IE51137B1 - Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soap - Google Patents
Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soapInfo
- Publication number
- IE51137B1 IE51137B1 IE866/81A IE86681A IE51137B1 IE 51137 B1 IE51137 B1 IE 51137B1 IE 866/81 A IE866/81 A IE 866/81A IE 86681 A IE86681 A IE 86681A IE 51137 B1 IE51137 B1 IE 51137B1
- Authority
- IE
- Ireland
- Prior art keywords
- water
- sodium
- detergent
- zeolite
- soap
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 57
- 239000003599 detergent Substances 0.000 title claims abstract description 53
- 239000000344 soap Substances 0.000 title claims abstract description 42
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 title claims abstract description 41
- 229910000323 aluminium silicate Inorganic materials 0.000 title claims abstract description 19
- 150000004670 unsaturated fatty acids Chemical class 0.000 title claims abstract description 14
- 235000021122 unsaturated fatty acids Nutrition 0.000 title claims abstract description 14
- 239000004094 surface-active agent Substances 0.000 claims abstract description 40
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 20
- 239000000271 synthetic detergent Substances 0.000 claims abstract description 10
- 239000011734 sodium Substances 0.000 claims description 36
- 239000010457 zeolite Substances 0.000 claims description 28
- 229910052708 sodium Inorganic materials 0.000 claims description 23
- 229910021536 Zeolite Inorganic materials 0.000 claims description 22
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 20
- 239000000463 material Substances 0.000 claims description 16
- 239000002245 particle Substances 0.000 claims description 15
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 14
- 229910001868 water Inorganic materials 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 238000005342 ion exchange Methods 0.000 claims description 10
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 8
- 239000004615 ingredient Substances 0.000 claims description 8
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 8
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical group [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 claims description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- 239000004115 Sodium Silicate Substances 0.000 claims description 7
- 239000011591 potassium Chemical group 0.000 claims description 7
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 7
- 125000000129 anionic group Chemical group 0.000 claims description 6
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 6
- 239000000194 fatty acid Substances 0.000 claims description 6
- 229930195729 fatty acid Natural products 0.000 claims description 6
- 230000036571 hydration Effects 0.000 claims description 6
- 238000006703 hydration reaction Methods 0.000 claims description 6
- 229910001425 magnesium ion Inorganic materials 0.000 claims description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 6
- 235000011152 sodium sulphate Nutrition 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 5
- 150000001768 cations Chemical class 0.000 claims description 5
- 150000004665 fatty acids Chemical class 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- 229910001424 calcium ion Inorganic materials 0.000 claims description 4
- 239000013078 crystal Substances 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 3
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 claims description 3
- 235000011180 diphosphates Nutrition 0.000 claims description 2
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 claims description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 claims description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims 1
- 229940005740 hexametaphosphate Drugs 0.000 claims 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 claims 1
- 239000002689 soil Substances 0.000 abstract description 8
- 125000000217 alkyl group Chemical group 0.000 description 22
- -1 triethanolammonium cations Chemical class 0.000 description 17
- 229920001296 polysiloxane Polymers 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 230000001276 controlling effect Effects 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- 239000003760 tallow Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000002736 nonionic surfactant Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- WYPBVHPKMJYUEO-NBTZWHCOSA-M sodium;(9z,12z)-octadeca-9,12-dienoate Chemical compound [Na+].CCCCC\C=C/C\C=C/CCCCCCCC([O-])=O WYPBVHPKMJYUEO-NBTZWHCOSA-M 0.000 description 5
- 235000013162 Cocos nucifera Nutrition 0.000 description 4
- 244000060011 Cocos nucifera Species 0.000 description 4
- 229940120146 EDTMP Drugs 0.000 description 4
- 150000008051 alkyl sulfates Chemical class 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 description 4
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 4
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 4
- 241000252233 Cyprinus carpio Species 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 229940077388 benzenesulfonate Drugs 0.000 description 3
- 239000007844 bleaching agent Substances 0.000 description 3
- 239000002738 chelating agent Substances 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000004996 alkyl benzenes Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- UPBDXRPQPOWRKR-UHFFFAOYSA-N furan-2,5-dione;methoxyethene Chemical compound COC=C.O=C1OC(=O)C=C1 UPBDXRPQPOWRKR-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 229940049918 linoleate Drugs 0.000 description 2
- 239000003607 modifier Substances 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 150000003445 sucroses Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910004809 Na2 SO4 Inorganic materials 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 235000019482 Palm oil Nutrition 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000004965 Silica aerogel Substances 0.000 description 1
- KIDJHPQACZGFTI-UHFFFAOYSA-N [6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCCCCCN(CP(O)(O)=O)CP(O)(O)=O KIDJHPQACZGFTI-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000002752 cationic softener Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FSBVERYRVPGNGG-UHFFFAOYSA-N dimagnesium dioxido-bis[[oxido(oxo)silyl]oxy]silane hydrate Chemical compound O.[Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O FSBVERYRVPGNGG-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- KRHIGIYZRJWEGL-UHFFFAOYSA-N dodecapotassium;tetraborate Chemical class [K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-] KRHIGIYZRJWEGL-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- WCHFOOKTKZYYAE-UHFFFAOYSA-N ethoxyperoxyethane Chemical group CCOOOCC WCHFOOKTKZYYAE-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- VSXGXPNADZQTGQ-UHFFFAOYSA-N oxirane;phenol Chemical compound C1CO1.OC1=CC=CC=C1 VSXGXPNADZQTGQ-UHFFFAOYSA-N 0.000 description 1
- 239000003002 pH adjusting agent Substances 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- 229940023569 palmate Drugs 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/141,222 US4265777A (en) | 1980-04-17 | 1980-04-17 | Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soap |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE810866L IE810866L (en) | 1981-10-17 |
| IE51137B1 true IE51137B1 (en) | 1986-10-15 |
Family
ID=22494725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE866/81A IE51137B1 (en) | 1980-04-17 | 1981-04-16 | Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soap |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4265777A (enFirst) |
| EP (1) | EP0038591B1 (enFirst) |
| JP (1) | JPS5736198A (enFirst) |
| AT (1) | ATE11564T1 (enFirst) |
| CA (1) | CA1157339A (enFirst) |
| DE (1) | DE3168577D1 (enFirst) |
| GR (1) | GR74458B (enFirst) |
| IE (1) | IE51137B1 (enFirst) |
| PH (1) | PH15715A (enFirst) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4404128A (en) * | 1981-05-29 | 1983-09-13 | The Procter & Gamble Company | Enzyme detergent composition |
| NZ201212A (en) * | 1981-07-15 | 1985-08-16 | Unilever Plc | Detergent additives and compositions |
| DE3264287D1 (en) * | 1981-09-14 | 1985-07-25 | Procter & Gamble | Alkaline aqueous liquid detergent compositions containing normally unstable ester perfumes |
| US4440663A (en) * | 1981-09-14 | 1984-04-03 | The Procter & Gamble Company | Alkaline aqueous liquid detergent compositions containing normally unstable ester perfumes |
| US4405483A (en) * | 1982-04-27 | 1983-09-20 | The Procter & Gamble Company | Stable liquid detergents containing aluminosilicate ion exchange material |
| FR2528722A1 (fr) * | 1982-06-18 | 1983-12-23 | Rhone Poulenc Chim Base | Zeolite comme auxiliaire de detergence |
| US4545919A (en) * | 1982-08-31 | 1985-10-08 | Ciba-Geigy Corporation | Detergent composition for washing off dyeings obtained with fibre-reactive dyes and washing process comprising the use thereof |
| EP0117568B1 (en) * | 1983-01-20 | 1986-10-15 | Unilever N.V. | Particulate detergent composition |
| GB8327271D0 (en) * | 1983-10-12 | 1983-11-16 | Unilever Plc | Built liquid detergent compositions |
| US4560492A (en) * | 1984-11-02 | 1985-12-24 | The Procter & Gamble Company | Laundry detergent composition with enhanced stain removal |
| JPH0633399B2 (ja) * | 1986-07-16 | 1994-05-02 | 花王株式会社 | 洗浄剤組成物 |
| JPH0633400B2 (ja) * | 1986-07-16 | 1994-05-02 | 花王株式会社 | 洗浄剤組成物 |
| DE3717227A1 (de) * | 1987-05-21 | 1988-12-01 | Henkel Kgaa | Phosphatfreies waschmittel mit reduzierter inkrustierungstendenz |
| JP2510135B2 (ja) * | 1987-05-25 | 1996-06-26 | ライオン株式会社 | 衣料用液体洗浄剤組成物 |
| SE463211B (sv) * | 1987-10-26 | 1990-10-22 | Berol Nobel Ab | Tvaettmedelskomposition innehaallande en kombination av amfotaer foerening och zeolit |
| DE3829847A1 (de) * | 1988-09-02 | 1990-03-15 | Basf Ag | Wasch- und reinigungsmittel |
| GB8825783D0 (en) * | 1988-11-03 | 1988-12-07 | Unilever Plc | Novel aluminosilicates & detergent compositions containing them |
| DE3929591A1 (de) * | 1989-09-06 | 1991-03-07 | Henkel Kgaa | Zeolithhaltiges fluessigwaschmittel |
| US5102572A (en) * | 1990-06-22 | 1992-04-07 | Ethyl Corporation | Lime soap dispersant comprising sodium cocoyl glyceryl sulfonate and N-alkyl-N,N-dimethylamine oxide |
| GB9012612D0 (en) * | 1990-06-06 | 1990-07-25 | Unilever Plc | Detergents compositions |
| GB9113675D0 (en) * | 1991-06-25 | 1991-08-14 | Unilever Plc | Particulate detergent composition or component |
| GB9119958D0 (en) * | 1991-09-18 | 1991-10-30 | Unilever Plc | Detergent compositions |
| GB9216386D0 (en) * | 1992-07-31 | 1992-09-16 | Unilever Plc | Use of aluminosilicates of the zeolite p type as low temperature calcium binders |
| LT3962B (en) | 1993-12-21 | 1996-05-27 | Albright & Wilson | Funcional fluids |
| US6489278B1 (en) * | 1993-12-30 | 2002-12-03 | Ecolab Inc. | Combination of a nonionic silicone surfactant and a nonionic surfactant in a solid block detergent |
| US5562866A (en) * | 1995-06-20 | 1996-10-08 | Albemarle Corporation | Formulated branched chain alcohol ether sulfate compounds |
| US5690539A (en) * | 1995-08-07 | 1997-11-25 | Cal-West Equipment Company Inc. | Method of abarding using surface abrasion compositions |
| GB9605534D0 (en) * | 1996-03-15 | 1996-05-15 | Unilever Plc | Detergent compositions |
| GB9605533D0 (en) * | 1996-03-15 | 1996-05-15 | Unilever Plc | Modified aluminosilicate |
| EP1002046B1 (de) | 1997-07-30 | 2003-04-16 | Basf Aktiengesellschaft | Feste textilwaschmittel-formulierung enthaltend glycin-n, n-diessigsäure-derivate |
| US6964945B1 (en) * | 1998-09-25 | 2005-11-15 | The Procter & Gamble Company | Solid detergent compositions |
| US6369021B1 (en) | 1999-05-07 | 2002-04-09 | Ecolab Inc. | Detergent composition and method for removing soil |
| GB9913547D0 (en) | 1999-06-10 | 1999-08-11 | Unilever Plc | Particulate detergent composition containing zeolite |
| GB9913546D0 (en) | 1999-06-10 | 1999-08-11 | Unilever Plc | Granular detergent component containing zeolite map and laundry detergent compositions containing it |
| GB0031823D0 (en) | 2000-12-29 | 2001-02-14 | Unilever Plc | Detergent compositions |
| GB0031827D0 (en) * | 2000-12-29 | 2001-02-14 | Unilever Plc | Detergent compositions |
| US6660713B2 (en) * | 2001-01-30 | 2003-12-09 | The Procter & Gamble Company | Hydrophobic nanozeolites for malodor control |
| GB0319367D0 (en) * | 2003-08-18 | 2003-09-17 | Unilever Plc | Detergent composition |
| US20080026150A1 (en) * | 2003-12-03 | 2008-01-31 | Cal-West Specialty Coatings, Inc. | Silica-Free Surface Abrasion Compositions and Their Uses |
| TW201031743A (en) | 2008-12-18 | 2010-09-01 | Basf Se | Surfactant mixture comprising branched short-chain and branched long-chain components |
| WO2011003904A1 (de) | 2009-07-10 | 2011-01-13 | Basf Se | Tensidgemisch mit kurz- und langkettigen komponenten |
| US20110237484A1 (en) | 2010-03-25 | 2011-09-29 | Basf Se | Electrochemical textile-washing process |
| JP2013524868A (ja) | 2010-03-25 | 2013-06-20 | ビーエーエスエフ ソシエタス・ヨーロピア | 電気化学的織物洗濯方法 |
| JP6607686B2 (ja) * | 2015-03-26 | 2019-11-20 | ライオン株式会社 | 繊維製品用の液体洗浄剤 |
| EP3724310A4 (en) | 2017-12-15 | 2021-07-21 | Rhodia Operations | COMPOSITION WITH LANTHANIDE METAL COMPLEX |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB569178A (en) | 1943-11-03 | 1945-05-10 | Edwin Taylor Chemicals Ltd | Improvements in or relating to the cutting of magnesium and its alloys |
| NL75847C (enFirst) * | 1949-07-19 | |||
| US4605509A (en) * | 1973-05-11 | 1986-08-12 | The Procter & Gamble Company | Detergent compositions containing sodium aluminosilicate builders |
| US4083793A (en) * | 1973-05-23 | 1978-04-11 | Henkel Kommanditgesellschaft Auf Aktien | Washing compositions containing aluminosilicates and nonionics and method of washing textiles |
| US4136051A (en) * | 1974-02-25 | 1979-01-23 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Pourable washing compositions containing a luminosilicates and non-ionics and method for their preparation |
| AT335590B (de) * | 1974-08-29 | 1977-03-25 | Henkel & Cie Gmbh | Flussiges bis pastenformiges wasch- und reinigungsmittelkonzentrat und verfahren zur herstellung |
| AT375395B (de) * | 1974-10-04 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| US4148603A (en) * | 1974-10-04 | 1979-04-10 | Henkel Kommanditgesellschaft Auf Aktien | Method of washing textiles and composition containing inorganic silicates and polycarboxylates and/or polyphosphonates |
| AT338948B (de) * | 1974-10-10 | 1977-09-26 | Henkel & Cie Gmbh | Pulverformige wasch- und reinigungsmittel und verfahren zu ihrer herstellung |
| DE2517218B2 (de) * | 1975-04-18 | 1977-05-05 | Henkel & Cie GmbH, 4000 Düsseldorf; Deutsche Gold- und Silber-Scheideanstalt vormals Roessler, 6000 Frankfurt | Kristallines zeolithpulver des typs a |
| ZA767017B (en) * | 1975-12-15 | 1978-06-28 | Colgate Palmolive Co | Method for reconditioning detergent powders |
| BE5T2 (fr) * | 1977-06-21 | 1980-02-08 | Procter & Gamble Europ | Wasmiddelrn |
| DE2729995A1 (de) * | 1977-07-02 | 1979-01-18 | Henkel Kgaa | Verfahren zum maschinellen waschen und reinigen von festen werkstoffen unter verwendung phosphatarmer oder phosphatfreier wasch- und reinigungsmittel |
| US4180485A (en) * | 1977-11-02 | 1979-12-25 | The Procter & Gamble Company | Spray-dried detergent compositions |
| JPS5638399A (en) * | 1979-09-07 | 1981-04-13 | Asahi Denka Kogyo Kk | Powder detergent for garments |
-
1980
- 1980-04-17 US US06/141,222 patent/US4265777A/en not_active Expired - Lifetime
-
1981
- 1981-04-06 AT AT81200388T patent/ATE11564T1/de not_active IP Right Cessation
- 1981-04-06 EP EP81200388A patent/EP0038591B1/en not_active Expired
- 1981-04-06 DE DE8181200388T patent/DE3168577D1/de not_active Expired
- 1981-04-08 GR GR64622A patent/GR74458B/el unknown
- 1981-04-14 PH PH25502A patent/PH15715A/en unknown
- 1981-04-15 CA CA000375554A patent/CA1157339A/en not_active Expired
- 1981-04-16 IE IE866/81A patent/IE51137B1/en not_active IP Right Cessation
- 1981-04-17 JP JP5836681A patent/JPS5736198A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE3168577D1 (en) | 1985-03-14 |
| EP0038591A1 (en) | 1981-10-28 |
| CA1157339A (en) | 1983-11-22 |
| GR74458B (enFirst) | 1984-06-28 |
| US4265777A (en) | 1981-05-05 |
| JPS5736198A (enFirst) | 1982-02-26 |
| PH15715A (en) | 1983-03-14 |
| ATE11564T1 (de) | 1985-02-15 |
| EP0038591B1 (en) | 1985-01-30 |
| IE810866L (en) | 1981-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0038591B1 (en) | Detergent compositions containing an aluminosilicate detergency builder and an unsaturated fatty acid soap | |
| AU662501B2 (en) | Liquid detergent compositions containing a suspended peroxygen bleach | |
| US5597790A (en) | Liquid detergent compositions containing a suspended peroxygen bleach | |
| US4686062A (en) | Detergent composition | |
| EP0165056B1 (en) | Built detergent compositions | |
| EP0293040B2 (en) | Liquid detergent containing solid peroxygen bleach | |
| EP0378262B1 (en) | Liquid detergent composition containing enzyme and enzyme stabilization system | |
| JPH0635596B2 (ja) | 洗剤組成物 | |
| US5250212A (en) | Liquid detergent containing solid peroxygen bleach and solvent system comprising water and lower aliphatic monoalcohol | |
| EP0030089A1 (en) | Detergent composition and method for producing it | |
| CA1316790C (en) | Non-phosphorus detergent bleach compositions | |
| AU650247B2 (en) | Suspending liquid detergent compositions | |
| JPH0662992B2 (ja) | 洗剤組成物 | |
| GB1580456A (en) | Detergent compositions | |
| EP0246896B1 (en) | Detergent compositions | |
| EP0070190B1 (en) | Detergent additives and detergent compositions containing them | |
| EP0361919B1 (en) | A composition for softening fabrics | |
| EP0095904A1 (en) | Detergent liquors and compositions for use therein | |
| NZ201211A (en) | Detergent additives and compositions | |
| JPH05132696A (ja) | 織物付着防止のための組成物及び方法 | |
| GB1453043A (en) | Low phosphate detergent compositions | |
| EP0181180B1 (en) | Detergent compositions | |
| CA1217108A (en) | Detergent liquors and compositions for use therein | |
| JPH10110190A (ja) | イミノビス(2−ヒドロキシメチル酢酸)誘導体を含有する洗浄剤組成物 | |
| EP0319054A2 (en) | Aluminosilicate built detergent bleach compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |