A (en) * | 1946-03-19 | 1959-01-13 | Thomas D Ramsey | Hermetically sealed primer |
| US2857847A (en) * | 1954-10-13 | 1958-10-28 | Olin Mathieson | Detonators |
| US3186341A (en) * | 1961-10-06 | 1965-06-01 | Bjorklund John Olof | Igniter with separated layers of explosive |
| DE1278288B (de) * | 1963-09-10 | 1968-09-19 | Dynamit Nobel Ag | Kartusche fuer gewerbliche Zwecke |
| US3353488A (en) * | 1964-10-10 | 1967-11-21 | Dynamit Nobel Ag | Primer for impact fuses |
| FR1449432A (fr) * | 1964-10-10 | 1966-08-12 | Dynamit Nobel Ag | Amorce perfectionnée pour détonateurs à percussion |
| DE1206762B (de) * | 1964-10-10 | 1965-12-09 | Dynamit Nobel Ag | Zuendhuetchen fuer Aufschlagzuender |
| US3306201A (en) * | 1965-06-30 | 1967-02-28 | Du Pont | Explosive composition and waterhammer-resistant delay device containing same |
| DE1603754A1 (de) * | 1966-04-28 | 1970-12-23 | Dynamit Nobel Ag | Kartusche zum Vortreiben des Arbeitskolbens von pulverkraftbetriebenen Geraeten zur gewerblichen Nutzung |
| US3638572A (en) * | 1969-02-18 | 1972-02-01 | Us Navy | Delay train for ordnance fuse |
| US3610151A (en) * | 1969-05-09 | 1971-10-05 | Us Army | Nonelectric squib assembly |
| GB1314203A (en) * | 1969-07-11 | 1973-04-18 | Dynamit Nobel Ag | Ammunition primers |
| US3618523A (en) * | 1970-05-06 | 1971-11-09 | Us Navy | Stab-electric detonator |
| DE3170446D1 (en) * | 1981-01-08 | 1985-06-13 | Imi Kynoch Ltd | Percussion cap for sporting ammunition |
-
1983
- 1983-04-08 US US06/483,134 patent/US4527481A/en not_active Expired - Lifetime
-
1984
- 1984-03-05 GB GB08405703A patent/GB2139740B/en not_active Expired
- 1984-03-05 DE DE8484301441T patent/DE3474208D1/de not_active Expired
- 1984-03-05 EP EP84301441A patent/EP0122012B1/en not_active Expired
- 1984-03-13 IE IE627/84A patent/IE55020B1/en unknown
- 1984-03-14 NO NO840980A patent/NO158833C/no unknown
- 1984-03-23 CA CA000450437A patent/CA1228505A/en not_active Expired
- 1984-04-04 PT PT78369A patent/PT78369B/pt not_active IP Right Cessation
- 1984-04-06 DK DK181184A patent/DK181184A/da unknown
- 1984-04-07 JP JP59068405A patent/JPS59205600A/ja active Granted
- 1984-07-27 AU AU31221/84A patent/AU571248B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| DK181184D0 (da) | 1984-04-06 |
| DE3474208D1 (en) | 1988-10-27 |
| US4527481A (en) | 1985-07-09 |
| JPH0413640B2 (show.php) | 1992-03-10 |
| EP0122012B1 (en) | 1988-09-21 |
| NO158833C (no) | 1988-11-02 |
| NO158833B (no) | 1988-07-25 |
| NO840980L (no) | 1984-10-09 |
| EP0122012A2 (en) | 1984-10-17 |
| JPS59205600A (ja) | 1984-11-21 |
| EP0122012A3 (en) | 1985-10-16 |
| PT78369A (en) | 1984-05-01 |
| AU3122184A (en) | 1985-02-07 |
| PT78369B (en) | 1986-08-28 |
| IE840627L (en) | 1984-10-08 |
| GB2139740B (en) | 1987-02-25 |
| GB8405703D0 (en) | 1984-04-11 |
| DK181184A (da) | 1984-10-09 |
| CA1228505A (en) | 1987-10-27 |
| GB2139740A (en) | 1984-11-14 |
| AU571248B2 (en) | 1988-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4527481A (en) | Impact sensitive high temperature detonator | |
| US5567906A (en) | Tungsten enhanced liner for a shaped charge | |
| US3188955A (en) | Explosive charge assemblies | |
| US5417162A (en) | Detonation coupling device | |
| AU586983B2 (en) | Non-primary explosive detonator and initiating element therefor | |
| EP1476712B1 (en) | Device for the disruption of explosive ordnance | |
| US2796833A (en) | Perforating devices | |
| US6467416B1 (en) | Combined high-blast/anti-armor warheads | |
| US3828676A (en) | Consumable explosive cartridges | |
| US4671177A (en) | Temperature resistant detonator | |
| CA2044682C (en) | Delay initiator for blasting | |
| EP1725827B1 (en) | Explosive cartridge | |
| CA1331935C (en) | Multi-directional initiator for explosives | |
| WO2000026603A1 (en) | Non-primary detonators | |
| CA2252353C (en) | Non-primary detonator | |
| EP3497399A1 (en) | A method of and a cartridge for disarming an unexploded blasting charge in a drill hole | |
| CA1295185C (en) | Non-primary explosive detonator | |
| JPH04236100A (ja) | 雷管およびその製造方法 | |
| JPS61117188A (ja) | 電気雷管の起爆方法及びその電気雷管 | |
| RU2074386C1 (ru) | Устройство для ударного инициирования | |
| US3236317A (en) | Projectile propelling apparatus for use in high temperature environment | |
| AU757884B2 (en) | Non-primary detonators | |
| AU2234200A (en) | Shaped charge for a perforating gun having a main body of explosive including TATB and a sensitive primer |